DE2349799C3 - Klebstoffe auf Basis von a - Cyanacrylsäure-Estern - Google Patents
Klebstoffe auf Basis von a - Cyanacrylsäure-EsternInfo
- Publication number
- DE2349799C3 DE2349799C3 DE2349799A DE2349799A DE2349799C3 DE 2349799 C3 DE2349799 C3 DE 2349799C3 DE 2349799 A DE2349799 A DE 2349799A DE 2349799 A DE2349799 A DE 2349799A DE 2349799 C3 DE2349799 C3 DE 2349799C3
- Authority
- DE
- Germany
- Prior art keywords
- lactones
- acid esters
- cyanoacrylic acid
- adhesives based
- cyanoacrylate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000853 adhesive Substances 0.000 title claims description 12
- 230000001070 adhesive effect Effects 0.000 title claims description 12
- 239000000203 mixture Substances 0.000 claims description 11
- 150000002148 esters Chemical class 0.000 claims description 8
- IJVRPNIWWODHHA-UHFFFAOYSA-N 2-cyanoprop-2-enoic acid Chemical compound OC(=O)C(=C)C#N IJVRPNIWWODHHA-UHFFFAOYSA-N 0.000 claims description 2
- 150000002596 lactones Chemical class 0.000 description 15
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical group O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 6
- -1 alkyl radical Chemical group 0.000 description 6
- ZYGHJZDHTFUPRJ-UHFFFAOYSA-N coumarin Chemical compound C1=CC=C2OC(=O)C=CC2=C1 ZYGHJZDHTFUPRJ-UHFFFAOYSA-N 0.000 description 6
- 239000004014 plasticizer Substances 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 229960000956 coumarin Drugs 0.000 description 3
- 235000001671 coumarin Nutrition 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000002562 thickening agent Substances 0.000 description 3
- WNZQDUSMALZDQF-UHFFFAOYSA-N 2-benzofuran-1(3H)-one Chemical compound C1=CC=C2C(=O)OCC2=C1 WNZQDUSMALZDQF-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 229930188620 butyrolactone Natural products 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- MLIREBYILWEBDM-UHFFFAOYSA-N cyanoacetic acid Chemical compound OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 description 2
- FGBJXOREULPLGL-UHFFFAOYSA-N ethyl cyanoacrylate Chemical compound CCOC(=O)C(=C)C#N FGBJXOREULPLGL-UHFFFAOYSA-N 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 238000010526 radical polymerization reaction Methods 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- ULKFLOVGORAZDI-UHFFFAOYSA-N 3,3-dimethyloxetan-2-one Chemical compound CC1(C)COC1=O ULKFLOVGORAZDI-UHFFFAOYSA-N 0.000 description 1
- VMUXSMXIQBNMGZ-UHFFFAOYSA-N 3,4-dihydrocoumarin Chemical compound C1=CC=C2OC(=O)CCC2=C1 VMUXSMXIQBNMGZ-UHFFFAOYSA-N 0.000 description 1
- 241000219112 Cucumis Species 0.000 description 1
- 235000015510 Cucumis melo subsp melo Nutrition 0.000 description 1
- 229920001651 Cyanoacrylate Polymers 0.000 description 1
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000002879 Lewis base Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- MWCLLHOVUTZFKS-UHFFFAOYSA-N Methyl cyanoacrylate Chemical compound COC(=O)C(=C)C#N MWCLLHOVUTZFKS-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000004830 Super Glue Substances 0.000 description 1
- FJJCIZWZNKZHII-UHFFFAOYSA-N [4,6-bis(cyanoamino)-1,3,5-triazin-2-yl]cyanamide Chemical compound N#CNC1=NC(NC#N)=NC(NC#N)=N1 FJJCIZWZNKZHII-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 238000010539 anionic addition polymerization reaction Methods 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 230000000368 destabilizing effect Effects 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- LFJLAWZRNOKTDN-UHFFFAOYSA-N dodecyl 2-cyanoprop-2-enoate Chemical compound CCCCCCCCCCCCOC(=O)C(=C)C#N LFJLAWZRNOKTDN-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- JJJFUHOGVZWXNQ-UHFFFAOYSA-N enbucrilate Chemical compound CCCCOC(=O)C(=C)C#N JJJFUHOGVZWXNQ-UHFFFAOYSA-N 0.000 description 1
