DE2502904A1 - Fluessigkristall-zusammensetzung - Google Patents
Fluessigkristall-zusammensetzungInfo
- Publication number
- DE2502904A1 DE2502904A1 DE19752502904 DE2502904A DE2502904A1 DE 2502904 A1 DE2502904 A1 DE 2502904A1 DE 19752502904 DE19752502904 DE 19752502904 DE 2502904 A DE2502904 A DE 2502904A DE 2502904 A1 DE2502904 A1 DE 2502904A1
- Authority
- DE
- Germany
- Prior art keywords
- liquid crystal
- carbon atoms
- crystal composition
- group
- composition according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000004973 liquid crystal related substance Substances 0.000 title claims description 309
- 239000000203 mixture Substances 0.000 title claims description 142
- 239000000463 material Substances 0.000 claims description 178
- 125000004432 carbon atom Chemical group C* 0.000 claims description 91
- 125000000217 alkyl group Chemical group 0.000 claims description 67
- 125000003545 alkoxy group Chemical group 0.000 claims description 64
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 45
- 125000004423 acyloxy group Chemical group 0.000 claims description 42
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 claims description 24
- 235000010290 biphenyl Nutrition 0.000 claims description 22
- 239000004305 biphenyl Substances 0.000 claims description 22
- 239000004988 Nematic liquid crystal Substances 0.000 claims description 19
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 7
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims 1
- 239000013078 crystal Substances 0.000 description 68
- 239000007788 liquid Substances 0.000 description 63
- 210000004027 cell Anatomy 0.000 description 33
- 210000002858 crystal cell Anatomy 0.000 description 18
- 230000004044 response Effects 0.000 description 15
- 238000005259 measurement Methods 0.000 description 10
- 238000002834 transmittance Methods 0.000 description 8
- 150000001733 carboxylic acid esters Chemical class 0.000 description 7
- 239000011521 glass Substances 0.000 description 7
- 125000000649 benzylidene group Chemical group [H]C(=[*])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 6
- 230000008859 change Effects 0.000 description 6
- 239000000047 product Substances 0.000 description 5
- 230000035945 sensitivity Effects 0.000 description 5
- 125000005337 azoxy group Chemical group [N+]([O-])(=N*)* 0.000 description 4
- 230000008901 benefit Effects 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- -1 cyano- Chemical class 0.000 description 4
- 230000007704 transition Effects 0.000 description 4
- 239000002075 main ingredient Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000011159 matrix material Substances 0.000 description 3
- 230000035699 permeability Effects 0.000 description 3
- 230000004043 responsiveness Effects 0.000 description 3
- 238000004781 supercooling Methods 0.000 description 3
- 239000004990 Smectic liquid crystal Substances 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000005540 biological transmission Effects 0.000 description 2
- 239000013065 commercial product Substances 0.000 description 2
- 230000006866 deterioration Effects 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000003487 electrochemical reaction Methods 0.000 description 2
- 239000003822 epoxy resin Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 229920000647 polyepoxide Polymers 0.000 description 2
- 238000009877 rendering Methods 0.000 description 2
- 230000003068 static effect Effects 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- VIFHWOQSMVTUCS-UHFFFAOYSA-N (2-butylphenyl) benzoate Chemical compound CCCCC1=CC=CC=C1OC(=O)C1=CC=CC=C1 VIFHWOQSMVTUCS-UHFFFAOYSA-N 0.000 description 1
- VSCVAEWUQRGESQ-UHFFFAOYSA-N (2-cyanophenyl) 4-butylbenzoate Chemical compound C1=CC(CCCC)=CC=C1C(=O)OC1=CC=CC=C1C#N VSCVAEWUQRGESQ-UHFFFAOYSA-N 0.000 description 1
- YMMUAOVFQVSPFX-UHFFFAOYSA-N (2-cyanophenyl) 4-methoxybenzoate Chemical compound C1=CC(OC)=CC=C1C(=O)OC1=CC=CC=C1C#N YMMUAOVFQVSPFX-UHFFFAOYSA-N 0.000 description 1
- FHOJMZHKTGMQBU-UHFFFAOYSA-N (4-cyanophenyl)imino-(4-hexylphenyl)-oxidoazanium Chemical compound C1=CC(CCCCCC)=CC=C1[N+]([O-])=NC1=CC=C(C#N)C=C1 FHOJMZHKTGMQBU-UHFFFAOYSA-N 0.000 description 1
- XQPASKYMKUXSJT-UHFFFAOYSA-N (6-benzylidenecyclohexa-2,4-dien-1-yl)-hexoxycyanamide Chemical compound C(CCCCC)ON(C1C(C=CC=C1)=CC1=CC=CC=C1)C#N XQPASKYMKUXSJT-UHFFFAOYSA-N 0.000 description 1
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 1
- OZUCXGWYZVDFOU-UHFFFAOYSA-N 2-(diethylamino)ethyl 6-hydroxy-4,7-dimethoxy-1-benzofuran-5-carboxylate;hydrochloride Chemical compound [Cl-].CC[NH+](CC)CCOC(=O)C1=C(O)C(OC)=C2OC=CC2=C1OC OZUCXGWYZVDFOU-UHFFFAOYSA-N 0.000 description 1
- WZFUQSJFWNHZHM-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC(=O)N1CC2=C(CC1)NN=N2 WZFUQSJFWNHZHM-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 241000186781 Listeria Species 0.000 description 1
- 101100400378 Mus musculus Marveld2 gene Proteins 0.000 description 1
- 206010035148 Plague Diseases 0.000 description 1
- 241001630870 Squalius cii Species 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- KTQHJEFEXYWZNV-UHFFFAOYSA-N [4-(2-butylphenoxy)carbonylphenyl] 4-butylbenzoate Chemical compound C1=CC(CCCC)=CC=C1C(=O)OC1=CC=C(C(=O)OC=2C(=CC=CC=2)CCCC)C=C1 KTQHJEFEXYWZNV-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- DXKMHDQQRQRYCI-UHFFFAOYSA-N butyl 4-methoxybenzoate Chemical compound CCCCOC(=O)C1=CC=C(OC)C=C1 DXKMHDQQRQRYCI-UHFFFAOYSA-N 0.000 description 1
- 230000003098 cholesteric effect Effects 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 230000005684 electric field Effects 0.000 description 1
- 238000005265 energy consumption Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 230000005669 field effect Effects 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000005032 impulse control Effects 0.000 description 1
- 239000003550 marker Substances 0.000 description 1
- KMVXENDYYJFUGZ-UHFFFAOYSA-N n-methoxy-n-(5-phenylpent-4-enyl)aniline Chemical compound C=1C=CC=CC=1N(OC)CCCC=CC1=CC=CC=C1 KMVXENDYYJFUGZ-UHFFFAOYSA-N 0.000 description 1
- 230000005693 optoelectronics Effects 0.000 description 1
- 238000010587 phase diagram Methods 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 230000010287 polarization Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000012827 research and development Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000006104 solid solution Substances 0.000 description 1
- 125000006850 spacer group Chemical group 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 238000001771 vacuum deposition Methods 0.000 description 1
- 238000007738 vacuum evaporation Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K19/00—Liquid crystal materials
- C09K19/04—Liquid crystal materials characterised by the chemical structure of the liquid crystal components, e.g. by a specific unit
- C09K19/42—Mixtures of liquid crystal compounds covered by two or more of the preceding groups C09K19/06 - C09K19/40
- C09K19/44—Mixtures of liquid crystal compounds covered by two or more of the preceding groups C09K19/06 - C09K19/40 containing compounds with benzene rings directly linked
Landscapes
- Chemical & Material Sciences (AREA)
- Crystallography & Structural Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Liquid Crystal Substances (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP49010732A JPS5950714B2 (ja) | 1974-01-25 | 1974-01-25 | 液晶組成物 |
| JP1302074A JPS50106886A (enExample) | 1974-01-31 | 1974-01-31 | |
| JP49013021A JPS6041107B2 (ja) | 1974-01-31 | 1974-01-31 | 液晶組成物 |
| JP49061346A JPS5950713B2 (ja) | 1974-05-30 | 1974-05-30 | 液晶組成物 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2502904A1 true DE2502904A1 (de) | 1975-07-31 |
| DE2502904C2 DE2502904C2 (enExample) | 1990-06-28 |
Family
ID=27455451
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752502904 Granted DE2502904A1 (de) | 1974-01-25 | 1975-01-24 | Fluessigkristall-zusammensetzung |
Country Status (2)
| Country | Link |
|---|---|
| US (1) | US4137192A (enExample) |
| DE (1) | DE2502904A1 (enExample) |
Cited By (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4011173A (en) * | 1972-08-03 | 1977-03-08 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Modified nematic mixtures with positive dielectric anisotropy |
| US4013582A (en) * | 1976-06-17 | 1977-03-22 | Rca Corporation | Liquid crystal compounds and electro-optic devices incorporating them |
| US4017416A (en) * | 1974-10-11 | 1977-04-12 | Chisso Corporation | P-cyanophenyl 4-alkyl-4'-biphenylcarboxylate, method for preparing same and liquid crystal compositions using same |
| US4020002A (en) * | 1974-02-28 | 1977-04-26 | Beckman Instruments, Inc. | Non-schiff base field effect liquid crystal composition |
| US4027950A (en) * | 1973-08-20 | 1977-06-07 | Matsushita Electric Industrial Co., Ltd. | Electro-optical display device |
| US4029594A (en) * | 1976-06-17 | 1977-06-14 | Rca Corporation | Novel liquid crystal compounds and electro-optic devices incorporating them |
| US4043935A (en) * | 1973-07-06 | 1977-08-23 | Kabushiki Kaisha Suwa Seikosha | Liquid crystal composition having high dielectric anisotropy and display device incorporating same |
| US4046708A (en) * | 1973-11-28 | 1977-09-06 | Thomson-Csf | Mixture of nematic liquid crystals exhibiting a positive dielectric anisotropy and a wide temperature range |
| US4048089A (en) * | 1975-07-31 | 1977-09-13 | Dainippon Ink & Chemicals, Inc. | Nematic liquid crystal composition |
| US4066570A (en) * | 1974-10-25 | 1978-01-03 | Hoffman-La Roche Inc. | Phenyl-pyrimidines |
| US4069167A (en) * | 1974-09-25 | 1978-01-17 | Chisso Corporation | Liquid crystal composition |
| US4076646A (en) * | 1975-09-12 | 1978-02-28 | Hitachi, Ltd. | Liquid crystal composition for field effect display devices |
| US4083797A (en) * | 1974-09-03 | 1978-04-11 | Beckman Instruments, Inc. | Nematic liquid crystal compositions |
| DE2745050A1 (de) * | 1976-10-06 | 1978-04-13 | Sharp Kk | Material aus fluessigen kristallen |
| US4090975A (en) * | 1974-11-01 | 1978-05-23 | Itek Corporation | Mixtures of nematic liquid crystal materials |
| US4096086A (en) * | 1974-12-23 | 1978-06-20 | Kabushiki Kaisha Suwa Seikosha | Nematic liquid crystal composition |
| US4118335A (en) * | 1975-10-29 | 1978-10-03 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Liquid crystalline materials of reduced viscosity |
| US4120567A (en) * | 1977-02-11 | 1978-10-17 | Rca Corporation | Electro-optic device |
| US4138358A (en) * | 1976-02-09 | 1979-02-06 | Temple University | Liquid crystal compositions |
| DE2842320A1 (de) * | 1977-09-29 | 1979-04-12 | Sharp Kk | Fluessigkristall-zusammensetzung |
| US4149413A (en) * | 1976-08-16 | 1979-04-17 | The Secretary Of State For Defence In Her Britannic Majesty's Government Of The United Kingdom Of Great Britain And Norther Ireland | Optically active liquid crystal mixtures and liquid crystal devices containing them |
| DE2847601A1 (de) * | 1977-11-02 | 1979-05-03 | Secr Defence Brit | Fluessigkristallgemische und ihre verwendung in anzeigevorrichtungen |
| US4206071A (en) * | 1974-05-25 | 1980-06-03 | Chisso Corporation | Liquid crystal composition |
| US4222887A (en) * | 1977-07-19 | 1980-09-16 | Canon Kabushiki Kaisha | Liquid crystal composition |
| US4293434A (en) * | 1978-08-08 | 1981-10-06 | VEB Werk fur Fernsehelektronik Berlin im VEB Kombinat Mikroelektronik | Liquid crystal compounds |
| WO1987004158A2 (fr) | 1986-01-03 | 1987-07-16 | MERCK Patent Gesellschaft mit beschränkter Haftung | Composes heterocycliques utilises comme composants de phases de cristaux liquides |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1592161A (en) * | 1976-08-13 | 1981-07-01 | Secr Defence | Biphenyl carboxylic esters and their use as liquid crystal materials |
| US4208106A (en) * | 1976-09-27 | 1980-06-17 | Beckman Instruments, Inc. | Fluorescent displays |
| US4253740A (en) * | 1977-09-12 | 1981-03-03 | The Secretary Of State For Defence In Her Britannic Majesty's Government Of The United Kingdom Of Great Britain And Northern Ireland | Liquid crystal materials and devices containing them |
| JPS5483694A (en) * | 1977-12-16 | 1979-07-03 | Hitachi Ltd | Nematic liquid crystal body for display device |
| JPS5941983B2 (ja) * | 1978-02-17 | 1984-10-11 | 大日本インキ化学工業株式会社 | トランス(エカトリアル↓−エカトリアル)1,4↓−ジ置換シクロヘキサン誘導体 |
| JPS5534206A (en) * | 1978-08-30 | 1980-03-10 | Hitachi Ltd | Nematic liquid crystal for display unit |
| DE2966302D1 (en) * | 1978-09-13 | 1983-11-17 | Secr Defence Brit | Improvements in or relating to liquid crystal materials and devices |
| US4203862A (en) * | 1978-12-22 | 1980-05-20 | Timex Corporation | Liquid crystal composition |
| US4228030A (en) * | 1979-02-28 | 1980-10-14 | General Electric Company | Liquid crystal compositions |
| US4309304A (en) * | 1979-11-01 | 1982-01-05 | Exxon Research & Engineering Co. | Liquid crystal compositions for multiplexed displays |
| US4328116A (en) * | 1979-11-01 | 1982-05-04 | Minnesota Mining And Manufacturing Company | Liquid crystal compositions for multiplexed displays |
| DE3006666A1 (de) * | 1980-02-22 | 1981-09-17 | Merck Patent Gmbh, 6100 Darmstadt | Phenylcyclohexenderivate, verfahren zu ihrer herstellung, diese enthaltende fluessigkristalline dielektrika und elektrooptisches anzeieelement |
| DE3023989A1 (de) * | 1980-06-26 | 1982-01-21 | Merck Patent Gmbh, 6100 Darmstadt | Fluessigkristallines dielektrikum |
| FR2490666A1 (fr) * | 1980-08-29 | 1982-03-26 | Thomson Csf | Cristal liquide cholesterique du type reentrant, et dispositif de detection de temperature utilisant un tel cristal liquide |
| GB2093057B (en) * | 1981-02-13 | 1985-10-16 | Secr Defence | Liquid crystal composition comprising a component of low dielectric anisotropy one of high clearing point and a low melting nematic component |
| EP0060646B1 (en) * | 1981-03-13 | 1985-10-09 | The Secretary of State for Defence in Her Britannic Majesty's Government of the United Kingdom of Great Britain and | Liquid crystal compositions |
| JPS59219381A (ja) * | 1983-05-26 | 1984-12-10 | Sharp Corp | 液晶組成物 |
| US4788000A (en) * | 1983-05-26 | 1988-11-29 | Sharp Kabushiki Kaisha | Liquid-crystal composition |
| GB8515510D0 (en) * | 1985-06-19 | 1985-07-24 | Secr Defence | Thermochromic liquid crystal materials |
| US5037574A (en) * | 1989-05-19 | 1991-08-06 | Cornell Research Foundation, Inc. | Hydrogen-bonded liquid crystal complexes |
| JPH09159997A (ja) * | 1995-12-07 | 1997-06-20 | Sharp Corp | 液晶パネルの欠陥候補箇所検出方法 |
| US6221444B1 (en) | 1998-06-10 | 2001-04-24 | Canon Kabushiki Kaisha | Liquid crystal device |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2356085A1 (de) * | 1972-11-09 | 1974-05-22 | Secr Defence Brit | Fluessigkristall-materialien und -einrichtungen |
| DE2306738B2 (de) * | 1972-02-23 | 1978-07-27 | F. Hoffmann-La Roche & Co Ag, Basel (Schweiz) | Schiffsche Basen, Verfahren zu deren Herstellung, sowie diese enthaltende nematische Gemische für elektrooptische Zwecke |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2024269A1 (en) * | 1970-05-19 | 1971-12-02 | Merck Patent Gmbh | Nematic mixtures - of low melting point, used in electronics |
| BE787198A (fr) * | 1971-08-07 | 1973-02-05 | Merck Patent Gmbh | Composes et melanges nematiques |
| US4011173A (en) * | 1972-08-03 | 1977-03-08 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Modified nematic mixtures with positive dielectric anisotropy |
| US3815972A (en) * | 1972-08-09 | 1974-06-11 | Olivetti & Co Spa | Low voltage liquid crystal display |
| US3953491A (en) * | 1972-08-19 | 1976-04-27 | Merck Patent Gesellschaft Mit Beschraenkter Haftung | Phenyl esters of 4-benzoyloxybenzoic acid |
| US3836478A (en) * | 1972-10-24 | 1974-09-17 | Ibm | Nematic materials |
| US3891307A (en) * | 1973-03-20 | 1975-06-24 | Matsushita Electric Industrial Co Ltd | Phase control of the voltages applied to opposite electrodes for a cholesteric to nematic phase transition display |
| JPS5023385A (enExample) * | 1973-07-06 | 1975-03-13 | ||
| JPS605630B2 (ja) * | 1973-07-06 | 1985-02-13 | セイコーエプソン株式会社 | 表示装置 |
| NL7414352A (nl) * | 1973-11-19 | 1975-05-21 | Hoffmann La Roche | Vloeibaarkristallijne bifenylen. |
| FR2252132B1 (enExample) * | 1973-11-28 | 1976-10-01 | Thomson Csf | |
| US4020002A (en) * | 1974-02-28 | 1977-04-26 | Beckman Instruments, Inc. | Non-schiff base field effect liquid crystal composition |
| JPS50150684A (enExample) * | 1974-05-25 | 1975-12-03 | ||
| DE2538865A1 (de) * | 1974-09-03 | 1976-03-11 | Beckman Instruments Inc | Nematische fluessigkristallmassen |
| US4147651A (en) * | 1974-09-03 | 1979-04-03 | Beckman Instruments, Inc. | Biphenyl based liquid crystal compositions |
-
1975
- 1975-01-23 US US05/543,431 patent/US4137192A/en not_active Expired - Lifetime
- 1975-01-24 DE DE19752502904 patent/DE2502904A1/de active Granted
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2306738B2 (de) * | 1972-02-23 | 1978-07-27 | F. Hoffmann-La Roche & Co Ag, Basel (Schweiz) | Schiffsche Basen, Verfahren zu deren Herstellung, sowie diese enthaltende nematische Gemische für elektrooptische Zwecke |
| DE2356085A1 (de) * | 1972-11-09 | 1974-05-22 | Secr Defence Brit | Fluessigkristall-materialien und -einrichtungen |
Cited By (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4011173A (en) * | 1972-08-03 | 1977-03-08 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Modified nematic mixtures with positive dielectric anisotropy |
| US4043935A (en) * | 1973-07-06 | 1977-08-23 | Kabushiki Kaisha Suwa Seikosha | Liquid crystal composition having high dielectric anisotropy and display device incorporating same |
| US4027950A (en) * | 1973-08-20 | 1977-06-07 | Matsushita Electric Industrial Co., Ltd. | Electro-optical display device |
| US4046708A (en) * | 1973-11-28 | 1977-09-06 | Thomson-Csf | Mixture of nematic liquid crystals exhibiting a positive dielectric anisotropy and a wide temperature range |
| US4020002A (en) * | 1974-02-28 | 1977-04-26 | Beckman Instruments, Inc. | Non-schiff base field effect liquid crystal composition |
| US4206071A (en) * | 1974-05-25 | 1980-06-03 | Chisso Corporation | Liquid crystal composition |
| US4083797A (en) * | 1974-09-03 | 1978-04-11 | Beckman Instruments, Inc. | Nematic liquid crystal compositions |
| US4147651A (en) * | 1974-09-03 | 1979-04-03 | Beckman Instruments, Inc. | Biphenyl based liquid crystal compositions |
| US4069167A (en) * | 1974-09-25 | 1978-01-17 | Chisso Corporation | Liquid crystal composition |
| US4017416A (en) * | 1974-10-11 | 1977-04-12 | Chisso Corporation | P-cyanophenyl 4-alkyl-4'-biphenylcarboxylate, method for preparing same and liquid crystal compositions using same |
| US4066570A (en) * | 1974-10-25 | 1978-01-03 | Hoffman-La Roche Inc. | Phenyl-pyrimidines |
| US4090975A (en) * | 1974-11-01 | 1978-05-23 | Itek Corporation | Mixtures of nematic liquid crystal materials |
| US4096086A (en) * | 1974-12-23 | 1978-06-20 | Kabushiki Kaisha Suwa Seikosha | Nematic liquid crystal composition |
| US4048089A (en) * | 1975-07-31 | 1977-09-13 | Dainippon Ink & Chemicals, Inc. | Nematic liquid crystal composition |
| US4076646A (en) * | 1975-09-12 | 1978-02-28 | Hitachi, Ltd. | Liquid crystal composition for field effect display devices |
| US4118335A (en) * | 1975-10-29 | 1978-10-03 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Liquid crystalline materials of reduced viscosity |
| US4138358A (en) * | 1976-02-09 | 1979-02-06 | Temple University | Liquid crystal compositions |
| US4029594A (en) * | 1976-06-17 | 1977-06-14 | Rca Corporation | Novel liquid crystal compounds and electro-optic devices incorporating them |
| US4013582A (en) * | 1976-06-17 | 1977-03-22 | Rca Corporation | Liquid crystal compounds and electro-optic devices incorporating them |
| US4149413A (en) * | 1976-08-16 | 1979-04-17 | The Secretary Of State For Defence In Her Britannic Majesty's Government Of The United Kingdom Of Great Britain And Norther Ireland | Optically active liquid crystal mixtures and liquid crystal devices containing them |
| US4141853A (en) * | 1976-10-06 | 1979-02-27 | Sharp Kabushiki Kaisha | Liquid crystal material |
| DE2745050A1 (de) * | 1976-10-06 | 1978-04-13 | Sharp Kk | Material aus fluessigen kristallen |
| US4120567A (en) * | 1977-02-11 | 1978-10-17 | Rca Corporation | Electro-optic device |
| US4222887A (en) * | 1977-07-19 | 1980-09-16 | Canon Kabushiki Kaisha | Liquid crystal composition |
| DE2842320A1 (de) * | 1977-09-29 | 1979-04-12 | Sharp Kk | Fluessigkristall-zusammensetzung |
| US4312773A (en) * | 1977-09-29 | 1982-01-26 | Sharp Kabushiki Kaisha | Liquid crystal compositions |
| DE2847601A1 (de) * | 1977-11-02 | 1979-05-03 | Secr Defence Brit | Fluessigkristallgemische und ihre verwendung in anzeigevorrichtungen |
| US4293434A (en) * | 1978-08-08 | 1981-10-06 | VEB Werk fur Fernsehelektronik Berlin im VEB Kombinat Mikroelektronik | Liquid crystal compounds |
| WO1987004158A2 (fr) | 1986-01-03 | 1987-07-16 | MERCK Patent Gesellschaft mit beschränkter Haftung | Composes heterocycliques utilises comme composants de phases de cristaux liquides |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2502904C2 (enExample) | 1990-06-28 |
| US4137192A (en) | 1979-01-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2502904A1 (de) | Fluessigkristall-zusammensetzung | |
| DE2656252C3 (de) | Dotierungsmittel für nematische Flüssigkristalle und damit dotiertes Flüssigkristallmaterial | |
| DE3685691T2 (de) | Ferroelektrische chiralsmektische fluessigkristallzusammensetzung und lichtschalter. | |
| DE2244195A1 (de) | Elektrooptisch-aktive materialzusammensetzungen und elektrooptisch-aktive vorrichtung unter verwendung derartiger materialzusammensetzungen | |
| DE4303335B4 (de) | Ferroelektrische Flüssigkristall-Mischungen mit kurzer ferroelektrischer Ganghöhe | |
| DE2854310A1 (de) | Nematisch-fluessige kristalle fuer anzeigevorrichtungen | |
| DE602004006495T2 (de) | Nematische flüssigkristallmischungen für bistabile flüssigkristallanzeigevorrichtungen | |
| DE3327300C2 (enExample) | ||
| DE2439703A1 (de) | Elektrooptisches element | |
| DD222039A5 (de) | Nematische fluessigkristall-zusammensetzung | |
| CH638827A5 (de) | Fluessigkristallmaterial. | |
| DE3420110C2 (de) | Zusammensetzungen für Flüssigkristalle | |
| DE60313211T2 (de) | Flüssigkristallzusammensetzung zur verwendung in bistabilen flüssigkristallanzeigen | |
| DE69010731T2 (de) | Ferroelektrische Flüssigkristall-Zusammensetzung. | |
| CH645399A5 (de) | Nematische kristallin-fluessige mischungen. | |
| DE3878457T2 (de) | Fluessigkristallzusammensetzung. | |
| DE2934918C2 (de) | Nematische Flüssigkristallzusammensetzungen für Anzeigevorrichtungen | |
| DE69331240T2 (de) | Multistabiler chirale neumatische anzeigevorrichtung | |
| DE3243688A1 (de) | Fluessigkristall-zusammensetzung | |
| DE2745050C2 (de) | Material aus flüssigen Kristallen | |
| DE3419512C1 (de) | Zusammensetzung fuer Fluessigkristalle | |
| DE3122529C2 (de) | Nematische Flüssigkristallmaterialien und ihre Verwendung | |
| DE2235385A1 (de) | Fluessigkristalline zusammensetzungen und ihre verwendung zur erzeugung von bildern | |
| DE3872116T2 (de) | Nematische fluessigkristallzusammensetzung. | |
| DE68911038T2 (de) | Ferroelektrische Flüssigkristallzusammensetzungen. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8125 | Change of the main classification | ||
| 8126 | Change of the secondary classification | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |