DE2538620A1 - Verfahren zur herstellung von chinoxalin- und chinazolinderivaten - Google Patents
Verfahren zur herstellung von chinoxalin- und chinazolinderivatenInfo
- Publication number
- DE2538620A1 DE2538620A1 DE19752538620 DE2538620A DE2538620A1 DE 2538620 A1 DE2538620 A1 DE 2538620A1 DE 19752538620 DE19752538620 DE 19752538620 DE 2538620 A DE2538620 A DE 2538620A DE 2538620 A1 DE2538620 A1 DE 2538620A1
- Authority
- DE
- Germany
- Prior art keywords
- compound
- formula
- isothiocyanate
- quinoxaline
- halogen atom
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 16
- XSCHRSMBECNVNS-UHFFFAOYSA-N quinoxaline Chemical compound N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 title claims description 16
- 238000004519 manufacturing process Methods 0.000 title description 5
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical class N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 22
- 150000002540 isothiocyanates Chemical class 0.000 claims description 14
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 13
- -1 alkoxy radical Chemical class 0.000 claims description 10
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 claims description 10
- 125000005843 halogen group Chemical group 0.000 claims description 9
- 239000000047 product Substances 0.000 claims description 9
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 claims description 8
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 claims description 8
- 238000010992 reflux Methods 0.000 claims description 8
- 239000002904 solvent Substances 0.000 claims description 8
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 claims description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 238000010438 heat treatment Methods 0.000 claims description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 238000007363 ring formation reaction Methods 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 3
- BQPIGGFYSBELGY-UHFFFAOYSA-N mercury(2+) Chemical compound [Hg+2] BQPIGGFYSBELGY-UHFFFAOYSA-N 0.000 claims description 3
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(ii) oxide Chemical compound [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical class [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 claims description 2
- WZKSXHQDXQKIQJ-UHFFFAOYSA-N F[C](F)F Chemical compound F[C](F)F WZKSXHQDXQKIQJ-UHFFFAOYSA-N 0.000 claims description 2
- 238000009835 boiling Methods 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 claims description 2
- 150000003254 radicals Chemical class 0.000 claims description 2
- 230000015572 biosynthetic process Effects 0.000 claims 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- XYLJNLCSTIOKRM-UHFFFAOYSA-N Alphagan Chemical compound C1=CC2=NC=CN=C2C(Br)=C1NC1=NCCN1 XYLJNLCSTIOKRM-UHFFFAOYSA-N 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- HURGDIYVXQDVMD-UHFFFAOYSA-N (5-bromoquinoxalin-6-yl)thiourea Chemical compound N1=CC=NC2=C(Br)C(NC(=S)N)=CC=C21 HURGDIYVXQDVMD-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 239000008367 deionised water Substances 0.000 description 3
- 229910021641 deionized water Inorganic materials 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- QZHBYNSSDLTCRG-UHFFFAOYSA-N 5-bromo-n-(4,5-dihydro-1h-imidazol-2-yl)quinoxalin-6-amine;2,3-dihydroxybutanedioate;hydron Chemical compound OC(=O)C(O)C(O)C(O)=O.C1=CC2=NC=CN=C2C(Br)=C1NC1=NCCN1 QZHBYNSSDLTCRG-UHFFFAOYSA-N 0.000 description 2
- IRAOSCSPAYZRJE-UHFFFAOYSA-N 5-bromoquinoxalin-6-amine Chemical compound N1=CC=NC2=C(Br)C(N)=CC=C21 IRAOSCSPAYZRJE-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- SOIFLUNRINLCBN-UHFFFAOYSA-N ammonium thiocyanate Chemical compound [NH4+].[S-]C#N SOIFLUNRINLCBN-UHFFFAOYSA-N 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- CPEKAXYCDKETEN-UHFFFAOYSA-N benzoyl isothiocyanate Chemical compound S=C=NC(=O)C1=CC=CC=C1 CPEKAXYCDKETEN-UHFFFAOYSA-N 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- OZOLRGZAVBQRBG-UHFFFAOYSA-N (2-methyl-3-nitrophenyl)boronic acid Chemical compound CC1=C(B(O)O)C=CC=C1[N+]([O-])=O OZOLRGZAVBQRBG-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 241000845082 Panama Species 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 230000003276 anti-hypertensive effect Effects 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 210000001072 colon Anatomy 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- BWFPGXWASODCHM-UHFFFAOYSA-N copper monosulfide Chemical compound [Cu]=S BWFPGXWASODCHM-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3914374A GB1463520A (en) | 1974-09-06 | 1974-09-06 | Process for the production of imidazolines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2538620A1 true DE2538620A1 (de) | 1976-03-18 |
Family
ID=10407882
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752538620 Pending DE2538620A1 (de) | 1974-09-06 | 1975-08-29 | Verfahren zur herstellung von chinoxalin- und chinazolinderivaten |
Country Status (12)
| Country | Link |
|---|---|
| JP (1) | JPS51149291A (enExample) |
| BE (1) | BE833135A (enExample) |
| CA (1) | CA1043791A (enExample) |
| DE (1) | DE2538620A1 (enExample) |
| DK (1) | DK398775A (enExample) |
| ES (1) | ES440760A1 (enExample) |
| FI (1) | FI752487A7 (enExample) |
| FR (1) | FR2283899A1 (enExample) |
| GB (1) | GB1463520A (enExample) |
| LU (1) | LU73327A1 (enExample) |
| NL (1) | NL7510473A (enExample) |
| SE (1) | SE7509271L (enExample) |
Cited By (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5021416A (en) * | 1989-10-31 | 1991-06-04 | Allergan, Inc. | Method for using (2-imidazolin-2-ylamino) quinoxalines to reduce or maintain intraocular pressure |
| US5077292A (en) * | 1989-10-12 | 1991-12-31 | Allergan, Inc. | (2-imidazolin-2-ylamino) tetrahydroquinoxalines and methods for using same |
| US5112822A (en) * | 1989-10-12 | 1992-05-12 | Allergan, Inc. | (2-imidazolin-2-ylamino) quinoxaline derivatives and methods for using same |
| US5130441A (en) * | 1990-02-06 | 1992-07-14 | Allergan, Inc. | Method for producing amino-2-imidazoline derivatives |
| US5198442A (en) * | 1989-10-12 | 1993-03-30 | Allergan, Inc. | (2-imidazolin-2-ylamino) quinoxaline derivatives and methods for using same |
| US5204347A (en) * | 1989-10-12 | 1993-04-20 | Allergan, Inc. | Methods for using (2-imidazolin-2-ylamino) tetrahydroquinoxalines |
| US5237072A (en) * | 1990-02-06 | 1993-08-17 | Allergan, Inc. | Method for producing amino-2-imidazoline derivatives |
| US5326763A (en) * | 1989-10-12 | 1994-07-05 | Allergan, Inc. | Methods for using (2-imidazolin-2-ylamino) quinoxaline derivatives |
| US5552403A (en) * | 1993-10-13 | 1996-09-03 | Allergan | Methods for using (2-imidazolin-2-ylamino) quinoxaline derivatives |
| US6323204B1 (en) | 1993-10-13 | 2001-11-27 | Allergan | Methods for using (2-imidazolin-2-ylamino) quinoxaline derivatives |
| RU2285003C1 (ru) * | 2005-04-29 | 2006-10-10 | Федеральное государственное унитарное предприятие "Центр по химии лекарственных средств" (ФГУП ЦХЛС-ВНИХФИ) | Способ получения 5-бром-6-[(2-имидазолин-2-ил)амино]хиноксалина l-тартрата |
| WO2015097600A2 (en) | 2013-12-24 | 2015-07-02 | Sentiss Pharma Private Limited | Topical brimonidine tartrate ophthalmic solution |
| WO2021220194A1 (en) | 2020-04-29 | 2021-11-04 | Sentiss Pharma Private Limited | Ophthalmic compositions comprising a combination of brinzolamide and brimonidine |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA2505836C (en) | 2004-05-06 | 2013-08-27 | Alcon Inc. | Topical brimonidine tartrate formulations that lack chlorine dioxide |
| JP6339364B2 (ja) * | 2013-12-27 | 2018-06-06 | カズマパートナーズ株式会社 | 無定形ブリモニジン酒石酸塩及びその製造方法 |
| JP6270603B2 (ja) * | 2014-04-14 | 2018-01-31 | カズマパートナーズ株式会社 | ブリモニジン酒石酸塩の新規多形及びその製造方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE795970A (fr) * | 1972-02-29 | 1973-08-27 | Pfizer | Nouveaux derives de quinoleine, quinoxaline et quinazoline er composition pharmaceutiques les contenant |
-
1974
- 1974-09-06 GB GB3914374A patent/GB1463520A/en not_active Expired
-
1975
- 1975-08-25 SE SE7509271A patent/SE7509271L/xx unknown
- 1975-08-27 CA CA234,270A patent/CA1043791A/en not_active Expired
- 1975-08-29 DE DE19752538620 patent/DE2538620A1/de active Pending
- 1975-09-01 JP JP50105862A patent/JPS51149291A/ja active Pending
- 1975-09-04 LU LU73327A patent/LU73327A1/xx unknown
- 1975-09-04 FI FI752487A patent/FI752487A7/fi not_active Application Discontinuation
- 1975-09-05 NL NL7510473A patent/NL7510473A/xx unknown
- 1975-09-05 FR FR7527324A patent/FR2283899A1/fr not_active Withdrawn
- 1975-09-05 ES ES440760A patent/ES440760A1/es not_active Expired
- 1975-09-05 DK DK398775A patent/DK398775A/da unknown
- 1975-09-05 BE BE159796A patent/BE833135A/xx unknown
Cited By (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5418234A (en) * | 1989-10-12 | 1995-05-23 | Allergan, Inc. | Methods for using (2-imidazolin-2-ylamino) quinoxaline derivatives |
| US5112822A (en) * | 1989-10-12 | 1992-05-12 | Allergan, Inc. | (2-imidazolin-2-ylamino) quinoxaline derivatives and methods for using same |
| US5198442A (en) * | 1989-10-12 | 1993-03-30 | Allergan, Inc. | (2-imidazolin-2-ylamino) quinoxaline derivatives and methods for using same |
| US5204347A (en) * | 1989-10-12 | 1993-04-20 | Allergan, Inc. | Methods for using (2-imidazolin-2-ylamino) tetrahydroquinoxalines |
| US5300504A (en) * | 1989-10-12 | 1994-04-05 | Allergan, Inc. | (2-imidazolin-2-ylamino) tetrahydroquinoxalines and methods for using same |
| US5326763A (en) * | 1989-10-12 | 1994-07-05 | Allergan, Inc. | Methods for using (2-imidazolin-2-ylamino) quinoxaline derivatives |
| US5373010A (en) * | 1989-10-12 | 1994-12-13 | Allergan, Inc. | Methods for using (2-imidazolin-2-ylamino) quinoxaline derivatives |
| US5077292A (en) * | 1989-10-12 | 1991-12-31 | Allergan, Inc. | (2-imidazolin-2-ylamino) tetrahydroquinoxalines and methods for using same |
| US5021416A (en) * | 1989-10-31 | 1991-06-04 | Allergan, Inc. | Method for using (2-imidazolin-2-ylamino) quinoxalines to reduce or maintain intraocular pressure |
| US5130441A (en) * | 1990-02-06 | 1992-07-14 | Allergan, Inc. | Method for producing amino-2-imidazoline derivatives |
| US5237072A (en) * | 1990-02-06 | 1993-08-17 | Allergan, Inc. | Method for producing amino-2-imidazoline derivatives |
| US5552403A (en) * | 1993-10-13 | 1996-09-03 | Allergan | Methods for using (2-imidazolin-2-ylamino) quinoxaline derivatives |
| US5561132A (en) * | 1993-10-13 | 1996-10-01 | Allergan | Methods for using (2-imidazolin-2-ylamino) quinoxaline derivatives |
| US5587376A (en) * | 1993-10-13 | 1996-12-24 | Allergan | Methods for using (2-imidazolin-2-ylamino) quinoxaline derivatives |
| US5703077A (en) * | 1993-10-13 | 1997-12-30 | Allergan | Methods for using (2-imidazolin-2-ylamino) quinoxaline derivatives |
| US5714486A (en) * | 1993-10-13 | 1998-02-03 | Allergan | Methods for using (2-imidazolin-2-ylamino) quinoxaline derivatives |
| US5756503A (en) * | 1993-10-13 | 1998-05-26 | Allergan | Methods for using (2-imidazolin-2-ylamino) Quinoxaline derivatives |
| US5773440A (en) * | 1993-10-13 | 1998-06-30 | Allergan | Methods for using (2-imidazolin-2-ylamino) quinoxaline derivatives |
| US6323204B1 (en) | 1993-10-13 | 2001-11-27 | Allergan | Methods for using (2-imidazolin-2-ylamino) quinoxaline derivatives |
| RU2285003C1 (ru) * | 2005-04-29 | 2006-10-10 | Федеральное государственное унитарное предприятие "Центр по химии лекарственных средств" (ФГУП ЦХЛС-ВНИХФИ) | Способ получения 5-бром-6-[(2-имидазолин-2-ил)амино]хиноксалина l-тартрата |
| WO2015097600A2 (en) | 2013-12-24 | 2015-07-02 | Sentiss Pharma Private Limited | Topical brimonidine tartrate ophthalmic solution |
| WO2021220194A1 (en) | 2020-04-29 | 2021-11-04 | Sentiss Pharma Private Limited | Ophthalmic compositions comprising a combination of brinzolamide and brimonidine |
Also Published As
| Publication number | Publication date |
|---|---|
| SE7509271L (sv) | 1975-12-29 |
| DK398775A (da) | 1976-03-07 |
| FI752487A7 (enExample) | 1976-03-07 |
| ES440760A1 (es) | 1977-04-01 |
| BE833135A (fr) | 1976-03-05 |
| CA1043791A (en) | 1978-12-05 |
| NL7510473A (nl) | 1976-03-09 |
| JPS51149291A (en) | 1976-12-22 |
| AU8430575A (en) | 1977-03-03 |
| GB1463520A (en) | 1977-02-02 |
| LU73327A1 (enExample) | 1977-05-11 |
| FR2283899A1 (fr) | 1976-04-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2538620A1 (de) | Verfahren zur herstellung von chinoxalin- und chinazolinderivaten | |
| DE3049963C2 (de) | 3-ß-Amino-nortropan-Derivate und Verfahren zu ihrer Herstellung | |
| DE3036390A1 (de) | Neue pyrrolo-pyrimidine, verfahren zu ihrer herstellung und ihre verwendung bei der herstellung von biologischen wirkstoffen | |
| DE1620694C3 (de) | Verfahren zur Herstellung von 5-Methyl-7-diäthylamino-s-triazolo [1,5-a] pyrimidin und seinen Salzen mit Säuren | |
| DE1795808B1 (de) | Verfahren zur Herstellung von 2,2,6,6-Tetramethyl-4-oxopiperidin | |
| DE2147023A1 (de) | Verfahren zur herstellung von 1htetrazol-verbindungen | |
| DE1795344B2 (de) | Verfahren zur herstellung von 3-aminoisothiazolen | |
| DE1695193A1 (de) | Verfahren zur Herstellung von Chinazolin-Derivaten | |
| DE2814330A1 (de) | Verfahren zur herstellung eines 2,6-dichlorpyridin-derivats | |
| DE1266425C2 (de) | Verfahren zur herstellung von anthrachinon-dispersionsfarbstoffen und deren verwendung | |
| DE2438077A1 (de) | Verfahren zur herstellung von propanolaminderivaten und nach dem verfahren hergestellte propanolaminderivate | |
| DE2433176C3 (de) | N-Cyano-cyano-acetimidate und Verfahren zur Herstellung von 2-Halopyrinüdinderivaten | |
| DE2653834C2 (de) | Verfahren zur Herstellung von 2-Cyanamino-4,6 bis (alkyl-bzw dialkyl-) amino-sym.-triazinen | |
| DE1962261C3 (de) | Verfahren zur Herstellung von 2,6- Bis-(diäthanolamino)-4,8-dipiperidinopyrimido[5,4-d]pyrimidin | |
| EP0261075B1 (de) | Verfahren zur Herstellung von Dispersionsfarbstoffen | |
| DE2119724B2 (de) | Verfahren zur herstellung einer halogensubstituierten benzoesaeure | |
| AT264531B (de) | Verfahren zur Herstellung von 1,10-Phenanthrolinen | |
| DE1770848A1 (de) | Verfahren zur Herstellung von 3-Methansulfonylphenthiazinen | |
| DE947165C (de) | Verfahren zur Herstellung von in 3-Stellung substituierten 4-Oxycumarinen | |
| EP0198795A2 (de) | Verfahren zur Herstellung von 1,4-Diaminoanthrachinonen | |
| DE2203461C3 (de) | Verfahren zur Herstellung von halogensubstituierten 3-Hydroxybenzo [c] -cinnolin-Derivaten | |
| DE1211626B (de) | Verfahren zur Herstellung von schwefelhaltigen Metallkomplexen | |
| DE1695893B1 (de) | Verfahren zur Herstellung von 4-Amino-5-acylamidomethylpyrimidinen | |
| DE2449523C3 (de) | Verfahren zur Herstellung von PhthaUmido- oder Cyclohexen-1,2-dicarboximido-Thionophosphaten | |
| DE2801353A1 (de) | Thiocarbamoyl-chromen-derivate und verfahren zu deren herstellung |