DE2559717C2 - - Google Patents
Info
- Publication number
- DE2559717C2 DE2559717C2 DE2559717A DE2559717A DE2559717C2 DE 2559717 C2 DE2559717 C2 DE 2559717C2 DE 2559717 A DE2559717 A DE 2559717A DE 2559717 A DE2559717 A DE 2559717A DE 2559717 C2 DE2559717 C2 DE 2559717C2
- Authority
- DE
- Germany
- Prior art keywords
- copper
- salts
- collagenate
- collagen
- treatment
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 102000008186 Collagen Human genes 0.000 claims description 5
- 108010035532 Collagen Proteins 0.000 claims description 5
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical class [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 claims description 5
- 229920001436 collagen Polymers 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 5
- 102000011782 Keratins Human genes 0.000 claims description 4
- 108010076876 Keratins Proteins 0.000 claims description 4
- 206010010957 Copper deficiency Diseases 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 208000024891 symptom Diseases 0.000 claims description 3
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 2
- 229930195729 fatty acid Natural products 0.000 claims description 2
- 239000000194 fatty acid Substances 0.000 claims description 2
- 150000004665 fatty acids Chemical class 0.000 claims description 2
- 239000004480 active ingredient Substances 0.000 claims 1
- 229910052802 copper Inorganic materials 0.000 description 7
- 239000010949 copper Substances 0.000 description 7
- 241000196324 Embryophyta Species 0.000 description 4
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 241001079625 Proteides Species 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- JJLJMEJHUUYSSY-UHFFFAOYSA-L copper(II) hydroxide Inorganic materials [OH-].[OH-].[Cu+2] JJLJMEJHUUYSSY-UHFFFAOYSA-L 0.000 description 2
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 125000001312 palmitoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 244000075850 Avena orientalis Species 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 244000141359 Malus pumila Species 0.000 description 1
- 235000011430 Malus pumila Nutrition 0.000 description 1
- 235000015103 Malus silvestris Nutrition 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- -1 copper Chemical class 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- AEJIMXVJZFYIHN-UHFFFAOYSA-N copper;dihydrate Chemical compound O.O.[Cu] AEJIMXVJZFYIHN-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 210000005069 ears Anatomy 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- UXIJQZSBOOKEKZ-UHFFFAOYSA-N oxocopper hydrate Chemical compound O.[Cu]=O UXIJQZSBOOKEKZ-UHFFFAOYSA-N 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/16—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Peptides Or Proteins (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Medicinal Preparation (AREA)
- Cosmetics (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7435929A FR2289179A1 (fr) | 1974-10-28 | 1974-10-28 | Sels metalliques de lipoaminoacides |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2559717A1 DE2559717A1 (de) | 1977-08-11 |
| DE2559717C2 true DE2559717C2 (OSRAM) | 1988-03-03 |
Family
ID=9144464
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2545194A Expired DE2545194C2 (de) | 1974-10-28 | 1975-10-09 | Mittel zur Behandlung von Hyperhidrose zur topischen Anwendung |
| DE19752559717 Granted DE2559717A1 (de) | 1974-10-28 | 1975-10-09 | Metallverbindungen und ihre verwendung zum behandeln von metallmangelerscheinungen |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2545194A Expired DE2545194C2 (de) | 1974-10-28 | 1975-10-09 | Mittel zur Behandlung von Hyperhidrose zur topischen Anwendung |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4089954A (OSRAM) |
| DE (2) | DE2545194C2 (OSRAM) |
| FR (1) | FR2289179A1 (OSRAM) |
| GB (1) | GB1468646A (OSRAM) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2715711A1 (de) * | 1977-04-07 | 1978-10-19 | Robugen Gmbh | Topisch anwendbares arzneimittel zur behandlung von viruserkrankungen der haut und der schleimhaut |
| JPS55118971A (en) * | 1979-03-08 | 1980-09-12 | Nippon Shikizai Kogyo Kenkyusho:Kk | Brightness modifier and modification of brightness |
| FR2462192B1 (fr) * | 1979-08-02 | 1986-08-01 | Oreal | Emulsions du type " eau-dans-l'huile " utilisables comme supports cosmetiques ou excipients pharmaceutiques |
| JPS58140026A (ja) * | 1982-01-14 | 1983-08-19 | Toyo Jozo Co Ltd | 吸収性良好な製剤 |
| FR2503153A1 (fr) * | 1981-04-02 | 1982-10-08 | Morelle Jean | Butyrylaminoacides. mode de preparation. emploi dans les domaines cosmetique, hygienique, therapeutique et agricole |
| JPS5872512A (ja) * | 1981-10-26 | 1983-04-30 | Miyoshi Kasei:Kk | メ−クアツプ化粧料 |
| US4675422A (en) * | 1985-10-23 | 1987-06-23 | Stepan Company | Organometallic compounds |
| FR2636238B1 (fr) * | 1988-09-14 | 1994-01-21 | Morelle Jean | Nouvelles compositions antisudorales |
| DE69013477T2 (de) * | 1989-06-12 | 1995-02-23 | Shiseido Co Ltd | Mittel gegen juckreiz. |
| FR2649697A1 (fr) * | 1989-07-11 | 1991-01-18 | Oreal | Nouveaux derives d'urethanne, leur preparation et leur application notamment comme agents hydratants dans des compositions cosmetiques ou pharmaceutiques destinees au traitement des peaux seches |
| JPH0578243A (ja) * | 1990-12-11 | 1993-03-30 | Shiseido Co Ltd | 鎮痒剤及び鎮痒組成物 |
| US5889050A (en) * | 1991-06-21 | 1999-03-30 | Astra Aktiebolag | 3,3'-dithiobis (propionic acids) and esters thereof |
| FR2698869B1 (fr) * | 1992-12-09 | 1995-02-24 | Morelle Jean | Acylaminoacides obtenus à partir de fibres issues du Bombyx Mori. |
| SE9500897D0 (sv) * | 1995-03-14 | 1995-03-14 | Astra Ab | The pharmacological use of certain cystine derivatives |
| FR2834215B1 (fr) * | 2001-12-27 | 2004-07-16 | Physica | Composes amphiphiles a usage pharmaceutique ou cosmetique |
| DE10257738A1 (de) * | 2002-12-10 | 2004-06-24 | Henkel Kgaa | 5-Lipoxigenase-Inhibitoren in Deodorantien und Antitranspirantien |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2463779A (en) * | 1947-08-26 | 1949-03-08 | Ernest B Kester | N-acylated derivatives of glutamic acid and process for preparing them |
| US2909535A (en) * | 1955-03-15 | 1959-10-20 | Colgate Palmolive Co | Novel higher aliphatic acid derivatives and compositions containing the same |
| US2842479A (en) * | 1955-05-24 | 1958-07-08 | Colgate Palmolive Co | Nu-higher aliphatic acyl alpha-amino aryl acetic acids and compositions therewith |
| NL123441C (OSRAM) * | 1964-01-17 | |||
| NL132126C (OSRAM) * | 1966-10-13 | |||
| GB1168302A (en) * | 1967-05-12 | 1969-10-22 | Roland-Yves Mauvernay | Aluminium N-Acetylglycinate and Pharmaceutical Compositions containing the same |
| US3836551A (en) * | 1970-01-30 | 1974-09-17 | Roehm Gmbh | Method for making salts of n-acylamino carboxylic acids |
| DE2111361B2 (de) * | 1971-03-10 | 1973-02-15 | Verwendung von n-acylaminosaeuren, deren salzen und/oder estern als emulgatoren | |
| FR2147822B1 (OSRAM) * | 1971-07-30 | 1974-10-18 | Centre Etd Ind Pharma | |
| GB1356370A (en) * | 1972-03-06 | 1974-06-12 | Howard A N | Methods and formulations for the treatment of obesity |
| GB1433314A (en) | 1973-08-09 | 1976-04-28 | Rhone Poulenc Sa | Aluminium and/or magnesium salts |
-
1974
- 1974-10-28 FR FR7435929A patent/FR2289179A1/fr active Granted
-
1975
- 1975-10-09 DE DE2545194A patent/DE2545194C2/de not_active Expired
- 1975-10-09 DE DE19752559717 patent/DE2559717A1/de active Granted
- 1975-10-14 US US05/621,954 patent/US4089954A/en not_active Expired - Lifetime
- 1975-10-27 GB GB4403775A patent/GB1468646A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2545194C2 (de) | 1985-06-20 |
| US4089954A (en) | 1978-05-16 |
| DE2559717A1 (de) | 1977-08-11 |
| GB1468646A (en) | 1977-03-30 |
| DE2545194A1 (de) | 1976-04-29 |
| FR2289179B1 (OSRAM) | 1978-07-21 |
| FR2289179A1 (fr) | 1976-05-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2559717C2 (OSRAM) | ||
| DE3930638A1 (de) | Verbindungen gegen uebermaessiges schwitzen | |
| DE3438455A1 (de) | L-lysin- und l-histidinpyruvat | |
| DE2436946A1 (de) | Zink/methionin-komplex-salze, verfahren zu ihrer herstellung und ihre verwendung in nahrungsmitteln | |
| DE2240782A1 (de) | Verfahren zur herstellung eines eisensaccharid-komplexes | |
| EP0734247B1 (de) | Kosmetische und/oder pharmazeutische zubereitungen | |
| DE69205154T2 (de) | Verwendung von mindestens einem gereinigten peptid, welches durch kaseinhydrolyse hergestellt werden kann und opiataktivität hat, als aktiven bestandteil in der herstellung einer kosmetischen zusammensetzung. | |
| DE3230292C2 (de) | Teilchenförmiges Futterzusatzmittel für Wiederkäuer und Verfahren zu seiner Herstellung | |
| DE3129826C2 (OSRAM) | ||
| DE69003960T2 (de) | Die Verwendung von deacetyliertem Chitin zur Herstellung eines Medikamentes für die Behandlung von entzündliche Krankheiten. | |
| DE3428399A1 (de) | Zinksalz des 3-(carboxymethyl)thioalanins (zinkcarbocystein), verfahren zu seiner herstellung und seine verwendung als arzneimittel | |
| DE2515594B2 (de) | Verfahren zur Herstellung eines stabilen, topisch aktiven Geles | |
| DE1168441B (de) | Verfahren zur Herstellung einer Polyaminopolyessigsaeure und ihrer komplexen Metallverbindungen | |
| DE3533494A1 (de) | Aerosol-anwendung von pentamidin (p,p'-(pentamethylen-dioxy)-dibenzamidin-bis(ss-hydroxyethansulfonat) zur behandlung der durch pneumocystis carinii bedingten lungenentzuendung | |
| DE2036679C3 (de) | Kosmetisches Mittel gegen Seborrhoea | |
| DE1967088C3 (de) | N3-Disubstituierte Cysteine | |
| DE1493618A1 (de) | Cumarinderivate und ein Verfahren zu ihrer Herstellung | |
| DE2814298A1 (de) | Bis-(carboxyalkoxy)-butandisaeureverbindungen in oralen zubereitungen zur zahnsteinhemmung | |
| DE1907149A1 (de) | Biocide Aminosaeurederivate | |
| RU96123487A (ru) | Способ получения золевых кремнийоксидных модификаций, легированных элементами iii группы | |
| DE2338350A1 (de) | Beta-(3,4-dialkanoyloxyphenyl)-lalanin-ester | |
| DE1795508C (de) | 6-(alpha- Aminoacylamino)-penicillansäurederivate. Ausscheidung aus: 144 5419 | |
| DE1695728A1 (de) | Verfahren zur Herstellung von Pyrazinderivaten | |
| EP0137499A3 (de) | Verfahren zur Gewinnung von beta-Elemonsäure und diese enthaltende pharmazeutische Zubereitungen | |
| DE1492057C (de) | Mittel zur Pflege von Haut und Haaren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OB | Request for examination as to novelty | ||
| 8110 | Request for examination paragraph 44 | ||
| AC | Divided out of |
Ref country code: DE Ref document number: 2545194 Format of ref document f/p: P |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |