DE2359617B2 - Stabile Dispersionen von Pfropfcopolymerisaten - Google Patents
Stabile Dispersionen von PfropfcopolymerisatenInfo
- Publication number
- DE2359617B2 DE2359617B2 DE2359617A DE2359617A DE2359617B2 DE 2359617 B2 DE2359617 B2 DE 2359617B2 DE 2359617 A DE2359617 A DE 2359617A DE 2359617 A DE2359617 A DE 2359617A DE 2359617 B2 DE2359617 B2 DE 2359617B2
- Authority
- DE
- Germany
- Prior art keywords
- polyol
- unsaturated
- parts
- vinyl
- polyols
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 239000006185 dispersion Substances 0.000 title claims description 49
- 229920000578 graft copolymer Polymers 0.000 title claims description 33
- 229920005862 polyol Polymers 0.000 claims description 139
- 150000003077 polyols Chemical class 0.000 claims description 137
- 239000000203 mixture Substances 0.000 claims description 48
- 239000000178 monomer Substances 0.000 claims description 40
- 229920002554 vinyl polymer Polymers 0.000 claims description 24
- 239000003054 catalyst Substances 0.000 claims description 22
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 21
- 238000004519 manufacturing process Methods 0.000 claims description 16
- 229920002635 polyurethane Polymers 0.000 claims description 13
- 239000004814 polyurethane Substances 0.000 claims description 13
- 238000002360 preparation method Methods 0.000 claims description 13
- 229920005830 Polyurethane Foam Polymers 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 12
- 239000011496 polyurethane foam Substances 0.000 claims description 12
- 229920006395 saturated elastomer Polymers 0.000 claims description 11
- 238000006116 polymerization reaction Methods 0.000 claims description 10
- 230000008569 process Effects 0.000 claims description 7
- 229920005903 polyol mixture Polymers 0.000 claims description 6
- 239000011953 free-radical catalyst Substances 0.000 claims description 4
- 150000003254 radicals Chemical class 0.000 claims description 4
- 230000003197 catalytic effect Effects 0.000 claims description 3
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 42
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 38
- 239000000047 product Substances 0.000 description 29
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 28
- 229910052757 nitrogen Inorganic materials 0.000 description 25
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 24
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 23
- -1 aliphatic polyols Chemical class 0.000 description 20
- 125000002947 alkylene group Chemical group 0.000 description 20
- 150000001875 compounds Chemical class 0.000 description 20
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 20
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 19
- 229920000570 polyether Polymers 0.000 description 17
- 238000003756 stirring Methods 0.000 description 17
- 239000002253 acid Substances 0.000 description 16
- 239000011541 reaction mixture Substances 0.000 description 16
- 239000004721 Polyphenylene oxide Substances 0.000 description 15
- 239000007788 liquid Substances 0.000 description 15
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 14
- 230000000704 physical effect Effects 0.000 description 12
- PAOHAQSLJSMLAT-UHFFFAOYSA-N 1-butylperoxybutane Chemical compound CCCCOOCCCC PAOHAQSLJSMLAT-UHFFFAOYSA-N 0.000 description 11
- 230000006835 compression Effects 0.000 description 11
- 238000007906 compression Methods 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 235000011187 glycerol Nutrition 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 9
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 239000006260 foam Substances 0.000 description 8
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 7
- 150000002894 organic compounds Chemical class 0.000 description 7
- 229920000728 polyester Polymers 0.000 description 7
- 229920001228 polyisocyanate Polymers 0.000 description 7
- 239000005056 polyisocyanate Substances 0.000 description 7
- 239000003039 volatile agent Substances 0.000 description 7
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- 238000011065 in-situ storage Methods 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 150000005846 sugar alcohols Polymers 0.000 description 6
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 6
- STMDPCBYJCIZOD-UHFFFAOYSA-N 2-(2,4-dinitroanilino)-4-methylpentanoic acid Chemical compound CC(C)CC(C(O)=O)NC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O STMDPCBYJCIZOD-UHFFFAOYSA-N 0.000 description 5
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 5
- 229920001577 copolymer Polymers 0.000 description 5
- 239000002245 particle Substances 0.000 description 5
- 230000035699 permeability Effects 0.000 description 5
- 229920000642 polymer Polymers 0.000 description 5
- NFPBWZOKGZKYRE-UHFFFAOYSA-N 2-propan-2-ylperoxypropane Chemical compound CC(C)OOC(C)C NFPBWZOKGZKYRE-UHFFFAOYSA-N 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 4
- 150000001414 amino alcohols Chemical class 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 4
- 238000009833 condensation Methods 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- JQZRVMZHTADUSY-UHFFFAOYSA-L di(octanoyloxy)tin Chemical compound [Sn+2].CCCCCCCC([O-])=O.CCCCCCCC([O-])=O JQZRVMZHTADUSY-UHFFFAOYSA-L 0.000 description 4
- ZQMIGQNCOMNODD-UHFFFAOYSA-N diacetyl peroxide Chemical compound CC(=O)OOC(C)=O ZQMIGQNCOMNODD-UHFFFAOYSA-N 0.000 description 4
- 125000003700 epoxy group Chemical group 0.000 description 4
- 238000007373 indentation Methods 0.000 description 4
- 229920001281 polyalkylene Polymers 0.000 description 4
- 229920001296 polysiloxane Polymers 0.000 description 4
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 4
- 239000004604 Blowing Agent Substances 0.000 description 3
- 239000004970 Chain extender Substances 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 3
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 239000004793 Polystyrene Substances 0.000 description 3
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 3
- 238000002835 absorbance Methods 0.000 description 3
- 239000002250 absorbent Substances 0.000 description 3
- 230000002745 absorbent Effects 0.000 description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 150000004985 diamines Chemical class 0.000 description 3
- 239000001530 fumaric acid Substances 0.000 description 3
- VOZRXNHHFUQHIL-UHFFFAOYSA-N glycidyl methacrylate Chemical compound CC(=C)C(=O)OCC1CO1 VOZRXNHHFUQHIL-UHFFFAOYSA-N 0.000 description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 3
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 3
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 3
- 239000011976 maleic acid Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 229910001220 stainless steel Inorganic materials 0.000 description 3
- 239000010935 stainless steel Substances 0.000 description 3
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 3
- RUELTTOHQODFPA-UHFFFAOYSA-N toluene 2,6-diisocyanate Chemical compound CC1=C(N=C=O)C=CC=C1N=C=O RUELTTOHQODFPA-UHFFFAOYSA-N 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 2
- XWJBRBSPAODJER-UHFFFAOYSA-N 1,7-octadiene Chemical compound C=CCCCCC=C XWJBRBSPAODJER-UHFFFAOYSA-N 0.000 description 2
- JLIDVCMBCGBIEY-UHFFFAOYSA-N 1-penten-3-one Chemical compound CCC(=O)C=C JLIDVCMBCGBIEY-UHFFFAOYSA-N 0.000 description 2
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 2
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- GOXQRTZXKQZDDN-UHFFFAOYSA-N 2-Ethylhexyl acrylate Chemical compound CCCCC(CC)COC(=O)C=C GOXQRTZXKQZDDN-UHFFFAOYSA-N 0.000 description 2
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 229920000538 Poly[(phenyl isocyanate)-co-formaldehyde] Polymers 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical class [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- UJMDYLWCYJJYMO-UHFFFAOYSA-N benzene-1,2,3-tricarboxylic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1C(O)=O UJMDYLWCYJJYMO-UHFFFAOYSA-N 0.000 description 2
- 230000008033 biological extinction Effects 0.000 description 2
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 2
- 229920001400 block copolymer Polymers 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 description 2
- 125000005442 diisocyanate group Chemical group 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- FJKIXWOMBXYWOQ-UHFFFAOYSA-N ethenoxyethane Chemical compound CCOC=C FJKIXWOMBXYWOQ-UHFFFAOYSA-N 0.000 description 2
- ZTWTYVWXUKTLCP-UHFFFAOYSA-L ethenyl-dioxido-oxo-$l^{5}-phosphane Chemical compound [O-]P([O-])(=O)C=C ZTWTYVWXUKTLCP-UHFFFAOYSA-L 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 230000001788 irregular Effects 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- ZGEGCLOFRBLKSE-UHFFFAOYSA-N methylene hexane Natural products CCCCCC=C ZGEGCLOFRBLKSE-UHFFFAOYSA-N 0.000 description 2
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 2
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 2
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- WLJVNTCWHIRURA-UHFFFAOYSA-N pimelic acid Chemical compound OC(=O)CCCCCC(O)=O WLJVNTCWHIRURA-UHFFFAOYSA-N 0.000 description 2
- 229920006149 polyester-amide block copolymer Polymers 0.000 description 2
- 229920006324 polyoxymethylene Polymers 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- 229920006295 polythiol Polymers 0.000 description 2
- SCUZVMOVTVSBLE-UHFFFAOYSA-N prop-2-enenitrile;styrene Chemical compound C=CC#N.C=CC1=CC=CC=C1 SCUZVMOVTVSBLE-UHFFFAOYSA-N 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- YPFDHNVEDLHUCE-UHFFFAOYSA-N propane-1,3-diol Chemical compound OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- 230000006641 stabilisation Effects 0.000 description 2
- 238000011105 stabilization Methods 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- TYFQFVWCELRYAO-UHFFFAOYSA-N suberic acid Chemical compound OC(=O)CCCCCCC(O)=O TYFQFVWCELRYAO-UHFFFAOYSA-N 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- LDHQCZJRKDOVOX-UHFFFAOYSA-N trans-crotonic acid Natural products CC=CC(O)=O LDHQCZJRKDOVOX-UHFFFAOYSA-N 0.000 description 2
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 description 2
- UIYCHXAGWOYNNA-UHFFFAOYSA-N vinyl sulfide Chemical compound C=CSC=C UIYCHXAGWOYNNA-UHFFFAOYSA-N 0.000 description 2
- ZRNSNCMYTTWZQQ-UHFFFAOYSA-N (4-ethoxybenzoyl) 4-ethoxybenzenecarboperoxoate Chemical compound C1=CC(OCC)=CC=C1C(=O)OOC(=O)C1=CC=C(OCC)C=C1 ZRNSNCMYTTWZQQ-UHFFFAOYSA-N 0.000 description 1
- XVOUMQNXTGKGMA-OWOJBTEDSA-N (E)-glutaconic acid Chemical compound OC(=O)C\C=C\C(O)=O XVOUMQNXTGKGMA-OWOJBTEDSA-N 0.000 description 1
- ZWKNLRXFUTWSOY-QPJJXVBHSA-N (e)-3-phenylprop-2-enenitrile Chemical compound N#C\C=C\C1=CC=CC=C1 ZWKNLRXFUTWSOY-QPJJXVBHSA-N 0.000 description 1
- ORTVZLZNOYNASJ-UPHRSURJSA-N (z)-but-2-ene-1,4-diol Chemical compound OC\C=C/CO ORTVZLZNOYNASJ-UPHRSURJSA-N 0.000 description 1
- BQCIDUSAKPWEOX-UHFFFAOYSA-N 1,1-Difluoroethene Chemical compound FC(F)=C BQCIDUSAKPWEOX-UHFFFAOYSA-N 0.000 description 1
- PDKAXHLOFWCWIH-UHFFFAOYSA-N 1,1-dichlorobuta-1,3-diene Chemical compound ClC(Cl)=CC=C PDKAXHLOFWCWIH-UHFFFAOYSA-N 0.000 description 1
- SKDFWEPBABSFMG-UHFFFAOYSA-N 1,2-dichloro-1,1-difluoroethane Chemical compound FC(F)(Cl)CCl SKDFWEPBABSFMG-UHFFFAOYSA-N 0.000 description 1
- VYMPLPIFKRHAAC-UHFFFAOYSA-N 1,2-ethanedithiol Chemical group SCCS VYMPLPIFKRHAAC-UHFFFAOYSA-N 0.000 description 1
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 1
- YGKHJWTVMIMEPQ-UHFFFAOYSA-N 1,2-propanedithiol Chemical group CC(S)CS YGKHJWTVMIMEPQ-UHFFFAOYSA-N 0.000 description 1
- 229940058015 1,3-butylene glycol Drugs 0.000 description 1
- PXGZQGDTEZPERC-UHFFFAOYSA-N 1,4-cyclohexanedicarboxylic acid Chemical compound OC(=O)C1CCC(C(O)=O)CC1 PXGZQGDTEZPERC-UHFFFAOYSA-N 0.000 description 1
- IZMZREOTRMMCCB-UHFFFAOYSA-N 1,4-dichloro-2-ethenylbenzene Chemical compound ClC1=CC=C(Cl)C(C=C)=C1 IZMZREOTRMMCCB-UHFFFAOYSA-N 0.000 description 1
- CDMDQYCEEKCBGR-UHFFFAOYSA-N 1,4-diisocyanatocyclohexane Chemical compound O=C=NC1CCC(N=C=O)CC1 CDMDQYCEEKCBGR-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- SBJCUZQNHOLYMD-UHFFFAOYSA-N 1,5-Naphthalene diisocyanate Chemical compound C1=CC=C2C(N=C=O)=CC=CC2=C1N=C=O SBJCUZQNHOLYMD-UHFFFAOYSA-N 0.000 description 1
- SRZXCOWFGPICGA-UHFFFAOYSA-N 1,6-Hexanedithiol Chemical group SCCCCCCS SRZXCOWFGPICGA-UHFFFAOYSA-N 0.000 description 1
- CWKVFRNCODQPDB-UHFFFAOYSA-N 1-(2-aminoethylamino)propan-2-ol Chemical compound CC(O)CNCCN CWKVFRNCODQPDB-UHFFFAOYSA-N 0.000 description 1
- UNMYKPSSIFZORM-UHFFFAOYSA-N 1-(2-ethenoxyethoxy)butane Chemical compound CCCCOCCOC=C UNMYKPSSIFZORM-UHFFFAOYSA-N 0.000 description 1
- XSZYESUNPWGWFQ-UHFFFAOYSA-N 1-(2-hydroperoxypropan-2-yl)-4-methylcyclohexane Chemical compound CC1CCC(C(C)(C)OO)CC1 XSZYESUNPWGWFQ-UHFFFAOYSA-N 0.000 description 1
- NXNQLKPBPWLUSX-UHFFFAOYSA-N 1-[2-(2-hydroxypropylamino)ethylamino]propan-2-ol Chemical compound CC(O)CNCCNCC(C)O NXNQLKPBPWLUSX-UHFFFAOYSA-N 0.000 description 1
- FPBWSPZHCJXUBL-UHFFFAOYSA-N 1-chloro-1-fluoroethene Chemical group FC(Cl)=C FPBWSPZHCJXUBL-UHFFFAOYSA-N 0.000 description 1
- GXZPMXGRNUXGHN-UHFFFAOYSA-N 1-ethenoxy-2-methoxyethane Chemical compound COCCOC=C GXZPMXGRNUXGHN-UHFFFAOYSA-N 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N 1-ethenoxybutane Chemical compound CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- OVGRCEFMXPHEBL-UHFFFAOYSA-N 1-ethenoxypropane Chemical compound CCCOC=C OVGRCEFMXPHEBL-UHFFFAOYSA-N 0.000 description 1
- OEVVKKAVYQFQNV-UHFFFAOYSA-N 1-ethenyl-2,4-dimethylbenzene Chemical compound CC1=CC=C(C=C)C(C)=C1 OEVVKKAVYQFQNV-UHFFFAOYSA-N 0.000 description 1
- OSSNTDFYBPYIEC-UHFFFAOYSA-N 1-ethenylimidazole Chemical compound C=CN1C=CN=C1 OSSNTDFYBPYIEC-UHFFFAOYSA-N 0.000 description 1
- CTXUTPWZJZHRJC-UHFFFAOYSA-N 1-ethenylpyrrole Chemical compound C=CN1C=CC=C1 CTXUTPWZJZHRJC-UHFFFAOYSA-N 0.000 description 1
- HQSMEHLVLOGBCK-UHFFFAOYSA-N 1-ethenylsulfinylethene Chemical compound C=CS(=O)C=C HQSMEHLVLOGBCK-UHFFFAOYSA-N 0.000 description 1
- BJEWLOAZFAGNPE-UHFFFAOYSA-N 1-ethenylsulfonylethane Chemical compound CCS(=O)(=O)C=C BJEWLOAZFAGNPE-UHFFFAOYSA-N 0.000 description 1
- YWBMNCRJFZGXJY-UHFFFAOYSA-N 1-hydroperoxy-1,2,3,4-tetrahydronaphthalene Chemical compound C1=CC=C2C(OO)CCCC2=C1 YWBMNCRJFZGXJY-UHFFFAOYSA-N 0.000 description 1
- AKUNSTOMHUXJOZ-UHFFFAOYSA-N 1-hydroperoxybutane Chemical compound CCCCOO AKUNSTOMHUXJOZ-UHFFFAOYSA-N 0.000 description 1
- TURGQPDWYFJEDY-UHFFFAOYSA-N 1-hydroperoxypropane Chemical compound CCCOO TURGQPDWYFJEDY-UHFFFAOYSA-N 0.000 description 1
- DTZHXCBUWSTOPO-UHFFFAOYSA-N 1-isocyanato-4-[(4-isocyanato-3-methylphenyl)methyl]-2-methylbenzene Chemical compound C1=C(N=C=O)C(C)=CC(CC=2C=C(C)C(N=C=O)=CC=2)=C1 DTZHXCBUWSTOPO-UHFFFAOYSA-N 0.000 description 1
- KOCUMXQOUWPSLK-UHFFFAOYSA-N 1-methoxybuta-1,3-diene Chemical compound COC=CC=C KOCUMXQOUWPSLK-UHFFFAOYSA-N 0.000 description 1
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- KUIZKZHDMPERHR-UHFFFAOYSA-N 1-phenylprop-2-en-1-one Chemical compound C=CC(=O)C1=CC=CC=C1 KUIZKZHDMPERHR-UHFFFAOYSA-N 0.000 description 1
- MFLLXRJTHGPGEB-UHFFFAOYSA-N 1-propylperoxypropane Chemical compound CCCOOCCC MFLLXRJTHGPGEB-UHFFFAOYSA-N 0.000 description 1
- IGGDKDTUCAWDAN-UHFFFAOYSA-N 1-vinylnaphthalene Chemical compound C1=CC=C2C(C=C)=CC=CC2=C1 IGGDKDTUCAWDAN-UHFFFAOYSA-N 0.000 description 1
- JHSWSKVODYPNDV-UHFFFAOYSA-N 2,2-bis(prop-2-enoxymethyl)propane-1,3-diol Chemical compound C=CCOCC(CO)(CO)COCC=C JHSWSKVODYPNDV-UHFFFAOYSA-N 0.000 description 1
- SXZSFWHOSHAKMN-UHFFFAOYSA-N 2,3,4,4',5-Pentachlorobiphenyl Chemical compound C1=CC(Cl)=CC=C1C1=CC(Cl)=C(Cl)C(Cl)=C1Cl SXZSFWHOSHAKMN-UHFFFAOYSA-N 0.000 description 1
- VOZKAJLKRJDJLL-UHFFFAOYSA-N 2,4-diaminotoluene Chemical compound CC1=CC=C(N)C=C1N VOZKAJLKRJDJLL-UHFFFAOYSA-N 0.000 description 1
- VZDIRINETBAVAV-UHFFFAOYSA-N 2,4-diisocyanato-1-methylcyclohexane Chemical compound CC1CCC(N=C=O)CC1N=C=O VZDIRINETBAVAV-UHFFFAOYSA-N 0.000 description 1
- FFRBMBIXVSCUFS-UHFFFAOYSA-N 2,4-dinitro-1-naphthol Chemical compound C1=CC=C2C(O)=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 FFRBMBIXVSCUFS-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- JKNCOURZONDCGV-UHFFFAOYSA-N 2-(dimethylamino)ethyl 2-methylprop-2-enoate Chemical compound CN(C)CCOC(=O)C(C)=C JKNCOURZONDCGV-UHFFFAOYSA-N 0.000 description 1
- IARGBXSVZJLGOI-UHFFFAOYSA-N 2-(ethenoxymethyl)-2-(hydroxymethyl)propane-1,3-diol Chemical compound OCC(CO)(CO)COC=C IARGBXSVZJLGOI-UHFFFAOYSA-N 0.000 description 1
- BEWCNXNIQCLWHP-UHFFFAOYSA-N 2-(tert-butylamino)ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCNC(C)(C)C BEWCNXNIQCLWHP-UHFFFAOYSA-N 0.000 description 1
- AKCRQHGQIJBRMN-UHFFFAOYSA-N 2-chloroaniline Chemical compound NC1=CC=CC=C1Cl AKCRQHGQIJBRMN-UHFFFAOYSA-N 0.000 description 1
- SBYMUDUGTIKLCR-UHFFFAOYSA-N 2-chloroethenylbenzene Chemical compound ClC=CC1=CC=CC=C1 SBYMUDUGTIKLCR-UHFFFAOYSA-N 0.000 description 1
- MENUHMSZHZBYMK-UHFFFAOYSA-N 2-cyclohexylethenylbenzene Chemical compound C1CCCCC1C=CC1=CC=CC=C1 MENUHMSZHZBYMK-UHFFFAOYSA-N 0.000 description 1
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical compound CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 1
- LZDXRPVSAKWYDH-UHFFFAOYSA-N 2-ethyl-2-(prop-2-enoxymethyl)propane-1,3-diol Chemical compound CCC(CO)(CO)COCC=C LZDXRPVSAKWYDH-UHFFFAOYSA-N 0.000 description 1
- KBKNKFIRGXQLDB-UHFFFAOYSA-N 2-fluoroethenylbenzene Chemical compound FC=CC1=CC=CC=C1 KBKNKFIRGXQLDB-UHFFFAOYSA-N 0.000 description 1
- SGJUFIMCHSLMRJ-UHFFFAOYSA-N 2-hydroperoxypropane Chemical compound CC(C)OO SGJUFIMCHSLMRJ-UHFFFAOYSA-N 0.000 description 1
- OMIGHNLMNHATMP-UHFFFAOYSA-N 2-hydroxyethyl prop-2-enoate Chemical compound OCCOC(=O)C=C OMIGHNLMNHATMP-UHFFFAOYSA-N 0.000 description 1
- OZPOYKXYJOHGCW-UHFFFAOYSA-N 2-iodoethenylbenzene Chemical compound IC=CC1=CC=CC=C1 OZPOYKXYJOHGCW-UHFFFAOYSA-N 0.000 description 1
- BKOOMYPCSUNDGP-UHFFFAOYSA-N 2-methylbut-2-ene Chemical group CC=C(C)C BKOOMYPCSUNDGP-UHFFFAOYSA-N 0.000 description 1
- JOMNTHCQHJPVAZ-UHFFFAOYSA-N 2-methylpiperazine Chemical compound CC1CNCCN1 JOMNTHCQHJPVAZ-UHFFFAOYSA-N 0.000 description 1
- LPKLOHNQLZWKTG-UHFFFAOYSA-N 2-n-methyl-2-n-propan-2-ylpropane-1,2-diamine Chemical compound CC(C)N(C)C(C)CN LPKLOHNQLZWKTG-UHFFFAOYSA-N 0.000 description 1
- PIAOLBVUVDXHHL-UHFFFAOYSA-N 2-nitroethenylbenzene Chemical compound [O-][N+](=O)C=CC1=CC=CC=C1 PIAOLBVUVDXHHL-UHFFFAOYSA-N 0.000 description 1
- SAFZQLDSMLNONX-UHFFFAOYSA-N 2-phenoxyethenylbenzene Chemical compound C=1C=CC=CC=1OC=CC1=CC=CC=C1 SAFZQLDSMLNONX-UHFFFAOYSA-N 0.000 description 1
- FMFHUEMLVAIBFI-UHFFFAOYSA-N 2-phenylethenyl acetate Chemical compound CC(=O)OC=CC1=CC=CC=C1 FMFHUEMLVAIBFI-UHFFFAOYSA-N 0.000 description 1
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 description 1
- HKADMMFLLPJEAG-UHFFFAOYSA-N 3,3,3-trifluoroprop-1-enylbenzene Chemical compound FC(F)(F)C=CC1=CC=CC=C1 HKADMMFLLPJEAG-UHFFFAOYSA-N 0.000 description 1
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 1
- DSSAWHFZNWVJEC-UHFFFAOYSA-N 3-(ethenoxymethyl)heptane Chemical compound CCCCC(CC)COC=C DSSAWHFZNWVJEC-UHFFFAOYSA-N 0.000 description 1
- CEBRPXLXYCFYGU-UHFFFAOYSA-N 3-methylbut-1-enylbenzene Chemical compound CC(C)C=CC1=CC=CC=C1 CEBRPXLXYCFYGU-UHFFFAOYSA-N 0.000 description 1
- AIMDYNJRXHEXEL-UHFFFAOYSA-N 3-phenylprop-1-enylbenzene Chemical compound C=1C=CC=CC=1CC=CC1=CC=CC=C1 AIMDYNJRXHEXEL-UHFFFAOYSA-N 0.000 description 1
- CQHADWBXOMARTO-UHFFFAOYSA-N 3-prop-1-enyloxolane-2,5-dione Chemical compound CC=CC1CC(=O)OC1=O CQHADWBXOMARTO-UHFFFAOYSA-N 0.000 description 1
- YBRVSVVVWCFQMG-UHFFFAOYSA-N 4,4'-diaminodiphenylmethane Chemical compound C1=CC(N)=CC=C1CC1=CC=C(N)C=C1 YBRVSVVVWCFQMG-UHFFFAOYSA-N 0.000 description 1
- YCIGYTFKOXGYTA-UHFFFAOYSA-N 4-(3-cyanopropyldiazenyl)butanenitrile Chemical compound N#CCCCN=NCCCC#N YCIGYTFKOXGYTA-UHFFFAOYSA-N 0.000 description 1
- JLBJTVDPSNHSKJ-UHFFFAOYSA-N 4-Methylstyrene Chemical compound CC1=CC=C(C=C)C=C1 JLBJTVDPSNHSKJ-UHFFFAOYSA-N 0.000 description 1
- DJYCUKPICQCQKY-UHFFFAOYSA-N 4-ethenyl-1-(4-ethenyl-2-phenylphenoxy)-2-phenylbenzene Chemical compound C=1C=CC=CC=1C1=CC(C=C)=CC=C1OC1=CC=C(C=C)C=C1C1=CC=CC=C1 DJYCUKPICQCQKY-UHFFFAOYSA-N 0.000 description 1
- HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical compound CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 description 1
- OIYTYGOUZOARSH-UHFFFAOYSA-N 4-methoxy-2-methylidene-4-oxobutanoic acid Chemical compound COC(=O)CC(=C)C(O)=O OIYTYGOUZOARSH-UHFFFAOYSA-N 0.000 description 1
- HOSGXJWQVBHGLT-UHFFFAOYSA-N 6-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical group N1C(=O)CCC2=CC(O)=CC=C21 HOSGXJWQVBHGLT-UHFFFAOYSA-N 0.000 description 1
- MGYMHQJELJYRQS-UHFFFAOYSA-N Ascaridole Chemical compound C1CC2(C)OOC1(C(C)C)C=C2 MGYMHQJELJYRQS-UHFFFAOYSA-N 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- DPUOLQHDNGRHBS-UHFFFAOYSA-N Brassidinsaeure Natural products CCCCCCCCC=CCCCCCCCCCCCC(O)=O DPUOLQHDNGRHBS-UHFFFAOYSA-N 0.000 description 1
- HGGMLVVCLNIDNO-UHFFFAOYSA-N C(=C)OCC1CO1.C(=C)OCC1CO1 Chemical compound C(=C)OCC1CO1.C(=C)OCC1CO1 HGGMLVVCLNIDNO-UHFFFAOYSA-N 0.000 description 1
- CHRUCKSZFVRIFF-UHFFFAOYSA-N CC=1C(=CC(=CC1)N=C=O)N=C=O.C1(=CC(=CC=C1)N=C=O)N=C=O Chemical compound CC=1C(=CC(=CC1)N=C=O)N=C=O.C1(=CC(=CC=C1)N=C=O)N=C=O CHRUCKSZFVRIFF-UHFFFAOYSA-N 0.000 description 1
- RTNBRHVTTXCMNM-UHFFFAOYSA-N CCN1CCOCC1.CC(O)COC(C)CO Chemical compound CCN1CCOCC1.CC(O)COC(C)CO RTNBRHVTTXCMNM-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- IMROMDMJAWUWLK-UHFFFAOYSA-N Ethenol Chemical compound OC=C IMROMDMJAWUWLK-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- WOBHKFSMXKNTIM-UHFFFAOYSA-N Hydroxyethyl methacrylate Chemical compound CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 description 1
- HETCEOQFVDFGSY-UHFFFAOYSA-N Isopropenyl acetate Chemical compound CC(=C)OC(C)=O HETCEOQFVDFGSY-UHFFFAOYSA-N 0.000 description 1
- YIVJZNGAASQVEM-UHFFFAOYSA-N Lauroyl peroxide Chemical compound CCCCCCCCCCCC(=O)OOC(=O)CCCCCCCCCCC YIVJZNGAASQVEM-UHFFFAOYSA-N 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 1
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 1
- HBZLTBZETPGRDV-AWLKUTLJSA-N OO.C(CC1)C[C@H]2[C@H]1CCCC2 Chemical compound OO.C(CC1)C[C@H]2[C@H]1CCCC2 HBZLTBZETPGRDV-AWLKUTLJSA-N 0.000 description 1
- BQMQLJQPTQPEOV-UHFFFAOYSA-N OP(=O)OC=C Chemical class OP(=O)OC=C BQMQLJQPTQPEOV-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ALQSHHUCVQOPAS-UHFFFAOYSA-N Pentane-1,5-diol Chemical compound OCCCCCO ALQSHHUCVQOPAS-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical compound C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical class C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 1
- YMOONIIMQBGTDU-VOTSOKGWSA-N [(e)-2-bromoethenyl]benzene Chemical compound Br\C=C\C1=CC=CC=C1 YMOONIIMQBGTDU-VOTSOKGWSA-N 0.000 description 1
- VJDDQSBNUHLBTD-GGWOSOGESA-N [(e)-but-2-enoyl] (e)-but-2-enoate Chemical compound C\C=C\C(=O)OC(=O)\C=C\C VJDDQSBNUHLBTD-GGWOSOGESA-N 0.000 description 1
- OXIKYYJDTWKERT-UHFFFAOYSA-N [4-(aminomethyl)cyclohexyl]methanamine Chemical compound NCC1CCC(CN)CC1 OXIKYYJDTWKERT-UHFFFAOYSA-N 0.000 description 1
- GPDWNEFHGANACG-UHFFFAOYSA-L [dibutyl(2-ethylhexanoyloxy)stannyl] 2-ethylhexanoate Chemical compound CCCCC(CC)C(=O)O[Sn](CCCC)(CCCC)OC(=O)C(CC)CCCC GPDWNEFHGANACG-UHFFFAOYSA-L 0.000 description 1
- ILNQBWPWHQSSNX-UHFFFAOYSA-N [hydroperoxy(diphenyl)methyl]benzene Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(OO)C1=CC=CC=C1 ILNQBWPWHQSSNX-UHFFFAOYSA-N 0.000 description 1
- QFISYKBJJWTOOD-UHFFFAOYSA-N [hydroperoxy(phenyl)methyl]benzene Chemical compound C=1C=CC=CC=1C(OO)C1=CC=CC=C1 QFISYKBJJWTOOD-UHFFFAOYSA-N 0.000 description 1
- BWLKKFSDKDJGDZ-UHFFFAOYSA-N [isocyanato(phenyl)methyl]benzene Chemical compound C=1C=CC=CC=1C(N=C=O)C1=CC=CC=C1 BWLKKFSDKDJGDZ-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229920001893 acrylonitrile styrene Polymers 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 description 1
- 150000001413 amino acids Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- MGYMHQJELJYRQS-ZJUUUORDSA-N ascaridole Natural products C1C[C@]2(C)OO[C@@]1(C(C)C)C=C2 MGYMHQJELJYRQS-ZJUUUORDSA-N 0.000 description 1
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- AOJOEFVRHOZDFN-UHFFFAOYSA-N benzyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC1=CC=CC=C1 AOJOEFVRHOZDFN-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- INLLPKCGLOXCIV-UHFFFAOYSA-N bromoethene Chemical compound BrC=C INLLPKCGLOXCIV-UHFFFAOYSA-N 0.000 description 1
- MPMBRWOOISTHJV-UHFFFAOYSA-N but-1-enylbenzene Chemical compound CCC=CC1=CC=CC=C1 MPMBRWOOISTHJV-UHFFFAOYSA-N 0.000 description 1
- BMRWNKZVCUKKSR-UHFFFAOYSA-N butane-1,2-diol Chemical compound CCC(O)CO BMRWNKZVCUKKSR-UHFFFAOYSA-N 0.000 description 1
- RGTXVXDNHPWPHH-UHFFFAOYSA-N butane-1,3-diamine Chemical compound CC(N)CCN RGTXVXDNHPWPHH-UHFFFAOYSA-N 0.000 description 1
- 235000019437 butane-1,3-diol Nutrition 0.000 description 1
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- IWTBWSGPDGPTIB-UHFFFAOYSA-N butanoyl butaneperoxoate Chemical compound CCCC(=O)OOC(=O)CCC IWTBWSGPDGPTIB-UHFFFAOYSA-N 0.000 description 1
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- SPTHWAJJMLCAQF-UHFFFAOYSA-M ctk4f8481 Chemical compound [O-]O.CC(C)C1=CC=CC=C1C(C)C SPTHWAJJMLCAQF-UHFFFAOYSA-M 0.000 description 1
- OIWOHHBRDFKZNC-UHFFFAOYSA-N cyclohexyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OC1CCCCC1 OIWOHHBRDFKZNC-UHFFFAOYSA-N 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- LDCRTTXIJACKKU-ONEGZZNKSA-N dimethyl fumarate Chemical compound COC(=O)\C=C\C(=O)OC LDCRTTXIJACKKU-ONEGZZNKSA-N 0.000 description 1
- 229960004419 dimethyl fumarate Drugs 0.000 description 1
- LDCRTTXIJACKKU-ARJAWSKDSA-N dimethyl maleate Chemical compound COC(=O)\C=C/C(=O)OC LDCRTTXIJACKKU-ARJAWSKDSA-N 0.000 description 1
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 1
- AFOSIXZFDONLBT-UHFFFAOYSA-N divinyl sulfone Chemical compound C=CS(=O)(=O)C=C AFOSIXZFDONLBT-UHFFFAOYSA-N 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- NHOGGUYTANYCGQ-UHFFFAOYSA-N ethenoxybenzene Chemical compound C=COC1=CC=CC=C1 NHOGGUYTANYCGQ-UHFFFAOYSA-N 0.000 description 1
- XJELOQYISYPGDX-UHFFFAOYSA-N ethenyl 2-chloroacetate Chemical compound ClCC(=O)OC=C XJELOQYISYPGDX-UHFFFAOYSA-N 0.000 description 1
- AFIQVBFAKUPHOA-UHFFFAOYSA-N ethenyl 2-methoxyacetate Chemical compound COCC(=O)OC=C AFIQVBFAKUPHOA-UHFFFAOYSA-N 0.000 description 1
- FFYWKOUKJFCBAM-UHFFFAOYSA-N ethenyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OC=C FFYWKOUKJFCBAM-UHFFFAOYSA-N 0.000 description 1
- MEGHWIAOTJPCHQ-UHFFFAOYSA-N ethenyl butanoate Chemical compound CCCC(=O)OC=C MEGHWIAOTJPCHQ-UHFFFAOYSA-N 0.000 description 1
- GFJVXXWOPWLRNU-UHFFFAOYSA-N ethenyl formate Chemical compound C=COC=O GFJVXXWOPWLRNU-UHFFFAOYSA-N 0.000 description 1
- BLCTWBJQROOONQ-UHFFFAOYSA-N ethenyl prop-2-enoate Chemical compound C=COC(=O)C=C BLCTWBJQROOONQ-UHFFFAOYSA-N 0.000 description 1
- AFGACPRTZOCNIW-UHFFFAOYSA-N ethenylsulfanylethane Chemical compound CCSC=C AFGACPRTZOCNIW-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- XUCNUKMRBVNAPB-UHFFFAOYSA-N fluoroethene Chemical compound FC=C XUCNUKMRBVNAPB-UHFFFAOYSA-N 0.000 description 1
- 150000002334 glycols Chemical group 0.000 description 1
- 238000010559 graft polymerization reaction Methods 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- PBZROIMXDZTJDF-UHFFFAOYSA-N hepta-1,6-dien-4-one Chemical compound C=CCC(=O)CC=C PBZROIMXDZTJDF-UHFFFAOYSA-N 0.000 description 1
- SXCBDZAEHILGLM-UHFFFAOYSA-N heptane-1,7-diol Chemical compound OCCCCCCCO SXCBDZAEHILGLM-UHFFFAOYSA-N 0.000 description 1
- KETWBQOXTBGBBN-UHFFFAOYSA-N hex-1-enylbenzene Chemical compound CCCCC=CC1=CC=CC=C1 KETWBQOXTBGBBN-UHFFFAOYSA-N 0.000 description 1
- YYLZFVAZIBYRMJ-UHFFFAOYSA-N hex-3-yne-1,6-dithiol Chemical compound SCCC#CCCS YYLZFVAZIBYRMJ-UHFFFAOYSA-N 0.000 description 1
- QQHJDPROMQRDLA-UHFFFAOYSA-N hexadecanedioic acid Chemical compound OC(=O)CCCCCCCCCCCCCCC(O)=O QQHJDPROMQRDLA-UHFFFAOYSA-N 0.000 description 1
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- FGGJBCRKSVGDPO-UHFFFAOYSA-N hydroperoxycyclohexane Chemical compound OOC1CCCCC1 FGGJBCRKSVGDPO-UHFFFAOYSA-N 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 150000001261 hydroxy acids Chemical group 0.000 description 1
- GHXZPUGJZVBLGC-UHFFFAOYSA-N iodoethene Chemical compound IC=C GHXZPUGJZVBLGC-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 239000011968 lewis acid catalyst Substances 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- AWJZTPWDQYFQPQ-UHFFFAOYSA-N methyl 2-chloroprop-2-enoate Chemical compound COC(=O)C(Cl)=C AWJZTPWDQYFQPQ-UHFFFAOYSA-N 0.000 description 1
- NUMHUJZXKZKUBN-UHFFFAOYSA-N methyl 4-ethenylbenzoate Chemical compound COC(=O)C1=CC=C(C=C)C=C1 NUMHUJZXKZKUBN-UHFFFAOYSA-N 0.000 description 1
- OIGSXRLVIQGTAV-UHFFFAOYSA-N methyl ethenesulfonate Chemical compound COS(=O)(=O)C=C OIGSXRLVIQGTAV-UHFFFAOYSA-N 0.000 description 1
- XJRBAMWJDBPFIM-UHFFFAOYSA-N methyl vinyl ether Chemical compound COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 description 1
- XFLSMWXCZBIXLV-UHFFFAOYSA-N n,n-dimethyl-2-(4-methylpiperazin-1-yl)ethanamine Chemical compound CN(C)CCN1CCN(C)CC1 XFLSMWXCZBIXLV-UHFFFAOYSA-N 0.000 description 1
- UCAOGXRUJFKQAP-UHFFFAOYSA-N n,n-dimethyl-5-nitropyridin-2-amine Chemical compound CN(C)C1=CC=C([N+]([O-])=O)C=N1 UCAOGXRUJFKQAP-UHFFFAOYSA-N 0.000 description 1
- DDTRTGHABFCXDF-UHFFFAOYSA-N n-formyl-2-methylprop-2-enamide Chemical compound CC(=C)C(=O)NC=O DDTRTGHABFCXDF-UHFFFAOYSA-N 0.000 description 1
- KQSABULTKYLFEV-UHFFFAOYSA-N naphthalene-1,5-diamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1N KQSABULTKYLFEV-UHFFFAOYSA-N 0.000 description 1
- NZIDBRBFGPQCRY-UHFFFAOYSA-N octyl 2-methylprop-2-enoate Chemical compound CCCCCCCCOC(=O)C(C)=C NZIDBRBFGPQCRY-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000002902 organometallic compounds Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- RPQRDASANLAFCM-UHFFFAOYSA-N oxiran-2-ylmethyl prop-2-enoate Chemical compound C=CC(=O)OCC1CO1 RPQRDASANLAFCM-UHFFFAOYSA-N 0.000 description 1
- UCUUFSAXZMGPGH-UHFFFAOYSA-N penta-1,4-dien-3-one Chemical class C=CC(=O)C=C UCUUFSAXZMGPGH-UHFFFAOYSA-N 0.000 description 1
- QYZLKGVUSQXAMU-UHFFFAOYSA-N penta-1,4-diene Chemical compound C=CCC=C QYZLKGVUSQXAMU-UHFFFAOYSA-N 0.000 description 1
- RUOPINZRYMFPBF-UHFFFAOYSA-N pentane-1,3-diol Chemical compound CCC(O)CCO RUOPINZRYMFPBF-UHFFFAOYSA-N 0.000 description 1
- GLOBUAZSRIOKLN-UHFFFAOYSA-N pentane-1,4-diol Chemical compound CC(O)CCCO GLOBUAZSRIOKLN-UHFFFAOYSA-N 0.000 description 1
- YWAKXRMUMFPDSH-UHFFFAOYSA-N pentene Chemical compound CCCC=C YWAKXRMUMFPDSH-UHFFFAOYSA-N 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- QIWKUEJZZCOPFV-UHFFFAOYSA-N phenyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OC1=CC=CC=C1 QIWKUEJZZCOPFV-UHFFFAOYSA-N 0.000 description 1
- WRAQQYDMVSCOTE-UHFFFAOYSA-N phenyl prop-2-enoate Chemical compound C=CC(=O)OC1=CC=CC=C1 WRAQQYDMVSCOTE-UHFFFAOYSA-N 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920001748 polybutylene Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 1
- BOQSSGDQNWEFSX-UHFFFAOYSA-N propan-2-yl 2-methylprop-2-enoate Chemical compound CC(C)OC(=O)C(C)=C BOQSSGDQNWEFSX-UHFFFAOYSA-N 0.000 description 1
- BWJUFXUULUEGMA-UHFFFAOYSA-N propan-2-yl propan-2-yloxycarbonyloxy carbonate Chemical compound CC(C)OC(=O)OOC(=O)OC(C)C BWJUFXUULUEGMA-UHFFFAOYSA-N 0.000 description 1
- ZJLMKPKYJBQJNH-UHFFFAOYSA-N propane-1,3-dithiol Chemical group SCCCS ZJLMKPKYJBQJNH-UHFFFAOYSA-N 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- KIDHWZJUCRJVML-UHFFFAOYSA-N putrescine Chemical compound NCCCCN KIDHWZJUCRJVML-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000002940 repellent Effects 0.000 description 1
- 239000005871 repellent Substances 0.000 description 1
- YYMBJDOZVAITBP-UHFFFAOYSA-N rubrene Chemical compound C1=CC=CC=C1C(C1=C(C=2C=CC=CC=2)C2=CC=CC=C2C(C=2C=CC=CC=2)=C11)=C(C=CC=C2)C2=C1C1=CC=CC=C1 YYMBJDOZVAITBP-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- BWYYYTVSBPRQCN-UHFFFAOYSA-M sodium;ethenesulfonate Chemical compound [Na+].[O-]S(=O)(=O)C=C BWYYYTVSBPRQCN-UHFFFAOYSA-M 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical compound C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 1
- 229920000638 styrene acrylonitrile Polymers 0.000 description 1
- 150000003440 styrenes Chemical class 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- YODZTKMDCQEPHD-UHFFFAOYSA-N thiodiglycol Chemical compound OCCSCCO YODZTKMDCQEPHD-UHFFFAOYSA-N 0.000 description 1
- 229950006389 thiodiglycol Drugs 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 150000003606 tin compounds Chemical class 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- 150000004998 toluenediamines Chemical class 0.000 description 1
- 238000012549 training Methods 0.000 description 1
- VJDDQSBNUHLBTD-UHFFFAOYSA-N trans-crotonic acid-anhydride Natural products CC=CC(=O)OC(=O)C=CC VJDDQSBNUHLBTD-UHFFFAOYSA-N 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
- 229940029284 trichlorofluoromethane Drugs 0.000 description 1
- DXNCZXXFRKPEPY-UHFFFAOYSA-N tridecanedioic acid Chemical compound OC(=O)CCCCCCCCCCCC(O)=O DXNCZXXFRKPEPY-UHFFFAOYSA-N 0.000 description 1
- QXJQHYBHAIHNGG-UHFFFAOYSA-N trimethylolethane Chemical compound OCC(C)(CO)CO QXJQHYBHAIHNGG-UHFFFAOYSA-N 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 229920006305 unsaturated polyester Polymers 0.000 description 1
- KOZCZZVUFDCZGG-UHFFFAOYSA-N vinyl benzoate Chemical compound C=COC(=O)C1=CC=CC=C1 KOZCZZVUFDCZGG-UHFFFAOYSA-N 0.000 description 1
- 229920001567 vinyl ester resin Polymers 0.000 description 1
- FUSUHKVFWTUUBE-UHFFFAOYSA-N vinyl methyl ketone Natural products CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/28—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen characterised by the compounds used containing active hydrogen
- C08G18/40—High-molecular-weight compounds
- C08G18/63—Block or graft polymers obtained by polymerising compounds having carbon-to-carbon double bonds on to polymers
- C08G18/635—Block or graft polymers obtained by polymerising compounds having carbon-to-carbon double bonds on to polymers onto unsaturated polymers
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F290/00—Macromolecular compounds obtained by polymerising monomers on to polymers modified by introduction of aliphatic unsaturated end or side groups
- C08F290/08—Macromolecular compounds obtained by polymerising monomers on to polymers modified by introduction of aliphatic unsaturated end or side groups on to polymers modified by introduction of unsaturated side groups
- C08F290/14—Polymers provided for in subclass C08G
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyurethanes Or Polyureas (AREA)
- Graft Or Block Polymers (AREA)
- Macromonomer-Based Addition Polymer (AREA)
- Polymerisation Methods In General (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00311809A US3823201A (en) | 1972-12-04 | 1972-12-04 | Highly-stable graft copolymer dispersions in polyols containing unsaturation and polyurethanes prepared therefrom |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2359617A1 DE2359617A1 (de) | 1974-06-27 |
| DE2359617B2 true DE2359617B2 (de) | 1981-06-04 |
Family
ID=23208584
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2359617A Ceased DE2359617B2 (de) | 1972-12-04 | 1973-11-30 | Stabile Dispersionen von Pfropfcopolymerisaten |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3823201A (Direct) |
| JP (1) | JPS5137228B2 (Direct) |
| AU (1) | AU477332B2 (Direct) |
| BE (1) | BE808151A (Direct) |
| CH (1) | CH592711A5 (Direct) |
| DE (1) | DE2359617B2 (Direct) |
| ES (1) | ES421049A1 (Direct) |
| FR (1) | FR2208922B1 (Direct) |
| GB (1) | GB1411646A (Direct) |
| IT (1) | IT999874B (Direct) |
| NL (1) | NL7316518A (Direct) |
Families Citing this family (121)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1022300A (en) * | 1971-08-30 | 1977-12-06 | Union Carbide Corporation | Polymer/polyols and process for production thereof |
| US4282331A (en) * | 1973-11-20 | 1981-08-04 | Union Carbide Corporation | Polyurethane foam prepared from a copolymer/polyol composition |
| US3953393A (en) * | 1974-01-07 | 1976-04-27 | Basf Wyandotte Corporation | Low temperature process for the preparation of graft copolymer dispersions |
| US4014846A (en) * | 1974-04-29 | 1977-03-29 | Basf Wyandotte Corporation | Low-viscous, stable polymer dispersions and polyurethanes prepared therefrom |
| US3933937A (en) * | 1974-05-15 | 1976-01-20 | Mccord Corporation | Molding-grade polyurethane |
| US4104236A (en) * | 1974-08-28 | 1978-08-01 | Union Carbide Corporation | Liquid polymer/polyols and polyurethane elastomers based thereon |
| CA1077641A (en) * | 1974-08-28 | 1980-05-13 | Donald W. Simroth | Polymer/polyols and process for production thereof |
| JPS5167397A (en) * | 1974-12-10 | 1976-06-10 | Myoshi Yushi Kk | Horiuretanno seizoho |
| US4172825A (en) * | 1975-07-10 | 1979-10-30 | Union Carbide Corporation | Polymer/polyols and process for production thereof |
| US4049590A (en) * | 1975-11-24 | 1977-09-20 | Basf Aktiengesellschaft | Manufacture of polyurethane compositions |
| US4021384A (en) * | 1975-12-22 | 1977-05-03 | Texaco Development Corporation | Infused polymer containing polyols and polyurethane compositions based thereon |
| US4021383A (en) * | 1975-12-22 | 1977-05-03 | Texaco Development Corporation | Infused polymer containing monohydric compounds and polyurethane compositions based thereon |
| JPS5281394A (en) * | 1975-12-29 | 1977-07-07 | Showa Highpolymer Co Ltd | Curable resin compositions |
| US4049636A (en) | 1976-02-25 | 1977-09-20 | Uniroyal, Inc. | Thermally stable polyurethane elastomer useful in molding flexible automobile exterior body parts |
| CA1092590A (en) * | 1976-06-24 | 1980-12-30 | Naresh R. Shah | Polymer/polyol compositions, processes for making same and processes for making polyurethane products therefrom |
| US4125505A (en) * | 1976-07-06 | 1978-11-14 | Union Carbide Corporation | Polymer/polyols from high ethylene oxide content polyols |
| US4226756A (en) * | 1976-07-06 | 1980-10-07 | Union Carbide Corporation | Mixtures of extenders and polyols or polymer/polyols useful in polyurethane production |
| US4264755A (en) * | 1976-11-19 | 1981-04-28 | Mobay Chemical Corporation | Hydroxy-functional vinyl copolymers |
| CA1123536A (en) * | 1976-12-20 | 1982-05-11 | Russell Van Cleve | Polymer/polyols via non-aqueous dispersion stabilizers |
| US4359542A (en) * | 1977-03-22 | 1982-11-16 | Olin Corporation | Graft copolymers from unsaturated monomers and azo di-ester polyols and polyurethanes prepared therefrom |
| US4190711A (en) * | 1977-09-29 | 1980-02-26 | Union Carbide Corporation | Thermoplastic polyether polyurethane elastomers |
| US4176218A (en) * | 1977-10-17 | 1979-11-27 | Basf Wyandotte Corporation | High resilience flexible foamed polyurethanes, foamable mixtures and process therefor |
| US4165432A (en) * | 1977-10-18 | 1979-08-21 | Olin Corporation | Peroxy di-ester polyols |
| US4153643A (en) * | 1977-10-18 | 1979-05-08 | Olin Corporation | Graft copolymers from unsaturated monomers and peroxy di-ester polyols and polyurethanes prepared therefrom |
| US4210727A (en) * | 1977-10-18 | 1980-07-01 | Olin Corporation | Graft copolymers from unsaturated monomers and peroxy di-ester polyols and polyurethanes prepared therefrom |
| US4148840A (en) * | 1978-03-29 | 1979-04-10 | Union Carbide Corporation | Polymer/polyol compositions made from preformed polymer/polyols, processes for making same and processes for making polyurethane products therefrom |
| US4181781A (en) * | 1978-05-30 | 1980-01-01 | Olin Corporation | In-situ polyvinyl grafting of polyurethanes |
| US4198488A (en) * | 1978-06-26 | 1980-04-15 | Union Carbide Corporation | Polymer-polyols and polyurethanes based thereon |
| US4312973A (en) * | 1978-08-10 | 1982-01-26 | Union Carbide Corporation | Polyurethane elastomers prepared from polyol or polymer/polyol-chain extender mixtures |
| US4202956A (en) * | 1978-11-13 | 1980-05-13 | Basf Wyandotte Corporation | Thixotropic isocyanate-terminated prepolymers and use in the preparation of polyurethane coating compositions |
| US4312963A (en) * | 1979-01-25 | 1982-01-26 | Olin Corporation | Stabilization of high resilience polyurethane foam |
| US4327194A (en) * | 1979-01-25 | 1982-04-27 | Olin Corporation | Flexible polyurethane foam prepared from a reaction mixture which _includes a polyether triol containing an effectively dispersed finely _divided solid particulate material |
| US4338407A (en) * | 1979-01-25 | 1982-07-06 | Olin Corporation | Stabilization of high resilience polyurethane foam |
| US4350780A (en) * | 1979-04-03 | 1982-09-21 | Union Carbide Corporation | Polyurethanes made with polymer/polyols prepared via preformed stabilizers |
| US4242249A (en) * | 1979-04-03 | 1980-12-30 | Union Carbide Corporation | Polymer/polyols via non-aqueous dispersion stabilizers |
| JPS5614519A (en) * | 1979-07-13 | 1981-02-12 | Asahi Denka Kogyo Kk | Production of polyurethane product |
| US4460715A (en) * | 1979-11-23 | 1984-07-17 | The Dow Chemical Company | Stable dispersions of polymers in polyfunctional compounds having a plurality of active hydrogens and polyurethanes produced therefrom |
| US4390645A (en) * | 1979-11-23 | 1983-06-28 | The Dow Chemical Company | Stable dispersions of polymers in polyfunctional compounds having a plurality of active hydrogens and polyurethanes therefrom |
| US4342840A (en) * | 1979-12-25 | 1982-08-03 | Asahi Glass Company, Ltd. | Process for producing polymer polyol |
| JPS5690818A (en) * | 1979-12-25 | 1981-07-23 | Asahi Glass Co Ltd | Polymer polyol and production of polyurethane therefrom |
| ES8100668A1 (es) * | 1980-01-08 | 1980-12-01 | Alcudia Sa | Procedimiento para preparar polioleteres polimericos |
| US4327005A (en) * | 1980-08-18 | 1982-04-27 | Basf Wyandotte Corporation | Process for the preparation of stabilized polymer dispersions in polyol at low temperature |
| US4334049A (en) * | 1980-08-18 | 1982-06-08 | Basf Wyandotte Corporation | Process for the preparation of finely divided solid polymers in polyol |
| US4332716A (en) * | 1980-12-10 | 1982-06-01 | Union Carbide Corporation | Polymer/polyisocyanate compositions, processes for making same and processes for making polyurethane products therefrom |
| US4539340A (en) * | 1981-07-01 | 1985-09-03 | Union Carbide Corporation | Half-ester adducts and polymer-polyols useful in the preparation of improved plastics, including polyurethane foams, elastomers and the like |
| US4357430A (en) * | 1981-10-02 | 1982-11-02 | Union Carbide Corporation | Polymer/polyols, methods for making same and polyurethanes based thereon |
| US4431754A (en) * | 1982-03-01 | 1984-02-14 | The Dow Chemical Company | Low viscosity polymer polyols via dilution |
| US4458038A (en) * | 1982-04-01 | 1984-07-03 | Basf Wyandotte Corporation | Process for the preparation of white graft polymer dispersions and flame-retardant polyurethane foams |
| US4690956A (en) * | 1982-04-01 | 1987-09-01 | Basf Corporation | Process for the preparation of graft polymer dispersions and flame-retardant polyurethane foams |
| US4689354A (en) * | 1982-04-01 | 1987-08-25 | Basf Corporation | Process for the preparation of white graft polymer dispersions and flame-retardant polyurethane foams |
| US4454255A (en) * | 1982-04-01 | 1984-06-12 | Basf Wyandotte Corporation | Process for the preparation of white graft polymer dispersions and flame-retardant polyurethane foams |
| USRE33291E (en) * | 1982-04-01 | 1990-08-07 | Basf Corporation | Process for the preparation of white graft polymer dispersions and flame-retardant polyurethane foams |
| US4640935A (en) * | 1982-12-09 | 1987-02-03 | The Dow Chemical Company | Addition polymerizable adducts for nonaqueous dispersions |
| US4593051A (en) * | 1983-02-07 | 1986-06-03 | Union Carbide Corporation | Photocopolymerizable compositons based on epoxy and polymer/hydroxyl-containing organic materials |
| US4493908A (en) * | 1983-02-17 | 1985-01-15 | The Dow Chemical Company | Stable dispersions of polymers in polyfunctional compounds having a plurality of active hydrogens |
| US4477603A (en) * | 1983-02-17 | 1984-10-16 | The Dow Chemical Company | Stable dispersions of polymers in polyfunctional active hydrogen compounds and polyurethanes based thereon |
| US4500675A (en) * | 1983-03-07 | 1985-02-19 | The Dow Chemical Company | Stable dispersions of polymers in polyfunctional compounds having a plurality of active hydrogens |
| US4529745A (en) * | 1983-05-02 | 1985-07-16 | Jim Walter Resources, Inc. | Unsaturated polyoxyalkylene adduct/fumarate diester reaction product for cellular foam stabilization |
| US4504633A (en) * | 1983-06-01 | 1985-03-12 | Stauffer Chemical Company | Modified poly(oxazolidone/urethane) compositions |
| US4585831A (en) * | 1983-06-06 | 1986-04-29 | Union Carbide Corporation | Epoxy-modified polyols and polymer-polyols useful in the preparation of improved plastics including polyurethane foams, elastomers and the like |
| US4647624A (en) * | 1983-06-06 | 1987-03-03 | Union Carbide Corporation | Epoxy-modified polyols and polymer-polyols useful in the preparation of improved plastics, including polyurethane foams, elastomers and the like |
| US4594366A (en) * | 1983-06-29 | 1986-06-10 | Union Carbide Corporation | Connected branched polyols and polyurethanes based thereon |
| US4554295A (en) * | 1983-07-13 | 1985-11-19 | Eastern Foam Products, Inc. | Method for preparing flexible polyurethane foams from polymer/polyols and improved polyurethane foam product |
| US4542165A (en) * | 1983-09-08 | 1985-09-17 | Sanyo Chemical Industries, Ltd. | Polyurethane based on epoxy-containing polymer polyol and process for making the same |
| US4581418A (en) * | 1984-08-23 | 1986-04-08 | The Dow Chemical Company | Process for preparing copolymer polyols |
| US4652589A (en) * | 1985-02-08 | 1987-03-24 | Union Carbide Corporation | Polymer/polyols having improved combustion resistance and intrinsic viscosity, methods of making same and polyurethanes prepared therefrom |
| US4623674A (en) | 1985-06-21 | 1986-11-18 | Union Carbide Corporation | Polymer/polyols of substituted styrenes and polyurethanes made therefrom |
| US4683272A (en) * | 1985-09-26 | 1987-07-28 | Texaco Inc. | Polymer polyols derived from novel dispersing media |
| US4686240A (en) | 1985-10-25 | 1987-08-11 | Union Carbide Corporation | Process for producing polyurethane foams using foam modifiers |
| US5021507A (en) * | 1986-05-05 | 1991-06-04 | National Starch And Chemical Investment Holding Corporation | Arcylic modified reactive urethane hot melt adhesive compositions |
| US4997857A (en) * | 1986-09-30 | 1991-03-05 | Arco Chemical Technology, Inc. | Stabilizers for polymer/polyols |
| DE3643789A1 (de) * | 1986-12-20 | 1988-06-30 | Bayer Ag | Thermoplastisch verarbeitbare, im wesentlichen lineare poly-(alpha)-aryl-olefin/polyurethan-blockcopolymere, verfahren zu deren herstellung und deren verwendung |
| US4797501A (en) * | 1986-12-31 | 1989-01-10 | Union Carbide Corporation | Silicone-based stabilizers useful in the preparation of improved polyurethane foams |
| US4742113A (en) * | 1987-02-20 | 1988-05-03 | Lord Corporation | Structural adhesive compositions |
| BE1002597A3 (fr) * | 1988-11-17 | 1991-04-09 | New Carbochimique S A | Copolymeres prestabilisants et stabilisants greffes, leur preparation, procede d'obtention de dispersions de polymeres-polyols et procede d'obtention de mousses de polyurethanne. |
| US5482995A (en) * | 1989-10-19 | 1996-01-09 | Elf Atochem S.A. | Grafted block copolymers, process for their manufacture and use of these copolymers |
| US5196476A (en) * | 1990-06-12 | 1993-03-23 | Arco Chemical Technology, L.P. | Polymer/polyol and preformed stabilizer systems |
| US5192812A (en) * | 1991-02-12 | 1993-03-09 | Union Carbide Chemicals & Plastics Technology Corporation | Cell openers for urethane foam surfactants |
| US5200434A (en) * | 1991-12-30 | 1993-04-06 | Union Carbide Chemicals & Plastics Technology Corporation | Amide derivatives of alkylene oxide polyethers and their uses in polyurethane foam manufacture |
| US5288766A (en) * | 1992-02-28 | 1994-02-22 | Basf Corporation | Poyurea based dispersions, foams prepared therefrom, and a process for the preparation therein |
| US5382642A (en) * | 1993-07-28 | 1995-01-17 | Arco Chemical Technology, L.P. | Copolymers of allyl alcohol propoxylates and vinyl aromatic monomers |
| US5606003A (en) | 1994-09-01 | 1997-02-25 | Gencorp Inc. | Primerless urethane adhesive compositions |
| DE4431226A1 (de) * | 1994-09-02 | 1996-03-07 | Bayer Ag | Niedrigviskose, stabile agglomeratfreie Polymerpolyole, ein Verfahren zu ihrer Herstellung und ihre Verwendung zur Herstellung von Polyurethankunststoffen |
| US5554662A (en) * | 1995-03-10 | 1996-09-10 | Bayer Adtiengesellschaft | Low viscosity polymer polyols a process for their production as well as the manufacture of polyurethane from materials |
| DE19526921A1 (de) * | 1995-07-24 | 1997-01-30 | Bayer Ag | Niedrigviskose Polymerpolyole, ein Verfahren zu ihrer Herstellung sowie ihre Verwendung zur Herstellung von Polyurethanschaumstoffen |
| MX9604872A (es) | 1995-10-27 | 1997-04-30 | Basf Corp | Composiciones de poliol que proporcionan resistencia mejorada a las llamas y factores k curados a las espumas de poliuretano. |
| EP0771829A1 (en) | 1995-10-30 | 1997-05-07 | Basf Corporation | Process of making an integral skin polyurethane article |
| US5688861A (en) | 1995-11-30 | 1997-11-18 | Arco Chemical Technology, L.P. | Process for the preparation of polyol polymer dispersions |
| DE19547632A1 (de) | 1995-12-20 | 1997-06-26 | Bayer Ag | Niedrigviskose Polymerpolyole, ein Verfahren zu ihrer Herstellung sowie ihre Verwendung zur Herstellung von Polyurethanschaumstoffen |
| US6624209B2 (en) | 1999-07-30 | 2003-09-23 | Sanyo Chemical Industries, Ltd. | Polymer polyol composition, process for producing the same, and process for producing polyurethane resin |
| US6756414B2 (en) | 1999-07-30 | 2004-06-29 | Sanyo Chemical Industries, Ltd. | Polymer polyol composition, process for producing the same, and process for producing polyurethane resin |
| AU764900B2 (en) | 2000-11-28 | 2003-09-04 | Evonik Goldschmidt Gmbh | Use of mixtures of organofunctionally modified polysiloxanes with branched alcohols in the production of flexible polyurethane foams |
| US6582771B1 (en) | 2002-05-03 | 2003-06-24 | Bayer Corporation | Method for producing a polyurethane/geofabric composite |
| US6833390B2 (en) * | 2002-07-22 | 2004-12-21 | Bayer Polymers Llc | Process for preparing closed-cell water-blown rigid polyurethane foams having improved mechanical properties |
| US7166358B2 (en) * | 2004-01-13 | 2007-01-23 | Lexmark International, Inc. | Polyurethane rolls with graft polyacrylate curatives |
| US7151154B2 (en) * | 2004-01-13 | 2006-12-19 | Lexmark International, Inc. | Graft polymer curatives and polyurethanes formed therefrom |
| US7034097B2 (en) * | 2004-01-13 | 2006-04-25 | Lexmark International, Inc. | Polyurethane elastomers with combination of curatives |
| US7347808B2 (en) * | 2004-01-13 | 2008-03-25 | Lexmark International, Inc. | Polyurethane rolls and methods of manufacturing |
| US7179882B2 (en) * | 2004-08-02 | 2007-02-20 | Bayer Materialscience Llc | Low viscosity polymer polyols |
| US7759423B2 (en) * | 2004-08-02 | 2010-07-20 | Bayer Materialscience Llc | Polymer polyols with ultra-high solids contents |
| DE102005050701A1 (de) * | 2005-10-22 | 2007-05-03 | Bayer Materialscience Ag | Verfahren zur Herstellung von PIPA-Polyolen |
| KR100839061B1 (ko) * | 2006-12-15 | 2008-06-19 | 금호석유화학 주식회사 | 무수말레인산을 이용한 폴리머 폴리올을 위한 제조용 안정제 |
| US8946313B2 (en) | 2011-12-16 | 2015-02-03 | Bayer Materialscience Llc | Hybrid PHD/PMPO polyols for polyurethane foam applications |
| US10066047B2 (en) | 2012-02-02 | 2018-09-04 | Covestro Llc | Polyurethane foams with decreased aldehyde emissions, a process for preparing these foams and a method for decreasing aldehyde in polyurethane foams |
| US20130289150A1 (en) | 2012-04-26 | 2013-10-31 | Bayer Materialscience Ag | Viscoelastic polyurethane foams |
| US9163099B2 (en) | 2013-03-08 | 2015-10-20 | Bayer Materialscience Llc | Polybutadiene modified polymer polyols, foams prepared from polybutadiene modified polymer polyols, and processes for the production thereof |
| DE102013217395A1 (de) | 2013-09-02 | 2015-03-05 | Evonik Industries Ag | Verwendung von Mischungen organofunktionell modifizierter Polysiloxane mit Amiden bei der Herstellung von Polyurethanweichschäumen |
| US9951174B2 (en) | 2015-05-20 | 2018-04-24 | Covestro Llc | Polyol compositions, a process for the production of these polyol compositions, and their use in the production of open celled polyurethane foams having high airflow |
| CN106519148B (zh) * | 2016-11-03 | 2019-04-19 | 万华化学集团股份有限公司 | 一种梳型大分子单体及其制备方法,一种聚合物多元醇及聚氨酯泡沫 |
| JP7162609B2 (ja) | 2017-03-15 | 2022-10-28 | コベストロ・エルエルシー | 温度感度が低減した改良粘弾性フォーム用ポリオール |
| US10766998B2 (en) | 2017-11-21 | 2020-09-08 | Covestro Llc | Flexible polyurethane foams |
| CN111349229B (zh) | 2018-12-21 | 2021-06-29 | 万华化学集团股份有限公司 | 稳定分散剂及其在制备共聚物多元醇中的应用 |
| US11795265B2 (en) | 2018-12-26 | 2023-10-24 | Wanhua Chemical Group Co., Ltd. | Macromonomeric stabilizer, preparation method thereof, and method for preparing polymeric polyol |
| JP2022552827A (ja) | 2019-10-09 | 2022-12-20 | コベストロ・エルエルシー | 光学及び赤外イメージングを用いたポリウレタン発泡体製品を製造する方法、システム、及びコンピュータープログラム製品 |
| CN112708124B (zh) * | 2019-10-24 | 2022-12-09 | 中国石油化工股份有限公司 | 一种高官能度聚醚多元醇的制备方法及其应用 |
| JP7788382B2 (ja) * | 2020-01-06 | 2025-12-18 | ダウ グローバル テクノロジーズ エルエルシー | ポリマーポリオールを作製するためのマクロマー及びプロセス |
| KR102553303B1 (ko) * | 2020-07-08 | 2023-07-07 | 주식회사 아이센스 | 관능화된 열가소성 폴리우레탄, 이의 제조방법 및 이를 이용한 의료용 고기능성 복합재료의 제조 방법 및 이를 포함하는 의료장치 |
| US11572433B2 (en) | 2021-03-12 | 2023-02-07 | Covestro Llc | In-situ formed polyols, a process for their preparation, foams prepared from these in-situ formed polyols and a process for their preparation |
| US11718705B2 (en) | 2021-07-28 | 2023-08-08 | Covestro Llc | In-situ formed polyether polyols, a process for their preparation, and a process for the preparation of polyurethane foams |
| KR102701706B1 (ko) * | 2021-08-30 | 2024-09-02 | 금호석유화학 주식회사 | 안정제, 그를 이용하여 제조된 폴리머 폴리올 및 그 제조방법 |
| CN114539507B (zh) * | 2021-12-30 | 2023-08-29 | 重庆大学 | 一种阻燃耐水解聚氨酯气凝胶及其制备方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE617230A (Direct) * | 1961-05-05 | |||
| FR2018190A1 (Direct) * | 1968-09-16 | 1970-05-29 | Dow Chemical Co | |
| BE759006A (fr) * | 1969-11-20 | 1971-05-17 | Marles Kuhlmann Wyandotte | Copolymeres greffes et preparation de polyurethanes |
-
1972
- 1972-12-04 US US00311809A patent/US3823201A/en not_active Expired - Lifetime
-
1973
- 1973-11-30 DE DE2359617A patent/DE2359617B2/de not_active Ceased
- 1973-11-30 ES ES421049A patent/ES421049A1/es not_active Expired
- 1973-12-03 GB GB5583973A patent/GB1411646A/en not_active Expired
- 1973-12-03 NL NL7316518A patent/NL7316518A/xx not_active Application Discontinuation
- 1973-12-03 CH CH1689773A patent/CH592711A5/xx not_active IP Right Cessation
- 1973-12-03 AU AU63129/73A patent/AU477332B2/en not_active Expired
- 1973-12-03 IT IT70542/73A patent/IT999874B/it active
- 1973-12-03 BE BE138457A patent/BE808151A/xx not_active IP Right Cessation
- 1973-12-03 FR FR7342966A patent/FR2208922B1/fr not_active Expired
- 1973-12-04 JP JP48134939A patent/JPS5137228B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES421049A1 (es) | 1976-07-01 |
| BE808151A (fr) | 1974-06-04 |
| CH592711A5 (Direct) | 1977-11-15 |
| GB1411646A (en) | 1975-10-29 |
| FR2208922B1 (Direct) | 1977-09-30 |
| AU6312973A (en) | 1975-06-05 |
| JPS5137228B2 (Direct) | 1976-10-14 |
| NL7316518A (Direct) | 1974-06-06 |
| FR2208922A1 (Direct) | 1974-06-28 |
| JPS501189A (Direct) | 1975-01-08 |
| US3823201A (en) | 1974-07-09 |
| IT999874B (it) | 1976-03-10 |
| AU477332B2 (en) | 1976-10-21 |
| DE2359617A1 (de) | 1974-06-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2359617B2 (de) | Stabile Dispersionen von Pfropfcopolymerisaten | |
| DE2500274A1 (de) | Pfropfmischpolymerisate | |
| DE2242476C2 (de) | Fließfähige bzw. flüssige Polymer/Polyol-Masse, Verfahren zu ihrer Herstellung und ihre Verwendung zur Herstellung von Polyurethanschäumen | |
| DE2519099C3 (de) | Verfahren zur Herstellung einer niederviskosen, stabilen Polymerdispersion | |
| DE2912330A1 (de) | Polymer/polyol-praeparate, verfahren zu deren herstellung und verfahren zur herstellung von polyurethanen aus denselben | |
| DE69302855T2 (de) | Optische Material mit hohem Brechungsindex und Verfahren zur Herstellung | |
| DE60209596T2 (de) | Polyurethanschaum-Zusammensetzung verwendbar in Schuhsohlen und Verfahren zu ihrer Herstellung | |
| DE69518423T2 (de) | Kontinuierliches Verfahren zur Herstellung von sehr stabilen, feinstteiligen, niedrig viskösen Polymerpolyolen mit niedriger durchmittlicher Teilchengrösse | |
| DE2056693A1 (de) | Verfahren zur Herstellung von flussigen, transparenten Pfropfmisch polymeren | |
| DE69804507T3 (de) | Polyurethanschaumstoff für schuhsohlen | |
| DE2450682A1 (de) | Pfropfmischpolymerdispersionen | |
| DE69502388T2 (de) | Zusammensetzung von sich gegenseitig durchdringenden polymeren strukturen | |
| DE1962501A1 (de) | Polyurethanschaumstrukturen mit einer aus einem Stueck bestehenden Haut,die verbesserte Eigenschaften aufweisen,und ein Verfahren zu deren Herstellung | |
| EP1029877B1 (de) | Verfahren zur Herstellung stabilisierter, feindisperser und niedrigviskoser Polymerpolyole mit hohen Gehalt an Styrol oder Styrol-Copolymerisaten | |
| DE19526921A1 (de) | Niedrigviskose Polymerpolyole, ein Verfahren zu ihrer Herstellung sowie ihre Verwendung zur Herstellung von Polyurethanschaumstoffen | |
| DE2545268B2 (de) | Polyurethanverbundstoff | |
| DE2448686A1 (de) | Dispersionen von pfropfmischpolymerisaten | |
| EP0002201B1 (de) | Dentalformkörper auf Basis von Polymethacrylaten, Verfahren zu ihrer Herstellung sowie Verwendung von Polymethacrylatmassen | |
| DE3401878A1 (de) | Polymerdispersionen und ihre verwendung | |
| DE69520802T2 (de) | Dispersionen auf der Basis von Pfropfpolymeren ein drittes Monomer enthaltend und daraus hergestellte Polyurethanschäume mit reduzierter Schrumpfneigung | |
| EP0477671A2 (de) | Verfahren zur Herstellung von ABS-Formmassen | |
| DE2728284C2 (de) | Polymer/Polyol-Präparate und deren Verwendung zur Herstellung von Polyurethan | |
| DE3031886A1 (de) | Waessrige emulsion eines fluessigen organischen peroxids, verfahren zu ihrer herstellung und ihre verwendung zum behandeln von glasfasern | |
| DE3854839T2 (de) | Verfahren zur herstellung thermoformbarer polyurethanschaumerzeugnisse | |
| DE2756601C2 (Direct) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8263 | Opposition against grant of a patent | ||
| 8235 | Patent refused |