DE2406930A1 - Neue heterocyclische verbindungen und verfahren zu ihrer herstellung - Google Patents
Neue heterocyclische verbindungen und verfahren zu ihrer herstellungInfo
- Publication number
- DE2406930A1 DE2406930A1 DE19742406930 DE2406930A DE2406930A1 DE 2406930 A1 DE2406930 A1 DE 2406930A1 DE 19742406930 DE19742406930 DE 19742406930 DE 2406930 A DE2406930 A DE 2406930A DE 2406930 A1 DE2406930 A1 DE 2406930A1
- Authority
- DE
- Germany
- Prior art keywords
- lower alkyl
- carbon atoms
- formula
- alkoxy
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 238000000034 method Methods 0.000 title claims description 100
- 150000002391 heterocyclic compounds Chemical class 0.000 title claims description 4
- 238000004519 manufacturing process Methods 0.000 title description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 653
- 125000004432 carbon atom Chemical group C* 0.000 claims description 606
- -1 alkali metal cyanoborohydride Chemical class 0.000 claims description 533
- 150000001875 compounds Chemical class 0.000 claims description 190
- 125000003545 alkoxy group Chemical group 0.000 claims description 133
- 229910052739 hydrogen Inorganic materials 0.000 claims description 106
- 239000001257 hydrogen Substances 0.000 claims description 106
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 103
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 99
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 91
- 125000003342 alkenyl group Chemical group 0.000 claims description 82
- 125000003282 alkyl amino group Chemical group 0.000 claims description 77
- 150000003254 radicals Chemical class 0.000 claims description 72
- 239000007859 condensation product Substances 0.000 claims description 67
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 67
- 150000001299 aldehydes Chemical class 0.000 claims description 66
- 239000000203 mixture Substances 0.000 claims description 61
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 61
- 150000002431 hydrogen Chemical class 0.000 claims description 58
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 56
- 150000002576 ketones Chemical class 0.000 claims description 52
- 239000002253 acid Substances 0.000 claims description 49
- 239000003795 chemical substances by application Substances 0.000 claims description 48
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 claims description 47
- 125000004414 alkyl thio group Chemical group 0.000 claims description 46
- 229910052736 halogen Inorganic materials 0.000 claims description 44
- 150000002367 halogens Chemical class 0.000 claims description 43
- 238000006243 chemical reaction Methods 0.000 claims description 42
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 39
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 38
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 38
- 125000004442 acylamino group Chemical group 0.000 claims description 37
- 239000007858 starting material Substances 0.000 claims description 36
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 34
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 32
- 125000002947 alkylene group Chemical group 0.000 claims description 31
- 150000003839 salts Chemical class 0.000 claims description 31
- 125000001424 substituent group Chemical group 0.000 claims description 31
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 30
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 30
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzenecarboxaldehyde Natural products O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 claims description 29
- 229910052757 nitrogen Inorganic materials 0.000 claims description 29
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 claims description 28
- 239000002585 base Substances 0.000 claims description 25
- 230000009467 reduction Effects 0.000 claims description 25
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 24
- 229910052801 chlorine Inorganic materials 0.000 claims description 23
- 239000000460 chlorine Substances 0.000 claims description 23
- 230000007062 hydrolysis Effects 0.000 claims description 23
- 238000006460 hydrolysis reaction Methods 0.000 claims description 23
- 150000001204 N-oxides Chemical class 0.000 claims description 22
- 229910052794 bromium Inorganic materials 0.000 claims description 22
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 21
- 239000003513 alkali Substances 0.000 claims description 21
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 claims description 21
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 21
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 20
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 19
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 17
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 17
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 16
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 claims description 16
- 150000004892 pyridazines Chemical class 0.000 claims description 16
- ILVXOBCQQYKLDS-UHFFFAOYSA-N pyridine N-oxide Chemical class [O-][N+]1=CC=CC=C1 ILVXOBCQQYKLDS-UHFFFAOYSA-N 0.000 claims description 16
- 150000003222 pyridines Chemical class 0.000 claims description 16
- 150000003230 pyrimidines Chemical class 0.000 claims description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 15
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 15
- 239000000047 product Substances 0.000 claims description 15
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 14
- 238000005984 hydrogenation reaction Methods 0.000 claims description 14
- 229910052783 alkali metal Inorganic materials 0.000 claims description 13
- 150000001412 amines Chemical class 0.000 claims description 13
- 125000003277 amino group Chemical group 0.000 claims description 12
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 12
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 12
- 150000003216 pyrazines Chemical class 0.000 claims description 12
- 229910001854 alkali hydroxide Inorganic materials 0.000 claims description 11
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 11
- 239000000126 substance Substances 0.000 claims description 11
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 claims description 10
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 claims description 10
- GAJBWMUZVXJIBO-UHFFFAOYSA-N 1-oxidopyridazin-1-ium Chemical class [O-][N+]1=CC=CC=N1 GAJBWMUZVXJIBO-UHFFFAOYSA-N 0.000 claims description 9
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 9
- 125000005843 halogen group Chemical group 0.000 claims description 9
- 229910052740 iodine Inorganic materials 0.000 claims description 9
- 230000008569 process Effects 0.000 claims description 9
- RUIZBQQGWNBRFH-UHFFFAOYSA-N 1-oxidopyrazin-1-ium Chemical class [O-][N+]1=CC=NC=C1 RUIZBQQGWNBRFH-UHFFFAOYSA-N 0.000 claims description 8
- OQZGLXOADHKTDN-UHFFFAOYSA-N 1-oxidopyrimidin-1-ium Chemical class [O-][N+]1=CC=CN=C1 OQZGLXOADHKTDN-UHFFFAOYSA-N 0.000 claims description 8
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 8
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 7
- 125000005237 alkyleneamino group Chemical group 0.000 claims description 7
- 125000003700 epoxy group Chemical group 0.000 claims description 7
- 230000003287 optical effect Effects 0.000 claims description 7
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 6
- 125000006177 alkyl benzyl group Chemical group 0.000 claims description 6
- 125000005336 allyloxy group Chemical group 0.000 claims description 6
- 239000007795 chemical reaction product Substances 0.000 claims description 6
- 125000006277 halobenzyl group Chemical group 0.000 claims description 6
- 150000004678 hydrides Chemical class 0.000 claims description 6
- 125000004076 pyridyl group Chemical group 0.000 claims description 6
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 6
- 238000003797 solvolysis reaction Methods 0.000 claims description 6
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 5
- 125000000068 chlorophenyl group Chemical group 0.000 claims description 5
- 238000009833 condensation Methods 0.000 claims description 5
- 230000005494 condensation Effects 0.000 claims description 5
- 230000003301 hydrolyzing effect Effects 0.000 claims description 5
- 229910052751 metal Inorganic materials 0.000 claims description 5
- 239000002184 metal Substances 0.000 claims description 5
- 125000006518 morpholino carbonyl group Chemical group [H]C1([H])OC([H])([H])C([H])([H])N(C(*)=O)C1([H])[H] 0.000 claims description 5
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 5
- 125000002098 pyridazinyl group Chemical group 0.000 claims description 5
- 125000006307 alkoxy benzyl group Chemical group 0.000 claims description 4
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims description 4
- 150000003973 alkyl amines Chemical class 0.000 claims description 4
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 claims description 4
- 125000006493 trifluoromethyl benzyl group Chemical group 0.000 claims description 4
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 claims description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 3
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 claims description 3
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 claims description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 3
- 238000005915 ammonolysis reaction Methods 0.000 claims description 3
- 150000003935 benzaldehydes Chemical class 0.000 claims description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 3
- 239000012876 carrier material Substances 0.000 claims description 3
- 125000005059 halophenyl group Chemical group 0.000 claims description 3
- UCFFGYASXIPWPD-UHFFFAOYSA-N methyl hypochlorite Chemical compound COCl UCFFGYASXIPWPD-UHFFFAOYSA-N 0.000 claims description 3
- 239000000825 pharmaceutical preparation Substances 0.000 claims description 3
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 claims description 3
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 claims description 2
- 101150052863 THY1 gene Proteins 0.000 claims description 2
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 claims description 2
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 239000003638 chemical reducing agent Substances 0.000 claims description 2
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 claims description 2
- 239000000543 intermediate Substances 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims 4
- 125000001589 carboacyl group Chemical group 0.000 claims 4
- 239000010985 leather Substances 0.000 claims 4
- 125000006361 alkylene amino carbonyl group Chemical group 0.000 claims 2
- 125000005505 thiomorpholino group Chemical group 0.000 claims 2
- NIIPNAJXERMYOG-UHFFFAOYSA-N 1,1,2-trimethylhydrazine Chemical compound CNN(C)C NIIPNAJXERMYOG-UHFFFAOYSA-N 0.000 claims 1
- GRFNBEZIAWKNCO-UHFFFAOYSA-N 3-pyridinol Chemical compound OC1=CC=CN=C1 GRFNBEZIAWKNCO-UHFFFAOYSA-N 0.000 claims 1
- 125000002009 alkene group Chemical group 0.000 claims 1
- 125000005082 alkoxyalkenyl group Chemical group 0.000 claims 1
- 125000004848 alkoxyethyl group Chemical group 0.000 claims 1
- LTXJLQINBYSQFU-UHFFFAOYSA-N pyrimidin-5-ol Chemical compound OC1=CN=CN=C1 LTXJLQINBYSQFU-UHFFFAOYSA-N 0.000 claims 1
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 171
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 126
- 239000000243 solution Substances 0.000 description 126
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 108
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 100
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 78
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 72
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Natural products OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 69
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 66
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 53
- 239000003921 oil Substances 0.000 description 52
- 235000019198 oils Nutrition 0.000 description 52
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 49
- 239000011541 reaction mixture Substances 0.000 description 45
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 44
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Natural products C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 38
- 235000011121 sodium hydroxide Nutrition 0.000 description 38
- 239000002904 solvent Substances 0.000 description 35
- 238000003756 stirring Methods 0.000 description 34
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 32
- 229910052938 sodium sulfate Inorganic materials 0.000 description 32
- 235000011152 sodium sulphate Nutrition 0.000 description 32
- 238000001704 evaporation Methods 0.000 description 31
- 238000002844 melting Methods 0.000 description 31
- 230000008018 melting Effects 0.000 description 31
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 30
- 230000008020 evaporation Effects 0.000 description 30
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 28
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 27
- 239000000155 melt Substances 0.000 description 27
- 229910000104 sodium hydride Inorganic materials 0.000 description 27
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 26
- 238000009835 boiling Methods 0.000 description 26
- 239000012312 sodium hydride Substances 0.000 description 26
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 25
- 239000000725 suspension Substances 0.000 description 25
- 239000000706 filtrate Substances 0.000 description 23
- 230000007935 neutral effect Effects 0.000 description 23
- 239000008346 aqueous phase Substances 0.000 description 22
- 229960004592 isopropanol Drugs 0.000 description 22
- 239000001530 fumaric acid Substances 0.000 description 21
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 21
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Natural products CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 20
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 20
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 20
- 239000003054 catalyst Substances 0.000 description 19
- 239000000284 extract Substances 0.000 description 18
- 238000001035 drying Methods 0.000 description 17
- 239000012259 ether extract Substances 0.000 description 17
- 230000002378 acidificating effect Effects 0.000 description 16
- 238000001816 cooling Methods 0.000 description 16
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 16
- 238000010992 reflux Methods 0.000 description 16
- 239000007868 Raney catalyst Substances 0.000 description 14
- 229910000564 Raney nickel Inorganic materials 0.000 description 14
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical group CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 14
- 150000007513 acids Chemical class 0.000 description 14
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 14
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 14
- 238000001953 recrystallisation Methods 0.000 description 14
- NIQQIJXGUZVEBB-UHFFFAOYSA-N methanol;propan-2-one Chemical compound OC.CC(C)=O NIQQIJXGUZVEBB-UHFFFAOYSA-N 0.000 description 13
- 235000011118 potassium hydroxide Nutrition 0.000 description 13
- 239000011734 sodium Substances 0.000 description 13
- HNOAXSVPMXZKBT-UHFFFAOYSA-N (2-phenyl-3-propan-2-yl-1,3-oxazolidin-5-yl)methanol Chemical compound CC(C)N1CC(CO)OC1C1=CC=CC=C1 HNOAXSVPMXZKBT-UHFFFAOYSA-N 0.000 description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 12
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 12
- 239000012071 phase Substances 0.000 description 12
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 12
- 229910052708 sodium Inorganic materials 0.000 description 12
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 12
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 11
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 11
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 11
- 150000001340 alkali metals Chemical class 0.000 description 11
- 150000002148 esters Chemical class 0.000 description 11
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 11
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 10
- 102000012740 beta Adrenergic Receptors Human genes 0.000 description 10
- 108010079452 beta Adrenergic Receptors Proteins 0.000 description 10
- 238000004821 distillation Methods 0.000 description 10
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 10
- 229910000027 potassium carbonate Inorganic materials 0.000 description 10
- 235000011181 potassium carbonates Nutrition 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- GHVZOJONCUEWAV-UHFFFAOYSA-N [K].CCO Chemical compound [K].CCO GHVZOJONCUEWAV-UHFFFAOYSA-N 0.000 description 9
- 125000003118 aryl group Chemical group 0.000 description 9
- 239000013078 crystal Substances 0.000 description 9
- 239000005457 ice water Substances 0.000 description 9
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 8
- 239000012230 colorless oil Substances 0.000 description 8
- 239000006185 dispersion Substances 0.000 description 8
- 239000003208 petroleum Substances 0.000 description 8
- 239000011591 potassium Substances 0.000 description 8
- 229910052700 potassium Inorganic materials 0.000 description 8
- YLZYSVYZMDJYOT-UHFFFAOYSA-N 2-methoxypyrimidine Chemical compound COC1=NC=CC=N1 YLZYSVYZMDJYOT-UHFFFAOYSA-N 0.000 description 7
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 229910052500 inorganic mineral Inorganic materials 0.000 description 7
- 235000010755 mineral Nutrition 0.000 description 7
- 239000011707 mineral Substances 0.000 description 7
- 229910052759 nickel Inorganic materials 0.000 description 7
- 229910000029 sodium carbonate Inorganic materials 0.000 description 7
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 6
- YZCKVEUIGOORGS-UHFFFAOYSA-N Hydrogen atom Chemical compound [H] YZCKVEUIGOORGS-UHFFFAOYSA-N 0.000 description 6
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 6
- 229910017053 inorganic salt Inorganic materials 0.000 description 6
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 6
- 235000019341 magnesium sulphate Nutrition 0.000 description 6
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical group CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 239000012074 organic phase Substances 0.000 description 6
- 229910052697 platinum Inorganic materials 0.000 description 6
- 239000003826 tablet Substances 0.000 description 6
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 6
- MLCNOCRGSBCAGH-UHFFFAOYSA-N 2,3-dichloropyrazine Chemical compound ClC1=NC=CN=C1Cl MLCNOCRGSBCAGH-UHFFFAOYSA-N 0.000 description 5
- 229920002472 Starch Polymers 0.000 description 5
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 5
- 125000002252 acyl group Chemical group 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 5
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 5
- 150000007522 mineralic acids Chemical class 0.000 description 5
- BAVYZALUXZFZLV-UHFFFAOYSA-N mono-methylamine Chemical group NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 5
- 150000007524 organic acids Chemical class 0.000 description 5
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 5
- 238000000746 purification Methods 0.000 description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 5
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 4
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 4
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical group CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 4
- 241000700199 Cavia porcellus Species 0.000 description 4
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 230000009471 action Effects 0.000 description 4
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 150000008064 anhydrides Chemical class 0.000 description 4
- 125000005239 aroylamino group Chemical group 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 4
- 229910052731 fluorine Inorganic materials 0.000 description 4
- 239000011737 fluorine Substances 0.000 description 4
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 4
- 239000011630 iodine Substances 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- HZVOZRGWRWCICA-UHFFFAOYSA-N methanediyl Chemical compound [CH2] HZVOZRGWRWCICA-UHFFFAOYSA-N 0.000 description 4
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 4
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 4
- 210000000056 organ Anatomy 0.000 description 4
- 239000002994 raw material Substances 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 4
- 125000003107 substituted aryl group Chemical group 0.000 description 4
- 125000005147 toluenesulfonyl group Chemical group C=1(C(=CC=CC1)S(=O)(=O)*)C 0.000 description 4
- 229940100445 wheat starch Drugs 0.000 description 4
- ZOFUUOULXZPZHP-UHFFFAOYSA-N (5,6-dichloropyridin-3-yl)methanol Chemical compound OCC1=CN=C(Cl)C(Cl)=C1 ZOFUUOULXZPZHP-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 3
- RYUWXGWHTRPERF-UHFFFAOYSA-N 2-chloro-3-phenylsulfanylpyrazine Chemical compound ClC1=NC=CN=C1SC1=CC=CC=C1 RYUWXGWHTRPERF-UHFFFAOYSA-N 0.000 description 3
- UNCQVRBWJWWJBF-UHFFFAOYSA-N 2-chloropyrimidine Chemical compound ClC1=NC=CC=N1 UNCQVRBWJWWJBF-UHFFFAOYSA-N 0.000 description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 3
- BLHCMGRVFXRYRN-UHFFFAOYSA-N 6-hydroxynicotinic acid Chemical compound OC(=O)C1=CC=C(O)N=C1 BLHCMGRVFXRYRN-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- 241000282326 Felis catus Species 0.000 description 3
- 238000000023 Kugelrohr distillation Methods 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 3
- 239000005662 Paraffin oil Substances 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 208000001871 Tachycardia Diseases 0.000 description 3
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 3
- 150000008041 alkali metal carbonates Chemical class 0.000 description 3
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 3
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 3
- 229940092714 benzenesulfonic acid Drugs 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 125000004799 bromophenyl group Chemical group 0.000 description 3
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 description 3
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 3
- 238000004140 cleaning Methods 0.000 description 3
- 230000008602 contraction Effects 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 3
- 238000006264 debenzylation reaction Methods 0.000 description 3
- NPOMSUOUAZCMBL-UHFFFAOYSA-N dichloromethane;ethoxyethane Chemical compound ClCCl.CCOCC NPOMSUOUAZCMBL-UHFFFAOYSA-N 0.000 description 3
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 3
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 3
- 125000006627 ethoxycarbonylamino group Chemical group 0.000 description 3
- DLLJVQNYBYOKGS-UHFFFAOYSA-N ethoxyethane;pentane Chemical compound CCCCC.CCOCC DLLJVQNYBYOKGS-UHFFFAOYSA-N 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- VZCYOOQTPOCHFL-OWOJBTEDSA-M fumarate(1-) Chemical compound OC(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-M 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 229940039009 isoproterenol Drugs 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 229910052744 lithium Inorganic materials 0.000 description 3
- 229940098779 methanesulfonic acid Drugs 0.000 description 3
- 125000006626 methoxycarbonylamino group Chemical group 0.000 description 3
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 3
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 3
- 230000002107 myocardial effect Effects 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-M oxalate(1-) Chemical compound OC(=O)C([O-])=O MUBZPKHOEPUJKR-UHFFFAOYSA-M 0.000 description 3
- 235000006408 oxalic acid Nutrition 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 3
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 3
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical class [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 3
- 102000005962 receptors Human genes 0.000 description 3
- 108020003175 receptors Proteins 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- 235000017550 sodium carbonate Nutrition 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- 210000003437 trachea Anatomy 0.000 description 3
- RMNYHSJQXBBJON-UHFFFAOYSA-N (3-benzyl-2-phenyl-1,3-oxazolidin-5-yl)methanol Chemical compound C=1C=CC=CC=1C1OC(CO)CN1CC1=CC=CC=C1 RMNYHSJQXBBJON-UHFFFAOYSA-N 0.000 description 2
- YODTUCOTWSNBGT-UHFFFAOYSA-N 1-(3-chloropyrazin-2-yl)oxy-3-(propan-2-ylamino)propan-2-ol Chemical compound CC(C)NCC(O)COC1=NC=CN=C1Cl YODTUCOTWSNBGT-UHFFFAOYSA-N 0.000 description 2
- LXAGZGFAXKNAON-UHFFFAOYSA-N 1-(propan-2-ylamino)-3-pyrimidin-2-yloxypropan-2-ol Chemical compound CC(C)NCC(O)COC1=NC=CC=N1 LXAGZGFAXKNAON-UHFFFAOYSA-N 0.000 description 2
- QSFSPKYABJTXGE-UHFFFAOYSA-N 1-[5-(2-aminoethyl)-3-chloropyridin-2-yl]oxy-3-(propan-2-ylamino)propan-2-ol Chemical compound CC(C)NCC(O)COC1=NC=C(CCN)C=C1Cl QSFSPKYABJTXGE-UHFFFAOYSA-N 0.000 description 2
- ANAKIMLMTXAAJA-UHFFFAOYSA-N 1-[5-(aminomethyl)pyridin-2-yl]oxy-3-(propan-2-ylamino)propan-2-ol Chemical compound CC(C)NCC(O)COC1=CC=C(CN)C=N1 ANAKIMLMTXAAJA-UHFFFAOYSA-N 0.000 description 2
- BBMCTIGTTCKYKF-UHFFFAOYSA-N 1-heptanol Chemical compound CCCCCCCO BBMCTIGTTCKYKF-UHFFFAOYSA-N 0.000 description 2
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 2
- WSNDAYQNZRJGMJ-UHFFFAOYSA-N 2,2,2-trifluoroethanone Chemical compound FC(F)(F)[C]=O WSNDAYQNZRJGMJ-UHFFFAOYSA-N 0.000 description 2
- MTLHVHGYDLIHHB-UHFFFAOYSA-N 2,3-dichloro-5-(oxan-2-yloxymethyl)pyridine Chemical compound N1=C(Cl)C(Cl)=CC(COC2OCCCC2)=C1 MTLHVHGYDLIHHB-UHFFFAOYSA-N 0.000 description 2
- IMCQXCPTQKOHCY-UHFFFAOYSA-N 2,3-dichloro-5-methylpyrazine Chemical compound CC1=CN=C(Cl)C(Cl)=N1 IMCQXCPTQKOHCY-UHFFFAOYSA-N 0.000 description 2
- DSJPCYWXUGROQW-UHFFFAOYSA-N 2-(6-chloropyridin-3-yl)ethanamine Chemical compound NCCC1=CC=C(Cl)N=C1 DSJPCYWXUGROQW-UHFFFAOYSA-N 0.000 description 2
- PZSISEFPCYMBDL-UHFFFAOYSA-N 2-bromo-3-methylpyridine Chemical compound CC1=CC=CN=C1Br PZSISEFPCYMBDL-UHFFFAOYSA-N 0.000 description 2
- ABJWQHGKWAUOBU-UHFFFAOYSA-N 2-chloro-3-(2-methoxyethoxy)pyrazine Chemical compound COCCOC1=NC=CN=C1Cl ABJWQHGKWAUOBU-UHFFFAOYSA-N 0.000 description 2
- UENWVFNBHFTLHK-UHFFFAOYSA-N 2-chloro-5-(2-methoxyethyl)pyrimidine Chemical compound COCCC1=CN=C(Cl)N=C1 UENWVFNBHFTLHK-UHFFFAOYSA-N 0.000 description 2
- VVXXREZPSINGBU-UHFFFAOYSA-N 2-chloro-5-(methylsulfanylmethyl)pyrimidine Chemical compound CSCC1=CN=C(Cl)N=C1 VVXXREZPSINGBU-UHFFFAOYSA-N 0.000 description 2
- OSKQRHCKRSMITJ-UHFFFAOYSA-N 2-chloro-6-phenylmethoxypyridine Chemical compound ClC1=CC=CC(OCC=2C=CC=CC=2)=N1 OSKQRHCKRSMITJ-UHFFFAOYSA-N 0.000 description 2
- AYVCBWUBNKVPAF-UHFFFAOYSA-N 2-chloro-n-hexylpyrimidine-5-carboxamide Chemical compound CCCCCCNC(=O)C1=CN=C(Cl)N=C1 AYVCBWUBNKVPAF-UHFFFAOYSA-N 0.000 description 2
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 2
- AXOQSSFFNWPYBW-UHFFFAOYSA-N 2-methyl-1-oxido-5-(oxiran-2-ylmethoxy)pyridin-1-ium Chemical compound C1=[N+]([O-])C(C)=CC=C1OCC1OC1 AXOQSSFFNWPYBW-UHFFFAOYSA-N 0.000 description 2
- HLTDBMHJSBSAOM-UHFFFAOYSA-N 2-nitropyridine Chemical compound [O-][N+](=O)C1=CC=CC=N1 HLTDBMHJSBSAOM-UHFFFAOYSA-N 0.000 description 2
- WRMNZCZEMHIOCP-UHFFFAOYSA-N 2-phenylethanol Chemical compound OCCC1=CC=CC=C1 WRMNZCZEMHIOCP-UHFFFAOYSA-N 0.000 description 2
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 2
- CGBQPTYOFPMKAL-UHFFFAOYSA-N 3-(benzylamino)propane-1,2-diol Chemical compound OCC(O)CNCC1=CC=CC=C1 CGBQPTYOFPMKAL-UHFFFAOYSA-N 0.000 description 2
- VHCWENVIQSXOQV-UHFFFAOYSA-N 3-chloro-n-propan-2-ylpyrazin-2-amine Chemical compound CC(C)NC1=NC=CN=C1Cl VHCWENVIQSXOQV-UHFFFAOYSA-N 0.000 description 2
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 2
- YRDPGBRDUTZTFI-UHFFFAOYSA-N 3-pyrimidin-2-yloxypropane-1,2-diol Chemical compound OCC(O)COC1=NC=CC=N1 YRDPGBRDUTZTFI-UHFFFAOYSA-N 0.000 description 2
- KBVRMHYXYDCRNR-UHFFFAOYSA-N 4-(3-prop-2-enoxypyrazin-2-yl)morpholine Chemical compound C=CCOC1=NC=CN=C1N1CCOCC1 KBVRMHYXYDCRNR-UHFFFAOYSA-N 0.000 description 2
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 2
- PXACTUVBBMDKRW-UHFFFAOYSA-N 4-bromobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Br)C=C1 PXACTUVBBMDKRW-UHFFFAOYSA-N 0.000 description 2
- FFSZVTIOFCMLGM-UHFFFAOYSA-N 4-pyrazin-2-ylmorpholine Chemical compound C1COCCN1C1=CN=CC=N1 FFSZVTIOFCMLGM-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- QOCRLBXEJHKBHV-UHFFFAOYSA-N 5,6-dichloro-n-methylpyridine-3-carboxamide Chemical compound CNC(=O)C1=CN=C(Cl)C(Cl)=C1 QOCRLBXEJHKBHV-UHFFFAOYSA-N 0.000 description 2
- QDSSSYJCTRKILR-UHFFFAOYSA-N 5-(2-methoxyethyl)-1h-pyrimidine-2,4-dione Chemical compound COCCC1=CNC(=O)NC1=O QDSSSYJCTRKILR-UHFFFAOYSA-N 0.000 description 2
- YLMMYIIRADIZJQ-UHFFFAOYSA-N 5-(methylsulfanylmethyl)-1h-pyrimidine-2,4-dione Chemical compound CSCC1=CNC(=O)NC1=O YLMMYIIRADIZJQ-UHFFFAOYSA-N 0.000 description 2
- NNTYODUTRIRVKT-UHFFFAOYSA-N 5-[(6-methylpyridin-3-yl)oxymethyl]-3-propan-2-yl-1,3-oxazolidin-2-one Chemical compound O1C(=O)N(C(C)C)CC1COC1=CC=C(C)N=C1 NNTYODUTRIRVKT-UHFFFAOYSA-N 0.000 description 2
- OLTRUTPHSBQWAZ-UHFFFAOYSA-N 5-chloro-6-oxo-1h-pyridine-3-carboxylic acid Chemical compound OC(=O)C1=CNC(=O)C(Cl)=C1 OLTRUTPHSBQWAZ-UHFFFAOYSA-N 0.000 description 2
- DEYOMDZKXMQLCF-UHFFFAOYSA-N 6-chloro-n-methylpyridine-3-carboxamide Chemical compound CNC(=O)C1=CC=C(Cl)N=C1 DEYOMDZKXMQLCF-UHFFFAOYSA-N 0.000 description 2
- DHLUJPLHLZJUBW-UHFFFAOYSA-N 6-methylpyridin-3-ol Chemical compound CC1=CC=C(O)C=N1 DHLUJPLHLZJUBW-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- 229910000497 Amalgam Inorganic materials 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Natural products OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- DCERHCFNWRGHLK-UHFFFAOYSA-N C[Si](C)C Chemical compound C[Si](C)C DCERHCFNWRGHLK-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- 229910021554 Chromium(II) chloride Inorganic materials 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical class OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- 229910001297 Zn alloy Inorganic materials 0.000 description 2
- JFKSZDFCECTMSZ-UHFFFAOYSA-N [2-hydroxy-3-(2-methoxypyridin-3-yl)oxypropyl] methanesulfonate Chemical compound COC1=NC=CC=C1OCC(O)COS(C)(=O)=O JFKSZDFCECTMSZ-UHFFFAOYSA-N 0.000 description 2
- HGZUJEXEMDUYCJ-UHFFFAOYSA-N [2-phenyl-3-(4-phenylbutan-2-yl)-1,3-oxazolidin-5-yl]methanol Chemical compound C1C(CO)OC(C=2C=CC=CC=2)N1C(C)CCC1=CC=CC=C1 HGZUJEXEMDUYCJ-UHFFFAOYSA-N 0.000 description 2
- 150000001242 acetic acid derivatives Chemical class 0.000 description 2
- WDNIVTZNAPEMHF-UHFFFAOYSA-N acetic acid;chromium Chemical compound [Cr].CC(O)=O.CC(O)=O WDNIVTZNAPEMHF-UHFFFAOYSA-N 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 150000004703 alkoxides Chemical class 0.000 description 2
- 125000004849 alkoxymethyl group Chemical group 0.000 description 2
- 125000005037 alkyl phenyl group Chemical group 0.000 description 2
- 125000001118 alkylidene group Chemical group 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 2
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 2
- 229910001863 barium hydroxide Inorganic materials 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 239000002876 beta blocker Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 230000036772 blood pressure Effects 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- NRDQFWXVTPZZAZ-UHFFFAOYSA-N butyl carbonochloridate Chemical compound CCCCOC(Cl)=O NRDQFWXVTPZZAZ-UHFFFAOYSA-N 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- XBWRJSSJWDOUSJ-UHFFFAOYSA-L chromium(ii) chloride Chemical compound Cl[Cr]Cl XBWRJSSJWDOUSJ-UHFFFAOYSA-L 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 239000008119 colloidal silica Substances 0.000 description 2
- ATDGTVJJHBUTRL-UHFFFAOYSA-N cyanogen bromide Chemical compound BrC#N ATDGTVJJHBUTRL-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 2
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 2
- HYYWMBIWYPMBGO-UHFFFAOYSA-N ethyl 4-chloro-2-(dimethylamino)pyrimidine-5-carboxylate Chemical compound CCOC(=O)C1=CN=C(N(C)C)N=C1Cl HYYWMBIWYPMBGO-UHFFFAOYSA-N 0.000 description 2
- 125000006260 ethylaminocarbonyl group Chemical group [H]N(C(*)=O)C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000006351 ethylthiomethyl group Chemical group [H]C([H])([H])C([H])([H])SC([H])([H])* 0.000 description 2
- YOMFVLRTMZWACQ-UHFFFAOYSA-N ethyltrimethylammonium Chemical group CC[N+](C)(C)C YOMFVLRTMZWACQ-UHFFFAOYSA-N 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000005187 foaming Methods 0.000 description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 125000005446 heptyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 229910001092 metal group alloy Inorganic materials 0.000 description 2
- 229910052987 metal hydride Inorganic materials 0.000 description 2
- 150000004681 metal hydrides Chemical class 0.000 description 2
- 125000005394 methallyl group Chemical group 0.000 description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 2
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 2
- 125000004458 methylaminocarbonyl group Chemical group [H]N(C(*)=O)C([H])([H])[H] 0.000 description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 2
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 description 2
- 229910000510 noble metal Inorganic materials 0.000 description 2
- LEVJVKGPFAQPOI-UHFFFAOYSA-N phenylmethanone Chemical compound O=[C]C1=CC=CC=C1 LEVJVKGPFAQPOI-UHFFFAOYSA-N 0.000 description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical group CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- HYHBKLWDTGTBME-UHFFFAOYSA-N pyrazin-1-ium;chloride Chemical compound Cl.C1=CN=CC=N1 HYHBKLWDTGTBME-UHFFFAOYSA-N 0.000 description 2
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical group C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 230000006794 tachycardia Effects 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 235000012222 talc Nutrition 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- NHGXDBSUJJNIRV-UHFFFAOYSA-M tetrabutylammonium chloride Chemical compound [Cl-].CCCC[N+](CCCC)(CCCC)CCCC NHGXDBSUJJNIRV-UHFFFAOYSA-M 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- 150000004886 thiomorpholines Chemical class 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- IFKPPSPIASUCKW-UHFFFAOYSA-N (2-hydroxy-3-pyrimidin-2-yloxypropyl) 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCC(O)COC1=NC=CC=N1 IFKPPSPIASUCKW-UHFFFAOYSA-N 0.000 description 1
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- AAWZDTNXLSGCEK-LNVDRNJUSA-N (3r,5r)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid Chemical compound O[C@@H]1CC(O)(C(O)=O)C[C@@H](O)C1O AAWZDTNXLSGCEK-LNVDRNJUSA-N 0.000 description 1
- RTBJVGAYBAXVPG-UHFFFAOYSA-N (E)-but-2-enedioic acid pyrazine Chemical compound C(C=CC(=O)O)(=O)O.N1=CC=NC=C1 RTBJVGAYBAXVPG-UHFFFAOYSA-N 0.000 description 1
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- FDLWUMHOQZOVMK-WLHGVMLRSA-N (e)-but-2-enedioic acid;1-(3-ethylsulfanylpyrazin-2-yl)oxy-3-(propan-2-ylamino)propan-2-ol Chemical compound OC(=O)\C=C\C(O)=O.CCSC1=NC=CN=C1OCC(O)CNC(C)C FDLWUMHOQZOVMK-WLHGVMLRSA-N 0.000 description 1
- PIINXYKJQGMIOZ-UHFFFAOYSA-N 1,2-dipyridin-2-ylethane-1,2-dione Chemical class C=1C=CC=NC=1C(=O)C(=O)C1=CC=CC=N1 PIINXYKJQGMIOZ-UHFFFAOYSA-N 0.000 description 1
- BTKUTTPFFPCUJO-UHFFFAOYSA-N 1-(2-methoxypyridin-3-yl)oxy-3-(propan-2-ylamino)propan-2-ol Chemical compound COC1=NC=CC=C1OCC(O)CNC(C)C BTKUTTPFFPCUJO-UHFFFAOYSA-N 0.000 description 1
- IJCXFHZIKSVEQJ-UHFFFAOYSA-N 1-(3,5-dimethylpyridin-2-yl)oxy-3-(propan-2-ylamino)propan-2-ol Chemical compound CC(C)NCC(O)COC1=NC=C(C)C=C1C IJCXFHZIKSVEQJ-UHFFFAOYSA-N 0.000 description 1
- AYYQCEWAHJYCEM-UHFFFAOYSA-N 1-(3-chloro-6-methylpyrazin-2-yl)oxy-3-(propan-2-ylamino)propan-2-ol Chemical compound CC(C)NCC(O)COC1=NC(C)=CN=C1Cl AYYQCEWAHJYCEM-UHFFFAOYSA-N 0.000 description 1
- QTJMVXXYIVINBY-UHFFFAOYSA-N 1-(3-methylpyridin-2-yl)oxy-3-(4-phenylbutan-2-ylamino)propan-2-ol Chemical compound N=1C=CC=C(C)C=1OCC(O)CNC(C)CCC1=CC=CC=C1 QTJMVXXYIVINBY-UHFFFAOYSA-N 0.000 description 1
- OUFJLVYYQGISBX-UHFFFAOYSA-N 1-(3-methylpyridin-4-yl)oxy-3-(propan-2-ylamino)propan-2-ol Chemical compound CC(C)NCC(O)COC1=CC=NC=C1C OUFJLVYYQGISBX-UHFFFAOYSA-N 0.000 description 1
- AOZADRZLLPNIMX-UHFFFAOYSA-N 1-(3-nitropyridin-2-yl)oxy-3-(propan-2-ylamino)propan-2-ol Chemical compound CC(C)NCC(O)COC1=NC=CC=C1[N+]([O-])=O AOZADRZLLPNIMX-UHFFFAOYSA-N 0.000 description 1
- DPAVHTDJMNFACK-UHFFFAOYSA-N 1-(3-phenylmethoxypyridin-2-yl)oxy-3-(propan-2-ylamino)propan-2-ol Chemical compound CC(C)NCC(O)COC1=NC=CC=C1OCC1=CC=CC=C1 DPAVHTDJMNFACK-UHFFFAOYSA-N 0.000 description 1
- HNJBDMHPEGJVAT-UHFFFAOYSA-N 1-(4-phenylpyridin-2-yl)oxy-3-(propan-2-ylamino)propan-2-ol Chemical compound C1=NC(OCC(O)CNC(C)C)=CC(C=2C=CC=CC=2)=C1 HNJBDMHPEGJVAT-UHFFFAOYSA-N 0.000 description 1
- WOBBZWRNKYYORA-UHFFFAOYSA-N 1-(5-nitropyridin-2-yl)oxy-3-(propan-2-ylamino)propan-2-ol Chemical compound CC(C)NCC(O)COC1=CC=C([N+]([O-])=O)C=N1 WOBBZWRNKYYORA-UHFFFAOYSA-N 0.000 description 1
- DDLBJELFJIDIPX-UHFFFAOYSA-N 1-(5-phenylpyrimidin-2-yl)oxy-3-(propan-2-ylamino)propan-2-ol Chemical compound C1=NC(OCC(O)CNC(C)C)=NC=C1C1=CC=CC=C1 DDLBJELFJIDIPX-UHFFFAOYSA-N 0.000 description 1
- NAZGDYNXGGZZTB-UHFFFAOYSA-N 1-(6-chloropyridazin-3-yl)oxy-3-(propan-2-ylamino)propan-2-ol Chemical compound CC(C)NCC(O)COC1=CC=C(Cl)N=N1 NAZGDYNXGGZZTB-UHFFFAOYSA-N 0.000 description 1
- OHNHZYKNSSTWFO-UHFFFAOYSA-N 1-(6-methyl-1-oxidopyridin-1-ium-3-yl)oxy-3-(propan-2-ylamino)propan-2-ol Chemical compound CC(C)NCC(O)COC1=CC=C(C)[N+]([O-])=C1 OHNHZYKNSSTWFO-UHFFFAOYSA-N 0.000 description 1
- IICRKRJZOMSZBH-UHFFFAOYSA-N 1-(6-methylpyrazin-2-yl)oxy-3-(propan-2-ylamino)propan-2-ol Chemical compound CC(C)NCC(O)COC1=CN=CC(C)=N1 IICRKRJZOMSZBH-UHFFFAOYSA-N 0.000 description 1
- GAQXHDOWYHYFPT-UHFFFAOYSA-N 1-(6-methylpyridin-3-yl)oxy-3-(propan-2-ylamino)propan-2-ol Chemical compound CC(C)NCC(O)COC1=CC=C(C)N=C1 GAQXHDOWYHYFPT-UHFFFAOYSA-N 0.000 description 1
- PRPNJYMSACFKCY-UHFFFAOYSA-N 1-(6-morpholin-4-ylpyridazin-3-yl)oxy-3-(propan-2-ylamino)propan-2-ol Chemical compound N1=NC(OCC(O)CNC(C)C)=CC=C1N1CCOCC1 PRPNJYMSACFKCY-UHFFFAOYSA-N 0.000 description 1
- USBPHEYEVXOKTK-UHFFFAOYSA-N 1-(6-phenylmethoxypyridin-2-yl)oxy-3-(propan-2-ylamino)propan-2-ol Chemical compound CC(C)NCC(O)COC1=CC=CC(OCC=2C=CC=CC=2)=N1 USBPHEYEVXOKTK-UHFFFAOYSA-N 0.000 description 1
- FCHHWNIIBDEKBS-UHFFFAOYSA-N 1-(propan-2-ylamino)-3-pyridazin-3-yloxypropan-2-ol Chemical compound CC(C)NCC(O)COC1=CC=CN=N1 FCHHWNIIBDEKBS-UHFFFAOYSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- SIYWAZSQIOMKTM-UHFFFAOYSA-N 1-[3-(dimethylamino)pyridin-2-yl]oxy-3-(propan-2-ylamino)propan-2-ol Chemical compound CC(C)NCC(O)COC1=NC=CC=C1N(C)C SIYWAZSQIOMKTM-UHFFFAOYSA-N 0.000 description 1
- YBWIBKZIWKITRS-UHFFFAOYSA-N 1-[3-chloro-5-(2-methoxyethyl)pyridin-2-yl]oxy-3-(propan-2-ylamino)propan-2-ol Chemical compound COCCC1=CN=C(OCC(O)CNC(C)C)C(Cl)=C1 YBWIBKZIWKITRS-UHFFFAOYSA-N 0.000 description 1
- MCKZXOLGMUVKQH-UHFFFAOYSA-N 1-[3-chloro-5-(hydroxymethyl)pyridin-2-yl]oxy-3-(propan-2-ylamino)propan-2-ol Chemical compound CC(C)NCC(O)COC1=NC=C(CO)C=C1Cl MCKZXOLGMUVKQH-UHFFFAOYSA-N 0.000 description 1
- WPQMAEQVHGHGBK-UHFFFAOYSA-N 1-bromo-3-(3-chloropyrazin-2-yl)oxypropan-2-ol Chemical compound BrCC(O)COC1=NC=CN=C1Cl WPQMAEQVHGHGBK-UHFFFAOYSA-N 0.000 description 1
- ZCQQCKNDSJPRQD-UHFFFAOYSA-N 1-bromo-3-[5-bromo-3-(propan-2-ylamino)pyrazin-2-yl]oxypropan-2-ol Chemical compound CC(C)NC1=NC(Br)=CN=C1OCC(O)CBr ZCQQCKNDSJPRQD-UHFFFAOYSA-N 0.000 description 1
- LDKSCZJUIURGMW-UHFFFAOYSA-N 1-isothiocyanato-3-methylsulfanylpropane Chemical group CSCCCN=C=S LDKSCZJUIURGMW-UHFFFAOYSA-N 0.000 description 1
- JQCSUVJDBHJKNG-UHFFFAOYSA-N 1-methoxy-ethyl Chemical group C[CH]OC JQCSUVJDBHJKNG-UHFFFAOYSA-N 0.000 description 1
- XSGMJDQRZDWEPW-UHFFFAOYSA-N 1-propan-2-ylazetidin-3-ol Chemical compound CC(C)N1CC(O)C1 XSGMJDQRZDWEPW-UHFFFAOYSA-N 0.000 description 1
- FZKCAHQKNJXICB-UHFFFAOYSA-N 2,1-benzoxazole Chemical compound C1=CC=CC2=CON=C21 FZKCAHQKNJXICB-UHFFFAOYSA-N 0.000 description 1
- XJCSQVBPRZIYPY-UHFFFAOYSA-N 2,3-dichloro-5-(chloromethyl)pyridine Chemical compound ClCC1=CN=C(Cl)C(Cl)=C1 XJCSQVBPRZIYPY-UHFFFAOYSA-N 0.000 description 1
- MAKFMOSBBNKPMS-UHFFFAOYSA-N 2,3-dichloropyridine Chemical compound ClC1=CC=CN=C1Cl MAKFMOSBBNKPMS-UHFFFAOYSA-N 0.000 description 1
- FILKGCRCWDMBKA-UHFFFAOYSA-N 2,6-dichloropyridine Chemical compound ClC1=CC=CC(Cl)=N1 FILKGCRCWDMBKA-UHFFFAOYSA-N 0.000 description 1
- JHMHYTKDALCQSZ-UHFFFAOYSA-N 2,6-dichloropyridine-3-carbonyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)N=C1Cl JHMHYTKDALCQSZ-UHFFFAOYSA-N 0.000 description 1
- GTAAJKZPDFSKSG-UHFFFAOYSA-N 2-(2,4-dioxo-1h-pyrimidin-5-yl)ethyl methanesulfonate Chemical compound CS(=O)(=O)OCCC1=CNC(=O)NC1=O GTAAJKZPDFSKSG-UHFFFAOYSA-N 0.000 description 1
- MARLAZIAHQMSOL-UHFFFAOYSA-N 2-(2-methoxyethoxy)pyrazine Chemical compound COCCOC1=CN=CC=N1 MARLAZIAHQMSOL-UHFFFAOYSA-N 0.000 description 1
- WQZMGKXBEWNAFP-UHFFFAOYSA-N 2-(5,6-dichloropyridin-3-yl)acetonitrile Chemical compound ClC1=CC(CC#N)=CN=C1Cl WQZMGKXBEWNAFP-UHFFFAOYSA-N 0.000 description 1
- OKDLTWMZYCMTOL-UHFFFAOYSA-N 2-(5,6-dichloropyridin-3-yl)ethanamine Chemical compound NCCC1=CN=C(Cl)C(Cl)=C1 OKDLTWMZYCMTOL-UHFFFAOYSA-N 0.000 description 1
- YNLWLBAHWMOFBQ-UHFFFAOYSA-N 2-(6-methoxypyridin-3-yl)ethanamine Chemical compound COC1=CC=C(CCN)C=N1 YNLWLBAHWMOFBQ-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- HUTCIVHVJJFXFN-UHFFFAOYSA-N 2-[2-hydroxy-3-(propan-2-ylamino)propoxy]-6-methylpyridin-3-ol Chemical compound CC(C)NCC(O)COC1=NC(C)=CC=C1O HUTCIVHVJJFXFN-UHFFFAOYSA-N 0.000 description 1
- KRIILKQTJUOQCJ-UHFFFAOYSA-N 2-bromo-4-phenylpyridine Chemical compound C1=NC(Br)=CC(C=2C=CC=CC=2)=C1 KRIILKQTJUOQCJ-UHFFFAOYSA-N 0.000 description 1
- JUSXLWAFYVKNLT-UHFFFAOYSA-N 2-bromobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1Br JUSXLWAFYVKNLT-UHFFFAOYSA-N 0.000 description 1
- 125000000143 2-carboxyethyl group Chemical group [H]OC(=O)C([H])([H])C([H])([H])* 0.000 description 1
- RKVUCIFREKHYTL-UHFFFAOYSA-N 2-chloro-3-methylpyridine Chemical compound CC1=CC=CN=C1Cl RKVUCIFREKHYTL-UHFFFAOYSA-N 0.000 description 1
- SOOAQIWRVFCPAP-UHFFFAOYSA-N 2-chloro-3-prop-2-enoxypyrazine Chemical compound ClC1=NC=CN=C1OCC=C SOOAQIWRVFCPAP-UHFFFAOYSA-N 0.000 description 1
- MZVSTDHRRYQFGI-UHFFFAOYSA-N 2-chloro-4-methylpyridine Chemical compound CC1=CC=NC(Cl)=C1 MZVSTDHRRYQFGI-UHFFFAOYSA-N 0.000 description 1
- BAZVFQBTJPBRTJ-UHFFFAOYSA-N 2-chloro-5-nitropyridine Chemical compound [O-][N+](=O)C1=CC=C(Cl)N=C1 BAZVFQBTJPBRTJ-UHFFFAOYSA-N 0.000 description 1
- VAVGOGHLNAJECD-UHFFFAOYSA-N 2-chloro-6-methoxypyridine Chemical compound COC1=CC=CC(Cl)=N1 VAVGOGHLNAJECD-UHFFFAOYSA-N 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- QJQZRLXDLORINA-UHFFFAOYSA-N 2-cyclohexylethanol Chemical compound OCCC1CCCCC1 QJQZRLXDLORINA-UHFFFAOYSA-N 0.000 description 1
- OPLMEXKOTKLLHE-UHFFFAOYSA-N 2-methyl-5-(oxiran-2-ylmethoxy)pyridine Chemical compound C1=NC(C)=CC=C1OCC1OC1 OPLMEXKOTKLLHE-UHFFFAOYSA-N 0.000 description 1
- XWKFPIODWVPXLX-UHFFFAOYSA-N 2-methyl-5-methylpyridine Natural products CC1=CC=C(C)N=C1 XWKFPIODWVPXLX-UHFFFAOYSA-N 0.000 description 1
- DYEWWMLKQRTCII-UHFFFAOYSA-N 2-nitro-3-phenylmethoxypyridine Chemical compound [O-][N+](=O)C1=NC=CC=C1OCC1=CC=CC=C1 DYEWWMLKQRTCII-UHFFFAOYSA-N 0.000 description 1
- SZFHAHACWVROGM-UHFFFAOYSA-N 2-phenyl-1,3-oxazolidine Chemical compound N1CCOC1C1=CC=CC=C1 SZFHAHACWVROGM-UHFFFAOYSA-N 0.000 description 1
- SDXAWLJRERMRKF-UHFFFAOYSA-N 3,5-dimethyl-1h-pyrazole Chemical compound CC=1C=C(C)NN=1 SDXAWLJRERMRKF-UHFFFAOYSA-N 0.000 description 1
- NOLMDTMFZHUFNI-UHFFFAOYSA-N 3-(2-methoxypyridin-3-yl)oxypropane-1,2-diol Chemical compound COC1=NC=CC=C1OCC(O)CO NOLMDTMFZHUFNI-UHFFFAOYSA-N 0.000 description 1
- WWAOSMWRXUSCOZ-UHFFFAOYSA-N 3-(3-chloropyridin-2-yl)oxypropane-1,2-diol Chemical compound OCC(O)COC1=NC=CC=C1Cl WWAOSMWRXUSCOZ-UHFFFAOYSA-N 0.000 description 1
- OYOQJUBQXIJGFR-UHFFFAOYSA-N 3-chloro-n,n-dimethylpyrazin-2-amine Chemical compound CN(C)C1=NC=CN=C1Cl OYOQJUBQXIJGFR-UHFFFAOYSA-N 0.000 description 1
- QBPDSKPWYWIHGA-UHFFFAOYSA-N 3-hydroxy-2-nitropyridine Chemical compound OC1=CC=CN=C1[N+]([O-])=O QBPDSKPWYWIHGA-UHFFFAOYSA-N 0.000 description 1
- LSXHCFSGOBFNDX-UHFFFAOYSA-N 3-methoxy-2-nitropyridine Chemical compound COC1=CC=CN=C1[N+]([O-])=O LSXHCFSGOBFNDX-UHFFFAOYSA-N 0.000 description 1
- MOQVHOPVBREXLY-UHFFFAOYSA-N 3h-dioxol-4-ylmethanol Chemical compound OCC1=COOC1 MOQVHOPVBREXLY-UHFFFAOYSA-N 0.000 description 1
- XJPZKYIHCLDXST-UHFFFAOYSA-N 4,6-dichloropyrimidine Chemical compound ClC1=CC(Cl)=NC=N1 XJPZKYIHCLDXST-UHFFFAOYSA-N 0.000 description 1
- OWQYAKLAVISYKC-UHFFFAOYSA-N 4-(3-chloro-6-methylpyrazin-2-yl)morpholine Chemical compound CC1=CN=C(Cl)C(N2CCOCC2)=N1 OWQYAKLAVISYKC-UHFFFAOYSA-N 0.000 description 1
- QDXCFLKGKSWHMI-UHFFFAOYSA-N 4-(6-chloropyridazin-3-yl)morpholine Chemical compound N1=NC(Cl)=CC=C1N1CCOCC1 QDXCFLKGKSWHMI-UHFFFAOYSA-N 0.000 description 1
- QISOBCMNUJQOJU-UHFFFAOYSA-N 4-bromo-1h-pyrazole-5-carboxylic acid Chemical compound OC(=O)C=1NN=CC=1Br QISOBCMNUJQOJU-UHFFFAOYSA-N 0.000 description 1
- ZPSYDWVKMBOSCI-UHFFFAOYSA-N 4-chloro-2-ethylpyrimidine Chemical compound CCC1=NC=CC(Cl)=N1 ZPSYDWVKMBOSCI-UHFFFAOYSA-N 0.000 description 1
- DFOHHQRGDOQMKG-UHFFFAOYSA-N 4-chloro-2-methylsulfanylpyrimidine Chemical compound CSC1=NC=CC(Cl)=N1 DFOHHQRGDOQMKG-UHFFFAOYSA-N 0.000 description 1
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 description 1
- PXYVNTRVKCTRCO-UHFFFAOYSA-N 5,6-dichloro-n-hexylpyridine-3-carboxamide Chemical compound CCCCCCNC(=O)C1=CN=C(Cl)C(Cl)=C1 PXYVNTRVKCTRCO-UHFFFAOYSA-N 0.000 description 1
- PKGGFQFESLZUMN-UHFFFAOYSA-N 5-[(6-methyl-1-oxidopyridin-1-ium-3-yl)oxymethyl]-3-propan-2-yl-1,3-oxazolidin-2-one Chemical compound O1C(=O)N(C(C)C)CC1COC1=CC=C(C)[N+]([O-])=C1 PKGGFQFESLZUMN-UHFFFAOYSA-N 0.000 description 1
- BPNCSGUMGMVACS-UHFFFAOYSA-N 5-ethyl-1h-pyrimidin-6-one Chemical compound CCC1=CN=CNC1=O BPNCSGUMGMVACS-UHFFFAOYSA-N 0.000 description 1
- JDBGXEHEIRGOBU-UHFFFAOYSA-N 5-hydroxymethyluracil Chemical compound OCC1=CNC(=O)NC1=O JDBGXEHEIRGOBU-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- MAQAGRJURDEYDQ-UHFFFAOYSA-N 6-methylpyridine Chemical compound CC1=C=CC=C[N]1 MAQAGRJURDEYDQ-UHFFFAOYSA-N 0.000 description 1
- OMIHGPLIXGGMJB-UHFFFAOYSA-N 7-oxabicyclo[4.1.0]hepta-1,3,5-triene Chemical compound C1=CC=C2OC2=C1 OMIHGPLIXGGMJB-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- ZVLYUNPAOYVHAE-UHFFFAOYSA-N BrCC(COC1=NC=CN=C1)O Chemical compound BrCC(COC1=NC=CN=C1)O ZVLYUNPAOYVHAE-UHFFFAOYSA-N 0.000 description 1
- 208000009079 Bronchial Spasm Diseases 0.000 description 1
- 208000014181 Bronchial disease Diseases 0.000 description 1
- 206010006482 Bronchospasm Diseases 0.000 description 1
- ZNUQLGRLMDQIID-UHFFFAOYSA-N C1=CN=CN=C1.OC(=O)C=CC(O)=O Chemical compound C1=CN=CN=C1.OC(=O)C=CC(O)=O ZNUQLGRLMDQIID-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 235000005979 Citrus limon Nutrition 0.000 description 1
- 244000248349 Citrus limon Species 0.000 description 1
- AAWZDTNXLSGCEK-UHFFFAOYSA-N Cordycepinsaeure Natural products OC1CC(O)(C(O)=O)CC(O)C1O AAWZDTNXLSGCEK-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- WZKSXHQDXQKIQJ-UHFFFAOYSA-N F[C](F)F Chemical compound F[C](F)F WZKSXHQDXQKIQJ-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- CTKINSOISVBQLD-UHFFFAOYSA-N Glycidol Chemical compound OCC1CO1 CTKINSOISVBQLD-UHFFFAOYSA-N 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 235000011430 Malus pumila Nutrition 0.000 description 1
- 235000015103 Malus silvestris Nutrition 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- BHKDKKZMPODMIQ-UHFFFAOYSA-N N-[5-cyano-4-(2-methoxyethylamino)pyridin-2-yl]-7-formyl-6-[(4-methyl-2-oxopiperazin-1-yl)methyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide Chemical compound COCCNc1cc(NC(=O)N2CCCc3cc(CN4CCN(C)CC4=O)c(C=O)nc23)ncc1C#N BHKDKKZMPODMIQ-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 239000004264 Petrolatum Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- AAWZDTNXLSGCEK-ZHQZDSKASA-N Quinic acid Natural products O[C@H]1CC(O)(C(O)=O)C[C@H](O)C1O AAWZDTNXLSGCEK-ZHQZDSKASA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 239000002262 Schiff base Substances 0.000 description 1
- 150000004753 Schiff bases Chemical class 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- YPWFISCTZQNZAU-UHFFFAOYSA-N Thiane Chemical compound C1CCSCC1 YPWFISCTZQNZAU-UHFFFAOYSA-N 0.000 description 1
- OTMXEQKCWAISIR-UHFFFAOYSA-N [3-(3-chloropyridin-2-yl)oxy-2-hydroxypropyl] methanesulfonate Chemical compound CS(=O)(=O)OCC(O)COC1=NC=CC=C1Cl OTMXEQKCWAISIR-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 150000008063 acylals Chemical class 0.000 description 1
- 230000002730 additional effect Effects 0.000 description 1
- 230000001800 adrenalinergic effect Effects 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 238000007098 aminolysis reaction Methods 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 206010003119 arrhythmia Diseases 0.000 description 1
- 230000004872 arterial blood pressure Effects 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 125000000649 benzylidene group Chemical group [H]C(=[*])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- ITQTTZVARXURQS-UHFFFAOYSA-N beta-methylpyridine Natural products CC1=CC=CN=C1 ITQTTZVARXURQS-UHFFFAOYSA-N 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000006630 butoxycarbonylamino group Chemical group 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 229950005499 carbon tetrachloride Drugs 0.000 description 1
- 150000001727 carbonic acid monoesters Chemical class 0.000 description 1
- MOIPGXQKZSZOQX-UHFFFAOYSA-N carbonyl bromide Chemical compound BrC(Br)=O MOIPGXQKZSZOQX-UHFFFAOYSA-N 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000002368 cardiac glycoside Substances 0.000 description 1
- 229940097217 cardiac glycoside Drugs 0.000 description 1
- 239000000496 cardiotonic agent Substances 0.000 description 1
- 230000003177 cardiotonic effect Effects 0.000 description 1
- 210000000748 cardiovascular system Anatomy 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical class OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- QSKWJTXWJJOJFP-UHFFFAOYSA-N chloroform;ethoxyethane Chemical compound ClC(Cl)Cl.CCOCC QSKWJTXWJJOJFP-UHFFFAOYSA-N 0.000 description 1
- 235000012000 cholesterol Nutrition 0.000 description 1
- UZEDIBTVIIJELN-UHFFFAOYSA-N chromium(2+) Chemical class [Cr+2] UZEDIBTVIIJELN-UHFFFAOYSA-N 0.000 description 1
- 230000002057 chronotropic effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 229940109275 cyclamate Drugs 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- QCRFMSUKWRQZEM-UHFFFAOYSA-N cycloheptanol Chemical compound OC1CCCCCC1 QCRFMSUKWRQZEM-UHFFFAOYSA-N 0.000 description 1
- BMCQFFXPECPDPS-UHFFFAOYSA-N cycloheptylmethanol Chemical compound OCC1CCCCCC1 BMCQFFXPECPDPS-UHFFFAOYSA-N 0.000 description 1
- WACQKHWOTAEEFS-UHFFFAOYSA-N cyclohexane;ethyl acetate Chemical compound CCOC(C)=O.C1CCCCC1 WACQKHWOTAEEFS-UHFFFAOYSA-N 0.000 description 1
- VSSAZBXXNIABDN-UHFFFAOYSA-N cyclohexylmethanol Chemical group OCC1CCCCC1 VSSAZBXXNIABDN-UHFFFAOYSA-N 0.000 description 1
- XCIXKGXIYUWCLL-UHFFFAOYSA-N cyclopentanol Chemical compound OC1CCCC1 XCIXKGXIYUWCLL-UHFFFAOYSA-N 0.000 description 1
- ISQVBYGGNVVVHB-UHFFFAOYSA-N cyclopentylmethanol Chemical group OCC1CCCC1 ISQVBYGGNVVVHB-UHFFFAOYSA-N 0.000 description 1
- YOXHCYXIAVIFCZ-UHFFFAOYSA-N cyclopropanol Chemical class OC1CC1 YOXHCYXIAVIFCZ-UHFFFAOYSA-N 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- 125000004915 dibutylamino group Chemical group C(CCC)N(CCCC)* 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- IEJIGPNLZYLLBP-UHFFFAOYSA-N dimethyl carbonate Chemical compound COC(=O)OC IEJIGPNLZYLLBP-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- OAGOUCJGXNLJNL-UHFFFAOYSA-N dimethylcyanamide Chemical compound CN(C)C#N OAGOUCJGXNLJNL-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- XTLNYNMNUCLWEZ-UHFFFAOYSA-N ethanol;propan-2-one Chemical compound CCO.CC(C)=O XTLNYNMNUCLWEZ-UHFFFAOYSA-N 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- HWJHWSBFPPPIPD-UHFFFAOYSA-N ethoxyethane;propan-2-one Chemical compound CC(C)=O.CCOCC HWJHWSBFPPPIPD-UHFFFAOYSA-N 0.000 description 1
- QCIFTCNILVVFLO-UHFFFAOYSA-N ethyl 2-(dimethylamino)-6-oxo-1h-pyrimidine-5-carboxylate Chemical compound CCOC(=O)C1=CN=C(N(C)C)NC1=O QCIFTCNILVVFLO-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- XCDHVLLHTHRGSU-UHFFFAOYSA-N ethyl n-[2-[5-chloro-6-[2-hydroxy-3-(propan-2-ylamino)propoxy]pyridin-3-yl]ethyl]carbamate Chemical compound CCOC(=O)NCCC1=CN=C(OCC(O)CNC(C)C)C(Cl)=C1 XCDHVLLHTHRGSU-UHFFFAOYSA-N 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000005748 halopyridines Chemical class 0.000 description 1
- 150000005694 halopyrimidines Chemical class 0.000 description 1
- 210000002837 heart atrium Anatomy 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 150000002463 imidates Chemical class 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 230000000297 inotrophic effect Effects 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- OSUHWOJYVPZLJL-UHFFFAOYSA-N methyl n-[[6-[2-hydroxy-3-(propan-2-ylamino)propoxy]pyridin-3-yl]methyl]carbamate Chemical compound COC(=O)NCC1=CC=C(OCC(O)CNC(C)C)N=C1 OSUHWOJYVPZLJL-UHFFFAOYSA-N 0.000 description 1
- 150000003956 methylamines Chemical class 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 229940032007 methylethyl ketone Drugs 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 125000004572 morpholin-3-yl group Chemical group N1C(COCC1)* 0.000 description 1
- 210000004165 myocardium Anatomy 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- CSMVTOPTKHUXTG-UHFFFAOYSA-N n-butyl-3-[2-hydroxy-3-(propan-2-ylamino)propoxy]pyridine-2-carboxamide Chemical compound CCCCNC(=O)C1=NC=CC=C1OCC(O)CNC(C)C CSMVTOPTKHUXTG-UHFFFAOYSA-N 0.000 description 1
- 125000004706 n-propylthio group Chemical group C(CC)S* 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 150000004967 organic peroxy acids Chemical class 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 229940066842 petrolatum Drugs 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- 229960003424 phenylacetic acid Drugs 0.000 description 1
- 239000003279 phenylacetic acid Substances 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical class OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 description 1
- HDOWRFHMPULYOA-UHFFFAOYSA-N piperidin-4-ol Chemical compound OC1CCNCC1 HDOWRFHMPULYOA-UHFFFAOYSA-N 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- VKJKEPKFPUWCAS-UHFFFAOYSA-M potassium chlorate Chemical compound [K+].[O-]Cl(=O)=O VKJKEPKFPUWCAS-UHFFFAOYSA-M 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical compound OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 1
- 229940107700 pyruvic acid Drugs 0.000 description 1
- 230000002040 relaxant effect Effects 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 238000009938 salting Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- LFQULJPVXNYWAG-UHFFFAOYSA-N sodium;phenylmethanolate Chemical compound [Na]OCC1=CC=CC=C1 LFQULJPVXNYWAG-UHFFFAOYSA-N 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 229930002534 steroid glycoside Natural products 0.000 description 1
- 150000008143 steroidal glycosides Chemical class 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 238000000967 suction filtration Methods 0.000 description 1
- 229950000244 sulfanilic acid Drugs 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 125000006633 tert-butoxycarbonylamino group Chemical group 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 230000024883 vasodilation Effects 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
- NLVXSWCKKBEXTG-UHFFFAOYSA-N vinylsulfonic acid Chemical compound OS(=O)(=O)C=C NLVXSWCKKBEXTG-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 235000014101 wine Nutrition 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/69—Two or more oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH244473A CH584209A5 (en) | 1973-02-20 | 1973-02-20 | 3-amino-2-hydroxypropoxy substd. diazines and pyridines - with beta-adrenergic blocking or stimulating activity |
| FI193/74A FI60391C (fi) | 1973-02-20 | 1974-01-23 | Analogifoerfarande foer framstaellning av beta-reseptor-aktiva 1-heterocyklyloxi-3-amino-2-propanolfoereningar |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2406930A1 true DE2406930A1 (de) | 1974-08-22 |
Family
ID=25690464
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742406930 Ceased DE2406930A1 (de) | 1973-02-20 | 1974-02-14 | Neue heterocyclische verbindungen und verfahren zu ihrer herstellung |
Country Status (15)
| Country | Link |
|---|---|
| AR (6) | AR208397A1 (enExample) |
| AT (1) | AT335455B (enExample) |
| BE (1) | BE811274A (enExample) |
| CA (1) | CA1027131A (enExample) |
| CS (1) | CS203970B2 (enExample) |
| DD (1) | DD110041A5 (enExample) |
| DE (1) | DE2406930A1 (enExample) |
| DK (1) | DK143501C (enExample) |
| ES (2) | ES446083A1 (enExample) |
| FR (1) | FR2218101B1 (enExample) |
| GB (1) | GB1465946A (enExample) |
| IE (1) | IE38839B1 (enExample) |
| IL (1) | IL44202A (enExample) |
| LU (1) | LU69415A1 (enExample) |
| SE (1) | SE420834B (enExample) |
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5186473A (enExample) * | 1974-12-16 | 1976-07-29 | Merck & Co Inc | |
| JPS5283759A (en) * | 1976-01-01 | 1977-07-12 | Merck & Co Inc | Substituted pyridines |
| DE2726796A1 (de) * | 1976-06-15 | 1977-12-29 | Merck & Co Inc | Neue substituierte pyridine, verfahren zu ihrer herstellung und ihre pharmazeutische verwendung |
| US4091104A (en) * | 1976-06-15 | 1978-05-23 | Merck & Co., Inc. | Substituted (3-loweralkylamino-2-R1 O-propoxy)pyridines, their preparation and use |
| US4092419A (en) * | 1976-06-15 | 1978-05-30 | Merck & Co., Inc. | Substituted (3-loweralkylamino-2-R1 O-propoxy)pyridines, their preparation and use |
| DE2820938A1 (de) * | 1977-05-16 | 1978-11-23 | Merck & Co Inc | Neue imidazoazine und imidazodiazine |
| EP0018016A1 (de) * | 1979-04-23 | 1980-10-29 | I. S. F. Società per Azioni | 3-(3'-Amino-2'-hydroxy-n-prop-1'-oxy)-6-isopropylidenhydrazinopyridazine, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel |
| EP0027990A1 (de) * | 1979-10-26 | 1981-05-06 | Schering Aktiengesellschaft | Substituierte Pyridine, Verfahren zu ihrer Herstellung und ihre Verwendung |
| US4753673A (en) * | 1977-07-22 | 1988-06-28 | The Dow Chemical Company | Trifluoromethyl pyridinyloxyphenoxy and pyridinylthiophenoxy propanoic acids and propanols and derivatives thereof and methods of herbicidal use |
| JP2008507491A (ja) * | 2004-07-23 | 2008-03-13 | バイエル・クロツプサイエンス・エス・アー | 殺真菌剤としての3−ピリジニルエチルベンズアミド誘導体 |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4195090A (en) * | 1973-02-20 | 1980-03-25 | Ciba-Geigy Corporation | 2-(3-Amino-2-hydroxy-propoxy)pyridine derivatives and pharmaceutical compositions therewith |
| DE2711655A1 (de) * | 1977-03-17 | 1978-09-21 | Basf Ag | Pyridinyl-aminoalkylaether |
| US4144343A (en) * | 1978-01-04 | 1979-03-13 | Merck & Co., Inc. | Heterocycle substituted (3-loweralkylamino-2-R1 O-propoxy)pyridines |
| JPS54106476A (en) * | 1978-01-04 | 1979-08-21 | Merck & Co Inc | Multiisubstituted 22*33lower alkylaminoo22 r100propoxy*pyridine |
| US4279913A (en) * | 1978-01-04 | 1981-07-21 | Merck & Co., Inc. | Polysubstituted-2-(3-loweralkylamino-2-R1 O-propoxy)pyridines |
| DK267779A (da) * | 1978-06-27 | 1979-12-28 | Merck & Co Inc | Fr&mgangsmaade til fremstilling af n-aralkylamino-propoxycyanopyridiner |
| US4210653A (en) * | 1978-06-27 | 1980-07-01 | Merck & Co., Inc. | Pyridyloxypropanolamines |
| US4208416A (en) * | 1978-06-27 | 1980-06-17 | Merck & Co., Inc. | N-Aralkyl containing cyanopyridines |
| US4393212A (en) * | 1979-01-29 | 1983-07-12 | Merck & Co., Inc. | Certain nicotinic acid esters and corresponding nicotinonitriles |
| US4294969A (en) * | 1979-01-29 | 1981-10-13 | Merck & Co., Inc. | Process for producing 2-bromo-3,5-disubstituted pyridines |
| DD150456A5 (de) * | 1979-03-01 | 1981-09-02 | Ciba Geigy Ag | Verfahren zur herstellung von derivaten des 3-amino-1,2-propandiols |
| US4281005A (en) | 1979-03-05 | 1981-07-28 | Merck & Co., Inc. | Novel 2-pyridylimidazole compounds |
| IL62602A (en) * | 1980-05-19 | 1984-06-29 | Labaz Sanofi Nv | Pyridoxine derivatives,their preparation and pharmaceutical compositions containing them |
| FR2502618A1 (fr) * | 1981-03-25 | 1982-10-01 | Synthelabo | Derives de pyridine, leur preparation et leur application en therapeutique |
| US4517188A (en) * | 1983-05-09 | 1985-05-14 | Mead Johnson & Company | 1-Pyrimidinyloxy-3-hetaryl-alkylamino-2-propanols |
| US4598149A (en) * | 1984-03-02 | 1986-07-01 | Merck & Co., Inc. | 3-amino-2-hydroxypropyl of pyrimidin-4-one useful as antihypertensive, cardioprotective, antiarrythmic, and antianginal agents |
| US6465467B1 (en) | 1999-05-21 | 2002-10-15 | Biovitrum Ab | Certain aryl-aliphatic and heteroaryl-aliphatic piperazinyl pyrazines and their use in the treatment of serotonin-related diseases |
| US7361671B2 (en) * | 2001-11-15 | 2008-04-22 | The Institute For Pharmaceutical Discovery, Inc. | Substituted heteroarylalkanoic acids |
| BR0311970A (pt) | 2002-06-19 | 2005-03-29 | Biovitrum Ab | Novos compostos, seu uso e preparação |
| AU2003297562A1 (en) * | 2002-11-27 | 2004-06-23 | Artesian Therapeutics, Inc. | COMPOUNDS WITH MIXED PDE-INHIBITORY AND Beta-ADRENERGIC ANTAGONIST OR PARTIAL AGONIST ACTIVITY FOR TREATMENT OF HEART FAILURE |
| RU2012116124A (ru) * | 2009-09-21 | 2013-10-27 | Вандербилт Юниверсити | О-БЕНЗИЛ НИКОТИНАМИДНЫЕ АНАЛОГИ КАК ПОЗИТИВНЫЕ АЛЛОСТЕРИЧЕСКИЕ МОДУЛЯТОРЫ mGluR5 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1001631A (en) * | 1972-05-05 | 1976-12-14 | Merck Sharp And Dohme (I.A.) Corp. | 2-(3-substituted amino-2-hydroxy-propoxy)-3-substituted pyrazines and method for preparation |
-
1974
- 1974-01-01 AR AR257054A patent/AR208397A1/es active
- 1974-01-01 AR AR257055A patent/AR207133A1/es active
- 1974-01-01 AR AR257058A patent/AR206801A1/es active
- 1974-01-29 SE SE7401114A patent/SE420834B/xx unknown
- 1974-02-11 IE IE255/74A patent/IE38839B1/xx unknown
- 1974-02-12 CA CA192,292A patent/CA1027131A/en not_active Expired
- 1974-02-13 IL IL44202A patent/IL44202A/xx unknown
- 1974-02-13 GB GB651874A patent/GB1465946A/en not_active Expired
- 1974-02-14 DE DE19742406930 patent/DE2406930A1/de not_active Ceased
- 1974-02-15 DK DK80774A patent/DK143501C/da not_active IP Right Cessation
- 1974-02-18 LU LU69415A patent/LU69415A1/xx unknown
- 1974-02-18 DD DD176616A patent/DD110041A5/xx unknown
- 1974-02-18 FR FR7405391A patent/FR2218101B1/fr not_active Expired
- 1974-02-19 BE BE141130A patent/BE811274A/xx not_active IP Right Cessation
- 1974-02-19 AT AT133074A patent/AT335455B/de not_active IP Right Cessation
- 1974-02-20 CS CS741252A patent/CS203970B2/cs unknown
- 1974-02-20 AR AR252438A patent/AR214612A1/es active
- 1974-12-23 AR AR257057A patent/AR203878A1/es active
-
1976
- 1976-01-01 AR AR264155A patent/AR208043A1/es active
- 1976-03-16 ES ES446083A patent/ES446083A1/es not_active Expired
- 1976-03-16 ES ES76446081A patent/ES446081A1/es not_active Expired
Cited By (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5186473A (enExample) * | 1974-12-16 | 1976-07-29 | Merck & Co Inc | |
| US4000282A (en) * | 1974-12-16 | 1976-12-28 | Merck & Co., Inc. | 2-(3-tert. butyl or isopropylamino-2-hydroxypropoxy)-3-cyanopyridines |
| JPS5283759A (en) * | 1976-01-01 | 1977-07-12 | Merck & Co Inc | Substituted pyridines |
| DE2726796A1 (de) * | 1976-06-15 | 1977-12-29 | Merck & Co Inc | Neue substituierte pyridine, verfahren zu ihrer herstellung und ihre pharmazeutische verwendung |
| US4091104A (en) * | 1976-06-15 | 1978-05-23 | Merck & Co., Inc. | Substituted (3-loweralkylamino-2-R1 O-propoxy)pyridines, their preparation and use |
| US4092419A (en) * | 1976-06-15 | 1978-05-30 | Merck & Co., Inc. | Substituted (3-loweralkylamino-2-R1 O-propoxy)pyridines, their preparation and use |
| DE2820938A1 (de) * | 1977-05-16 | 1978-11-23 | Merck & Co Inc | Neue imidazoazine und imidazodiazine |
| US4753673A (en) * | 1977-07-22 | 1988-06-28 | The Dow Chemical Company | Trifluoromethyl pyridinyloxyphenoxy and pyridinylthiophenoxy propanoic acids and propanols and derivatives thereof and methods of herbicidal use |
| EP0018016A1 (de) * | 1979-04-23 | 1980-10-29 | I. S. F. Società per Azioni | 3-(3'-Amino-2'-hydroxy-n-prop-1'-oxy)-6-isopropylidenhydrazinopyridazine, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel |
| EP0027990A1 (de) * | 1979-10-26 | 1981-05-06 | Schering Aktiengesellschaft | Substituierte Pyridine, Verfahren zu ihrer Herstellung und ihre Verwendung |
| JP2008507491A (ja) * | 2004-07-23 | 2008-03-13 | バイエル・クロツプサイエンス・エス・アー | 殺真菌剤としての3−ピリジニルエチルベンズアミド誘導体 |
Also Published As
| Publication number | Publication date |
|---|---|
| IE38839B1 (en) | 1978-06-07 |
| AR206801A1 (es) | 1976-08-23 |
| AT335455B (de) | 1977-03-10 |
| CA1027131A (en) | 1978-02-28 |
| AR208397A1 (es) | 1976-12-27 |
| DK143501C (da) | 1982-02-22 |
| LU69415A1 (enExample) | 1975-12-09 |
| AR203878A1 (es) | 1975-10-31 |
| CS203970B2 (en) | 1981-03-31 |
| AR207133A1 (es) | 1976-09-15 |
| BE811274A (fr) | 1974-08-19 |
| DK143501B (da) | 1981-08-31 |
| AR214612A1 (es) | 1979-07-13 |
| DD110041A5 (enExample) | 1974-12-05 |
| FR2218101A1 (enExample) | 1974-09-13 |
| IL44202A0 (en) | 1974-06-30 |
| ES446081A1 (es) | 1977-06-16 |
| SE420834B (sv) | 1981-11-02 |
| ATA133074A (de) | 1976-07-15 |
| AR208043A1 (es) | 1976-11-22 |
| ES446083A1 (es) | 1977-09-16 |
| FR2218101B1 (enExample) | 1977-07-15 |
| IL44202A (en) | 1978-10-31 |
| IE38839L (en) | 1974-08-20 |
| GB1465946A (en) | 1977-03-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2406930A1 (de) | Neue heterocyclische verbindungen und verfahren zu ihrer herstellung | |
| DE69815008T2 (de) | Alfa-substituierte Phenylpropionsäurederivate und diese enthaltende Arzneimittel | |
| EP1280776B1 (de) | Substituierte benzoesäureamide und deren verwendung zur hemmung von angiogenese | |
| EP0136658B1 (de) | 1-Benzyl-aminoalkyl-pyrrolidinone und ihre Säureadditionssalze, Verfahren zu ihrer Herstellung und Arzneimittel | |
| DE69023928T2 (de) | DIAMINVERBINDUNGEN UND ARZNEIMITTEL GEGEN CEREBRALE STöRUNGEN DIE DIESE ENTHALTEN. | |
| DE2706977A1 (de) | Benzoesaeuren und deren derivate sowie verfahren zu ihrer herstellung | |
| DE2520910A1 (de) | Cyclisch substituierte derivate des 1-amino-2-propanol | |
| EP0041215B1 (de) | Imidazoazolalkensäureamide, neue Zwischenprodukte zu ihrer Herstellung, ihre Herstellung und ihre Verwendung in Arzneimitteln | |
| DE2820938A1 (de) | Neue imidazoazine und imidazodiazine | |
| DE60006054T2 (de) | Herstellungsverfahren für Pyridinderivate | |
| DE2920250C2 (enExample) | ||
| DE4243381B4 (de) | 3(2H)-Pyridazinonderivate, Verfahren und Zwischenprodukte zu ihrer Herstellung sowie diese enthaltende Arzneimittel und ihre Verwendung | |
| DE69524241T2 (de) | 2,7,-substituierte octahydro-1h-pyrido[1,2-a]pyrazin derivate | |
| EP0225522A1 (de) | Imidazopyridazinalkensäureamide, Verfahren ihrer Herstellung, Zwischenprodukte zu ihrer Herstellung | |
| DE3027106C2 (enExample) | ||
| EP0000485A1 (de) | Piperidino-propanole, ihre Herstellung und pharmazeutische Präparate die diese enthalten | |
| DE2507902A1 (de) | Neue amine und verfahren zu ihrer herstellung | |
| EP1003728B1 (de) | 2-(3-(4-(2-t-Butyl-6-trifluormethylpyrimidin-4-yl)piperazin-1-yl)propylmercapto)pyrimidin-4-ol-fumarat | |
| DE69530408T2 (de) | Neue zwischenprodukte und verfahren zur herstellung von pyridin-derivaten | |
| DE69724216T2 (de) | Pyridin-Zwischenprodukte, verwendbar zur Herstellung von Beta-adrenergischen Rezeptor-Agonisten | |
| EP0013408B1 (de) | 4-Aminopyridine, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE1620746A1 (de) | Verfahren zur Herstellung von Phenothiazin-Derivaten | |
| CH584209A5 (en) | 3-amino-2-hydroxypropoxy substd. diazines and pyridines - with beta-adrenergic blocking or stimulating activity | |
| US4410530A (en) | 2-(3-Amino-2-hydroxy-propoxy)-mono-and diazines | |
| AT336618B (de) | Verfahren zur herstellung von neuen heterocyclischen verbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8172 | Supplementary division/partition in: |
Ref country code: DE Ref document number: 2463165 Format of ref document f/p: P |
|
| Q171 | Divided out to: |
Ref country code: DE Ref document number: 2463165 |
|
| 8110 | Request for examination paragraph 44 | ||
| 8131 | Rejection |