DE2344134A1 - Kohlensaeurederivate des 2-mercapto-4,5dichlor-thiazols, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide - Google Patents
Kohlensaeurederivate des 2-mercapto-4,5dichlor-thiazols, verfahren zu ihrer herstellung sowie ihre verwendung als herbizideInfo
- Publication number
- DE2344134A1 DE2344134A1 DE19732344134 DE2344134A DE2344134A1 DE 2344134 A1 DE2344134 A1 DE 2344134A1 DE 19732344134 DE19732344134 DE 19732344134 DE 2344134 A DE2344134 A DE 2344134A DE 2344134 A1 DE2344134 A1 DE 2344134A1
- Authority
- DE
- Germany
- Prior art keywords
- ester
- acid
- mercapto
- alkyl
- chloride
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 13
- 239000004009 herbicide Substances 0.000 title claims description 9
- 238000004519 manufacturing process Methods 0.000 title claims 2
- 150000001721 carbon Chemical class 0.000 title 1
- -1 aryl mercapto Chemical class 0.000 claims description 81
- 125000000217 alkyl group Chemical group 0.000 claims description 23
- 239000002253 acid Substances 0.000 claims description 22
- 125000004432 carbon atom Chemical group C* 0.000 claims description 22
- 125000003545 alkoxy group Chemical group 0.000 claims description 12
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims description 12
- 125000004414 alkyl thio group Chemical group 0.000 claims description 11
- FLDIPKCTYWJMAW-UHFFFAOYSA-N 4,5-dichloro-3h-1,3-thiazole-2-thione Chemical compound SC1=NC(Cl)=C(Cl)S1 FLDIPKCTYWJMAW-UHFFFAOYSA-N 0.000 claims description 10
- 239000011230 binding agent Substances 0.000 claims description 10
- 229910052736 halogen Inorganic materials 0.000 claims description 10
- 150000002367 halogens Chemical class 0.000 claims description 10
- 229910052757 nitrogen Inorganic materials 0.000 claims description 10
- 125000001188 haloalkyl group Chemical group 0.000 claims description 8
- 229910052717 sulfur Inorganic materials 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 6
- 239000003085 diluting agent Substances 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 claims description 5
- 150000001298 alcohols Chemical class 0.000 claims description 5
- 125000003710 aryl alkyl group Chemical class 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- 239000004606 Fillers/Extenders Substances 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000000304 alkynyl group Chemical group 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 4
- 150000005840 aryl radicals Chemical class 0.000 claims description 4
- 125000004104 aryloxy group Chemical group 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 150000002989 phenols Chemical class 0.000 claims description 3
- 150000003254 radicals Chemical class 0.000 claims description 3
- 125000000335 thiazolyl group Chemical group 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- 150000002366 halogen compounds Chemical class 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000003107 substituted aryl group Chemical group 0.000 claims description 2
- 239000004094 surface-active agent Substances 0.000 claims description 2
- 230000008635 plant growth Effects 0.000 claims 2
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical class O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 claims 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 1
- 125000000547 substituted alkyl group Chemical group 0.000 claims 1
- 150000002148 esters Chemical class 0.000 description 61
- HDFRDWFLWVCOGP-UHFFFAOYSA-N carbonothioic O,S-acid Chemical compound OC(S)=O HDFRDWFLWVCOGP-UHFFFAOYSA-N 0.000 description 32
- 238000006243 chemical reaction Methods 0.000 description 22
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- 239000000203 mixture Substances 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- 239000002904 solvent Substances 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 239000004480 active ingredient Substances 0.000 description 12
- 241000196324 Embryophyta Species 0.000 description 11
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 10
- 150000001875 compounds Chemical class 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 8
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 7
- 150000003839 salts Chemical class 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000003208 petroleum Substances 0.000 description 6
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 5
- SKOLWUPSYHWYAM-UHFFFAOYSA-N carbonodithioic O,S-acid Chemical compound SC(S)=O SKOLWUPSYHWYAM-UHFFFAOYSA-N 0.000 description 5
- 239000003995 emulsifying agent Substances 0.000 description 5
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- FDEQQCOTLPPCAO-UHFFFAOYSA-N Cl.OC(O)=O Chemical compound Cl.OC(O)=O FDEQQCOTLPPCAO-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 241000219146 Gossypium Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 3
- 244000046052 Phaseolus vulgaris Species 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 230000000855 fungicidal effect Effects 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- YXIWHUQXZSMYRE-UHFFFAOYSA-N 1,3-benzothiazole-2-thiol Chemical compound C1=CC=C2SC(S)=NC2=C1 YXIWHUQXZSMYRE-UHFFFAOYSA-N 0.000 description 2
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 2
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 2
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 2
- 244000075850 Avena orientalis Species 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- 244000000626 Daucus carota Species 0.000 description 2
- 235000002767 Daucus carota Nutrition 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 235000007351 Eleusine Nutrition 0.000 description 2
- 241000209215 Eleusine Species 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 244000042664 Matricaria chamomilla Species 0.000 description 2
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Natural products C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- 241000209094 Oryza Species 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 244000062793 Sorghum vulgare Species 0.000 description 2
- 240000006694 Stellaria media Species 0.000 description 2
- 235000021307 Triticum Nutrition 0.000 description 2
- 244000098338 Triticum aestivum Species 0.000 description 2
- 241000219422 Urtica Species 0.000 description 2
- 238000007792 addition Methods 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- 150000004651 carbonic acid esters Chemical class 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- QPJDMGCKMHUXFD-UHFFFAOYSA-N cyanogen chloride Chemical compound ClC#N QPJDMGCKMHUXFD-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 230000002363 herbicidal effect Effects 0.000 description 2
- 239000012433 hydrogen halide Substances 0.000 description 2
- 229910000039 hydrogen halide Inorganic materials 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 235000019713 millet Nutrition 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- 230000001376 precipitating effect Effects 0.000 description 2
- 239000011435 rock Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 125000003396 thiol group Chemical class [H]S* 0.000 description 2
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 2
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 description 2
- CHHPXEHWEFPYST-UHFFFAOYSA-N (4,5-dichloro-1,3-thiazol-2-yl) thiocyanate Chemical compound ClC=1N=C(SC#N)SC=1Cl CHHPXEHWEFPYST-UHFFFAOYSA-N 0.000 description 1
- KDJHUPRULWPOMV-UHFFFAOYSA-N (4-methoxyphenyl)-methylcarbamothioic S-acid Chemical compound COC1=CC=C(N(C)C(O)=S)C=C1 KDJHUPRULWPOMV-UHFFFAOYSA-N 0.000 description 1
- BMUQVYYTLVPLKM-UHFFFAOYSA-N 1,1,2-trichloro-2-isocyanatoethene Chemical compound ClC(Cl)=C(Cl)N=C=O BMUQVYYTLVPLKM-UHFFFAOYSA-N 0.000 description 1
- YHMYGUUIMTVXNW-UHFFFAOYSA-N 1,3-dihydrobenzimidazole-2-thione Chemical compound C1=CC=C2NC(S)=NC2=C1 YHMYGUUIMTVXNW-UHFFFAOYSA-N 0.000 description 1
- YFBUDXNMBTUSOC-UHFFFAOYSA-N 1,4-dihydroquinoxaline-2,3-dithione Chemical compound C1=CC=C2NC(=S)C(=S)NC2=C1 YFBUDXNMBTUSOC-UHFFFAOYSA-N 0.000 description 1
- GWMKSGRFMNQZNP-UHFFFAOYSA-N 2-(4-chlorophenyl)sulfanylethyl hydrogen carbonate hydrochloride Chemical compound Cl.OC(=O)OCCSC1=CC=C(Cl)C=C1 GWMKSGRFMNQZNP-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- FLFWJIBUZQARMD-UHFFFAOYSA-N 2-mercapto-1,3-benzoxazole Chemical compound C1=CC=C2OC(S)=NC2=C1 FLFWJIBUZQARMD-UHFFFAOYSA-N 0.000 description 1
- 229940054266 2-mercaptobenzothiazole Drugs 0.000 description 1
- CKSQAPOBAREFLO-UHFFFAOYSA-N 2-methoxyethyl(methyl)carbamothioic s-acid Chemical compound COCCN(C)C(S)=O CKSQAPOBAREFLO-UHFFFAOYSA-N 0.000 description 1
- QPCQOZLXCUBANS-UHFFFAOYSA-N 2-methylpropyl hydrogen carbonate dihydrochloride Chemical compound Cl.Cl.C(OCC(C)C)(O)=O QPCQOZLXCUBANS-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- PPHAQZXMDYFUTI-UHFFFAOYSA-N 3,4,4a,5-tetrahydro-2H-quinoline-1-carbothioic S-acid Chemical compound N1(CCCC2CC=CC=C12)C(O)=S PPHAQZXMDYFUTI-UHFFFAOYSA-N 0.000 description 1
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- TWFRMOJOOVEFCI-UHFFFAOYSA-N 4,5-dichloro-1,3-thiazole Chemical class ClC=1N=CSC=1Cl TWFRMOJOOVEFCI-UHFFFAOYSA-N 0.000 description 1
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 description 1
- 125000004861 4-isopropyl phenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001318 4-trifluoromethylbenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])*)C(F)(F)F 0.000 description 1
- 240000002245 Acer pensylvanicum Species 0.000 description 1
- 235000006760 Acer pensylvanicum Nutrition 0.000 description 1
- 240000005528 Arctium lappa Species 0.000 description 1
- 235000003130 Arctium lappa Nutrition 0.000 description 1
- 235000008078 Arctium minus Nutrition 0.000 description 1
- 235000005781 Avena Nutrition 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- 235000016068 Berberis vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- 244000056139 Brassica cretica Species 0.000 description 1
- 235000003351 Brassica cretica Nutrition 0.000 description 1
- 235000003343 Brassica rupestris Nutrition 0.000 description 1
- 241000209200 Bromus Species 0.000 description 1
- 235000007866 Chamaemelum nobile Nutrition 0.000 description 1
- 241000219312 Chenopodium Species 0.000 description 1
- FQYCPPQTUMUMDV-UHFFFAOYSA-N Cl.CSCCOC(O)=O Chemical compound Cl.CSCCOC(O)=O FQYCPPQTUMUMDV-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 241000208175 Daucus Species 0.000 description 1
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 241000234642 Festuca Species 0.000 description 1
- 241000748465 Galinsoga Species 0.000 description 1
- 241001101998 Galium Species 0.000 description 1
- 235000009438 Gossypium Nutrition 0.000 description 1
- 241000209219 Hordeum Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241000801118 Lepidium Species 0.000 description 1
- 244000211187 Lepidium sativum Species 0.000 description 1
- 235000007849 Lepidium sativum Nutrition 0.000 description 1
- 241000209510 Liliopsida Species 0.000 description 1
- 235000017945 Matricaria Nutrition 0.000 description 1
- 101100310622 Mus musculus Soga1 gene Proteins 0.000 description 1
- SVYKKECYCPFKGB-UHFFFAOYSA-N N,N-dimethylcyclohexylamine Chemical compound CN(C)C1CCCCC1 SVYKKECYCPFKGB-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- NGPVQFYHCMTLNT-UHFFFAOYSA-N OC(O)=S.Cl Chemical compound OC(O)=S.Cl NGPVQFYHCMTLNT-UHFFFAOYSA-N 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 241000209117 Panicum Species 0.000 description 1
- 235000006443 Panicum miliaceum subsp. miliaceum Nutrition 0.000 description 1
- 235000009037 Panicum miliaceum subsp. ruderale Nutrition 0.000 description 1
- 241000219833 Phaseolus Species 0.000 description 1
- 241001310793 Podium Species 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- 108010009736 Protein Hydrolysates Proteins 0.000 description 1
- 241000209051 Saccharum Species 0.000 description 1
- 240000000111 Saccharum officinarum Species 0.000 description 1
- 235000007201 Saccharum officinarum Nutrition 0.000 description 1
- 241000780602 Senecio Species 0.000 description 1
- 240000003705 Senecio vulgaris Species 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- 241000220261 Sinapis Species 0.000 description 1
- 235000002634 Solanum Nutrition 0.000 description 1
- 241000207763 Solanum Species 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 244000152045 Themeda triandra Species 0.000 description 1
- 244000274883 Urtica dioica Species 0.000 description 1
- 235000009108 Urtica dioica Nutrition 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical class ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 1
- QOHQYMPGUOODJU-UHFFFAOYSA-N butoxymethanethioic s-acid Chemical compound CCCCOC(S)=O QOHQYMPGUOODJU-UHFFFAOYSA-N 0.000 description 1
- ZLGSHYJQPSHOJA-UHFFFAOYSA-N butyl hydrogen carbonate;hydrochloride Chemical compound Cl.CCCCOC(O)=O ZLGSHYJQPSHOJA-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical class OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- ATDGTVJJHBUTRL-UHFFFAOYSA-N cyanogen bromide Chemical compound BrC#N ATDGTVJJHBUTRL-UHFFFAOYSA-N 0.000 description 1
- GCFAUZGWPDYAJN-UHFFFAOYSA-N cyclohexyl 3-phenylprop-2-enoate Chemical compound C=1C=CC=CC=1C=CC(=O)OC1CCCCC1 GCFAUZGWPDYAJN-UHFFFAOYSA-N 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- LMBWSYZSUOEYSN-UHFFFAOYSA-N diethyldithiocarbamic acid Chemical compound CCN(CC)C(S)=S LMBWSYZSUOEYSN-UHFFFAOYSA-N 0.000 description 1
- ZXSBDSGRQIWJPM-UHFFFAOYSA-N dimethylcarbamothioic s-acid Chemical compound CN(C)C(S)=O ZXSBDSGRQIWJPM-UHFFFAOYSA-N 0.000 description 1
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 241001233957 eudicotyledons Species 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 244000230030 foxtail bristlegrass Species 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000006229 isopropoxyethyl group Chemical group [H]C([H])([H])C([H])(OC([H])([H])C([H])([H])*)C([H])([H])[H] 0.000 description 1
- 101150085091 lat-2 gene Proteins 0.000 description 1
- 239000011133 lead Substances 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- GPPYYOFCUVXNNH-UHFFFAOYSA-N methyl hydrogen carbonate;hydrochloride Chemical compound Cl.COC(O)=O GPPYYOFCUVXNNH-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 235000010460 mustard Nutrition 0.000 description 1
- CWMZIDRTDQTOTI-UHFFFAOYSA-N n,n-bis(2-cyanoethyl)carbamoyl chloride Chemical compound N#CCCN(C(=O)Cl)CCC#N CWMZIDRTDQTOTI-UHFFFAOYSA-N 0.000 description 1
- MGQPJLWKFQNTOZ-UHFFFAOYSA-N n,n-bis(prop-2-enyl)carbamoyl chloride Chemical compound C=CCN(C(=O)Cl)CC=C MGQPJLWKFQNTOZ-UHFFFAOYSA-N 0.000 description 1
- PHWISQNXPLXQRU-UHFFFAOYSA-N n,n-dimethylcarbamothioyl chloride Chemical compound CN(C)C(Cl)=S PHWISQNXPLXQRU-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- HFGGXBQZQRVOKM-UHFFFAOYSA-N piperidine-1-carbothioic s-acid Chemical compound SC(=O)N1CCCCC1 HFGGXBQZQRVOKM-UHFFFAOYSA-N 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- DQRVWGKCDJKPAQ-UHFFFAOYSA-N prop-2-enyl hydrogen carbonate Chemical compound OC(=O)OCC=C DQRVWGKCDJKPAQ-UHFFFAOYSA-N 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 239000003531 protein hydrolysate Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- URXNOJQCVQXMCT-UHFFFAOYSA-N pyrrolidine-1-carbothioic s-acid Chemical compound SC(=O)N1CCCC1 URXNOJQCVQXMCT-UHFFFAOYSA-N 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003560 thiocarbamic acids Chemical class 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000003799 water insoluble solvent Substances 0.000 description 1
- 239000003021 water soluble solvent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/36—Sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (17)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732344134 DE2344134A1 (de) | 1973-09-01 | 1973-09-01 | Kohlensaeurederivate des 2-mercapto-4,5dichlor-thiazols, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide |
| US05/497,356 US3989710A (en) | 1973-09-01 | 1974-08-14 | Certain 2-mercapto-4,5-dichloro-thiazole compounds |
| NO742937A NO742937L (enExample) | 1973-09-01 | 1974-08-15 | |
| SE7410958A SE7410958L (enExample) | 1973-09-01 | 1974-08-29 | |
| BE148008A BE819319A (fr) | 1973-09-01 | 1974-08-29 | Nouveaux derives d'acide carbonique de 2-mercapto-4,5-dichlorothioazole. |
| NL7411531A NL7411531A (nl) | 1973-09-01 | 1974-08-29 | Koolzuurderivaten van 2-mercapto 4.5-dichloor- thiazolen, alsmede werkwijze voor de bereiding en toepassing ervan als herbiciden. |
| IL45565A IL45565A0 (en) | 1973-09-01 | 1974-08-29 | Carbonic acid derivatives of 2-mercapto-4,5-dichloro-thiazole,their preparation and their use as herbicides |
| OA55285A OA04770A (fr) | 1973-09-01 | 1974-08-30 | Nouveaux dérivés d'acide carbonique de 2-mercapto-4,5-dichlorothiazole, leur procédé de préparation et leur application comme herbicides. |
| BR7275/74A BR7407275D0 (pt) | 1973-09-01 | 1974-08-30 | Processo para a preparacao de derivados de acido carbonico do 2-mercapto-4 5-dicloro-tiazol bem como composicoes herbicidas a base destes |
| LU70823A LU70823A1 (enExample) | 1973-09-01 | 1974-08-30 | |
| DK461974A DK461974A (enExample) | 1973-09-01 | 1974-08-30 | |
| FR7429678A FR2242386B1 (enExample) | 1973-09-01 | 1974-08-30 | |
| GB3800674A GB1429457A (en) | 1973-09-01 | 1974-08-30 | Derivatives of 2-mercapto-4,5-dichlorothiazole processes for their preparation and their use as herbicides |
| ZA00745547A ZA745547B (en) | 1973-09-01 | 1974-08-30 | Novel derivates of 2-,ercapio-4,5-dicholothiazole, processes for their preparation and their use a herbicides |
| FI2551/74A FI255174A7 (enExample) | 1973-09-01 | 1974-08-30 | |
| JP49099507A JPS5049428A (enExample) | 1973-09-01 | 1974-08-31 | |
| JP49099506A JPS5050375A (enExample) | 1973-09-01 | 1974-08-31 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732344134 DE2344134A1 (de) | 1973-09-01 | 1973-09-01 | Kohlensaeurederivate des 2-mercapto-4,5dichlor-thiazols, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2344134A1 true DE2344134A1 (de) | 1975-03-13 |
Family
ID=5891354
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732344134 Pending DE2344134A1 (de) | 1973-09-01 | 1973-09-01 | Kohlensaeurederivate des 2-mercapto-4,5dichlor-thiazols, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3989710A (enExample) |
| JP (2) | JPS5050375A (enExample) |
| BE (1) | BE819319A (enExample) |
| BR (1) | BR7407275D0 (enExample) |
| DE (1) | DE2344134A1 (enExample) |
| DK (1) | DK461974A (enExample) |
| FI (1) | FI255174A7 (enExample) |
| FR (1) | FR2242386B1 (enExample) |
| GB (1) | GB1429457A (enExample) |
| IL (1) | IL45565A0 (enExample) |
| LU (1) | LU70823A1 (enExample) |
| NL (1) | NL7411531A (enExample) |
| NO (1) | NO742937L (enExample) |
| OA (1) | OA04770A (enExample) |
| SE (1) | SE7410958L (enExample) |
| ZA (1) | ZA745547B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4308052A (en) * | 1977-09-21 | 1981-12-29 | Monsanto Company | N-Substituted benzothiazolines substituted with thiol esters useful as herbicides and plant growth regulants |
| EP0018497B1 (de) * | 1979-04-06 | 1982-04-28 | Bayer Ag | Azolyloxy-essigsäureamide, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide |
| DE2946524A1 (de) * | 1979-11-17 | 1981-06-11 | Bayer Ag, 5090 Leverkusen | Azolyloxy-carbonsaeure-n-oxy-amide, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
| DE4225024A1 (de) * | 1992-07-29 | 1994-02-03 | Bayer Ag | Chlorthiazolderivate |
| DE10034132A1 (de) * | 2000-07-13 | 2002-01-24 | Bayer Ag | Heterocyclische Fluoralkenylthioether (lll) |
| ES2258408B1 (es) * | 2005-03-14 | 2007-11-16 | Catalana D'innovacions Per La Construccio, S.L. | Procedimiento y dispositivo para la realizacion de excavaciones de forma general paralelepipedica. |
| EP3968772A4 (en) * | 2019-05-13 | 2023-05-24 | Agrematch Ltd. | COMPOSITIONS FOR CROP PROTECTION |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2697098A (en) * | 1950-12-28 | 1954-12-14 | Sharples Chemicals Inc | Process for preparing dithiocarbamic acid derivatives |
| US2766253A (en) * | 1954-02-26 | 1956-10-09 | Monsanto Chemicals | Thiazolyl mercapto alkyl thionocarbamates |
| US2721868A (en) * | 1954-05-03 | 1955-10-25 | Monsanto Chemicals | 5-carboxy-2-thiazolyl dithiocarbamates |
| DE1595995A1 (de) * | 1966-04-23 | 1970-02-12 | Merck Ag E | Fungizides Mittel |
-
1973
- 1973-09-01 DE DE19732344134 patent/DE2344134A1/de active Pending
-
1974
- 1974-08-14 US US05/497,356 patent/US3989710A/en not_active Expired - Lifetime
- 1974-08-15 NO NO742937A patent/NO742937L/no unknown
- 1974-08-29 SE SE7410958A patent/SE7410958L/xx unknown
- 1974-08-29 NL NL7411531A patent/NL7411531A/xx unknown
- 1974-08-29 IL IL45565A patent/IL45565A0/xx unknown
- 1974-08-29 BE BE148008A patent/BE819319A/xx unknown
- 1974-08-30 ZA ZA00745547A patent/ZA745547B/xx unknown
- 1974-08-30 BR BR7275/74A patent/BR7407275D0/pt unknown
- 1974-08-30 OA OA55285A patent/OA04770A/xx unknown
- 1974-08-30 GB GB3800674A patent/GB1429457A/en not_active Expired
- 1974-08-30 LU LU70823A patent/LU70823A1/xx unknown
- 1974-08-30 DK DK461974A patent/DK461974A/da unknown
- 1974-08-30 FI FI2551/74A patent/FI255174A7/fi unknown
- 1974-08-30 FR FR7429678A patent/FR2242386B1/fr not_active Expired
- 1974-08-31 JP JP49099506A patent/JPS5050375A/ja active Pending
- 1974-08-31 JP JP49099507A patent/JPS5049428A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| DK461974A (enExample) | 1975-04-28 |
| BE819319A (fr) | 1975-02-28 |
| NL7411531A (nl) | 1975-03-04 |
| US3989710A (en) | 1976-11-02 |
| GB1429457A (en) | 1976-03-24 |
| JPS5050375A (enExample) | 1975-05-06 |
| NO742937L (enExample) | 1974-04-01 |
| LU70823A1 (enExample) | 1975-06-11 |
| OA04770A (fr) | 1980-08-31 |
| ZA745547B (en) | 1975-09-24 |
| SE7410958L (enExample) | 1975-03-03 |
| BR7407275D0 (pt) | 1975-06-24 |
| FI255174A7 (enExample) | 1975-03-02 |
| FR2242386A1 (enExample) | 1975-03-28 |
| FR2242386B1 (enExample) | 1978-06-09 |
| IL45565A0 (en) | 1974-11-29 |
| JPS5049428A (enExample) | 1975-05-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2013406A1 (de) | 1(13 4 Thiadiazol 2 yl) lmidazohdi non (2) Derivate, Verfahren zu ihrer Her stellung und ihre Verwendung als herbizide | |
| DE1518815C3 (de) | m-(UreidophenyI)-carbaminsäureester, deren Herstellung und diese enthaltende herbizide Mittel | |
| DE2254200C2 (de) | Tetrahydro-1,3,5-triazin-2,6-dione, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide | |
| DE2214632A1 (de) | 1,2,3-thiadiazolderivate | |
| DE2344134A1 (de) | Kohlensaeurederivate des 2-mercapto-4,5dichlor-thiazols, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide | |
| DE1670924B2 (de) | 1,2,4-thiadiazolyl-harnstoffderivate | |
| DE1191823B (de) | Verfahren zur Herstellung von neuen 2-Halogen-3-mercaptochinoxalinderivaten | |
| DE2247310A1 (de) | Tetrasubstituierte harnstoffe, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide | |
| DE1218210B (de) | Fungizide Mittel mit herbizider und nematozider Wirkung | |
| DE2510936A1 (de) | Thienylharnstoffe | |
| DE2256275A1 (de) | Neue substituierte harnstoffverbindungen und verfahren zu ihrer herstellung | |
| DE2557552C2 (de) | Diurethane und herbizide Mittel, enthaltend diese Verbindungen als Wirkstoffe | |
| DE1795037A1 (de) | N-Acyl-2-amino-1,3,4-thiadiazole | |
| DE1795117C3 (de) | lmidazolidin-2-on-1 -carbonsäureamide, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| DE1932827C3 (de) | Cycloaliphatische Imidazolidin-2-on-1-carbonsäure-amide, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide | |
| DE2050979C2 (de) | 3-(5-Sulfamoyl-1,3,4-thiadiazol-2-yl)-harnstoffverbindungen | |
| DE2221500A1 (de) | Isothioharnstoff-verbindungen, verfahren zu deren herstellung und deren verwendung als mikrobizide | |
| DE2320362A1 (de) | Dichlorthiazolylharnstoffe, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide | |
| DE3031191A1 (de) | 1,2,4-triazole mit pestizider wirkung | |
| CH482394A (de) | Herbizides Mittel | |
| EP0039520B1 (de) | Carbamoyloxime, Verfahren und Mittel zu deren Herstellung, Schädlingsbekämpfungsmittel, enthaltend solche Verbindungen, sowie Verwendung solcher Verbindungen als Schädlingsbekämpfungsmittel | |
| EP0079537A1 (de) | Carbamoyloxime, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| DE1817949A1 (de) | 1,3,4-thiadiazolyl(5)-harnstoffe, ihre verwendung als herbizide und verfahren zu ihrer herstellung | |
| DE1811717A1 (de) | 2,4-Dicyano-6-nitrophenyl-Derivate | |
| DE1193055B (de) | Verfahren zur Herstellung von Thionophosphon-saeureestern |