- 229950010048 enbucrilate Drugs 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 229940053009 ethyl cyanoacrylate Drugs 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- WVXQYJXDTJWWEA-UHFFFAOYSA-N heptyl 2-cyanoprop-2-enoate Chemical compound CCCCCCCOC(=O)C(=C)C#N WVXQYJXDTJWWEA-UHFFFAOYSA-N 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- QRWOVIRDHQJFDB-UHFFFAOYSA-N isobutyl cyanoacrylate Chemical compound CC(C)COC(=O)C(=C)C#N QRWOVIRDHQJFDB-UHFFFAOYSA-N 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 150000007527 lewis bases Chemical class 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- CXMXRPHRNRROMY-UHFFFAOYSA-N n-Decanedioic acid Natural products OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 1
- SXRFXXNXVPFXDU-UHFFFAOYSA-N pentyl 2-cyanoprop-2-enoate Chemical class CCCCCOC(=O)C(=C)C#N SXRFXXNXVPFXDU-UHFFFAOYSA-N 0.000 description 1
- IPDQIHIYQHAUCO-UHFFFAOYSA-N phenyl 2-cyanoprop-2-enoate Chemical compound N#CC(=C)C(=O)OC1=CC=CC=C1 IPDQIHIYQHAUCO-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 125000005498 phthalate group Chemical class 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- ITCZEZQMUWEPQP-UHFFFAOYSA-N prop-2-enyl 2-cyanoprop-2-enoate Chemical compound C=CCOC(=O)C(=C)C#N ITCZEZQMUWEPQP-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000003330 sebacic acids Chemical class 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 150000003900 succinic acid esters Chemical class 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000009941 weaving Methods 0.000 description 1
- PAPBSGBWRJIAAV-UHFFFAOYSA-N ε-Caprolactone Chemical compound O=C1CCCCCO1 PAPBSGBWRJIAAV-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09J—ADHESIVES; NON-MECHANICAL ASPECTS OF ADHESIVE PROCESSES IN GENERAL; ADHESIVE PROCESSES NOT PROVIDED FOR ELSEWHERE; USE OF MATERIALS AS ADHESIVES
- C09J4/00—Adhesives based on organic non-macromolecular compounds having at least one polymerisable carbon-to-carbon unsaturated bond ; adhesives, based on monomers of macromolecular compounds of groups C09J183/00 - C09J183/16
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Adhesives Or Adhesive Processes (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2349799A DE2349799C3 (de) | 1973-10-04 | 1973-10-04 | Klebstoffe auf Basis von a - Cyanacrylsäure-Estern |
| US05/509,827 US3961966A (en) | 1973-10-04 | 1974-09-27 | Cyanoacrylate adhesives |
| AT788474A AT332506B (de) | 1973-10-04 | 1974-10-01 | Verbesserte cyanacrylatklebstoffe |
| FR7433287A FR2246615B3 (enExample) | 1973-10-04 | 1974-10-03 | |
| GB4317874A GB1474069A (en) | 1973-10-04 | 1974-10-04 | Adhesive composition |
| NLAANVRAGE7413151,A NL178085C (nl) | 1973-10-04 | 1974-10-04 | Werkwijze voor de bereiding van een verbeterde kleefstof. |
| JP49114604A JPS5746471B2 (enExample) | 1973-10-04 | 1974-10-04 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2349799A DE2349799C3 (de) | 1973-10-04 | 1973-10-04 | Klebstoffe auf Basis von a - Cyanacrylsäure-Estern |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2349799A1 DE2349799A1 (de) | 1975-04-24 |
| DE2349799B2 DE2349799B2 (de) | 1979-10-31 |
| DE2349799C3 true DE2349799C3 (de) | 1980-07-24 |
Family
ID=5894470
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2349799A Expired DE2349799C3 (de) | 1973-10-04 | 1973-10-04 | Klebstoffe auf Basis von a - Cyanacrylsäure-Estern |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3961966A (enExample) |
| JP (1) | JPS5746471B2 (enExample) |
| AT (1) | AT332506B (enExample) |
| DE (1) | DE2349799C3 (enExample) |
| FR (1) | FR2246615B3 (enExample) |
| GB (1) | GB1474069A (enExample) |
| NL (1) | NL178085C (enExample) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4196271A (en) * | 1975-12-24 | 1980-04-01 | Toagosei Chemical Industry Co., Ltd. | Adhesive composition |
| JPS5358541A (en) * | 1976-11-05 | 1978-05-26 | Taoka Chem Co Ltd | Odorization of cyanoacrylates |
| JPS5416544A (en) * | 1977-07-07 | 1979-02-07 | Arufua Gijiyutsu Kenkiyuushiyo | Alphhcyanoacrylate base adhesive composition |
| US4257841A (en) * | 1978-01-06 | 1981-03-24 | Monsanto Company | Stabilizing and supporting apparatus for float zone refined semiconductor crystal rod |
| US4382419A (en) * | 1980-11-13 | 1983-05-10 | Ihc Holland N.V. | Floating vessel with moon well and ice guard therefor |
| DE3540594A1 (de) * | 1985-11-15 | 1987-05-27 | Henkel Kgaa | Klebstoffe auf basis von cyanacrylsaeureestern |
| JPS62153370A (ja) * | 1985-12-27 | 1987-07-08 | Alpha Giken:Kk | 2―シアノアクリレート系組成物および接着剤 |
| US5273227A (en) * | 1992-02-13 | 1993-12-28 | Smith Jr Jonathan R | Rotation-retarded product roll |
| US5415357A (en) * | 1992-02-13 | 1995-05-16 | Smith, Jr.; Jonathan R. | Product roll with rotation impedance |
| JP2616345B2 (ja) * | 1992-05-29 | 1997-06-04 | 東亞合成株式会社 | 接着剤組成物 |
| US5328944A (en) * | 1992-07-14 | 1994-07-12 | Loctite Corporation | Cyanoacrylate adhesives with improved cured thermal properties |
| US5424343A (en) * | 1992-10-08 | 1995-06-13 | Loctite Corporation | Thermally resistant cyanoacrylates employing substituted napthasultone additive |
| US5288794A (en) * | 1992-10-23 | 1994-02-22 | Loctite Corporation | Cyanoacrylate adhesives with improved cured thermal properties utilizing substituted aromatic additive |
| US6217603B1 (en) | 1997-08-29 | 2001-04-17 | Closure Medical Corporation | Methods of applying monomeric compositions effective as wound closure devices |
| US20020018689A1 (en) * | 1995-06-07 | 2002-02-14 | Badejo Ibraheem T. | Adhesive applicators with improved polymerization initiators |
| US5981621A (en) * | 1996-02-29 | 1999-11-09 | Closure Medical Corporation | Monomeric compositions effective as wound closure devices |
| EP1100380B1 (en) | 1999-05-29 | 2011-11-02 | Tyco Healthcare Group LP | Bioabsorbable blends and surgical articles therefrom |
| US6310166B1 (en) | 1999-08-12 | 2001-10-30 | Closure Medical Corporation | Sterilized cyanoacrylate solutions containing thickeners |
| US6224622B1 (en) * | 1999-09-29 | 2001-05-01 | Chemence, Inc. | Bioabsorable cyanoacrylate tissue adhesives |
| US6977278B1 (en) | 2001-01-08 | 2005-12-20 | Loctite (R&D) Ltd. | Cyanoacrylate compositions curable to flexible polymeric materials |
| EP2999689B1 (en) | 2013-05-21 | 2017-10-04 | Henkel IP & Holding GmbH | Cyanoacrylate compositions |
| US20210363393A1 (en) * | 2018-02-09 | 2021-11-25 | Toagosei Co., Ltd. | Adhesive composition that easily disintegrates in water |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2467927A (en) * | 1947-05-29 | 1949-04-19 | Goodrich Co B F | Preparation of monomeric alkyl alpha-cyano-acrylates |
| US2585537A (en) * | 1949-10-21 | 1952-02-12 | Du Pont | Beta-methylene-beta-propiolactone copolymers |
| US3155685A (en) * | 1960-01-04 | 1964-11-03 | Monsanto Co | Preparation of ester lactones |
| US3759264A (en) * | 1966-04-07 | 1973-09-18 | Eastman Kodak Co | Surgical method |
| US3527841A (en) * | 1968-04-10 | 1970-09-08 | Eastman Kodak Co | Alpha-cyanoacrylate adhesive compositions |
-
1973
- 1973-10-04 DE DE2349799A patent/DE2349799C3/de not_active Expired
-
1974
- 1974-09-27 US US05/509,827 patent/US3961966A/en not_active Expired - Lifetime
- 1974-10-01 AT AT788474A patent/AT332506B/de not_active IP Right Cessation
- 1974-10-03 FR FR7433287A patent/FR2246615B3/fr not_active Expired
- 1974-10-04 GB GB4317874A patent/GB1474069A/en not_active Expired
- 1974-10-04 JP JP49114604A patent/JPS5746471B2/ja not_active Expired
- 1974-10-04 NL NLAANVRAGE7413151,A patent/NL178085C/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| GB1474069A (en) | 1977-05-18 |
| FR2246615A1 (enExample) | 1975-05-02 |
| JPS5077435A (enExample) | 1975-06-24 |
| DE2349799B2 (de) | 1979-10-31 |
| US3961966A (en) | 1976-06-08 |
| NL178085C (nl) | 1986-01-16 |
| DE2349799A1 (de) | 1975-04-24 |
| ATA788474A (de) | 1976-01-15 |
| JPS5746471B2 (enExample) | 1982-10-04 |
| AT332506B (de) | 1976-10-11 |
| FR2246615B3 (enExample) | 1977-07-15 |
| NL7413151A (nl) | 1975-04-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2349799C3 (de) | Klebstoffe auf Basis von a - Cyanacrylsäure-Estern | |
| DE1594087C3 (de) | Unter Sauerstoffausschluß erhärtende Klebemittel | |
| DE1569862C3 (de) | Unter Sauerstoffausschluß erhärtende Klebmittel auf Basis von Acrylsäureestern mehrwertiger Alkohole | |
| DE2622875C2 (de) | Härtbare Zusammensetzungen | |
| DE2849965C3 (de) | Klebstoff auf der Basis von Cyanacrylsäureestern | |
| DE1295122B (de) | Unter Luftabschluss haertendes Klebemittel | |
| DE2223026A1 (de) | Klebstoffmasse | |
| DE2833842A1 (de) | Verbesserte klebstoffzubereitung auf basis von 2-cyanacrylaten und verfahren zur verbesserung der klebstoffeigenschaften derartiger zubereitungen | |
| EP0222333A2 (de) | Klebstoffe auf Basis von Cyanacrylsäureestern | |
| DE1645379B2 (de) | Anaerob haertbare massen | |
| DE2222709C3 (de) | Unter Luftabschluß polymerisierende Masse | |
| DE2607961A1 (de) | Bei sauerstoffausschluss erhaertende klebstoffe und dichtungsmassen | |
| DE1669989B2 (de) | Stabilisierte Massen auf der Basis von halogenenthaltenden Polymerisaten und Organozinnverbindungen | |
| DE1128135B (de) | Verfahren zum Beschleunigen des Auspolymerisierens ungesaettigter Polyesterharzmassen in Gegenwart von organischen Peroxyden und Vanadinsalzen | |
| DE1493317B2 (de) | Stabilisierungsmittel fuer epsilon- caprolactone | |
| CH394146A (de) | Verfahren zum Stabilisieren polymerisierbarer Verbindungen | |
| DE1720272A1 (de) | Verfahren zur Herstellung von Chloroprenpolymerisaten | |
| DE2006630C3 (de) | Anaerob härtbare Polyesterpolyacrylat-Massen | |
| DE1187372B (de) | Verfahren zur Herstellung von Polyamiden | |
| DE946664C (de) | Verfahren zur Herstellung von Polyestern oder Mischestern aus cyclischen 6-gliedrigen Estern | |
| DE3006017C2 (de) | Cyanoacrylat-Klebestoffzusammensetzung | |
| DE2649372B2 (de) | Anaerob härtende an der Luft stabile Massen und Verwendung derselben als Klebe- und Dichtungsmittel | |
| DE1720390A1 (de) | Verfahren zur Herstellung von Polymerisaten | |
| DE2429167A1 (de) | Klebstoffmasse | |
| DE3025127C2 (de) | Cyanoacrylat-Klebestoffzusammensetzung. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |