DE2502904C2 - - Google Patents
Info
- Publication number
- DE2502904C2 DE2502904C2 DE2502904A DE2502904A DE2502904C2 DE 2502904 C2 DE2502904 C2 DE 2502904C2 DE 2502904 A DE2502904 A DE 2502904A DE 2502904 A DE2502904 A DE 2502904A DE 2502904 C2 DE2502904 C2 DE 2502904C2
- Authority
- DE
- Germany
- Prior art keywords
- liquid crystal
- carbon atoms
- group
- crystal composition
- general formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000004973 liquid crystal related substance Substances 0.000 claims description 185
- 239000000463 material Substances 0.000 claims description 91
- 239000000203 mixture Substances 0.000 claims description 64
- 125000004432 carbon atom Chemical group C* 0.000 claims description 59
- 125000000217 alkyl group Chemical group 0.000 claims description 23
- 125000003545 alkoxy group Chemical group 0.000 claims description 21
- 125000004423 acyloxy group Chemical group 0.000 claims description 16
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 16
- 239000004988 Nematic liquid crystal Substances 0.000 claims description 14
- 235000010290 biphenyl Nutrition 0.000 claims description 8
- 239000004305 biphenyl Substances 0.000 claims description 8
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 239000013078 crystal Substances 0.000 description 17
- 239000007788 liquid Substances 0.000 description 17
- 210000002858 crystal cell Anatomy 0.000 description 15
- 210000004027 cell Anatomy 0.000 description 13
- 230000004044 response Effects 0.000 description 10
- -1 alkyl radical Chemical group 0.000 description 9
- 238000002834 transmittance Methods 0.000 description 7
- 230000008901 benefit Effects 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 125000000649 benzylidene group Chemical group [H]C(=[*])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 4
- 239000002075 main ingredient Substances 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 description 3
- 239000011159 matrix material Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 230000007704 transition Effects 0.000 description 3
- 125000005337 azoxy group Chemical group [N+]([O-])(=N*)* 0.000 description 2
- 125000003262 carboxylic acid ester group Chemical class [H]C([H])([*:2])OC(=O)C([H])([H])[*:1] 0.000 description 2
- 239000013065 commercial product Substances 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000003487 electrochemical reaction Methods 0.000 description 2
- 230000005032 impulse control Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000004043 responsiveness Effects 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- 230000003068 static effect Effects 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000004781 supercooling Methods 0.000 description 2
- HZRXDEHAXGKBME-UHFFFAOYSA-N (4-butylphenyl)imino-(4-ethoxyphenyl)-oxidoazanium Chemical compound C1=CC(CCCC)=CC=C1N=[N+]([O-])C1=CC=C(OCC)C=C1 HZRXDEHAXGKBME-UHFFFAOYSA-N 0.000 description 1
- CCFGQAGVYODMMK-UHFFFAOYSA-N (4-cyanophenyl)imino-(4-heptylphenyl)-oxidoazanium Chemical compound C1=CC(CCCCCCC)=CC=C1[N+]([O-])=NC1=CC=C(C#N)C=C1 CCFGQAGVYODMMK-UHFFFAOYSA-N 0.000 description 1
- FHOJMZHKTGMQBU-UHFFFAOYSA-N (4-cyanophenyl)imino-(4-hexylphenyl)-oxidoazanium Chemical compound C1=CC(CCCCCC)=CC=C1[N+]([O-])=NC1=CC=C(C#N)C=C1 FHOJMZHKTGMQBU-UHFFFAOYSA-N 0.000 description 1
- 239000004990 Smectic liquid crystal Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 230000003098 cholesteric effect Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000005684 electric field Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000005265 energy consumption Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 230000005669 field effect Effects 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- PJXISJQVUVHSOJ-UHFFFAOYSA-N indium(III) oxide Inorganic materials [O-2].[O-2].[O-2].[In+3].[In+3] PJXISJQVUVHSOJ-UHFFFAOYSA-N 0.000 description 1
- WABPQHHGFIMREM-UHFFFAOYSA-N lead(0) Chemical compound [Pb] WABPQHHGFIMREM-UHFFFAOYSA-N 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- KMVXENDYYJFUGZ-UHFFFAOYSA-N n-methoxy-n-(5-phenylpent-4-enyl)aniline Chemical compound C=1C=CC=CC=1N(OC)CCCC=CC1=CC=CC=C1 KMVXENDYYJFUGZ-UHFFFAOYSA-N 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- JLXXLCJERIYMQG-UHFFFAOYSA-N phenylcyanamide Chemical compound N#CNC1=CC=CC=C1 JLXXLCJERIYMQG-UHFFFAOYSA-N 0.000 description 1
- 230000010287 polarization Effects 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 238000009877 rendering Methods 0.000 description 1
- 238000012827 research and development Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 125000006850 spacer group Chemical group 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K19/00—Liquid crystal materials
- C09K19/04—Liquid crystal materials characterised by the chemical structure of the liquid crystal components, e.g. by a specific unit
- C09K19/42—Mixtures of liquid crystal compounds covered by two or more of the preceding groups C09K19/06 - C09K19/40
- C09K19/44—Mixtures of liquid crystal compounds covered by two or more of the preceding groups C09K19/06 - C09K19/40 containing compounds with benzene rings directly linked
Landscapes
- Chemical & Material Sciences (AREA)
- Crystallography & Structural Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Liquid Crystal Substances (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP49010732A JPS5950714B2 (ja) | 1974-01-25 | 1974-01-25 | 液晶組成物 |
| JP1302074A JPS50106886A (enExample) | 1974-01-31 | 1974-01-31 | |
| JP49013021A JPS6041107B2 (ja) | 1974-01-31 | 1974-01-31 | 液晶組成物 |
| JP49061346A JPS5950713B2 (ja) | 1974-05-30 | 1974-05-30 | 液晶組成物 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2502904A1 DE2502904A1 (de) | 1975-07-31 |
| DE2502904C2 true DE2502904C2 (enExample) | 1990-06-28 |
Family
ID=27455451
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752502904 Granted DE2502904A1 (de) | 1974-01-25 | 1975-01-24 | Fluessigkristall-zusammensetzung |
Country Status (2)
| Country | Link |
|---|---|
| US (1) | US4137192A (enExample) |
| DE (1) | DE2502904A1 (enExample) |
Families Citing this family (48)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4011173A (en) * | 1972-08-03 | 1977-03-08 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Modified nematic mixtures with positive dielectric anisotropy |
| JPS5023385A (enExample) * | 1973-07-06 | 1975-03-13 | ||
| JPS5043076A (enExample) * | 1973-08-20 | 1975-04-18 | ||
| FR2252132B1 (enExample) * | 1973-11-28 | 1976-10-01 | Thomson Csf | |
| US4020002A (en) * | 1974-02-28 | 1977-04-26 | Beckman Instruments, Inc. | Non-schiff base field effect liquid crystal composition |
| JPS50150684A (enExample) * | 1974-05-25 | 1975-12-03 | ||
| US4147651A (en) * | 1974-09-03 | 1979-04-03 | Beckman Instruments, Inc. | Biphenyl based liquid crystal compositions |
| US4069167A (en) * | 1974-09-25 | 1978-01-17 | Chisso Corporation | Liquid crystal composition |
| US4017416A (en) * | 1974-10-11 | 1977-04-12 | Chisso Corporation | P-cyanophenyl 4-alkyl-4'-biphenylcarboxylate, method for preparing same and liquid crystal compositions using same |
| US4066570A (en) * | 1974-10-25 | 1978-01-03 | Hoffman-La Roche Inc. | Phenyl-pyrimidines |
| US4090975A (en) * | 1974-11-01 | 1978-05-23 | Itek Corporation | Mixtures of nematic liquid crystal materials |
| GB1501718A (en) * | 1974-12-23 | 1978-02-22 | Suwa Seikosha Kk | Nematic liquid crystal material |
| JPS5216489A (en) * | 1975-07-31 | 1977-02-07 | Dainippon Ink & Chem Inc | Nematic liquid crystal composite |
| JPS5235183A (en) * | 1975-09-12 | 1977-03-17 | Hitachi Ltd | Liquid crystal composition for electoric field effect type display |
| DE2548360C2 (de) * | 1975-10-29 | 1983-12-08 | Merck Patent Gmbh, 6100 Darmstadt | Flüssigkristalline Materialien mit verminderter Viskosität |
| US4138358A (en) * | 1976-02-09 | 1979-02-06 | Temple University | Liquid crystal compositions |
| US4013582A (en) * | 1976-06-17 | 1977-03-22 | Rca Corporation | Liquid crystal compounds and electro-optic devices incorporating them |
| US4029594A (en) * | 1976-06-17 | 1977-06-14 | Rca Corporation | Novel liquid crystal compounds and electro-optic devices incorporating them |
| GB1592161A (en) * | 1976-08-13 | 1981-07-01 | Secr Defence | Biphenyl carboxylic esters and their use as liquid crystal materials |
| GB1596012A (en) * | 1976-08-16 | 1981-08-19 | Secr Defence | Optically active liquid crystal materials and liquid crystal devices containing them |
| US4208106A (en) * | 1976-09-27 | 1980-06-17 | Beckman Instruments, Inc. | Fluorescent displays |
| DE2745050C2 (de) * | 1976-10-06 | 1983-03-10 | Sharp K.K., Osaka | Material aus flüssigen Kristallen |
| US4120567A (en) * | 1977-02-11 | 1978-10-17 | Rca Corporation | Electro-optic device |
| JPS5421978A (en) * | 1977-07-19 | 1979-02-19 | Canon Inc | Liquid crystal composition |
| US4253740A (en) * | 1977-09-12 | 1981-03-03 | The Secretary Of State For Defence In Her Britannic Majesty's Government Of The United Kingdom Of Great Britain And Northern Ireland | Liquid crystal materials and devices containing them |
| JPS5450490A (en) * | 1977-09-29 | 1979-04-20 | Sharp Corp | Liquid crystal composition |
| GB2009219B (en) * | 1977-11-02 | 1982-04-28 | Secr Defence | Liquid ctystal material mixtures and devices incorporating such mixtures |
| JPS5483694A (en) * | 1977-12-16 | 1979-07-03 | Hitachi Ltd | Nematic liquid crystal body for display device |
| JPS5941983B2 (ja) * | 1978-02-17 | 1984-10-11 | 大日本インキ化学工業株式会社 | トランス(エカトリアル↓−エカトリアル)1,4↓−ジ置換シクロヘキサン誘導体 |
| US4293434A (en) * | 1978-08-08 | 1981-10-06 | VEB Werk fur Fernsehelektronik Berlin im VEB Kombinat Mikroelektronik | Liquid crystal compounds |
| JPS5534206A (en) * | 1978-08-30 | 1980-03-10 | Hitachi Ltd | Nematic liquid crystal for display unit |
| DE2966302D1 (en) * | 1978-09-13 | 1983-11-17 | Secr Defence Brit | Improvements in or relating to liquid crystal materials and devices |
| US4203862A (en) * | 1978-12-22 | 1980-05-20 | Timex Corporation | Liquid crystal composition |
| US4228030A (en) * | 1979-02-28 | 1980-10-14 | General Electric Company | Liquid crystal compositions |
| US4309304A (en) * | 1979-11-01 | 1982-01-05 | Exxon Research & Engineering Co. | Liquid crystal compositions for multiplexed displays |
| US4328116A (en) * | 1979-11-01 | 1982-05-04 | Minnesota Mining And Manufacturing Company | Liquid crystal compositions for multiplexed displays |
| DE3006666A1 (de) * | 1980-02-22 | 1981-09-17 | Merck Patent Gmbh, 6100 Darmstadt | Phenylcyclohexenderivate, verfahren zu ihrer herstellung, diese enthaltende fluessigkristalline dielektrika und elektrooptisches anzeieelement |
| DE3023989A1 (de) * | 1980-06-26 | 1982-01-21 | Merck Patent Gmbh, 6100 Darmstadt | Fluessigkristallines dielektrikum |
| FR2490666A1 (fr) * | 1980-08-29 | 1982-03-26 | Thomson Csf | Cristal liquide cholesterique du type reentrant, et dispositif de detection de temperature utilisant un tel cristal liquide |
| EP0058512B1 (en) * | 1981-02-13 | 1986-01-15 | The Secretary of State for Defence in Her Britannic Majesty's Government of the United Kingdom of Great Britain and | Liquid crystal compounds exhibiting a small dielectric anisotropy and liquid crystal materials and devices incorporating such compounds |
| DE3266741D1 (en) * | 1981-03-13 | 1985-11-14 | Secr Defence Brit | Liquid crystal compositions |
| US4788000A (en) * | 1983-05-26 | 1988-11-29 | Sharp Kabushiki Kaisha | Liquid-crystal composition |
| JPS59219381A (ja) * | 1983-05-26 | 1984-12-10 | Sharp Corp | 液晶組成物 |
| GB8515510D0 (en) * | 1985-06-19 | 1985-07-24 | Secr Defence | Thermochromic liquid crystal materials |
| DE3600052A1 (de) | 1986-01-03 | 1987-07-09 | Merck Patent Gmbh | Heterocyclische verbindungen |
| US5037574A (en) * | 1989-05-19 | 1991-08-06 | Cornell Research Foundation, Inc. | Hydrogen-bonded liquid crystal complexes |
| JPH09159997A (ja) * | 1995-12-07 | 1997-06-20 | Sharp Corp | 液晶パネルの欠陥候補箇所検出方法 |
| US6221444B1 (en) | 1998-06-10 | 2001-04-24 | Canon Kabushiki Kaisha | Liquid crystal device |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2024269A1 (en) * | 1970-05-19 | 1971-12-02 | Merck Patent Gmbh | Nematic mixtures - of low melting point, used in electronics |
| BE787198A (fr) * | 1971-08-07 | 1973-02-05 | Merck Patent Gmbh | Composes et melanges nematiques |
| BE795775A (fr) * | 1972-02-23 | 1973-08-22 | Hoffmann La Roche | Bases de schiff cristallines liquides |
| US4011173A (en) * | 1972-08-03 | 1977-03-08 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Modified nematic mixtures with positive dielectric anisotropy |
| US3815972A (en) * | 1972-08-09 | 1974-06-11 | Olivetti & Co Spa | Low voltage liquid crystal display |
| US3953491A (en) * | 1972-08-19 | 1976-04-27 | Merck Patent Gesellschaft Mit Beschraenkter Haftung | Phenyl esters of 4-benzoyloxybenzoic acid |
| US3836478A (en) * | 1972-10-24 | 1974-09-17 | Ibm | Nematic materials |
| FR2207758A1 (en) * | 1972-11-09 | 1974-06-21 | United Kingdom Government | Liquid crystal material - comprising two or more benzene rings para substd at both ends of the chain |
| US3891307A (en) * | 1973-03-20 | 1975-06-24 | Matsushita Electric Industrial Co Ltd | Phase control of the voltages applied to opposite electrodes for a cholesteric to nematic phase transition display |
| JPS5023385A (enExample) * | 1973-07-06 | 1975-03-13 | ||
| JPS605630B2 (ja) * | 1973-07-06 | 1985-02-13 | セイコーエプソン株式会社 | 表示装置 |
| NL7414352A (nl) * | 1973-11-19 | 1975-05-21 | Hoffmann La Roche | Vloeibaarkristallijne bifenylen. |
| FR2252132B1 (enExample) * | 1973-11-28 | 1976-10-01 | Thomson Csf | |
| US4020002A (en) * | 1974-02-28 | 1977-04-26 | Beckman Instruments, Inc. | Non-schiff base field effect liquid crystal composition |
| JPS50150684A (enExample) * | 1974-05-25 | 1975-12-03 | ||
| DE2538865A1 (de) * | 1974-09-03 | 1976-03-11 | Beckman Instruments Inc | Nematische fluessigkristallmassen |
| US4147651A (en) * | 1974-09-03 | 1979-04-03 | Beckman Instruments, Inc. | Biphenyl based liquid crystal compositions |
-
1975
- 1975-01-23 US US05/543,431 patent/US4137192A/en not_active Expired - Lifetime
- 1975-01-24 DE DE19752502904 patent/DE2502904A1/de active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE2502904A1 (de) | 1975-07-31 |
| US4137192A (en) | 1979-01-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2502904C2 (enExample) | ||
| DE2854310C2 (enExample) | ||
| DE3879380T2 (de) | Ferroelektrische fluessigkristall-zusammensetzungen. | |
| DE3779875T2 (de) | Ferroelektrische fluessigkristallmischung fuer anzeigevorrichtungen des "guest-host"-typs. | |
| DE2656252C3 (de) | Dotierungsmittel für nematische Flüssigkristalle und damit dotiertes Flüssigkristallmaterial | |
| DE2418364B2 (de) | Elektrooptisches Anzeigeelement mit einem nematischen Flüssigkristallsystem mit positiver dielektrischer Anisotropie | |
| CH653143A5 (de) | Fluessigkristall-anzeigeelemente. | |
| DE602004006495T2 (de) | Nematische flüssigkristallmischungen für bistabile flüssigkristallanzeigevorrichtungen | |
| DE3023989A1 (de) | Fluessigkristallines dielektrikum | |
| DE3327300C2 (enExample) | ||
| CH638827A5 (de) | Fluessigkristallmaterial. | |
| DE3807958B4 (de) | Supertwist-Flüssigkristallanzeigeelement | |
| DD222039A5 (de) | Nematische fluessigkristall-zusammensetzung | |
| DE3420110C2 (de) | Zusammensetzungen für Flüssigkristalle | |
| DE3007259C2 (enExample) | ||
| DE69010731T2 (de) | Ferroelektrische Flüssigkristall-Zusammensetzung. | |
| DE3784017T2 (de) | Fluessigkristallzusammensetzung. | |
| DE3878457T2 (de) | Fluessigkristallzusammensetzung. | |
| CH645399A5 (de) | Nematische kristallin-fluessige mischungen. | |
| DE3419512C1 (de) | Zusammensetzung fuer Fluessigkristalle | |
| DE3872116T2 (de) | Nematische fluessigkristallzusammensetzung. | |
| DE2418703C3 (de) | Nematische Flüssigkeitskristallmasse und deren Verwendung in elektrooptischen Elementen | |
| DE3122529C2 (de) | Nematische Flüssigkristallmaterialien und ihre Verwendung | |
| DE3315618C2 (de) | Flüssigkristallzusammensetzung und Flüssigkristallanzeigevorrichtung | |
| DE2644219C2 (de) | Verwendung einer nichtsmektischen Flüssigkristallmischung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8125 | Change of the main classification | ||
| 8126 | Change of the secondary classification | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |