DE2457102C3 - Vulkanisierbares Fluorelastomercobolymerisat - Google Patents
Vulkanisierbares FluorelastomercobolymerisatInfo
- Publication number
- DE2457102C3 DE2457102C3 DE19742457102 DE2457102A DE2457102C3 DE 2457102 C3 DE2457102 C3 DE 2457102C3 DE 19742457102 DE19742457102 DE 19742457102 DE 2457102 A DE2457102 A DE 2457102A DE 2457102 C3 DE2457102 C3 DE 2457102C3
- Authority
- DE
- Germany
- Prior art keywords
- copolymer
- percent
- weight
- structural units
- vinylidene fluoride
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920001973 fluoroelastomer Polymers 0.000 title claims description 23
- -1 perfluoroalkyl perfluorovinyl ether Chemical compound 0.000 claims description 16
- BQCIDUSAKPWEOX-UHFFFAOYSA-N 1,1-Difluoroethene Chemical group FC(F)=C BQCIDUSAKPWEOX-UHFFFAOYSA-N 0.000 claims description 11
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 claims description 9
- HCDGVLDPFQMKDK-UHFFFAOYSA-N hexafluoropropylene Chemical group FC(F)=C(F)C(F)(F)F HCDGVLDPFQMKDK-UHFFFAOYSA-N 0.000 claims description 8
- BLTXWCKMNMYXEA-UHFFFAOYSA-N 1,1,2-trifluoro-2-(trifluoromethoxy)ethene Chemical group FC(F)=C(F)OC(F)(F)F BLTXWCKMNMYXEA-UHFFFAOYSA-N 0.000 claims description 7
- 229920000642 polymer Polymers 0.000 claims description 5
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 2
- 239000011877 solvent mixture Substances 0.000 claims 1
- 229920001577 copolymer Polymers 0.000 description 49
- 239000000203 mixture Substances 0.000 description 21
- 238000000034 method Methods 0.000 description 13
- 239000000178 monomer Substances 0.000 description 11
- 239000004816 latex Substances 0.000 description 10
- 229920000126 latex Polymers 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 239000000243 solution Substances 0.000 description 9
- 238000001723 curing Methods 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 229920001971 elastomer Polymers 0.000 description 6
- 239000007789 gas Substances 0.000 description 6
- 239000003999 initiator Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- 238000006116 polymerization reaction Methods 0.000 description 5
- 150000003254 radicals Chemical class 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium peroxydisulfate Substances [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 4
- VAZSKTXWXKYQJF-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)OOS([O-])=O VAZSKTXWXKYQJF-UHFFFAOYSA-N 0.000 description 4
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 4
- 239000003431 cross linking reagent Substances 0.000 description 4
- 230000009477 glass transition Effects 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 238000005259 measurement Methods 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 230000032683 aging Effects 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000007334 copolymerization reaction Methods 0.000 description 3
- 239000000806 elastomer Substances 0.000 description 3
- 238000007720 emulsion polymerization reaction Methods 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- OQMIRQSWHKCKNJ-UHFFFAOYSA-N 1,1-difluoroethene;1,1,2,3,3,3-hexafluoroprop-1-ene Chemical group FC(F)=C.FC(F)=C(F)C(F)(F)F OQMIRQSWHKCKNJ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- DIRTUSMKNXOPBJ-UHFFFAOYSA-N carbamic acid;propane-1,3-diamine Chemical compound NC(O)=O.NCCCN DIRTUSMKNXOPBJ-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 238000010924 continuous production Methods 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 150000002736 metal compounds Chemical class 0.000 description 2
- 229920000570 polyether Polymers 0.000 description 2
- 238000011417 postcuring Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- DHCDFWKWKRSZHF-UHFFFAOYSA-L thiosulfate(2-) Chemical compound [O-]S([S-])(=O)=O DHCDFWKWKRSZHF-UHFFFAOYSA-L 0.000 description 2
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 description 2
- RRZIJNVZMJUGTK-UHFFFAOYSA-N 1,1,2-trifluoro-2-(1,2,2-trifluoroethenoxy)ethene Chemical compound FC(F)=C(F)OC(F)=C(F)F RRZIJNVZMJUGTK-UHFFFAOYSA-N 0.000 description 1
- JMGNVALALWCTLC-UHFFFAOYSA-N 1-fluoro-2-(2-fluoroethenoxy)ethene Chemical compound FC=COC=CF JMGNVALALWCTLC-UHFFFAOYSA-N 0.000 description 1
- XSQHUYDRSDBCHN-UHFFFAOYSA-N 2,3-dimethyl-2-propan-2-ylbutanenitrile Chemical compound CC(C)C(C)(C#N)C(C)C XSQHUYDRSDBCHN-UHFFFAOYSA-N 0.000 description 1
- LCPVQAHEFVXVKT-UHFFFAOYSA-N 2-(2,4-difluorophenoxy)pyridin-3-amine Chemical compound NC1=CC=CN=C1OC1=CC=C(F)C=C1F LCPVQAHEFVXVKT-UHFFFAOYSA-N 0.000 description 1
- CPDIMKQNIGAJOG-UHFFFAOYSA-N 2-(cinnamylideneamino)ethanamine Chemical compound NCCN=CC=CC1=CC=CC=C1 CPDIMKQNIGAJOG-UHFFFAOYSA-N 0.000 description 1
- AUUGWBRHHCJWHN-UHFFFAOYSA-N 3-(cinnamylideneamino)propan-1-amine Chemical compound NCCCN=CC=CC1=CC=CC=C1 AUUGWBRHHCJWHN-UHFFFAOYSA-N 0.000 description 1
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical class C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 1
- XUCIYIZWGKMUKO-UHFFFAOYSA-N 4-[(4-aminocyclohexyl)methyl]cyclohexan-1-amine;carbamic acid Chemical compound NC(O)=O.C1CC(N)CCC1CC1CCC(N)CC1 XUCIYIZWGKMUKO-UHFFFAOYSA-N 0.000 description 1
- LISYJIIYAKKNFI-UHFFFAOYSA-N 6-(cinnamylideneamino)hexan-1-amine Chemical compound NCCCCCCN=CC=CC1=CC=CC=C1 LISYJIIYAKKNFI-UHFFFAOYSA-N 0.000 description 1
- 229930185605 Bisphenol Natural products 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 239000006243 Fine Thermal Substances 0.000 description 1
- 241001441571 Hiodontidae Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000012790 adhesive layer Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- YOALFLHFSFEMLP-UHFFFAOYSA-N azane;2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoic acid Chemical compound [NH4+].[O-]C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F YOALFLHFSFEMLP-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- USFRYJRPHFMVBZ-UHFFFAOYSA-M benzyl(triphenyl)phosphanium;chloride Chemical compound [Cl-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(C=1C=CC=CC=1)CC1=CC=CC=C1 USFRYJRPHFMVBZ-UHFFFAOYSA-M 0.000 description 1
- ZFVMWEVVKGLCIJ-UHFFFAOYSA-N bisphenol AF Chemical compound C1=CC(O)=CC=C1C(C(F)(F)F)(C(F)(F)F)C1=CC=C(O)C=C1 ZFVMWEVVKGLCIJ-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 239000012986 chain transfer agent Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 230000001112 coagulating effect Effects 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 238000000113 differential scanning calorimetry Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- WBZKQQHYRPRKNJ-UHFFFAOYSA-L disulfite Chemical compound [O-]S(=O)S([O-])(=O)=O WBZKQQHYRPRKNJ-UHFFFAOYSA-L 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- RLRHPCKWSXWKBG-UHFFFAOYSA-N n-(2-azaniumylethyl)carbamate Chemical compound NCCNC(O)=O RLRHPCKWSXWKBG-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- ACVYVLVWPXVTIT-UHFFFAOYSA-M phosphinate Chemical compound [O-][PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-M 0.000 description 1
- 125000005496 phosphonium group Chemical group 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 238000000053 physical method Methods 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- GRLPQNLYRHEGIJ-UHFFFAOYSA-J potassium aluminium sulfate Chemical compound [Al+3].[K+].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O GRLPQNLYRHEGIJ-UHFFFAOYSA-J 0.000 description 1
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 150000004023 quaternary phosphonium compounds Chemical class 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- CHQMHPLRPQMAMX-UHFFFAOYSA-L sodium persulfate Substances [Na+].[Na+].[O-]S(=O)(=O)OOS([O-])(=O)=O CHQMHPLRPQMAMX-UHFFFAOYSA-L 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- SPEMQUPJTGQFIM-UHFFFAOYSA-N triazanium;hydrogen sulfite;sulfite Chemical compound [NH4+].[NH4+].[NH4+].OS([O-])=O.[O-]S([O-])=O SPEMQUPJTGQFIM-UHFFFAOYSA-N 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F214/00—Copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by a halogen
- C08F214/18—Monomers containing fluorine
- C08F214/22—Vinylidene fluoride
- C08F214/222—Vinylidene fluoride with fluorinated vinyl ethers
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US43842674A | 1974-01-31 | 1974-01-31 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2457102A1 DE2457102A1 (de) | 1975-08-07 |
| DE2457102B2 DE2457102B2 (de) | 1980-11-20 |
| DE2457102C3 true DE2457102C3 (de) | 1981-07-02 |
Family
ID=23740616
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742457102 Expired DE2457102C3 (de) | 1974-01-31 | 1974-12-03 | Vulkanisierbares Fluorelastomercobolymerisat |
Country Status (10)
| Country | Link |
|---|---|
| JP (1) | JPS534035B2 (enExample) |
| BE (1) | BE824979A (enExample) |
| CA (1) | CA1047695A (enExample) |
| DE (1) | DE2457102C3 (enExample) |
| FR (1) | FR2259849B1 (enExample) |
| GB (1) | GB1496084A (enExample) |
| IT (1) | IT1031311B (enExample) |
| LU (1) | LU71777A1 (enExample) |
| NL (1) | NL155852B (enExample) |
| SU (1) | SU822755A3 (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0525685A1 (en) * | 1991-07-24 | 1993-02-03 | AUSIMONT S.p.A. | Vinylidene fluoride based fluoroelastomeric copolymers modified with perfluoroalkylvinylether |
| EP0525687A1 (en) * | 1991-07-24 | 1993-02-03 | AUSIMONT S.p.A. | Ionically vulcanizable fluoroelastomeric copolymers |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4141874A (en) * | 1975-11-15 | 1979-02-27 | Daikin Kogyo Co., Ltd. | Fluorine-containing elastomeric copolymers, process for preparing the same and composition containing the same |
| US4316836A (en) | 1980-04-23 | 1982-02-23 | E. I. Du Pont De Nemours And Company | Stabilized fluoroelastomer compositions |
| US4484894A (en) * | 1980-09-03 | 1984-11-27 | Eiichi Masuhara | Sheet for lining denture base |
| JPS57104925U (enExample) * | 1980-12-19 | 1982-06-28 | ||
| JPS57109810A (en) * | 1980-12-26 | 1982-07-08 | Asahi Glass Co Ltd | Copolymer giving fluorine-containing elastomer with cold and alcohol resistance |
| DE3437278A1 (de) * | 1984-10-11 | 1986-04-17 | Hoechst Ag, 6230 Frankfurt | Konzentrierte, waessrige dispersionen von vinylidenfluorid-polymeren und verfahren zu deren herstellung |
| JPS61151014U (enExample) * | 1985-03-11 | 1986-09-18 | ||
| US5260392A (en) * | 1991-07-24 | 1993-11-09 | Ausimont S.P.A. | Ionically vulcanizable fluoroelastomeric copolymers |
| JP3208913B2 (ja) * | 1993-03-23 | 2001-09-17 | キヤノン株式会社 | 定着装置及び定着ローラー |
| JP3327016B2 (ja) | 1994-12-06 | 2002-09-24 | ダイキン工業株式会社 | 低温シール性に優れたフッ素ゴム共重合体及びその硬化用組成物 |
| DE19542501A1 (de) * | 1995-11-15 | 1997-05-22 | Bayer Ag | Peroxidisch vernetzbare Fluorkautschuke, ein Verfahren zu deren Herstellung und deren Verwendung |
| EP1109844B1 (en) | 1998-08-21 | 2004-02-18 | Dupont Dow Elastomers L.L.C. | Fluoroelastomer composition having excellent processability and low temperature properties |
| US6326436B2 (en) | 1998-08-21 | 2001-12-04 | Dupont Dow Elastomers, L.L.C. | Fluoroelastomer composition having excellent processability and low temperature properties |
| JP4610856B2 (ja) * | 2003-02-06 | 2011-01-12 | Nok株式会社 | フッ素ゴム系シール材用組成物及びフッ素ゴム系シール材 |
| WO2007049469A1 (ja) | 2005-10-27 | 2007-05-03 | Daikin Industries, Ltd. | 架橋性組成物およびそれからなる成形品 |
| RU2432366C1 (ru) * | 2010-04-09 | 2011-10-27 | Федеральное государственное унитарное предприятие "Ордена Ленина и ордена Трудового Красного Знамени научно-исследовательский институт синтетического каучука имени академика С.В. Лебедева" | Низкомолекулярные тройные сополимеры винилиденфторида и мономера, содержащего фторсульфатную группу |
| GB2517481A (en) * | 2013-08-22 | 2015-02-25 | 3M Innovative Properties Co | Method of making peroxide fluoropolymers using non-fluorindated emulsifiers |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2968649A (en) * | 1958-12-04 | 1961-01-17 | Du Pont | Elastomeric terpolymers |
| US3235537A (en) * | 1961-06-23 | 1966-02-15 | Du Pont | Fluorine containing terpolymer of a perfluorovinyl ether, vinylidene fluoride and a monomer of the structure cfx=cfy |
| US3467636A (en) * | 1967-02-24 | 1969-09-16 | Du Pont | Redox catalyst system for preparing vinylidene fluoride interpolymers |
| US3645991A (en) * | 1970-04-02 | 1972-02-29 | Du Pont | Vinylidene fluoride copolymers having improved resistance to heat-aging |
-
1974
- 1974-12-03 DE DE19742457102 patent/DE2457102C3/de not_active Expired
-
1975
- 1975-01-29 CA CA218,891A patent/CA1047695A/en not_active Expired
- 1975-01-29 JP JP1145475A patent/JPS534035B2/ja not_active Expired
- 1975-01-30 GB GB414575A patent/GB1496084A/en not_active Expired
- 1975-01-30 FR FR7502936A patent/FR2259849B1/fr not_active Expired
- 1975-01-30 SU SU752106666A patent/SU822755A3/ru active
- 1975-01-30 BE BE152873A patent/BE824979A/xx unknown
- 1975-01-30 IT IT1977975A patent/IT1031311B/it active
- 1975-01-31 LU LU71777A patent/LU71777A1/xx unknown
- 1975-01-31 NL NL7501183A patent/NL155852B/xx not_active IP Right Cessation
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0525685A1 (en) * | 1991-07-24 | 1993-02-03 | AUSIMONT S.p.A. | Vinylidene fluoride based fluoroelastomeric copolymers modified with perfluoroalkylvinylether |
| EP0525687A1 (en) * | 1991-07-24 | 1993-02-03 | AUSIMONT S.p.A. | Ionically vulcanizable fluoroelastomeric copolymers |
Also Published As
| Publication number | Publication date |
|---|---|
| LU71777A1 (enExample) | 1975-12-09 |
| JPS534035B2 (enExample) | 1978-02-13 |
| CA1047695A (en) | 1979-01-30 |
| DE2457102A1 (de) | 1975-08-07 |
| JPS50109280A (enExample) | 1975-08-28 |
| IT1031311B (it) | 1979-04-30 |
| AU7769075A (en) | 1976-07-29 |
| NL155852B (nl) | 1978-02-15 |
| DE2457102B2 (de) | 1980-11-20 |
| GB1496084A (en) | 1977-12-21 |
| NL7501183A (nl) | 1975-08-04 |
| BE824979A (fr) | 1975-07-30 |
| FR2259849A1 (enExample) | 1975-08-29 |
| SU822755A3 (ru) | 1981-04-15 |
| FR2259849B1 (enExample) | 1977-04-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2457102C3 (de) | Vulkanisierbares Fluorelastomercobolymerisat | |
| DE2659972C2 (de) | Modifizierte fluorhaltige Copolymerisate | |
| DE3030882C2 (enExample) | ||
| DE2815187C2 (enExample) | ||
| EP0582841B1 (de) | Kombinationen aus Polyorganosiloxanen und doppelbindungsghaltigen Fluorkautschuken durch Si-H-Addition | |
| DE69500730T2 (de) | Kationische fluorierte Copolymere für die öl- und wasserabweisende Behandlung von Baumaterialien | |
| DE1520543C3 (de) | Verfahren zur Herstellung von hartbaren elastomeren Tetrafluorathylen mischpolymerisaten | |
| DE1227242B (de) | Verfahren zur Herstellung eines elastomeren Terpolymeren | |
| DE2440316C2 (de) | Vulkanisierbare Fluorelastomere | |
| DE1204407B (de) | Verfahren zur Herstellung von Mischpolymerisaten | |
| DE1745305C3 (de) | Verfahren zur Herstellung von Vinylidenfluorid-Mischpolymerisaten | |
| DE1139978B (de) | Verfahren zur Herstellung eines elastomeren Mischpolymerisates aus Trifluorchloraethylen und Vinylidenfluorid | |
| DE2161861B2 (de) | Kontinuierliches Verfahren zur Herstellung eines Vinylidenfluorid-Copolymeren | |
| DE1248944C2 (de) | Verfahren zur herstellung von chlorierungsprodukten des polyaethylends | |
| DE2535126A1 (de) | Verfahren zur herstellung elastomerer vinylidenfluoridmischpolymerisate | |
| DE1569073A1 (de) | Verfahren zum Vernetzen eines linearen gesaettigten Polymerisats | |
| DE1245120B (de) | Verfahren zur Herstellung gehaerteter Formkoerper oder UEberzuege aus fluorhaltigen Polymerisaten | |
| DE1745257A1 (de) | Form-oder UEberzugsmassen aus Polyamid- und Polyurethansegmente enthaltenden Copolymeren | |
| DE2639968A1 (de) | Polymerisate aus olefinischen nitrilen | |
| DE68921844T2 (de) | Vollaromatisches Polyamidcopolymer. | |
| DE2114440B2 (de) | Verfahren zur Herstellung von elastomeren Copolymeren mit verbesserten Wärmealterungseigenschaften | |
| DE1720984A1 (de) | Polyamide und Verfahren zu deren Herstellung | |
| DE2223027A1 (de) | Verfahren zur Herstellung von Fluorkohlenstoffpolymeren | |
| DE2414395A1 (de) | Thermoplastische mischpolymere und verfahren zu deren herstellung | |
| DE1165253B (de) | Verfahren zum Vernetzen von Polymerisaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |