DE2254200C2 - Tetrahydro-1,3,5-triazin-2,6-dione, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide - Google Patents
Tetrahydro-1,3,5-triazin-2,6-dione, Verfahren zu ihrer Herstellung sowie ihre Verwendung als HerbizideInfo
- Publication number
- DE2254200C2 DE2254200C2 DE2254200A DE2254200A DE2254200C2 DE 2254200 C2 DE2254200 C2 DE 2254200C2 DE 2254200 A DE2254200 A DE 2254200A DE 2254200 A DE2254200 A DE 2254200A DE 2254200 C2 DE2254200 C2 DE 2254200C2
- Authority
- DE
- Germany
- Prior art keywords
- triazine
- tetrahydro
- dione
- carbon atoms
- general formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 44
- YTFXKURWTLWPKK-UHFFFAOYSA-N 1,3,5-triazinane-2,4-dione Chemical class O=C1NCNC(=O)N1 YTFXKURWTLWPKK-UHFFFAOYSA-N 0.000 title claims description 11
- 238000002360 preparation method Methods 0.000 title claims description 9
- 239000004009 herbicide Substances 0.000 title description 3
- -1 alkyl radical Chemical class 0.000 claims description 53
- 150000001875 compounds Chemical class 0.000 claims description 43
- 238000006243 chemical reaction Methods 0.000 claims description 25
- 125000004432 carbon atom Chemical group C* 0.000 claims description 24
- 239000000460 chlorine Substances 0.000 claims description 20
- 239000002253 acid Substances 0.000 claims description 19
- 150000001412 amines Chemical class 0.000 claims description 16
- 239000011230 binding agent Substances 0.000 claims description 12
- 230000015572 biosynthetic process Effects 0.000 claims description 7
- 125000003282 alkyl amino group Chemical group 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- 150000007522 mineralic acids Chemical class 0.000 claims description 3
- 150000007524 organic acids Chemical class 0.000 claims description 3
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 150000007857 hydrazones Chemical class 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 150000003254 radicals Chemical class 0.000 claims 2
- 238000002844 melting Methods 0.000 description 41
- 230000008018 melting Effects 0.000 description 41
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 36
- 239000000843 powder Substances 0.000 description 35
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 27
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 19
- 239000004480 active ingredient Substances 0.000 description 19
- GEWRKGDRYZIFNP-UHFFFAOYSA-N 1h-1,3,5-triazine-2,4-dione Chemical compound OC1=NC=NC(O)=N1 GEWRKGDRYZIFNP-UHFFFAOYSA-N 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 241000196324 Embryophyta Species 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 8
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 8
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 7
- 241000209140 Triticum Species 0.000 description 7
- 235000021307 Triticum Nutrition 0.000 description 7
- 239000003995 emulsifying agent Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- 210000002268 wool Anatomy 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 241000220261 Sinapis Species 0.000 description 6
- 240000006694 Stellaria media Species 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 6
- CNGFQZPAQMNBPP-UHFFFAOYSA-N [c-methylsulfanyl-n-(propan-2-ylideneamino)carbonimidoyl]azanium;iodide Chemical compound I.CS\C(N)=N/N=C(C)C CNGFQZPAQMNBPP-UHFFFAOYSA-N 0.000 description 5
- 230000006378 damage Effects 0.000 description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 5
- 239000011159 matrix material Substances 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 5
- 238000003786 synthesis reaction Methods 0.000 description 5
- 241001049165 Caria Species 0.000 description 4
- 150000001805 chlorine compounds Chemical class 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 230000002363 herbicidal effect Effects 0.000 description 4
- BKCXNNIZYGZXTB-UHFFFAOYSA-N isocyanoformyl chloride Chemical compound ClC(=O)[N+]#[C-] BKCXNNIZYGZXTB-UHFFFAOYSA-N 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- XTFIVUDBNACUBN-UHFFFAOYSA-N 1,3,5-trinitro-1,3,5-triazinane Chemical compound [O-][N+](=O)N1CN([N+]([O-])=O)CN([N+]([O-])=O)C1 XTFIVUDBNACUBN-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 244000075850 Avena orientalis Species 0.000 description 3
- 241000219312 Chenopodium Species 0.000 description 3
- 244000000626 Daucus carota Species 0.000 description 3
- 235000002767 Daucus carota Nutrition 0.000 description 3
- 239000004606 Fillers/Extenders Substances 0.000 description 3
- 241001310793 Podium Species 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 240000008042 Zea mays Species 0.000 description 3
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 125000002877 alkyl aryl group Chemical group 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229920000151 polyglycol Polymers 0.000 description 3
- 239000010695 polyglycol Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- DFWRZHZPJJAJMX-UHFFFAOYSA-N propanimidamide;hydrochloride Chemical compound Cl.CCC(N)=N DFWRZHZPJJAJMX-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 2
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical compound C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 2
- OXTMOWQWAUAEHV-UHFFFAOYSA-N 1-amino-6-methylsulfanyl-3-phenyl-1,3,5-triazinane-2,4-dione Chemical compound O=C1N(N)C(SC)NC(=O)N1C1=CC=CC=C1 OXTMOWQWAUAEHV-UHFFFAOYSA-N 0.000 description 2
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 2
- 235000007319 Avena orientalis Nutrition 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- 244000192528 Chrysanthemum parthenium Species 0.000 description 2
- 241000723377 Coffea Species 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- 241000208175 Daucus Species 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 241000192043 Echinochloa Species 0.000 description 2
- 235000007351 Eleusine Nutrition 0.000 description 2
- 241000209215 Eleusine Species 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 241000234642 Festuca Species 0.000 description 2
- 241000748465 Galinsoga Species 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 241000209082 Lolium Species 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 235000017945 Matricaria Nutrition 0.000 description 2
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 241000209094 Oryza Species 0.000 description 2
- 244000046052 Phaseolus vulgaris Species 0.000 description 2
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical group ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 244000062793 Sorghum vulgare Species 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical group 0.000 description 2
- 230000001588 bifunctional effect Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- WCQOBLXWLRDEQA-UHFFFAOYSA-N ethanimidamide;hydrochloride Chemical compound Cl.CC(N)=N WCQOBLXWLRDEQA-UHFFFAOYSA-N 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000003502 gasoline Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 235000009973 maize Nutrition 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- NNBBQNFHCVVQHZ-UHFFFAOYSA-N methyl carbamimidothioate;sulfuric acid Chemical compound CSC(N)=N.OS(O)(=O)=O NNBBQNFHCVVQHZ-UHFFFAOYSA-N 0.000 description 2
- KGGGDOUUGUNODJ-UHFFFAOYSA-N methyl n'-ethylcarbamimidothioate;hydroiodide Chemical compound I.CCNC(=N)SC KGGGDOUUGUNODJ-UHFFFAOYSA-N 0.000 description 2
- 235000019713 millet Nutrition 0.000 description 2
- ZCLVKRFCNWGTIS-UHFFFAOYSA-N n-carbonochloridoyl-n-methylcarbamoyl chloride Chemical compound ClC(=O)N(C)C(Cl)=O ZCLVKRFCNWGTIS-UHFFFAOYSA-N 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 230000008635 plant growth Effects 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 239000011435 rock Substances 0.000 description 2
- RMBAVIFYHOYIFM-UHFFFAOYSA-M sodium methanethiolate Chemical compound [Na+].[S-]C RMBAVIFYHOYIFM-UHFFFAOYSA-M 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- FYADHXFMURLYQI-UHFFFAOYSA-N 1,2,4-triazine Chemical compound C1=CN=NC=N1 FYADHXFMURLYQI-UHFFFAOYSA-N 0.000 description 1
- SNKFEUREJVFDCD-UHFFFAOYSA-N 1-amino-3-(4-methylphenyl)-6-methylsulfanyl-1,3,5-triazinane-2,4-dione Chemical compound O=C1N(N)C(SC)NC(=O)N1C1=CC=C(C)C=C1 SNKFEUREJVFDCD-UHFFFAOYSA-N 0.000 description 1
- RQLBNDJOWIRXCB-UHFFFAOYSA-N 1-amino-6-methylsulfanyl-3-propan-2-yl-1,3,5-triazinane-2,4-dione Chemical compound CSC1NC(=O)N(C(C)C)C(=O)N1N RQLBNDJOWIRXCB-UHFFFAOYSA-N 0.000 description 1
- JUEFDVSMEHYRSK-UHFFFAOYSA-N 1-benzyl-3-ethylurea Chemical compound CCNC(=O)NCC1=CC=CC=C1 JUEFDVSMEHYRSK-UHFFFAOYSA-N 0.000 description 1
- QNMWSLMZPATZTD-UHFFFAOYSA-N 1-benzyl-3-methylurea Chemical compound CNC(=O)NCC1=CC=CC=C1 QNMWSLMZPATZTD-UHFFFAOYSA-N 0.000 description 1
- YKLDLMXTBHWMPV-UHFFFAOYSA-N 1-cyclohexyl-3-methylurea Chemical compound CNC(=O)NC1CCCCC1 YKLDLMXTBHWMPV-UHFFFAOYSA-N 0.000 description 1
- SAWZLGZLJDMTPD-UHFFFAOYSA-N 1-ethyl-3-propan-2-ylurea Chemical compound CCNC(=O)NC(C)C SAWZLGZLJDMTPD-UHFFFAOYSA-N 0.000 description 1
- SQBHGDSDVWCPHN-UHFFFAOYSA-N 1-methyl-3-phenylurea Chemical compound CNC(=O)NC1=CC=CC=C1 SQBHGDSDVWCPHN-UHFFFAOYSA-N 0.000 description 1
- YLFYUSNPIHLTBP-UHFFFAOYSA-N 1-methyl-3-propan-2-ylurea Chemical compound CNC(=O)NC(C)C YLFYUSNPIHLTBP-UHFFFAOYSA-N 0.000 description 1
- ASJNAIAPGATWLY-UHFFFAOYSA-N 1-tert-butyl-3-ethylurea Chemical compound CCNC(=O)NC(C)(C)C ASJNAIAPGATWLY-UHFFFAOYSA-N 0.000 description 1
- ZTLLIUXPRBPQGM-UHFFFAOYSA-N 3-cyclohexyl-6-methylsulfanyl-1-(propan-2-ylideneamino)-1,3,5-triazinane-2,4-dione Chemical compound O=C1N(N=C(C)C)C(SC)NC(=O)N1C1CCCCC1 ZTLLIUXPRBPQGM-UHFFFAOYSA-N 0.000 description 1
- FKSFZGRCAOCHTE-UHFFFAOYSA-N 3-methyl-6-methylsulfanyl-1-(propan-2-ylideneamino)-1,3,5-triazinane-2,4-dione Chemical compound CSC1NC(=O)N(C)C(=O)N1N=C(C)C FKSFZGRCAOCHTE-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- FYONGVIXULQQEI-UHFFFAOYSA-N 6-methylsulfanyl-3-phenyl-1-propan-2-yl-1,3,5-triazinane-2,4-dione Chemical compound O=C1N(C(C)C)C(SC)NC(=O)N1C1=CC=CC=C1 FYONGVIXULQQEI-UHFFFAOYSA-N 0.000 description 1
- GLYGZSFLVYNIRQ-UHFFFAOYSA-N 6-methylsulfanyl-3-propan-2-yl-1-(propan-2-ylideneamino)-1,3,5-triazinane-2,4-dione Chemical compound CSC1NC(=O)N(C(C)C)C(=O)N1N=C(C)C GLYGZSFLVYNIRQ-UHFFFAOYSA-N 0.000 description 1
- 240000002245 Acer pensylvanicum Species 0.000 description 1
- 235000006760 Acer pensylvanicum Nutrition 0.000 description 1
- 235000005781 Avena Nutrition 0.000 description 1
- 235000007320 Avena fatua Nutrition 0.000 description 1
- 241000209764 Avena fatua Species 0.000 description 1
- 235000016068 Berberis vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- 244000056139 Brassica cretica Species 0.000 description 1
- 235000003351 Brassica cretica Nutrition 0.000 description 1
- 235000003343 Brassica rupestris Nutrition 0.000 description 1
- 241000209200 Bromus Species 0.000 description 1
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical compound NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 241001101998 Galium Species 0.000 description 1
- 240000005702 Galium aparine Species 0.000 description 1
- 235000014820 Galium aparine Nutrition 0.000 description 1
- 241001456088 Hesperocnide Species 0.000 description 1
- 241000209219 Hordeum Species 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241000801118 Lepidium Species 0.000 description 1
- 244000211187 Lepidium sativum Species 0.000 description 1
- 235000007849 Lepidium sativum Nutrition 0.000 description 1
- 241000209510 Liliopsida Species 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 241000209117 Panicum Species 0.000 description 1
- 235000006443 Panicum miliaceum subsp. miliaceum Nutrition 0.000 description 1
- 235000009037 Panicum miliaceum subsp. ruderale Nutrition 0.000 description 1
- 241000219833 Phaseolus Species 0.000 description 1
- 241000746981 Phleum Species 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000209051 Saccharum Species 0.000 description 1
- 240000000111 Saccharum officinarum Species 0.000 description 1
- 235000007201 Saccharum officinarum Nutrition 0.000 description 1
- 241000780602 Senecio Species 0.000 description 1
- 240000003705 Senecio vulgaris Species 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- 235000002634 Solanum Nutrition 0.000 description 1
- 241000207763 Solanum Species 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 244000152045 Themeda triandra Species 0.000 description 1
- 241000219422 Urtica Species 0.000 description 1
- 235000009108 Urtica dioica Nutrition 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical group ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 241000209149 Zea Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004188 dichlorophenyl group Chemical group 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- BGRWYRAHAFMIBJ-UHFFFAOYSA-N diisopropylcarbodiimide Natural products CC(C)NC(=O)NC(C)C BGRWYRAHAFMIBJ-UHFFFAOYSA-N 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 235000019439 ethyl acetate Nutrition 0.000 description 1
- BLHLJVCOVBYQQS-UHFFFAOYSA-N ethyllithium Chemical compound [Li]CC BLHLJVCOVBYQQS-UHFFFAOYSA-N 0.000 description 1
- 241001233957 eudicotyledons Species 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 244000230030 foxtail bristlegrass Species 0.000 description 1
- 229910021485 fumed silica Inorganic materials 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- KRZGKJJPEOUIBI-UHFFFAOYSA-N hydron;thiourea;iodide Chemical compound I.NC(S)=N KRZGKJJPEOUIBI-UHFFFAOYSA-N 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 235000014380 magnesium carbonate Nutrition 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 235000010460 mustard Nutrition 0.000 description 1
- UQFUPDGKJDVKCV-UHFFFAOYSA-N n-benzyl-n-carbonochloridoylcarbamoyl chloride Chemical compound ClC(=O)N(C(Cl)=O)CC1=CC=CC=C1 UQFUPDGKJDVKCV-UHFFFAOYSA-N 0.000 description 1
- JMUUPPALQRUKTR-UHFFFAOYSA-N n-carbonochloridoyl-n-(4-chlorophenyl)carbamoyl chloride Chemical compound ClC(=O)N(C(Cl)=O)C1=CC=C(Cl)C=C1 JMUUPPALQRUKTR-UHFFFAOYSA-N 0.000 description 1
- YJFBQAVICWDKHD-UHFFFAOYSA-N n-carbonochloridoyl-n-cyclohexylcarbamoyl chloride Chemical compound ClC(=O)N(C(Cl)=O)C1CCCCC1 YJFBQAVICWDKHD-UHFFFAOYSA-N 0.000 description 1
- ZSERAKDDJUCIBK-UHFFFAOYSA-N n-carbonochloridoyl-n-phenylcarbamoyl chloride Chemical compound ClC(=O)N(C(Cl)=O)C1=CC=CC=C1 ZSERAKDDJUCIBK-UHFFFAOYSA-N 0.000 description 1
- VJTOMRZQGQNLTP-UHFFFAOYSA-N n-carbonochloridoyl-n-propan-2-ylcarbamoyl chloride Chemical compound CC(C)N(C(Cl)=O)C(Cl)=O VJTOMRZQGQNLTP-UHFFFAOYSA-N 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 150000002926 oxygen Chemical class 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229960004838 phosphoric acid Drugs 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 239000003531 protein hydrolysate Substances 0.000 description 1
- DRTZAIDVOGUYSP-UHFFFAOYSA-N pyridin-1-ium;chloride;hydrochloride Chemical compound Cl.Cl.C1=CC=NC=C1 DRTZAIDVOGUYSP-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M sodium chloride Inorganic materials [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 229940055764 triaz Drugs 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- 229960004319 trichloroacetic acid Drugs 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/64—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with three nitrogen atoms as the only ring hetero atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/14—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hydrogen or carbon atoms directly attached to at least one ring carbon atom
- C07D251/16—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hydrogen or carbon atoms directly attached to at least one ring carbon atom to only one ring carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/14—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hydrogen or carbon atoms directly attached to at least one ring carbon atom
- C07D251/16—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hydrogen or carbon atoms directly attached to at least one ring carbon atom to only one ring carbon atom
- C07D251/20—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hydrogen or carbon atoms directly attached to at least one ring carbon atom to only one ring carbon atom with no nitrogen atoms directly attached to a ring carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/30—Only oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/38—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/42—One nitrogen atom
- C07D251/46—One nitrogen atom with oxygen or sulfur atoms attached to the two other ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Description
in der
R1 und
haben,
R1 und
haben,
Cl
R2 die oben angegebene Bedeutung
und diese in an sich bekannter Weise mit Verbindungen der allgemeinen Formel R3 - H in
Gegenwart von Säurebindern oder mit Verbindungen der allgemeinen Formel R3 - M umsetzt,
wobei M für ein AlkalimetaHatom oder
ein Magnesiummonohalogenid steht und wobei R3 jeweils die in Anspruch 1 angegebene
Bedeutung (für R3 - H jedoch ausgenommen R3 = C, _4-Alkyl) hat, oder daß man
in an sich bekannter Weise Verbindungen der allgemeinen Formel
in an sich bekannter Weise Verbindungen der allgemeinen Formel
R1— Ν' N — R2
gefunden, worin
R' für einen geradkettigen oder verzweigten Alkylrest
mit 1 bis 12 Kohlenstoffatomen, einen Cycloalkylrest mit 5 bis 7 Kohlenstoffatomen, einen
Benzylrest oder einen gegebenenfalls durch Chlor und/oder Methyl substituierten Phenylrest steht,
R2 für Wasserstoff, einen Alkylrest fflit 1 bis 4 Kohlenstoffatomen, eine Amino- oder Isopropyiidenaminogruppe steht und
R2 für Wasserstoff, einen Alkylrest fflit 1 bis 4 Kohlenstoffatomen, eine Amino- oder Isopropyiidenaminogruppe steht und
R3 für einen Alkylrest mit 1 bis 4 Kohlenstoffatomen, eine Alkylthiogruppe mit 1 bis 2 Kohlenstoffatomen,
eine Alkylaminogruppe mit 1 bis 4 Kohlenstoffatomen oder eine Dialkylaminogruppe mit 1
ι; oder 2 Kohlenstoffatomen je Alkylrest steht,
ausgenommen solche Verbindungen der Formel (I), in denen gleichzeitig R1 einen Alkylrest, Cycloalkylrest
oder gegebenenfalls (durch Chlor und/oder Methyl) substituierten Phenylrest, R2 Wasserstoff oder einen
Alkylrest und R3 einen Alkylamino- oder Dialkylaminorest
— jeweils mit der oben angegebenen Anzahl von Kohlenstoffatomen — bedeuten.
Weiterhin wurde gefunden, daß man die Tetrahydrol,3,5-triazin-2,6-dio:ie
der allgemeinen Formel (I), worin R1, R2 und R3 die oben angegebene Bedeutung haben,
erhält, wenn man ßis-(chlorcarbonyl)-amine der allgemeinen Formel
(IX)
worin
N^
H O
H O
R1 und R2 die oben angegebene Bedeutung haben,
mit anorganischen Säurehalogeniden zu Verbindungen der allgemeinen Formel (VIII) und
weiter gemäß Verfahrensvariante (a) umsetzt.
5. Verwendung von Tetrahydro- l,3,5-triazin-2,6-dionen
der allgemeinen Formel (I) gemäß Anspruch 1, worin R1, R2 und R3 die in Anspruch 1 angegebene
Bedeutung haben, zur Bekämpfung von unerwünschten Pflanzenwachstum.
(I)
Die Erfindung betrifft Tetrahydro-133-triazin-2,6-dione,
Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide.
Es ist bereits bekanntgeworden, daß Hexahydro-1,3,5-triazin-2,4,6-trione
eine gewisse herbizide Wirkung zeigen (vgl. deutsche Offenlegungsschrift 19 27921).
Ihre Wirkung befriedigt jedoch nicht.
Es wurden nun neue Tetrahydro-l,3,5-triazin-2,6-dione
der allgemeinen Formel
R' — N, ',N-R'
COCl
R1 —N
4
\
\
COCI
in welcher
R' die oben angegebene Bedeutung hat,
mit Verbindungen der allgemeinen Formel
HN = C-NH-R2
I (ΠΙ)
R3
in welcher
R2 und R3 die oben angegebene Bedeutung haben,
oder deren Salze mit organischen oder anorganischen Säuren in Gegenwart von Säurebindern umsetzt, wobei
in den Fällen, in denen R2 für Amino steht, diese Gruppe in an sich bekannter Weise durch Hydrazonenbildung
geschützt werden und nach der Reaktion leicht wieder freigesetzt werden kann (Verfahren A).
Man erhält Tetrahydro-1,3,5-triazin-2,6-dione der
allgemeinen Formel (I), worin R1 und R2 die oben
angegebene Bedeutung haben und RJ für eine Alkylaminogruppe
mit 1 bis 4 Kohlenstoffatomen oder eine Dialkylaminogruppe mit 1 oder 2 Kohlenstoffatomen je
Alkylrest steht, wenn man Verbindungen der allgemeinen Formel
O
h. R1 —N N-R2
h. R1 —N N-R2
S—R4
R1 und R3 die oben angegebene Bedeutung haben und
R4 für einen gegebenenfalls, z. B. durch Carboxyl,
substituierten Alkylrest steht,
in an sich bekannter Weise mit Aminen der allgemeinen Formel
HN
R5
(V)
und diese in an sich bekannter Weise mit Verbindungen der allgemeinen Formel R3 - H in
Gegenwart von Säurebindern oder mit Verbindungen der allgemeinen Formel R3 - M umsetzt,
wobei M für ein Alkalimetallatom oder ein Magnesiummonohalogenid
steht und wobei R3 jeweils die bei Verfahren A angegebene Bedeutung (für R3 - H jedoch ausgenommen R3 = C, _rAlkyl)
hat (Verfahren C, Variante a), oder daß man
ίο (b) in an sich bekannter Weise Verbindungen der allgemeinen
Formel
R6
15
worin entweder
R5 für Wasserstoff und R6 für Alkyl mit 1 bis 4
Kohlenstoffatomen oder
R5 und R6 jeweils für Alkyl mit 1 oder 2 Kohlenstoffatomen stehen,
R5 und R6 jeweils für Alkyl mit 1 oder 2 Kohlenstoffatomen stehen,
umsetzt (Verfahren B).
Man kann die Tetrahydro- l,3,5-triazin-2,6-d!one der
allgemeinen Formel (I), worin R1, R2 und R3 die bei 2s
Verfahren A angegebene Bedeutung haben, ferner dadurch herstellen, daß man
(a) Verbindungen der allgemeinen Formel
O
R'-NH- C— NH- R2
R'-NH- C— NH- R2
in der
R' und R2 die oben angegebene Bedeutung haben,
mit Chlorcarbonylisocyaniddichlorid der Formel O Cl
Il /
Cl-C-N=C (Vn)
Cl
gegebenenfalls in Gegenwart von Säurebindeni, zu
Verbindungen der allgemeinen Formel (VIII) umsetzt,
R'_N N —R2
JO
35
(VID)
in der
Cl
R' und R2 die oben angegebene Bedeutung haben,
COCI CH3
C(H< —N + HN-N = C xHJ —
COCl C CH,
HN SCH,
Rl—N N-R2
(IX)
OH
worin
R1 und R2 die oben angegebene Bedeutung haben,
mit anorganischen Säurehalogeniden zu Verbindungen der allgemeinen Formel (VIII) und weiter
gemäß Verfahrensvariante (a) umsetzt (Verfahren C, Variante b).
Die neuen Tetrahydro-13,5-triazin-2,6-dione der
allgemeinen Formel (I) zeichnen sich durch starke herbizide Wirksamkeit aus. Überraschenderweise zeigen
die erfindungsgemäßen Tetrahydro-13,5-triazin-2,6-dione eine erheblich höhere herbizide Wirkung als
die aus dem Stand eier Technik bekannten Hexahydro-13,5-triazin-2,4,6-trione.
Die erfindungsgemäßen Stoffe stellen somit eine Bereicherung der Technik dar.
Bei den Ringschlußreaktionen gemäß Verfahren A und C (Variante a) handelt es sich nicht um übliche
Verfahren. Es war zwar am Prioritätstag bekannt, daß sich NH-Verbindungen mit Säurechloriden acylieren
lassen, aber die zu den beanspruchten Verbindungen führenden Umsetzungen zwischen bifunktionellen NH-Verbindungen,
(III) bzw. (VI), mit bifunktionellen Säurechloriden (II) bzw. mit Chlorcarbonylisocyaniddichlorid
(VII) gemäß Verfahren A und C (Variante a) waren nicht vorbekannt, sondern sind neuartige,
technisch fortschrittliche und überraschende Ringschlußreaktionen. Überraschend war insbesondere der
aufgefundene glatte, ganz überwiegend zum Ringschluß führende Reaktionsverlauf, was nicht vorhersehbar war,
da alternativ auch eine lineare Verkettung der ■Komponenten hätte stattfinden können.
Verwendet man nach Verfahren A N-Phenyl-bis-(chlorcarbop.yl)-amin und Aceton-S-m:thyl-isothiosemicarbazonhydrojodid in Gegenwart von Triäthy'amin und spaltet anschließend in schwach saurer Lösung, so kann der Reaktionsablauf durch folgendes Formekchema wiedergegeben werden:
Verwendet man nach Verfahren A N-Phenyl-bis-(chlorcarbop.yl)-amin und Aceton-S-m:thyl-isothiosemicarbazonhydrojodid in Gegenwart von Triäthy'amin und spaltet anschließend in schwach saurer Lösung, so kann der Reaktionsablauf durch folgendes Formekchema wiedergegeben werden:
3 N(C2H5)3
-N(C2Hs)3
N(C2H5), ■
N(C2H5), ■
HJ
HCi
I, — N N — N = C
SCH3
-(CHj)2CO
C6H,-N N-NH2
SCH,
Verwendet man nach Verfahren B l-lsopropyl-S-amino^-methylthio-tetrahydro-l^S-triazin^o-dion und Äthylamin
in Gegenwart von p-Toluolsulfonsäure als Katalysator, so kann der Reaktionsablauf durch das folgende
Formelschema wiedergegeben werden:
(CHj)2CH-N N-NH2
SCH,
+ C2H,-NH2
(H'
(CHj)2CH-N N-NH2
O NH-C2H,
Verwende! m;in nach Verfahren C (Variante a) N-(4-C'hlorphenyl)-N'-äthylharnslolT, Chlorcarbnnylisoeyaniddichlorid
und Natrium-thiomelhylat oder nach Verfahren C (Variante b) ]-(4-ChlorphenyH-J-äthyl-hexahydrol.3.5-tri.i/in-2.4.6-tri<
>n. Phosphorpentachlorid und Natrium-thiomethylat, so kann der Reaktionsablauf durch das
folgende Formelschenia wiedergegeben sverden:
I!
c
4-CI —
Cl
N
O
O
NH-C2H,
Cl
I
C
C
Pyridin — 2HCl
4-Cl-CH1-N N-C2H,
PCI,
4-CI — C6H1-N N-C2H,
O Cl
NaSCH,
— NaCl
4-Cl-CH1-N N-C2H,
SCH-,
D;e erfindungsgemäß verwendbaren Bis-fchlorcarbonyl
>-amine sind zum Teil bereits bekannt (vgl. Synthesis. 1970. Seiten 542 und 543) und können soweit noch nicht
bekannt, in analoger Weise hergestellt werden. Als Beispiele seien im einzelnen genannt:
N-MethyKbis-chlorcarbonylJ-amin.
N'-Äthyi-ibis-chlorcarbonylJ-amin.
N-PropyKbis-chlorcarbonyl^amin.
N-Isopropyl-ibis-chlorcarbonylJ-amin.
N-selc-Butyl-ibis-chlorcarbonylJ-arnin.
N-tert-Butyl-{bis-chlorcarbonyI)-amin.
N-OctyKbis-chlorcarbony^-amin.
N-DodecyKbis-chlorcarbonyl^amin.
N-Cyclohexyl-(b!S-chIorcarbonyl)-amin.
N-BenzyKbis-chlorcarbonyty-amin.
N-(4-Chlor-phenyl)-(bis-chlorcarbonyl)-amin.
N-P^-Dichlor-phenylHbis-chlorcarbonyl)-
N-(4-Methyi-pheny!)-(bis-chlorcarbonyl)-amin.
N'-IS-Chlor-phenyiHbis-chiorcarbonylJ-amin.
amin.
N-(2.4-Dichlor-phenyl)-(bis-chlorcarbonyl)-amin.
Die erfindungsgemäß verwendbaren Verbindungen der Formel (III) sind bereits weitgehend bekannt und
sind, soweit noch nicht bekannt, nach bekannten
Verfahren herstellbar (vgl. z. B. Houben —Weyl. Metho-
rf, den der organischen Chemie. 4. Auflage. Band VIII.
Seiten 170-193, Band IX. Seiten 884-915. und Band XI/2, Seiten 38-69). Als Beispiele seien im einzelnen
genannt:
^i Acetamidin-hydrochlorid
!sobutyrarr.idin-hydrochlorid
Butyramidin-hydrochlorid
S-Methyl-isothioharnstofF-sulfat
!sobutyrarr.idin-hydrochlorid
Butyramidin-hydrochlorid
S-Methyl-isothioharnstofF-sulfat
N-S-Dimethyl-isothioharnstofT-hydrojodid
HN = C-NH-CH,
S
CH,
CH,
R3 IV
allgemeine Formel III Sp. 4
N-Äthyl-S-methyl-isothioharnstofT-hydrojodid
N-Butyl-S-äthyl-isothioharnMofT-hvdrojodid
Aeeton-S-methyl-isothiosemicarbazon-hydrojodid
I (3,4- Dichlorphenyl)-3-amino-4-methylthio-
tetrahydro-1 J^-triazin^ß-dion,
l-Methyl-4-methylthio-tetrahydro-
HN = C — Nu — N =
S
CH,
CH,
CfI,
CII, I Isopropyl 4-methylthiotetrahyclro-
l,3.5-triazin-2.6-dion, lterl.-Btityl-4-methvHhio-(etrahydro-
1,3,5-triazin-2,6-dion, l-Cyclohexyl-4-methylthio-(etrahydro-
l,3,5-triazin-2,6-dion, I-Benzy 1-4 methylthio-tetrahydro-
l,3,5-triazin-2,6-dion. I -I'heny 1-4 -methyl thio- tetrahydro·
l,3.5-triazin-2,6-dion. 1 (3.4· Dichlorphenyl)-4-methylthio-tetrahydro-
1,3,5-triazin-2.6dion, l■l5opΓopyl-3-methyl-4-methylthio-tetrahydro-
1 J.S-triazin^.ö-dion.
l-tert.-ButvlO-methyl^-methylihio-tetrahydro-
R1 R'
allgemeine Formel III Sp. 4 Amidra/on
NH
Il
R = C-NH-NH2
l-Isopropyliden-acetamidrazon
NH CH,
Il /
CH3-C-NH-N = C
\ CH.,
R3
R2
l-Isopropyliden-propionamidrazon
l-Methyl-S-methyl-isothiosemicarbazidhydrojodid.
Die gemäß Verfahren B als Ausgangsstoffe verwendeten 4-Alkylthio-tetrahydro-l,3,5-triazin-2,6-dione sind
bisher noch nicht bekannt; sie können jedoch nach Verfahren A hergestellt werden.
l-Methyl-S-amino-^methylthio-tetrahydro-
133-triazin-2,6-dion,
l-Äthyl-3-amino-4-methyIthio-tetrahydro-
133-triazin-2,6-dion,
l-Isopropyl-S-amino^-methylthio-tetrahydro-
13,5-t:riazin-2,6-dion,
l-tert-ButylO-amino^-methylthio-tetrahydro-
^^triazin^o,
l-Cydohexyl-S-amincM-methylthio-tetrahydro-
133-triazin-2,6-dion,
l-Benzyl-S-ammo-^methylthio-tetrahydro-
133-triazin-2,6-dion,
l-Phenyl-S-amino-i-methylthio-tetrahydro-
1 ^-triazin-iö-dion,
l-Cyclohexyl-3-methyl-4-methylthio■tetrahyclro-
1,3.5-triazin-2.6-dion. I -Phenyl- 3- methyl -4- methyl thio- tetrahydro-
l,3,5-triazin-2,6-dion. l-lsopropyl-3-äthyl-4-methylthio-tetΓahydro-
1.3.5-triazin-2.6-dion. Itert.-Butyl-S-äthyl^-methylthio-tetrahydro-
IJ.5-triazin-2.6dion. l-Cyclohexyl-3-äthyl-4-me^hylthio-tetrahydro-
l.3.5-triazin-2.6-dion. l-Phenyl-3-äthyl-4-methylthio-tetrahydro-
1.3.5-triazin-2.6-dion. l-lsopropyl-S-isopropyl^-methylthio-
tetrahydro-1 J.S-triazin^.ö-dion,
l-tert.-Butyl-3-isopropyl-4-methylthio-
tetrahydro-1.3.5-triazin-2.6-dion. l-Cyclohexyl-3-isopropyl-4-methylthio-
tetrahydro-l,3.5-triazin-2.6-dion. l-Phenyl-3-isopropyl-4-methylthio-tetrahydro-1.3.5-triazin-2.6-dion.
Die in Verfahren B als Ausgangsstoffe verwendeten Amine gemäß Formel (V) sind bereits bekannt. Als
Beispiele seien genannt:
Methylamin. Dimethylamin. Äthylamin. Isopropylamin. Butylamin, Diäthylamin.
Die in Verfahren C (Variante a) als Ausgangsstoffe eingesetzten Verbindungen der Formel (VI) sind bereits
weitgehend bekannt und können, soweit noch nicht bekannt, nach bekannten Verfahren hergestellt werden.
Als Beispiele seien genannt:
Ν,Ν'-Dimethyl-harnstoff,
Ν,Ν'-Diäthyl-harnstoff,
1 -Isopropyliden-^methyl-semicarbazon,
Il
I -IsopropylidenA-isopropyl-semicarbazon.
l-lsopropyliden-4-tert.-biityl-semicarbazon,
l-lsopropylidenA-cyclohexyl-semicarbazon,
i-lsopropylidenA-phenylsemicarbazon.
Das gemäß Verfahren C (Variante a) als Ausgangsverbindung
eingesetzte Chlorcarbonylisocyaniddichlorid ist durch Formel (VII) eindeutig definiert. Die
Verbindung ist bereits bekannt (vgl. deutsche Patentschrift 12 24 720). Die gemäß Verfahren C (Variante a)
als Ausgangsstoffe eingesetzten Verbindungen R'— FJ
oder R1—M, in denen M vorzugsweise Li, Na. K, MgCl,
MgBr oder MgI bedeutet, sind bereits bekannt. Als Beispiele seien genannt:
Methyl-lithium.
M ethyl-magnesit! mbrom id.
Äthyl-Iithium.
Natriiimthiomcthylat,
Natrium-thioäthylat, Methylamin,
Athylamin.
Propylamin, Isopropylamin, Dimethylamin, Diethylamin.
Die bei Verfahren C (Variante b) als Ausgangsstoffe eingesetzten Verbindungen der Formel (IX) sind bereits
weitgehend bekannt und können, soweit noch nicht bekannt, nach bekannten Verfahren hergestellt werden.
Als Beispiele seien genannt:
l-Methyl-3-isopropylidenamino-hexahydro-
1.3.5-triazin-2.4,6-trion. l-lsopropyl-3-isopropylidenamino-hexahydro-
1.3.5-triazin-2,4,6-trion, l-tert.-ButylO-isopropylidenamino-hexahydro-
i-CyclohexylO-isopropylidenamino-hexahydro-
l,3.5-triazin-2,4,6-'rion, i-Benzyl-3-isopropylidenamino-hexahydro-
l-Phenyl-3-isopropylidenamino-hexahydro-
l-(3.4-Dichlorphenyl)-3-isopropylidenamino-
hexahydro-1 J.S-triazin^Aö-trion.
I-Isopropyl^-methyl-hexahydro-U.S-triazin-
2,4,6-trion. l-tert.-ButylO-methyl-hexahydro-U.S-triazin-
2.4,6-trion. ] -CyclohexyW-methyl-hexahydro-13,5-triazin-
2,4,6-trion, 1 -PhenyI-3-methyl-hexahydro-13,5-triazin-
2,4,6-trion, l-Isopropyl-S-äthyl-hexahydro-^^triazin-
2,4,6-trion, l-tert.-Butyl-3-äthyl-hexahydro-l^-triazin-
2,4,6-trion, 1 -Cyciohexal-S-äthyl-hexahydro-13,5-triazin-
2,4,6-trion, 1 -Pheny]-3-äthyl-hexahydro-4 3,5-triazin-
2,4,6-trion, 1 -Isopropyl-3-isopropyl-hexahydro-13,5-tria7in-
2,4,6-trion, 1 -tert-Butyl-S-isopropyl-hexahydro-13,5-triazin-
2AJÖ- trion,
l-Cyclohexyl^-isopropyl-hexahydro-IJ.S-triazin-
2,4,6-trior„
l-Phenyl-S-isopropyl-hexahydro-IJ.S-triazin-
l-Phenyl-S-isopropyl-hexahydro-IJ.S-triazin-
2,4,6-trion.
Unter den nach Verfahren C (Variante b) verwendbaren anorganischen Säurehalogeniden sind vorzugsweise
Thionylchlorid, Phosgen, Phosphoruxychlorid oder Phosphorpentachlorid zu verstehen.
Die nach Verfahren (d) verwendbaren Verbindungen R'-H oder R1—M sind bereits für Verfahrensvariante
(a)definierl worden und sind mit diesen identisch.
Als Verdünnungsmittel bei Verfahren (A) kommen alle inerten organischen Lösungsmittel in Frage. Hierzu
gehören vorzugsweise Kohlenwasserstoffe, wie Petroläther, Benzol,Toluol und Xylol; Äther, wie Diä'thyläther.
Diisopropyläther und Dioxan; ferner Säureamide. wie Dimethylformamid und Dimethylacetamid.
Als .Säurebinder können alle üblichen Säurebindungsmittel
verwendet werden. Hierzu gehören vorzugsweise die Alkalihydroxide, Alkalicarbonate, Alkoholate und
tertiäre Amiri·;. Als besonders geeignet seien im
einzelnen genannt: Natriumhydroxid, Kaliumhydroxid, Natriumcarbonat, Kaliumcarbonat, Kalium-tert.-biitylat,
Pyridin, Triäthylamin. Triäthylendiamin. Dimethylanilin oder Diisopropyl-äthyl-amin.
Die Reaktionstemperaturen können in einem größeren Bereich variiert werden. Im allgemeinen arbeitet
man zwischen etwa 0 und etwa 5O0C, vorzugsweise zwischen 20 und 400C.
Die Umsetzungen erfolgen vorzugsweise bei Normaldruck, können jedoch bei Verwendung flüchtiger
Reaktanten auch bei erhöhtem Druck durchgeführt werden.
Bei der Durchführung des erfindungsgemäßen Verfahrens A setzt man auf 1 Mol Bischlorcarbonylamir. (II)
1 Mol der jeweiligen Verbindung gemäß Formel (III) ein
und fügt zur Neutralisierung der enstehenden Säure 2-4 Mol Säurebinder zu. Die Reaktion verläuft
exotherm. Die entstandenen Salze werden durch Absaugen oder Ausschütteln mit Wasser entfernt, die
organiche Phase eingedampft und der Rückstand umkristallisiert.
Als Verdünnungsmittel bei Verfahren B können beliebige organische Lösungsmittel verwendet werden.
Vorzugsweise sind darunter Alkohole, wie lsopropanol, tert.-Butanol, Carbonsäuren, wie Ameisensäure oder
Eisessig, und Äther, wie Diäthyläther oder Dioxan zu verstehen.
Als Katalysatoren kann man beliebige anorganische und organische Säuren zusetzen. Hierzu gehören
vorzugsweise Sauerstoffsäuren des Phosphors, Carbonsäuren und Sulfonsäuren oder Mischungen hiervon. Als
besonders geeignet seien genannt: Phosphorsäure, Eisessig, Trichloressigsäure, Benzolsulfonsäure oder
p-To'iuoIsuIfonsäure.
Die Reaktionstemperaturen können in einem größeren Bereich variiert werden. Im allgemeinen arbeitet
man zwichen etwa 0 und etwa 500C, vorzugsweise zwischen 20 und 30° C.
Die Umsetzungen erfolgen vorzugsweise bei Normaldruck,
können jedoch bei Verwendung flüchtiger Reaktanten auch bei erhöhtem Druck durchgeführt
werden.
Bei der Durchführung des erfindungsgemäßen Verfahrens B setzt man auf 1 Mol einer Verbindung gemäß
Formel (IV) einen Oberschuß von 5—10 Mol einer Verbindung gemäß Formel (V) ein.
14
Die Menge des zugesetzten Katalysators kann von
etwa 0,1 Mol bis etwa 1 Mol variiert werden.
Je iiach Natur der Verbindung (V) wird diese
gasförmig eingeleitet in die oder zugetropft zu der vorbereiteten Reaktionslösung. Die Reaktion verläuft
mit schwacher Wärmetönung unter Mercaptanabspaltung. Nach Beendigung der Abspaltung dampft man die
Reaktionsmischung in Vakuum ein und reinigt den Rückstand durch Kristallisation.
Als Verdünnungsmittel bei Verfahren C (Variante a) kommen alle inerten organischen Lösungsmittel in
Frage. Hierzu gehören vorzugsweise Kohlenwasserstoffe, wie Benzin, Benzol, Toluol und Äther, wie
Diäthjlätherund Dioxan.
Als Säurebinder kommen alle nicht nucleophilen Säurebindungsmittel in Frage. Hierzu gehören vorzugsweise
tertiäre Amine. Als besonders geeignet seien im einzelnen genannt: Triäthylamin, Diisopropyl-äthyldiViü'i, ι i'idi'tyict'iuiäiViin, r yriuifi üfiu uiiVicii'iyiaiVuii'l.
Die Reaktionstemperaturen können in einem größeren Bereich variiert werden. Im allgemeinen arbeitet
man zwischen etwa — 20° und etwa 400C, vorzugsweise
zwischen 0° und 300C.
Die Umsetzungen erfolgen vorzugsweise bei Normaldruck, können jedoch bei Verwendung von flüchtigen
Reaktanten auch bei erhöhtem Druck durchgeführt werden.
Bei der Durchführung des erfindungsgemäßen Verfahrens (Variante a) setn man auf 1 Mol einer
Verbindung gemäß Formel (VI) 1 Mol Chlorcarbonylisocyaniddichlorid (VlI) ein und bindet die entstehende
Säure durch 2 Mol eines geeigneten Säurefängers. Die Reaktion verläuft exotherm.
Man entfernt die entstandenen Salze durch Filtration und setzt die Reaktionslösung mit 1 Mol einer
Verbindung der Formel R3— H in Gegenwart von 1 Mol eines Säurebinders oder mit 1 Mol einer Verbindung der
Formel R3—M weiter um. Man entfernt die Salze durch
Filtration oder Ausschütteln mit Wasser, dampft die organische Phase im Vakuum ein und kristallisiert den
Rückstand um. Die Zwischenstufe (VIII) kann jedoch auch isoliert werden.
Als Verdünnungsmittel bei Verfahren C (Variante b) kommen alle inerten organichen Lösungsmittel in
Frage. Hierzu gehören vorzugsweise Kohlenwasserstoffe, wie Benzin. Benzol, Toluol und chlorierte
Kohlenwasserstoffe, wie Methylenchlorid, Chloroform und Tetrachlorkohlenstoff.
Die Reaktionstemperaturen können in einem größeren Bereich variiert werden. Im allgemeinen arbeitet
man zwischen etwa 20 und etwa 1200C, vorzugsweise zwischen 40 und 80° C.
Die Umsetzungen erfolgen vorzugsweise bei Normaldruck, können jedoch bei Verwendung von flüchtigen
Reaktanten auch bei erhöhtem Druck durchgeführt werden.
Bei der Durchführung des erfindungsgemäßen Verfahrens C (Variante b) setzt man auf 1 MoI einer
Verbindung gemäß Formel (IX) 1—10 MoI des anorganischen Säurehalogenids ein, das entweder
gasförmig eingeleitet oder portionsweise zugegeben wird. Die Reaktion verläuft unter Gasentwicklung. Am
Ende der Reaktionszeit entfernt man einen Überschuß des Säurehalogenids oder dessen Reaktionsprodukte
durch Evakuieren. Die gebildete Zwischenstufe (VIII) kann dann mit oder ohne Isolierung wie bei Verfahren C
(Variante a) beschrieben weiter umgesetzt werden.
Als neue Wirkstoffe seien im einzelnen genannt:
l-Methyl-S-äthyl^-methylthio-tetrahydro-
l,3,5-triazin-2,6-dion, l-Methyl-S-isopropylidenamino^-methylthio-
tetrahydro-l,3,5-triazin-2,6-dion, 1-Methyl-3-amino-4-methylamino-'r!tnhydro-
1,3,5-triazin-2,6-dion, l-Methyl-3-amino-4-äthyl-ietrahydro-
l,3,5-triazin-2,6-dion, l-Äthyl-3-amino-4-methylthio-tetrahydro-
1,3,5-triazin-2,6-dion, l-Isopropyl-4-methyl-tetrahydrol,3,5-triazin-2,6-dion,
-lsopropyl-4-äthyl-tetrahydro-
i-lsopropyl-4-methylthio-tetrahydro-
l,3,5-triazin-2,6-dion, i-lsopropyl^-amino^-methyl-tetrahydro-
-Isopi upyi-3-iiiMii'iO-4-dMiyi-ieii anyui u-
1,3,5-triazin-2,6-dion, l-lsopropylO-amino^-methylthio-tetrahydro-
l,3,5-triazin-2,6-dion, l-IsopropylO-amino^-methylamino-tetrahyd-o-
l,3,5-triazJn-2,6-dion. l-IsopropylO-amino^-dimethylamino-
tetrahydro-1 J.S-triazin^.ö-dion,
l-lsopropyl-S-amino^-äthylamino-tetrahydro-
l-lsopropyl-3-isopropylidenamino-4-methylthio-
tetrahydro-1,3,5-triazin-2,6-dion, l-lsopropyl-S-isopropylidenamino^-äthylamino-
tetrahydro-1,3.5-triazin-2,6-dion, l-Isopropyl-S-methyl^-methylthio-tetrahydro-
l,3.5-triazin-2,6-dion, l-Isopropyl-3-äthyl-4-methylthio-tetrahydro-
Isopropyl-3-isopropyl-4-methylthiotetrahydro-1 AS-triazin^.B-dion,
Isopropyl-S-me'hyM-methyl-tetrahydro-
l,3,5-tri.azin-2,6-dion, -IsopropylO-methyl^-äthyl-tetrahydro-
1,3,5-tr iazin-2,6-dion, -sek.-Bulyl-3-amino-4-methylthio-tetr ;hydro-
1,3,5-triazin-2,6-dion. -tert.-Bu'tyl-S-amino^-methylthio-tetrahydro-
1,3,5-tnazin-2,6-dion, -tert.-Bu tyl-3-isopropylidenamino-4-methyl-
thio-tetxahydro-1 ^.S-triazin^.e-dion.
-tert.-Bu tyl-S-amino^-methylamino-tetrahydro-
1,3,5-triazin-2,6-dion, -tert.-Bu tyl-3-amino-4-äthylamino-te trahydro-
l,3,5-triazin-2,6-dion, -Butyl-S-amino^-methylthio-tetrahydro-1,3,5-tri
azin-2,6-dion, Octyl-3-aniino-4-methylthio-tetrahydro-
1,3,5-tri azin-2,6-dion, -Dodecyl-S-amino^-methylthio-tetrahydro-
13,5-triazin-2,6-dion, -Cyciohexyl-S-amino^-methylthio-tetrahydro-
l-CycIohexyl-S-amino^-äthylamino-tetrahydro-
13^-triazin-2,6-dion, i-Benzyl-S-isopropylidenamino^-methylthio-
tetrahydro-13r5-triazin-2,6-dion, l-Benzyl-S-amino^-äthyl-tetrahydro-13,5-triazin-2,6-dion,
-Benzyl- S-amino^-vnethylamino-tetrahydro-1,3,5-triazin-2,6-dion,
l-Phenyl-3-amino-4-äthyl-tetrahydro-
1 r3,5-triazin-2,6-dion,
l-Phenyl-3-amino-4-äthylamino-tetrahydro-
l-Phenyl-3-amino-4-äthylamino-tetrahydro-
13,5-triazin-2,6-dion,
l-(4-Chloi^henyl)-3-amino-4-methy!thio-
l-(4-Chloi^henyl)-3-amino-4-methy!thio-
tetrahydro-13,5-triazin-2,6-dion,
l-(4-ChIorphenyl)-3-amino-4-äthylamino-
l-(4-ChIorphenyl)-3-amino-4-äthylamino-
tetrahydro-1 3,5-triazin-2,6-dion,
l-(3,4-Dichlorphenyl)-3-amino-4-methyIthio-
l-(3,4-Dichlorphenyl)-3-amino-4-methyIthio-
tetrahydro-1 r3,5-triazin-2,6-dion,
l-(4-Methylphenyl)-3-amino-4-methyIthio-
l-(4-Methylphenyl)-3-amino-4-methyIthio-
tetrahydro-13r5-triazin-2,6-dion.
Die erfindungsgemäßen Wirkstoffe weisen starke herbizide Eigenschaften auf und können deshalb zur
Bekämpfung von Unkraut verwendet werden. Unter Unkraut im weitesten Sinne sind alle Pflanzen zu
verstehen, die un Orten aufwachsen, wo sie unerwünscht
sind. Da die Wirkstoffe das Pflanzenwachstum in unterschiedlicher Weise beeinflussen, können sie als
selektive Herbizide verwendet werden. In höheren Konzentrationen (25 kg/ha) eignen sich die ertindungsgemäßen
Wirkstoffe zur totalen Unkrautbekämpfung.
Die erfindungsgemäßen Stoffe können z. B. bei uen
folgenden Pflanzen verwendet werden: Dikotyle, wie Senf (Sinapis), Kresse (Lepidium), Klettenlabkraut
(Galium), Vogelmiere (Stellaria), Kamille (Matricaria), Franzosenkraut (Galinsoga), Gänsefuß (Chenopodium),
Brennessel (Urtica), Kreuzkraut (Senecio), Baumwolle iGossypium), Rüben (Beta), Möhren (Daucus), Bohnen
(Phaseolus), Kartoffeln (Solanum), Kaffee (Coffea); Monokotyle, wie Lieschgras (Phleum), Rispengras (Poa),
Schwingel (Festuca), Eleusine (Eleusine), Fennich (Setaria), Raygras (Lolium), Trespe (Bromus), Hühnerhirse
(Echinochloa), Mais (Zea), Reis (Oryza), Hafer (Avena), Gerste (Hordeum), Weizen (Triticum), Hirse
(Panicum), Zuckerrohr (Saccharum).
Besonders gut eignen sich die Wirkstoffe zur selektiven Unkrautbekämpfung in Baumwolle, Mais,
Getreide und Möhren.
Die erfindungsgemäßen Wirkstoffe können in die üblichen Formulierungen übergeführt werden, wie
Lösungen, Emulsionen, Suspensionen, Pulver, Pasten und Granulate. Diese werden in bekannter Weise
hergestellt, z. B. durch Vermischen der Wirkstoffe mit Streckmitteln, also flüssigen Lösungsmitteln, unter
Druck stehenden verflüssigten Gasen und/oder festen Trägerstoffen, gegebenenfalls unter Verwendung von
oberflächenaktiven Mitteln, also Emulgiermitteln und/oder Dispergiermitteln und/oder schaumerzeugenden
Mitteln. Im Falle der Benutzung von Wasser als Streckmittel können z. B. auch organische Lösungsmittel
als Hilfslösungsmittel verwendet werden. Als flüssige Lösungsmittel kommen im wesentlichen in Frage:
Aromaten, wie Xylol, Toluol, Benzol oder Alkylnaphthaline, chlorierte Aromaten oder chlorierte aliphatische
Kohlenwasserstoffe, wie Chlorbenzole, Chloräthylene oder Methylenchlorid, aliphatische Kohlenwasserstoffe,
wie Cyclohexan oder Paraffine, z. B. Erdölfraktionen, Alkohole, wie Butanol oder Glycol sowie deren Äther
und Ester, Ketone, wie Aceton, Methyläthylketon, Methyiisobutyiketon oder Cyclohexanon, stark polare
Lösungsmittel, wie DimethylformamidundDimethylsulfoxid
sowie Wasser; mit verflüssigten gasförmigen Streckmitteln oder Trägerstoffen sind solche Flüssigkeiten
gemeint, welche bei normaler Temperatur und unter Normaldruck gasförmig sind, z. B. Aerosol-Treibgase,
wie Halogenkohlenwasserstoffe. z.B. Freon; als feste
Trägerstoffe: natürliche Gesteins>nehle, wie Kaoline, Tonerden, Talkum, Kreide, Quarz, Attapulgit, Montmorillor.it
und Diatomeenerde, und synthetische Gesteins mehle, wie hochdisperse Kieselsäure, Aluminiumoxid
und Silikate; als Emulgier- und/oder schaumerzeugende Mittel: nichtionogene und anionische Emulgatoren, wie
Polyoxyäthylen-Fettsäureester, Polyoxyäthylen-Fettal
kohol-äther, z. B. Alkylarylpolyglycol-äther, Alkylsulfo
nate, Alkylsulfate, Arylsulfonate sowie Eiweißhydroly
ίο sate; als Dispergiermittel: z.B. Lignin-Sulfitablaugen
und Methylcellulose.
Die erfindungsgemäßen Wirkstoffe können in den Formulierungen in Mischung mit anderen bekannten
Wirkstoffen vorliegen.
Die Formulierungen enthalten im allgemeinen zwi
sehen 0,1 und 95 Gewichtsprozent Wirkstoff, Vorzugs weise zwischen 0,5 und 90 Gewichtsprozent
Die Wirkstoffe können als solche, in Form ihrer Formulierungen oder der daraus bereiteten Anwen
dungsformen, wie gebrauchsfertige Lösungen, Emulsionen, Suspensionen, Pulver, Pasten und Granulate
angewandt werden. Die Anwendung geschieht in üblicher Weise, z. B. durch Gießen, Verspritzen
Vernebeln, Verstreuen, Verstäuben.
Die Anwendung ist sowohl nach dem post-emergence-Verfahren
wie nach dem pre-emergence-Verfahren möglich. Die eingesetzte Wirkstoffmasse kann in
größeren Bereichen schwanken. Sie hängt im wesentli chen ab von der Art des gewünschten Effekts. Im
allgemeinen liegen die Aufwandmengen zwischen 0,1 und 20 kg Wirkstoff/ha, vorzugsweise zwischen 0,5 und
15 kg/ha.
Herstellungsbeispiele
CH3-N N-N = C(CHj)2
SCH,
15,6 g (0,1 MoI) N-Methyl-bis-ichlorcarbonylJ-amir
werden in 100 ecm Benzol gelöst und unter Rühren zu
27,3 g (0,1 Mol) Aceton-S-methyl-isothio-semicarbazon
hydrojodid in 100 ecm Benzol suspendiert zugetropft Anschließend tropft man langsam 303 g (03 Mol
Triäthylamin in 50 ecm Benzol zu. Man rührt noch 1 Stunde nach und saugt den Niederschlag ab. Dei
Niederschlag wird in 100 ecm Chloroform und 100 ccn Wasser gegeben und ausgeschüttelt. Die Chloroform
phase wird abgetrennt, über Calciumchlorid getrockne und zusammen mit dem Benzolfiltrat im Vakuurr
eingedampft. Der Rückstand wird aus Isopropano umkristallisiert. Man erhält 17,3 g (76%) 1-Me'.hyl-3-iso
propylidenamino-4-methylthio-tetrahydro-13,5-triazin-2,6-dion
als farbloses Pulver, Schmelzpunkt 130 - 132° C
CH,- N N-NH2
O SCH3
22.8 g (0,1 Mol) 1-Methyl-3-isopropylidenamino-4
methylthio-tetrahydro-1,3,5-triazin-2.6-dion (nach Bei
230 216/12
spiel 1 hergestellt) werden in 250 ecm Äthanol gelost
und unter Zusatz einer Spatelspitze p-Toluolsulfonsäure 5 Stunden auf 50° C erwärmt, wobei ein Vakuum von ca.
200 mm Hg angelegt wird. Man dampft im Vakuum ein und kristallisiert den Rückstand aus Äthanol um. Man
erhält 18 g(96°/o) l-Methyl-S-amino^-methylthio-tetrahydro-lr3,5-triazin-2,6-dion
als farblose Nadeln, Schmelzpunkt 174-175° C.
Beispiel 6
O
O
(CHj)2CH-N N-NH2
NH-CH3
CH3-N N-NH2
NH-CH3
18,8 g (0,1 Mol) l-Methyl-a-amino^-methylthio-tetrahydro-l3.5-triazin-2,6-dion
(nach Beispiel 2 hergestellt) werden in 200 ecm Isopropanol unter Zusatz von 6 g
Eisessig und einer Spatelspitze p-Toluolsulfonsäure
gelöst und bei Raumtemperatur mit Methylamin-Gas gesättigt. Man läßt den Ansatz ca. 10 Stunden stehen,
dampft irr. Vakuum ein und kristallisiert den Rückstand aus Isopropanol um. Man erhält 15 g(88°/o) l-Methyl-3-amino-4-methyIamino-tetrahydro-13^-triazin-2,6-dion
als farbloses Pulver, Schmelzpunkt 225 - 227° C.
Beispiel 4
O
O
(CHj)2CH-N N-N = C(CHj)2
O SCH3
O SCH3
Analog Beispiel 3 erhält man aus l-Isopropyl-3-amino-4-methylthio-tetrahydro-l
,3,5-triazin-2,6-dion (nach Beispiel 5 hergestellt) und Methylamin das 1-Isopropyl-3
-amino-4-methylamino-tetrahydro-1,3,5-triazin-2,6-dion
als farbloses Pulver vom Schmelzpunkt 195-196°C.
(CH^CH—N N-NH2
N(CH3),
Analog Beispiel 3 erhält man aus l-Isopropyl-3-amino-4-methylthio-tetrahydro-l
,3,5-triazin-2,6-dion (nach Beispiel 5 hergestellt) und Dimethylamin das 1-Isopropyl-S-amino^-dimethylamino-tetra-hydro-l^S-triazin-2,6-dion
als farbloses Pulver vom Schmelzpunkt 131-133°C.
(CH3J2CH-N N
NH2
NH-C2H5
Analog Beispiel I erhält man aus N-Isopropyl-bis-(chlorcarbonyl)-amin
(analog Synthesis 1970, S. 542-543 hergestellt: Kp12: 66-67°C) und Aceton-S-methyl-isothio-semicarbazon-hydrojodid
unter Zusatz von Triäthylamin 1 -IsopropylO-isopropylidenamino^-methylthio-tetrahydro-l,3,5-triazin-2,6-dion
als blaßgelbes Pulver vom Schmelzpunkt 110-1120C.
Beispiel 5
O
O
(CH3J2CH-N N-NH2
Analog Beispiel 3 erhält man aus l-Isopropyl-3-amino-4-methylthio-tetrahydro-l
,3,5-triazin-2,6-dion (nach Beispiel 5 hergestellt) und Äthylamin das 1-Isopropyl
- 3 - amino - 4 - ethylamino - tetrahydro -1,3,5 - triazin-2,6-dion
als farbloses Pulver vom Schmelzpunkt 122-1230C.
Beispiel 9
O
O
H V-N N-N = C(CHj)2
SCH,
Analog Beispiel 2 erhält man aus l-Isopropyl-3-isopropylidenamino
- 4 - methylthio - tetrahydro -1,3.5 - triazin-2,6-dion
(nach Beispiel 4 hergestellt) das 1-lsopropyl-4-methylthio-l,3,5-triazin-2,6-dion
als farblose Nadeln vom Schmelzpunkt 148-1500C.
Analog Beispiel 1 erhält man aus N-Cyclohexyl-bis-(chlorcarbonyl)-amin
(analog Synthesis 1970, S. 542-543 hergestellt, Kp1,,: 80-820C) und Aceton-S-methyl-isothioscmicarbazon-hydrojodid
unter Zusatz von Triäthylamin l-C'yclohexyl-3-isopropylidenamino-4-methylthio-tetrahydro-l,3,5-triazin-2,6-dion
als blaßgelbes Pulver vom Schmelzpunkt 111 — 112°C.
| 19 | 22 | 54 | 200 | 20 |
| Beispiel 10 | Beispiel 14 | |||
| O A N N—NH2 |
O V-N N-NH2 |
SCH3
Analog Beispiel 2 erhält man aus l-Cyclohexyl-3-isopropylidenamino
- 4 - methylthio - tetrahydro -1,3,5 - triazin-2,6-dion (nach Beispiel 9 hergestellt) das 1-Cyclohexyl-S-amino^-methylthio-tetrahydro-l^.S-triazin-2,6-dion
als farbloses Pulver vom Schmelzpunkt 177-1790C.
O SCH3
Analog Beispiel 2 erhält man aus l-Phenyl-3-isopropylidenamino
-4 - methylthio - tetrahydro -1,3,5 - triazin-2,6-dion (nach Beispiel 13 hergestellt) das 1-Phenyl-3-amino-4-methylthio-tetrahydro-1,3,5-triazin-2,6-dion
als farblose Nadeln vom Schmelzpunkt iO5-2O8°C.
-CH2-N N-N =
SCHj
Beispiel 15
O
O
N N-NH2
NH-CH3
Analog Beispiel 1 erhält man aus N-Benzyl-bis-(chlorcarbonyl)-amin
und Aceton-S-methyl-isothiosemicarbon-hydrojodid unter Zusatz von Triäthylamin
1 - Benzyl - 3 - isopropylidenamino -4 - methylthio - tetrahydro-l,3,5-triai.n-2,6-dion
als blaßbraunes Pulver vom Schmelzpunkt 148-1500C.
Beispiel 12
O
O
CH2—N N-NH2
Analog Beispiel 3 erhält man aus l-Phenyl-3-amino-4-methylthio-tetrahydro-l,3,5-triazin-2,6-dion
(nach Beispiel 14 hergestellt) und Methylamin das 1-Phenyl-3
-amino -4 - methylamino - tetrahydro-1,3,5 -triazin-2,6-dion
als farbloses Pulver vom Schmelzpunkt 242-244°C.
CH3
N N-N =
SCH3
Analog Beispiel 2 erhält man aus l-Benzyl-3-isopropylidenamino
- 4 - methylthio - tetrahydro -1,3,5 - triazin-2,6-dion
(nach Beispiel U hergestellt) das 1-Benzyl-
als farbloses Pulver vom Schmelzpunkt 127-128°C. y,
SCH3
Analog Beispiel 1 erhält man aus N-(4-Methylphenyl)-bis-(chlorcarbonyl)-amin
und Aceton-S-methyl-isothiosemicarbazon-hydrojodid unter Zusatz von
Triäthylamin 1 - (4 - Methylphenyl) - 3 - isopropylidenamino-4-methyIthio-tetrahydro-l,3,5-triazin-2,6-dion
als gelbes Pulver vom Schmelzpunkt 170-1730C.
N N-N = C(CHj)2
SCH3
Analog Beispiel I erhält man aus N-Phenyl-bis-(chlorcarbonyl)-amin
und Aceton-S-methyl-isothiosemicarbazon-hydrojodid
unter Zusatz von Triäthylamin 1 -Phenyl-3-isopropylidenamino-4-methylthi!>tetrahydro-l,3,5-triazin-2,6-dion
als blaßgclbes Pulver vom Schmelzpunkt 206-207°C.
Analog Beispiel 2 erhält man aus l-(4-Methylphenyl)-3
-isopropylidenamino-4 -methylthio- tetrahydro-1,3.5-triazin-2.6-clion
(nach Beispiel 16 hergestellt) das l-(4-Mcthylphenyl)-3-amino-4-methylthio-tetrahydro-1.3,5-triazin-2,6-dion
als farbloses Pulver vom Schmelzpunkt 19(i-197°C.
CH3
N-NH2
NH-CH3
Analog Beispiel 3 erhält man aus l-(4-Methylphenyl)-S-amino^-mcthylthio-tetrahydro-l^S-triazin^o-dion
(nach Beispiel 17 hergestellt) und Methylamin das l-(4-Methylphenyl)-3-amino'-4-methylarnino-tetrahydro-l,3,5-triazin-2,G-dion
als farbloses Pulver vom Schmelzpunkt 242-243°C.
Analog Beispiel 3 erhält man aus l-(4-Methylphenyl)-3-amino-4-methylthio-tetrahydro-l,3,5-triazin-2,6-dion
(nach Beispiel 17 hergestellt) und Äthylamin das l-(4-Methylphenyl)-3-amino-4-äthylamino-tetrahydrol,3,5-triazin-2,6-dion
als farblose Nadeln vom Schmelzpunkt 247-248°C.
N N-N = C(CHj)2
Analog Beispiel 1 erhält man aus N-(4-Chlorphenyl)-bis-(chlorcarbonyl)-amin
und Aceton-S-methyl-isothioseirricarbazon-hydrojodid
unter Zusatz von Triäthylamin 1 - (4 - Chlorphenyl)-3 - isopropylidenamino-4 - methylthio - tetrahydro -1,3,5 - triaziη - 2,6 - dion als
farbloses Pulver vom Schmelzpunkt 142-144°C.
Analog Beispiel 2 erhält man aus l-(4-Chlorphenyl)-3 - isopropylidenamino - 4 - methylthio - tetrahydrol,3,5-triazin-2,6-dion
(nach Beispiel 20 hergestellt) das l-(4-Chlorphenyl)-3-amino-4 -methylthio- tetrahydro-1.3,5-triazin-2,6-dion
als farbloses Pulver vcm Schmelznunkt 210-2120C.
Cl
N N-N = C(CH3),
SCH3
lu Analog Beispiel 1 erhält man aus N-(3,4-Dichlorpheiiyl)-bis-(chlorcarbonyl)-amin
und Aceton-S-methyl-isothiosemicarbazon-hydrojodid unter Zusatz von
Triäthylamin l-^-Dichlorphenvö-S-isopropylidenamino-4-methylthio-tetrahydro-l,3,5-triazin-2,6-dion
als farbloses Pulver vom Schmelzpunkt 181-182°C.
SCH3
Analog Beispiel 2 erhält man aus l-(3,4-Dichlorphtuyl)
- 3 - isopropylidenamino - 4 - methylthio - tetrahydro-l,3,5-triazin-2,6-dion (nach Beispiel 22 hergestellt)
das l-(3,4-Dichlorphenyl)-3-amino-4-methylthiotetrahydro-l,3,5-triazin-2,6-dion
als farbloses Pulver vom Schmelzpunkt 247°C (Zersetzung).
B e i s ρ i e 1 24
O
O
CH3-N N —CH3
Vs
SCH3
23,2 g(0,l Mol) N.S-Dimethyl-isothioharnstoff-hydrojodid
werden in 100 ecm Wasser und 250 ecm Benzol vorgelegt. Unter kräftigem Rühren tropft man aus 2
Tropftrichtern gleichzeitig 15,6 g (0,1 Mol) N-Methylbis(chlorcarbonyl)-amin
in 100 ecm trockenem Benzol und 12 g (0,3 Mol) Natriumhydroxid in 100 ecm Wasser
gelöst langsam zu. Die Reaktion verläuft stark exotherm. Man rührt 1 Stunde nach, saugt gegebenenfalls
ausgefallenes Produkt ab, trennt die Benzolphase ab, trocknet sl·; über Calciumchlorid und dampft im
Vakuum ein. Der Rückstand wird zusammen mit evtl. Nutschgut aus Isopiopanol umkristallisiert. Man erhält
•j5 Wg (75%) l^-Dimethyl^-methyithio-tetrahydro-U.S-triazin-2,6-dion
als farbloses Pulver vom Schmelzpunkt 137-139° C.
B e i s ρ i e I 25
CH3-N N-C2H5
SCH,
Analog Beispiel 24 erhält man aus N-Äthyl-S-methylisothioharnstoff-hydrojodid
und N-Methyl-bis-(chlor-
carbonyl (-ami η I -Methyl-3-iithy I-4-methylthio-tetrahydro-1.3,5-triazin-2.6-dion
als farbloses Pulver vom Schmelzpunkt I18-|I9°C.
CH,-
-N Ν —C4H,-n
3 -met hy 1 -4-methylthio- tetrahydro-1.3,5 -triaz.in-2.6-di
on als farbloses Pulver vom Schmelzpunkt 135-137°C
B e i s ρ j e I 30
-N N-CH,
η SCH,
Analog Beispiel 24 erhält man aus N-n-Butyl-S-methvl-isoihiohamstolT-hydrojodid
und N-Methyl-bisichlorcarbonyli-amin
l-Methyl-3-butyl-4-methylthiotetrahydro-l.3.5-triazin-2.6-clion
als farhloses Pulver vom Schmelzpunkt 121 — 122"C".
Beispiel 27
O
O
A
(CHjXH-N N-CH,
(CHjXH-N N-CH,
SCH,
SCH,
Analog Beispiel 24 erhält man aus N.S-Dimethyl-iso
thioharnstoff-hydrojodid und N-Phenyl-bis-(ehlor
carbonyl)-amin l-Phcnyl-3-methyl-4-methylthio-tetra
hydro-l,3.5-triazin-2.6-dion als farblose Plättchen von
Schmelzpunkt 236 239°C.
B e i s ρ i e I 31
O
O
N N-C2H,
SCH,
Analog Beispiel 24 erhält man aus N.S-Dimethyl-isothioharnstoff-hydrojcidid
und N-hopropyl-bis-(chlorcarbonyh-amin
(analog Synthesis 1970. S. 542-543 hergestellt. Kp -: 66-67"C) l-lsopropyl-3-methyI-4-methylthio-tetrahydro-!.3.5-triazin-2.6-dion
als farblo^e-,
Pulver vom Schmelzpunkt ~"3-~5"C.
Beispiel 28
O
O
(C H j -CH-N N-C-H,
SCH,
Analog Beispiel 24 erhält man aus N-Ath>l-S-methylisothioharnstoff
- hydrojodid und N - Isopropyl - bis-(chl'ircarbonyl
i-amin 1 - Isopropyl o-äthyl^-methylthir»-tetrahydro-1.3.5-triazin-2.6-dion
als farbloses Pulver vom Schmelzpunkt 198-2On-C.
B e i s ρ i e I 29
N-CH.
SCH.
Analog Beispiel 24 erhält man aus N.S-Dimethylisothioharnstoff-hydrojodid
und N-Cyclohexyl-bisichlorcarbonylrarnin
(analog Synthesis 1970. Seite 542-543 hergestellt. Kp--.: 80-82'Ci 1-CvciohexvI-Analog
Beispiel 24 erhält man aus N-Äthyl-S-methylisothioharnstoff-hydrojodid
und N Phenyl-bis-(chlor carbonyl ι-amin 1 -Phenyl-3-äthyM-methylthio-tetra
hydro-1.3.5-triazin-2.6-dion als farbloses Pulver von/ Schmelzpunkt 149-15O°C.
Beispiel 32
O
O
SCH.
Analog Beispiel 24 erhält man aus N-n-Propyl-S-methyl-isothioharnstolT-hydrojodid
und N-Phenyl-bis-(chlorcarbonyli-amin
1-Phenyl-3-n-propyl-4-methylthio-tetrahydro-1.3.5-tnazin-2.6-dion
als farbloses PuI- \er vom Schmelzpunkt 124-1263C.
Beispiel
O
O
SCH,
Analog Beispiel 24 erhält man aus N.S-Dimethylisothioharnstoff-hydrojodid
und N-(4-ChIorphenyl)-bis-ichlorcarbonyl
i-amin 1 -(4-ChIorphenyl)-3-methyl-4-rnelhyiihiu-ietiahydru-i.3.5-iriazin-2.6-uiön
loses Pulver vom Schmelzpunkt 146-148°C.
loses Pulver vom Schmelzpunkt 146-148°C.
2h
Beispiel 38
Beispiel 38
CII1-N Nil
O CMI,
Analog Beispiel 24 erhiill man aus N-Athyl-S-methylisothtoliarnston"-hydrojodid
und N-i-t-Chlorpnein I )-bis-(chlorcarhonvlt-amin
1 -(-l-C hltirphcii>
1 >-3-;iIh>
1 -4-incthylthio-tetrahydm-l.3.5-lriazin-2.(>-dion
als farblo^'s Pulver vom Schmelzpunkt I11S 2W~l\
CII1-N NlI
C) SCH,
Analog Beispiel 24 erhält man aus S-Methyl-isolhioharnstolT-sullat
und N-Methyl-bis-(chlorcarbonyl)-amin I -MethyM-methylthio-tetrahydro-l.3.5-triaziiv
2.6-dion als farbloses Pulver vom Schmelzpunkt 244-245°C
10.1g (0.1 Mol) Propionamidin-hvclroehlorid werden
in 125 L-Liii Wasser und 200 rein Benzol suspendiert.
I inier kräftigem Kühren tropft man gleichzeitig aus 2
Tropftrichtern 1i.bg(0.l Mol) NMeihvl-bis-fchlorcarbon\l)amin
in 100 ecm trockenem Ben/ol und 18 g(0.45 Mol) Natriumhydroxid in 100 ecm Wasser gelöst
langsam zu. Die Reaktion verläuft exotherm. Man rührt I Stunde nach, trennt die wäßrige Phase ab. säuert sie
mit F-'iscssig an und dampft im Vakuum ein. Der
klickstand wird mehrfach mit hssigsaurc-athviester
ausgekocn!. Man engt die Lösung im Vakuum ein und kiihlt ab. Der Niederschlag wird abgesaugt. Man erhält
7.8 g (50%) I -Methyi^-athyltetrahydro- 1.3.5-trinzin-2.6-dion
als farblose Nadeln vom Schmelzpunkt 202-203 C.
Ii e ι s ρ i e I .1(>
O
O
(CII1IjCH-N 'Nil
CMI,
Beispiel 36
O
O
(CIlJ-CH-N NH
O SCH,
Analog Beispiel 4d ei halt man aus Propionamidinhydrochlorid
und NMsopropyl-bis-fchlorcarbonyl )-amin
1 - Isopmpyl -4 -äthyl -tetrahydro-1.3.5 - Iriazin-2.6-dion
al-; t'arblove Nadeln vom Schmelzpunkt
14(. 1-18 C.
Beispiel 40
O
O
Analog Beispiel 24 erhält man aus S-Methyl-isothiohamstofT-sulfat
und N-Isopropyl-bis-(chlorcarbonyl)-amin 1 - Isopropyl-4-methylthio-tetrahydro-1.3.5-triazin-2.6-dion
als farbloses Pulver vom Schmelzpunkt 186-187°C.
Analog Beispiel 24 erhält man aus S-Methyl-isothioharnstoff-sulfat
und N-Phenyl-bis-ichlorcarbonyiyamin
1-Phenyl-4-me-thylthio-tetrahydro-l_3^-triazin-2.6-dion
als farbloses Pulver vom Schmelzpunkt 256-258°C (Zersetzung).
N NH
CH,
Analog Beispiel 46 erhält man aus Acetamidinhydrochlorid
und N-Phenyl-bis-ichlorcarbonylj-amin
1 - Phenyl -4-methyl - tetrahydro-1,3,5 - triazin -2,6-dion
als farbloses Pulver vom Schmelzpunkt 245-247°C.
Analog Beispiel 26 erhäit man aus Propionamidinhydro-chlorid
und N-Phenyl-bis-ichlorcarbonylVamin
I -l'henyl-4-äthyl-tetrahydro- l.3..5-lria/m-2.(>-clion als
farblose Nadeln vom Schmelzpunkt 172 I 75°C.
Analog zu Hejspiel I kennen die in der folgenden
Tabelle I aufgeführten Verbindungen hergestellt werden:
Ri--N N—N--
CH.
Ulm- R
| 45 | C3H,- |
| 46 | CH — |
| 47 | C4H,- |
| 48 | (CH,I3CH-CH, |
| 49 | C3H5-CH(CH,) |
| 50 | C13H25- |
51 Cl
R1
Schmelzpunkt
— S -C3H, IIS
-S-CjH, 81-83
— S —C3H. 94-96
-S-CH, 151-152
-S-CH, 92-93
-S-ClI, rotes Öl
— S-CII, 127-128 -S-CH, 74-76 -S-CH1 95-96
— S —CH, 183-184
28
Analog /u Heispiel I können die in der folgenden
Tabelle 2 auf;."führUn Verbindungen hergestellt
werden:
R'--N N-NH,
o' Y-- cn
Heispid R1
| R | lh | — | Scltnip. ("Cl |
| C | II- | — | 199-201 |
| C | H, | — | 131-132 |
| C4 | H, | 1,CII- CH3- | 133-134 |
| (C | H, | -CH(CH,)- | 166-168 |
| C3 | ?H | 151-152 | |
| C1 | 116-118 | ||
| Cl | Cl | 237-238 | |
CH,
Cl
220-223
Cl
Analog zu Beispiel 3 können die in der folgenden Tabelle 3 aufgeführten Verbindungen hergestellt werden:
Tabelle 3
O
O
R1 —N N-NH2
R3
Beispiel R1
Nr.
| 60 | C2H5 |
| 61 | C2H5 |
| 62 | C2H5 |
| 63 | C3H7 |
| 64 | C3H7 |
NH-CH3 NH-C2H5
NH-CH(CH3), NH — CH3
NH-C2H5
Schmp. (0C)
162-164 194-195 147-150 144-145
130-133
29
| 65 | C3H7- |
| 66 | CjH7- |
| 67 | (CHj)2CH- |
| 68 | (CHj)2CH- |
| 69 | (CHO2CH-CH2 |
| 70 | (CHj)2CH-CH2 |
| 71 | (CHj)2CH-CH2 |
| 72 | C2H5-CH(CHO |
| 73 | C2Hs-CH(CHO |
| 74 | C2H5-CH(CH,) |
| 75 | C2H-CH(CHj) |
| 76 | C12H25- |
| 22 54 200 30 |
S c h nip. CC) |
| κ' | 123-121 |
| NH-CH(CHO2 | 104-105 |
| N(CHj)2 | 158-160 |
| NH-CH(CHj)2 | 154-156 |
| NH-CH2-CH(CHO2 | 160-161 |
| Nil —CHj | 142-144 |
| NH-C2H5 | 136-138 |
| NH-CH(CHO2 | 150-151 |
| NH-CH3 | 104-106 |
| NH-C2H5 | 145-146 |
| NH-CH(CHO2 | 120-121 |
| NH-C4H9 | 148-149 |
| NH-CHj | 169-171 |
| NH-CHj | 178-179 |
| NH-C2H5 | 169-172 |
| NH-CH(CHO2 | |
N(CHj)2
207-210
NH-CH,
234-235
N(CHj)2
172-173
Setzt man die 3-Isopropylidenamino-Verbindungen (nach Beispiel 1 erhalten) ein und erhitzt unter wasserfreien
Bedingungen, so erhält man analog Beispiel 3 die in der folgenden Tabelle 4 aufgeführten Verbindungen:
R1 — N N — N = C
CH3
CH3
R3
Beispiel R!
Nr.
83 (CHj)2CH-CH2
84 < H
R'
N(CHj)1
N(CHj)2
N(CHj)2
N(CH3J2
Schmp. (0C)
60-61 156-158
168-172
| 22 54 200 | 5 | R1 | CH3 ι |
R2 | 32 | ro | Schmp. CC) |
230 216/122 | |
| 31 | Analog zu den vorangehenden Beispielen erhalt man die folgenden | O N —R2 |
I (CHj)2CH-CH- |
Verbindungen | |||||
| Tabelle | R3 | o- | -NH2 | 152-154 | |||||
| R1 —N | (CHj)2CH-CH2- | -NK2 | • 153-155 | ||||||
| O | -NH2 | 181-182 | |||||||
| Beispiel Nr. |
(CHj)2CH- | -NH2 | R-' | 210-212 | |||||
| (CHj)2CH- | -NH2 | 131-133 | |||||||
| 86 | (CHj)2CH-CH2- | -N = C(CHj)2 | —S—CH, | Öl | |||||
| 87 | -NH2 | —NHCH, | 166-168 | ||||||
| 88 | CH, | -NH2 | -NHCH3 | 242-244 | |||||
| 89 | CH3— CHj — CH — | -S-CH3 | |||||||
| 90 | (CHj)3C-CH2- | -NH2 | -N(CHj)2 | 151-152 | |||||
| 91 | 0- | -NH2 | -N(CHj)2 | 229-231 | |||||
| 92 | (CHj)3C-CHj- | -NH2 | — S-CHj | 172-173 | |||||
| 93 | CHj | -NH2 | -NHCH3 | 202-204 | |||||
| CHj-CH2-CH- | |||||||||
| 94 | (CHj)JC-CH2- | -NH2 | -S-CH3 | 91-93 | |||||
| 95 | O | -NH2 | — SCHj | 159-161 | |||||
| 96 | (C2HO2CH- | -NH2 | -SC2H5 | 176-178 | |||||
| 97 | (C2HO2CH- | -N = C(CHj)2 | -SC2H5 | 92-93 | |||||
| (CjHO2CH- | -NH2 | 143-145 | |||||||
| 98 | (C,HO2CH— | -NH2 | -N(CHj)2 | 90-92 | |||||
| 99 | -N = C(CII1). | -N(CHj)2 | 9l-()3 | ||||||
| 100 | -N(CHj)2 | ||||||||
| 101 | — SCH, | ||||||||
| 102 | — SCH, | ||||||||
| 103 | -N(CHO2 | ||||||||
| 104 | -SC2H, | ||||||||
33
| Fortsetzung | R1 | -NH2 | R3 | Schmp. (0C) |
| Beispiel Nr. |
(C2Hj)1CH- | -N=C(CHj)2 | -SC2H5 | 125-126 |
| 105 | (CH3)jC —CH- | -SCH3 | Siedepunkt | |
| 106 | ( | -NH2 | 175/0,35 mbar | |
| :h3 | -SCH3 | 68 | ||
| 107 | (CH3J3C-CH- | -N = C(CHj)2 | ||
| CH3 | -NH2 | -SC2H5 | Siedepunkt 178/0,26 mbar |
|
| 108 | (CH3)jC —CH- CH3 |
-SC2H5 | 130 | |
| 109 | (CHj)3C-CH- | |||
| ( | ||||
| :hj | ||||
Verwendungsbeispiele In den Tabellen A und B stimmen dieWirkstoft-Num-
mern mit den Nummern der vorangehenden Herstel-
In den nachfolgenden Verwendungsbeispielen wur- 33 lungsbeispiele überein,
den die aus DE-OS 19 27 921 vorbekannten strukturähnlichen Verbindungen der Formeln
und
O = C
(VM-2)
als Vergleichsmittel herangezogen.
Beispiel A
Post-emergence-Test
Post-emergence-Test
Lösungsmittel:
5 Gewichtsteile Aceton
Emulgator:
Emulgator:
1 Gewichtsteil Alkylarylpolyglycoläther
Zur Herstellung einer zweckmäßigen Wirkstoffzubereitung
vermischt man 1 Gewichtsteil Wirkstoff mit der angegebenen Menge Lösungsmittel, gibt die angegebene
Menge Emulgator zu und verdünnt das Konzentrat mit Wasser auf die gewünschte Konzentration.
Mit der Wirkstoffzubereitung spritzt man Testpflanzen, welche eine Höhe von 5-15 cm haben so, daß die
in der Tabelle angegebenen Wirkstoffmengen pro Flächeneinheit ausgebracht werden. Die Konzentration
der Spritzbrühe wird so gewählt, daß in 20001
Wasser/ha die in der Tabelle angegebenen Wirkstoffmengen ausgebracht werden. Nach drei Wochen wird
der Schädigungsgrad der Pflanzen bonitiert in % Schädigung im Vergleich zur Entwicklung der unbehandelten
Kontrolle. Es bedeuten:
0% = keine Wirkung (wie unbehandelte Kontrolle)
M 100% - totale Vernichtung
M 100% - totale Vernichtung
Wirkstoffe, Aufwandmengen und Resultate gehen aus der nachfolgenden Tabelle hervor:
| i | A | 35 | 0 | Sinapis | 22 | 54 | 200 | Mohren | 36 |
Baum
wolle |
Weizen | Bohnen | |
| Tabelle |
Wirk-
stoff- aufwand kg/ha |
0 | 0 | 0 | 0 | 0 | 20 | ||||||
|
Wirk
stoff Nr. |
1 |
Echino- Cheno-
chloa podium |
40 | 0 |
Galin-
soga |
Stel
laria |
Matri-
caria |
0 | Hafer | 0 | 0 | 0 | |
| VM-I | 0,5 | 20 | 20 | 80 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 40 | |
| 1 | 20 | 100 | 80 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 40 | ||
| I VM-2 | 0,5 | 40 | 100 | 100 | 0 | 0 | 20 | 100 | 40 | 100 | 100 | 100 | |
| 1 | 20 | 100 | 100 | 0 | ü | 0 | 100 | 40 | 100 | 100 | 90 | ||
| I 4 | 0,5 | 90 | 100 | 100 | 100 | 100 | 100 | 10Ü | 90 | 100 | 100 | 100 | |
| 1 | 1 | 80 | 100 | 100 | 100 | so | 80 | 100 | 80 | 100 | 100 | 100 | |
| 1 5 | 0,5 | 100 | 100 | 100 | 100 | ICH) | 100 | 100 | 100 | 100 | 90 | 100 | |
| 1 | 1 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 60 | 100 | |
| S 6 | 0,5 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | |
| 1 | 1 | 100 | 90 | 100 | 100 | 100 | 100 | 100 | 60 | 100 | 100 | 100 | |
| I io | 0,5 | 100 | 80 | 100 | 100 | 100 | 100 | 60 | 100 | 40 | 20 | 90 | |
| ι | 1 | 100 | 100 | 100 | 100 | 100 | 100 | 40 | 100 | 20 | 0 | 60 | |
| § 29 | 0,5 | 100 | 90 | 100 | 100 | 80 | 100 | 100 | 80 | 20 | 20 | 90 | |
| S | 1 | 90 | 100 | 100 | 100 | 60 | 90 | 90 | 60 | 0 | 0 | 60 | |
| ■ 36 | 0,5 | 90 | 80 | 100 | 100 | 80 | 100 | 20 | 60 | 60 | 80 | 80 | |
| 1 | 1 | 80 | 100 | 100 | 100 | 60 | 100 | 0 | 40 | 40 | 60 | 60 | |
| 1 39 | 0,5 | 80 | 80 | 100 | 90 | 100 | 80 | 60 | 60 | 60 | 40 | 90 | |
| S | 1 | 60 | 100 | 60 | 80 | 90 | 80 | 40 | 50 | 40 | 20 | 80 | |
| 1 53 | 0,5 | 100 | , 100 | 100 | 100 | 100 | 100 | 100 | 80 | 100 | 40 | 100 | |
| S | 1 | 60 | 100 | 60 | 100 | 80 | 60 | 80 | 60 | 80 | 40 | 100 | |
| 1 54 | 0,5 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 80 | 100 | 80 | 100 | |
| 1 | 60 | 100 | 100 | 100 | 100 | 100 | 80 | 60 | 100 | 60 | 100 | ||
| 63 | 0,5 | 100 | 100 | 100 | 100 | 60 | 100 | 100 | 80 | 100 | 60 | 100 | |
| I | 60 | 100 | 100 | 100 | 60 | 60 | 100 | 60 | 100 | 40 | 100 | ||
| 66 | 0.5 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 60 | 100 | |
| I | 80 | 100 | 100 | 100 | 100 | 100 | 100 | 80 | 100 | 40 | 100 | ||
| 69 | 0,5 | 80 | 100 | 100 | 100 | 100 | 80 | 100 | 80 | 100 | 80 | 100 | |
| I | 60 | 100 | 100 | 100 | 80 | 60 | 100 | 60 | .00 | 60 | 100 | ||
| 77 | 0,5 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 80 | 100 | |
| 1 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 40 | 100 | ||
| 79 | 0,5 | ion | 100 | 100 | 100 | 100 | 100 | 100 | 60 | 100 | 80 | 100 | |
| I | 80 | 100 | 100 | 100 | 100 | 100 | 100 | 40 | 100 | 80 | 100 | ||
| 80 | 0,5 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 90 | 100 | 80 | 100 | |
| I | 100 | 100 | 100 | 100 | 100 | 100 | 80 | 100 | 60 | 100 | |||
| 81 | 0.5 | 100 | 100 | 100 | 100 | 90 | |||||||
| 100 | 100 | 100 | 90 | 60 | |||||||||
| (Fortsetzung) | WirkstofT- aufwand kg/ha |
WirkstolT- aufwand kg/ha |
37 | Chenopo- dium |
100 | 100 | 22 54 | 200 | 100 | 38 | 90 | Baum wolle |
Weizen | |
| Tabelle A | Post-emergence-Test | 0,5 | 1 | 100 | 90 | 100 | 90 | 60 | 100 | 80 | ||||
| Wirkstoff Nr. |
0,5 | 0,5 | 100 | 100 | 100 | 100 | 100 | 60 | 80 | |||||
| 87 | 0,5 | 1 | Echino- clilua |
100 | 100 | 100 | Sinapis | 80 | Matricaria | 100 | 100 | 60 | ||
| 88 | 0,5 | 0,5 | 100 | 100 | 100 | 100 | 100 | 80 | 100 | 90 | 100 | 80 | ||
| 90 | 0,5 | 1 | 80 | 100 | 100 | 100 | 100 | 80 | 60 | 80 | 60 | |||
| 91 | 0,5 | 100 | 100 | 100 | 100 | 100 | 100 | |||||||
| 92 | 1 | 90 | 100 | 100 | 100 | Matri- caria |
100 | 100 | ||||||
| Tabelle A | 0,5 | 80 | Echino- Cheno- Sinapis chloa podium |
100 | 100 | 100 | 60 | 100 | 60 | Baum wolle |
Weizen | |||
| 1 | 100 | 100 | 100 | Galinsoga Stellaria | 40 | 40 | 40 | 40 | ||||||
| 0,5 | 70 | 100 | 100 | 100 | 100 | 100 | 20 | 20 | ||||||
| (Fortsetzung) | I | 100 | 100 | 100 | Galin- soga |
!00 | 100 | Daucus Avcna fatua |
100 | 100 | 100 | |||
| Post-emergence-Test | 0,5 | 100 | 100 | 100 | i00 | 100 | 100 | 60 | 80 | 100 | 100 | |||
| Wirkstoff Nr. |
1 | 100 | 100 | 100 | 90 | 100 | 100 | 40 | 60 | 40 | 20 | |||
| 93 | 0,5 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 0 | 0 | |||
| I | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 40 | 100 | |||||
| 94 | 0,5 | 100 | 100 | 100 | 100 | 100 | 100 | 70 | 20 | 100 | ||||
| 1 | 100 | 100 | 100 | 100 | Stcllaria | 80 | 80 | 30 | 80 | 20 | ||||
| 95 | 0,5 | 100 | - | 100 | 100 | 80 | 100 | 100 | 80 | 60 | 0 | |||
| 1 | 100 | - | ioo | 100 | 60 | 100 | 100 | 60 | 100 | 100 | ||||
| 96 | 0.5 | 100 | 100 | 100 | 100 | 100 | 100 | 20 | 30 | 100 | 100 | |||
| I | 100 | 100 | 100 | 100 | 100 | 100 | 0 | 20 | 100 | 100 | ||||
| 97 | 0,5 | 100 | - | 100 | 100 | 100 | 100 | 100 | 80 | 100 | 100 | |||
| I | 100 | - | 100 | 100 | 100 | 100 | 100 | 60 | 100 | 100 | ||||
| 98 | 0.5 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | ||||||
| 100 | 100 | 80 | 80 | 100 | 100 | 80 | ||||||||
| 99 | 80 | 100 | 100 | 100 | 100 | 100 | 30 | |||||||
| 100 | 100 | 100 | 100 | 100 | 100 | 100 | ||||||||
| 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | |||||||
| 100 | 100 | 100 | 90 | 100 | 90 | 0 | ||||||||
| 102 | 100 | 100 | 100 | 100 | 100 | 30 | 0 | |||||||
| 100 | 100 | 100 | 100 | 100 | 90 | 10 | ||||||||
| 103 | 100 | ■;oü | 100 | 40 | 0 | |||||||||
| - | 100 | 80 | ||||||||||||
| 107 | 100 | 100 | 80 | |||||||||||
| 100 | 80 | 50 | ||||||||||||
| 109 | 100 | |||||||||||||
| IÖÖ | ||||||||||||||
| 100 | ||||||||||||||
| 100 | ||||||||||||||
| 100 | ||||||||||||||
| 100 |
Beispiel B
Pre-emergence-Test
Pre-emergence-Test
Lösungsmittel:
5 Gewichtsteile Aceton
Emulgator:
Emulgator:
I Gewichtsteil Alkylarylpolyglycoläther
Zur Herstellung einer zweckmäßigen NVirkstoffzubereitung
vermischt man I Gewichtsteil Wirkstoff mit der angegebenen Menge Lösungsmittel, gibt man die
angegebene Menge Emulgator zu und verdünnt das Konzentrat mit Wasser auf die gewünschte Konzentralion.
Samen der Testpflanzen werden in normalem Boden
ausgesät und nach 24 Stunden mit der Wirkstoffzuberei tung begossen. Dabei hält man die Wassermenge prc
Fläclieneinheit zweckmäßigerweise konstant. Die Wirk
Stoffkonzentration in der Zubereitung spielt keine Rolle entscheidend ist nur die Aufwandmenge des Wirkstoff:
pro Flächeneinheit. Nach drei Wochen wird dei Schädigungsgrad der Pflanzen bonitiert in % Schädi
gung im Vergleich zur F.ntwicklung der unbehandelter Kontrolle. Es bedeuten:
0% = keine Wirkung (wie unbehandelte Kontrolle)
100% = totale Vernichtung
100% = totale Vernichtung
Wirkstoffe. Aufwandmengen und Resultate gehen au« der nachfolgenden Tabelle hervor:
| Tabelle | B | U irk- stiill'- .nifw and k,j!/ll.l |
I chino- chln.i |
( lieno- piiilium |
Sinaptv | Ln- li ti πι |
Stel lana |
(ralin- soga |
Malri- | A\en;i fat im |
H au in - wolle |
Wei zen |
Hu οπ | M1 |
| P γρ -ρ m ρ ro ρ η r ρ -Tp ς I | S | fl | 0 | 0 | π | 0 | 0 | 0 | (I | 0 | 0 | ό | 0 | |
| U ! Γ k - VlIlIT Sr |
0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||
| VM-I | 20 | fl | 40 | 0 | 20 | 80 | 80 | 20 | 0 | 0 | 40 | 20 | ||
| 2.> | 0 | I) | 0 | 0 | 0 | 60 | 40 | I) | 0 | 0 | 20 | 0 | ||
| Wi-: | 100 | KK) | 100 | 100 | 100 | 100 | 100 | K)(I | 90 | 60 | 100 | 60 | ||
| 100 | KH) | 100 | KH) | 100 | KH) | KH) | 100 | SO | 60 | 90 | 40 | |||
| 4 | > | 100 | 100 | 100 | 100 | 100 | KXI | 100 | 90 | KX) | 100 | 90 | 40 | |
| KK) | KXi | 90 | 100 | KX) | 100 | 100 | 80 | 80 | 80 | 80 | 20 | |||
| *> | KK) | KXl | 100 | KX) | - | 100 | 100 | 90 | 60 | 20 | 90 | 50 | ||
| KK) | KKi | 100 | 100 | - | 100 | 100 | 80 | 60 | (I | 90 | 20 | |||
| > | I OfI | KK) | 90 | 100 | - | 100 | 100 | 90 | 60 | 60 | KH) | SO | ||
| IfKi | so | 90 | 90 | - | KKJ | KHl | SO | 40 | 40 | 60 | 60 | |||
| •ι | 5 | KKi | KKi | KKl | KX) | - | 100 | IfKI | 100 | 60 | 40 | KH) | SO | |
| ion | so | 90 | 100 | - | KXI | 100 | KKl | 40 | 20 | 80 | 80 | |||
| |Ι! | 5 | Kin | Κ'κι | IfKl | 100 | 100 | 100 | 100 | 100 | 100 | 60 | 100 | 60 | |
| τ ς | S' I | KiO | SO | KXl | 100 | 100 | 100 | 100 | 100 | 60 | 100 | 40 | ||
| KKj | ! I H) | 100 | KH) | 100 | KXl | 100 | 80 | 40 | 60 | 90 | 40 | |||
| KO | KXl | 80 | KK) | 100 | 100 | 100 | 60 | 20 | 60 | 60 | 20 | |||
| [4 | > | 100 | KXl | 100 | 100 | - | 100 | 100 | 100 | 80 | 60 | 100 | SO | |
| 100 | 100 | 100 | 100 | - | 100 | 100 | 100 | 80 | 40 | 100 | 60 | |||
| '3 | > | ion | KX) | 40 | 90 | - | 100 | 100 | 80 | 60 | 60 | 60 | 60 | |
| -ι <■ | 100 | 80 | 40 | 80 | - | 100 | 100 | 60 | 40 | 40 | 60 | 40 | ||
| Γ4 | 5 | KX) | 100 | 80 | 60 | - | 100 | 100 | 60 | SO | 60 | 80 | 60 | |
| 80 | 80 | 80 | 40 | - | 100 | 100 | 60 | 60 | 40 | 60 | 40 | |||
| ,3 | IfX) | 100 | 100 | 100 | - | 100 | 100 | 100 | 80 | SO | 100 | 60 | ||
| 2.5 | KX) | 100 | 100 | KX) | - | 100 | 100 | 80 | 60 | 80 | 100 | 60 | ||
| ι6 | -: | 1 CWt | 100 | 80 | - | I V/V | 60 | 60 | ir*J | ΑΠ 7U |
L.e\ | |||
| 2 - | 100 | KXJ | 100 | 80 | — | 100 | 100 | 40 | 40 | 60 | 60 | 60 | ||
| ,9 | ||||||||||||||
| Tabelle | B (Fortsetzung) | Wirk- stolT- inifwand kg/ha |
lichino- chloii |
C'heno- pmliuni |
Sinapis | Loliiim | (ialin- sopa |
Matri- cnria |
•\ven;i 1.1 Uli |
Baum wolle |
W Yi/en | Biu-ri- wci/en |
Mi |
| I're emergence-Test | 5 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 80 | 60 | 100 | 80 | |
| Wirk s ίο rf Nr. |
2.5 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 80 | 20 | K/0 | 60 | |
| 77 | 5 | 100 | 100 | 80 | 100 | 100 | 100 | 60 | 40 | 40 | 80 | 60 | |
| 2,5 | 100 | 100 | 80 | X(I | 100 | 100 | 40 | 40 | 20 | 40 | 60 | ||
| 79 | 5 | 100 | 100 | 100 | 100 | 100 | 100 | 80 | 60 | 60 | K)O | 80 | |
| 2.5 | 100 | 100 | 100 | 100 | 100 | 100 | 80 | 40 | 60 | 100 | 60 | ||
| 80 | !00 | 100 | 100 | 100 | 100 | U)O | 100 | 40 | 60 | 90 | 80 | ||
| ι 5 | KH) | 100 | 100 | 100 | 100 | 100 | 100 | 40 | 60 | 60 | fiO | ||
Tabelle B (Fortsetzung)
l're-emergence-Test
l're-emergence-Test
| Wirkst.-ill | WirkstolT- | r.chinn- | C'heno- | Sinapis | l.oliiini | Stellaria | Cialin- | Matri- | Weizen | Baum | Mi |
| Nr. | ii u f wa nc! | chloa | podium | soga | caria | wolle | |||||
| kg/ha | |||||||||||
| 86 | S | 100 | 90 | 90 | 90 | 90 | 100 | 90 | 60 | 60 | 60 |
| 87 | 5 | 100 | 100 | 100 | 80 | 100 | 100 | 100 | 40 | 60 | 40 |
| 88 | 5 | 100 | 100 | 80 | 80 | 100 | 100 | 100 | 60 | 0 | 20 |
| 89 | 5 | 100 | 90 | 80 | 100 | 80 | 100 | 100 | 60 | 20 | 80 |
| 90 | 5 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 60 | 100 | 80 |
| 91 | ^ | KX) | 100 | 100 | 80 | 100 | 100 | 90 | 60 | 60 | 60 |
| 92 | 5 | 100 | 100 | 100 | 100 | 100 | 100 | 90 | 60 | 60 | 60 |
| 93 | 5 | 90 | 100 | 100 | 80 | 80 | 100 | 100 | 0 | 60 | 50 |
| Tabelle B | (Fortsetzung) | Wirk- stoff- aufwand kg/ha |
Echino- chloa |
Cheno- podium |
Sinapis | Lolium | Stellaria | Galin- soga |
Matri- caria |
Avena fatua |
Baum wolle |
Weizen | Mais |
| Pre-emergence-Test | 5 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 80 | |
| Wirk stoff Nr. |
2.5 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 80 | 60 | |
| 94 | 5 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 0 | 20 | 20 | |
| 2.5 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 80 | 0 | 0 | 0 | ||
| 95 | 5 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 60 | 20 | 20 | 20 | |
| 2,5 | 100 | 100 | 100 | 90 | 100 | 100 | 100 | 40 | 0 | 0 | 0 | ||
| 96 | 5 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 0 | 0 | 40 | |
| 2.5 | 100 | 100 | 100 | 90 | 100 | 100 | 100 | 100 | 0 | 0 | 0 | ||
| 97 | 5 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 40 | |
| 2.5 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 80 | 80 | 80 | 20 | ||
| 98 | |||||||||||||
Wirk· Wirk- l'cliino- Cheno- Siii.ipis I.nimm Stell.in;i (r.iliii- M.itri- \ven.i H;mm- Wci/l'ii M.iis
stoff stoff- L'lilo.i poiliuiii sou.ι ein.ι l'.ilu.i «olle
Nr .ml'» and
| 5 | 100 | 100 | 100 | 100 | 1()1) | 100 | 100 | 100 | 40 | so | (H > |
| 2.5 | 100 | iod | 100 | 80 | 10(1 | 100 | 100 | so | 0 | W) | 40 |
| 5 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | KK) | 4(1 | 40 | |
| 2.5 | 100 | 100 | 100 | ItH) | 100 | 100 | 100 | so | W) | 2t! | 20 |
| S | 100 | 100 | 90 | KHI | 100 | 100 | "(Ι | 90 | .10 | W) | |
| 2.5 | 90 | 100 | so | 100 | 100 | 100 | W) | 80 | 10 | W) | |
| S | 100 | 100 | 90 | 100 | 100 | 100 | 80 | 100 | 40 | 70 | |
| ItH/ | ] JVM | K)/ J | I IV) | 70 | 90 | ■»() | 60 |
Claims (4)
1. Tetrahydro- 1,3,5-triazin-2,6-dione der allgemeinen
Formel
R1—N N —R2
Il (D
R3
worin
R1 für einen geradkettigen oder verzweigten
Alkylrest mit 1 bis 12 Kohlenstoffatomen, einen Cycloalkylrest mit 5 bis 7 Kohlenstoffatomen,
einen Benzylrest oder einen gegebenenfalls durch Chlor und/oder Methyl substituierten
Phenyirest steht,
R2 für Wasserstoff, einen Alkylrest mit 1 bis 4 Kohlenstoffatomen, eine Amino- oder Isopropylidenaminogruppe
steht und
R3 für einen Alkylrest mit ' bis 4 Kohlenstoffatomen,
eine Alkylthiogruppe mit 1 bis 2 Kohlenstoffatomen, eine Alkylaminogruppe mit
1 bis 4 Kohlenstoffatomen oder eine Dialkylaminogruppe mit 1 oder 2 Kohlenstoffatomen je
Alkylrest steht,
ausgenommen solche Verbindungen der Formel (I)1
in denen gleichzeitig R1 einen Alkylrest, Cycloalkylrest oder gegebenenfalls (durch Chlor und/oder
Methyl) substituierten Phenyirest, R2 Wasserstoff oder einen Alkylrest und R3 einen Alkylamino- oder
Dialkylaminorest — jeweils mit der oben angegebenen Anzahl von Kohlenstoffatomen — bedeuten.
2. Verfahren zur Herstellung von Tetrahydro-1,3,5-triazin-2,6-dionen
der allgemeinen Formel (I) gemäß Anspruch 1, worin R1, R2 und R3 die in
Anspruch 1 angegebene Bedeutung haben, dadurch gekennzeichnet, daß man Bis-(chlorcarbonyl)-amine
der allgemeinen Formel
R1 —N
4
\
\
COCI
(ID
COCI
(ΠΙ)
R' die oben angegebene Bedeutung hat,
mit Verbindungen der allgemeinen Formel
HN = C-NH-R2
HN = C-NH-R2
R3
worin
R2 und R3 die oben angegebene Bedeutung haben.
oder deren Salzen mit organischen oder anorganischen Säuren in Gegenwart von Säurebindern
umsetzt, wobei in den Fällen, in denen R2 für Amino
steht, diese Gruppe in an sich bekannter Weise
ίο
durch Hydrazonbildung geschützt werden und nach der Reaktion leicht wieder freigesetzt werden kann.
3. Verfahren zur Herstellung von Tetrahydrol,3,5-triazin-2,6-dionen
der allgemeinen Formel (I) gemäß Anspruch 1, worin R1 und R2 die im Anspruch
T angegebene Bedeutung haben und R3 für eine Aikylaminogruppe mit 1 bis 4 Kohlenstoffatomen
oder eine Dialkylaminogruppe mit 1 oder 2 Kohlenstoffatomen je Alkylrest steht, dadurch
gekennzeichnet, daß man Verbindungen der allgemeinen Formel
R1—N N —R2
(IV)
R1 und R2 die oben angegebene Bedeutung haben
und
R4 für einen gegebenenfalls, z.B. durch
R4 für einen gegebenenfalls, z.B. durch
Carboxyl, substituierten Alkylrest steht,
in an sich bekannter Weise mit Aminen der allgemeinen Formel
HN
4
\
\
R5
(V)
R6
worin entweder
worin entweder
R5 für Wasserstoff und R6 für Alkyl mit 1 bis
4 Kohlenstoffatomen oder
R5 und R6 jeweils für Alkyl mit I oder 2 Kohlenstoffatomen
stehen,
umsetzt.
4. Verfahren zur Herstellung von Tetrahydrol,3,5-triazin-2,6-dionen
der allgemeinen Formel (I) gemäß Anspruch 1, worin R1, R2 und R3 die in
Anspruch 1 angegebene Bedeutung haben, dadurch gekennzeichnet, daß man
(a) Verbindungen der allgemeinen Formel
O
R1 —NH-C —NH-R2
R1 —NH-C —NH-R2
(VO
in der
R' und R2 die oben angegebene Bedeutung haben,
mit C hiorcarbonyiisocyaniddichlorid der Formel
Ci-C-N =
Cl
Cl
(VII)
gegebenenfalls in Gegenwart von Säurebindern zu Verbindungen der allgemeinen Formel
(VIII) umsetzt.
(b)
R!—N N —R2
(VDI)
Priority Applications (37)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2254200A DE2254200C2 (de) | 1972-11-06 | 1972-11-06 | Tetrahydro-1,3,5-triazin-2,6-dione, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide |
| US05/407,693 US4056527A (en) | 1972-11-06 | 1973-10-18 | Tetrahydro-1,3,5-triazine-2,6-diones |
| PH15153A PH11488A (en) | 1972-11-06 | 1973-10-24 | Tetrahydro-1,3,5-triazine-2,6-diones compositions and their use as herbicides |
| YU02834/73A YU283473A (en) | 1972-11-06 | 1973-10-31 | Process for preparing new tetrahydro-1,3,5-triazine-2,6-diones |
| IL7343536A IL43536A (en) | 1972-11-06 | 1973-11-01 | Tetrahydro-1,3,5-triazine-2,6-diones their production and their use as herbicides |
| CS737524A CS187386B2 (en) | 1972-11-06 | 1973-11-01 | Herbicide agent and method of production of the active substances |
| SU731969697A SU762759A3 (en) | 1972-11-06 | 1973-11-02 | Herbicidic agent |
| BG024913A BG20539A3 (bg) | 1972-11-06 | 1973-11-02 | Хербецидно средство |
| FI3392/73A FI56683C (fi) | 1972-11-06 | 1973-11-02 | Saosom herbicider anvaendbara tetrahydro-1,3,5-triazin-2,6-dioner |
| IT30895/73A IT1046112B (it) | 1972-11-06 | 1973-11-02 | Tetraidro 1.3.5 triazin 2.6 dioni procedimento per la loro preparazione e loro impiego come erbicidi |
| DD174431A DD112344A5 (de) | 1972-11-06 | 1973-11-02 | |
| RO197376523A RO72337A (fr) | 1972-11-06 | 1973-11-03 | Procede pour la preparation des tetrahydro-1,3,5-triazin-2,6-diones |
| GB5123173A GB1397888A (en) | 1972-11-06 | 1973-11-05 | Tetrahydro-1,3,5-triazine-2,6-diones processes for their production and their use as herbicides |
| EG417/73A EG11056A (en) | 1972-11-06 | 1973-11-05 | Tetrahidro-1,3,5-triazine-2,6-diones process for their production and their use as herbicides |
| PL1973166334A PL91285B1 (de) | 1972-11-06 | 1973-11-05 | |
| TR17724A TR17724A (tr) | 1972-11-06 | 1973-11-05 | Tetrahidro-1,3,5-triazin-2,6-dionlar,imallerinde mahsus usuller ve herbisidler,olarak kullanilmalari |
| BR8613/73A BR7308613D0 (pt) | 1972-11-06 | 1973-11-05 | 2, 6-dionas, e composicoes herbicidas a base destas processo para a preparacao de tetra hidro-1,3,5, triazino |
| IE1985/73A IE38471B1 (en) | 1972-11-06 | 1973-11-05 | Tetrahydro-1,3,5-triazine-2,6-diones,processes for their production and their use as herbicides |
| DK597873A DK136067C (da) | 1972-11-06 | 1973-11-05 | Herbicidt virksomme tetrahydro-1,3,5-triazin-2,6-dioner |
| CH880277A CH596767A5 (de) | 1972-11-06 | 1973-11-05 | |
| CH1552373A CH596765A5 (de) | 1972-11-06 | 1973-11-05 | |
| LU68742A LU68742A1 (de) | 1972-11-06 | 1973-11-05 | |
| AU62167/73A AU497238B2 (en) | 1972-11-06 | 1973-11-05 | Tetrahydro-1, 3, 5-triazine-2, 6-diones |
| AR250846A AR213259A1 (es) | 1972-11-06 | 1973-11-05 | Nuevas tetrahidro-1,3,5,-triacin-2,6-dionas de propiedades herbicidas,procedimiento para su produccion y composiciones herbicidas a base de los mismos |
| ZA738488A ZA738488B (en) | 1972-11-06 | 1973-11-05 | Tetrahydro-1,3,5-triazine-2,6-diones,processes for their production and their use as herbicides |
| NO734255A NO140061C (no) | 1972-11-06 | 1973-11-05 | Tetrahydro-1,3,5-triazin-2,6-dioner med herbicide egenskaper |
| NLAANVRAGE7315118,A NL177111C (nl) | 1972-11-06 | 1973-11-05 | Werkwijze voor het bereiden van herbicide preparaten, alsmede werkwijze ter bereiding van voor gebruik in dergelijke preparaten geschikte tetrahydro-1,3,5-triazine-2,6-dionen. |
| HUBA2990A HU169963B (en) | 1972-11-06 | 1973-11-06 | Herbicides containing tetrahydro-1,3,5-triazines and process for producing the active agent |
| BE137446A BE806964A (fr) | 1972-11-06 | 1973-11-06 | Nouvelles tetrahydro-1,3,5-triazine, 2,6-diones |
| AT932973A AT328790B (de) | 1972-11-06 | 1973-11-06 | Herbizides mittel |
| FR7339335A FR2205517B1 (de) | 1972-11-06 | 1973-11-06 | |
| ES420258A ES420258A1 (es) | 1972-11-06 | 1973-11-07 | Procedimiento para preparar tetrahidro-1,3,5-triacin-2,6- dionas. |
| SE7315000A SE404800B (sv) | 1972-11-06 | 1973-12-11 | Vissa angivna tetrahydro-1,3,5-triazin-2,6-dioner till anvendning som herbicider |
| KE2585*UA KE2585A (en) | 1972-11-06 | 1975-12-02 | Tetrahydro-1,3,5-triazine-2,6-diones, processes for their production and their use as herbicides |
| ES447080A ES447080A1 (es) | 1972-11-06 | 1976-04-15 | Procedimiento para preparar tetrahidro-1,3,5-triacin-2,6- dionas. |
| MY197636A MY7600036A (en) | 1972-11-06 | 1976-12-31 | Tetrahydro-1,3,5-triazine-2 6-diones processes for their production and their use as herbicides |
| JP59091989A JPS6034953A (ja) | 1972-11-06 | 1984-05-10 | テトラヒドロ―1,3,5―トリアジン―2,6―ジオン類の製造方法 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2254200A DE2254200C2 (de) | 1972-11-06 | 1972-11-06 | Tetrahydro-1,3,5-triazin-2,6-dione, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2254200A1 DE2254200A1 (de) | 1974-05-16 |
| DE2254200C2 true DE2254200C2 (de) | 1982-04-22 |
Family
ID=5860916
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2254200A Expired DE2254200C2 (de) | 1972-11-06 | 1972-11-06 | Tetrahydro-1,3,5-triazin-2,6-dione, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide |
Country Status (35)
| Country | Link |
|---|---|
| US (1) | US4056527A (de) |
| JP (1) | JPS6034953A (de) |
| AR (1) | AR213259A1 (de) |
| AT (1) | AT328790B (de) |
| AU (1) | AU497238B2 (de) |
| BE (1) | BE806964A (de) |
| BG (1) | BG20539A3 (de) |
| BR (1) | BR7308613D0 (de) |
| CH (2) | CH596767A5 (de) |
| CS (1) | CS187386B2 (de) |
| DD (1) | DD112344A5 (de) |
| DE (1) | DE2254200C2 (de) |
| DK (1) | DK136067C (de) |
| EG (1) | EG11056A (de) |
| ES (2) | ES420258A1 (de) |
| FI (1) | FI56683C (de) |
| FR (1) | FR2205517B1 (de) |
| GB (1) | GB1397888A (de) |
| HU (1) | HU169963B (de) |
| IE (1) | IE38471B1 (de) |
| IL (1) | IL43536A (de) |
| IT (1) | IT1046112B (de) |
| KE (1) | KE2585A (de) |
| LU (1) | LU68742A1 (de) |
| MY (1) | MY7600036A (de) |
| NL (1) | NL177111C (de) |
| NO (1) | NO140061C (de) |
| PH (1) | PH11488A (de) |
| PL (1) | PL91285B1 (de) |
| RO (1) | RO72337A (de) |
| SE (1) | SE404800B (de) |
| SU (1) | SU762759A3 (de) |
| TR (1) | TR17724A (de) |
| YU (1) | YU283473A (de) |
| ZA (1) | ZA738488B (de) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4356024A (en) | 1980-02-20 | 1982-10-26 | Bayer Aktiengesellschaft | Process for the preparation of 1-amino-1,3,5-triazine-2,4(1H, 3H)-dione compounds |
| US4426523A (en) | 1981-02-24 | 1984-01-17 | Bayer Aktiengesellschaft | Preparation of 1-amino-1,3,5-triazine-2,4(1H, 3H)-diones |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3983116A (en) * | 1973-04-05 | 1976-09-28 | E. I. Du Pont De Nemours And Company | Herbicidal triazines |
| US4035365A (en) | 1973-11-01 | 1977-07-12 | Imperial Chemical Industries Limited | Triazinediones |
| GB1543037A (en) * | 1975-02-05 | 1979-03-28 | Ici Ltd | Selective herbicidal triazine-diones |
| US4068081A (en) | 1974-02-15 | 1978-01-10 | Imperial Chemical Industries Limited | Δ-Triazine-2,6-dione |
| US3907795A (en) * | 1974-05-24 | 1975-09-23 | Du Pont | 3-(Tetrahydro-2-pyranyl)-1,3,5-triazinediones and their use as herbicides |
| US4174445A (en) * | 1976-10-23 | 1979-11-13 | Bayer Aktiengesellschaft | Preparation of arthropodicidally active substituted triazine-2,4-diones |
| US4348331A (en) * | 1980-09-19 | 1982-09-07 | Bayer Aktiengesellschaft | Process for the preparation of N-substituted imido-dicarboxylic acid diaryl esters |
| AU7715981A (en) * | 1980-11-21 | 1982-05-27 | Bayer Aktiengesellschaft | Synergistic herbicidal mixtures |
| DE3238007A1 (de) * | 1982-10-13 | 1984-04-19 | Bayer Ag, 5090 Leverkusen | Herbizide mittel auf basis von triazinon- und triazindion-derivaten |
| DE3409065A1 (de) * | 1984-03-13 | 1985-09-26 | Bayer Ag, 5090 Leverkusen | 3-cyclopropylmethyl-1,3,5-triazin-2,4-dione |
| DE3412946A1 (de) * | 1984-04-06 | 1985-10-17 | Bayer Ag, 5090 Leverkusen | 3-(2,2-tetramethylen-propyl)-1,3,5-triazin-2,4-dione |
| JP2635869B2 (ja) * | 1991-11-20 | 1997-07-30 | 株式会社東芝 | 熱交換器 |
| AU3427193A (en) * | 1992-01-15 | 1993-08-03 | E.I. Du Pont De Nemours And Company | Pyrimidin compounds useful as herbicides |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3835133A (en) * | 1971-03-15 | 1974-09-10 | Sandoz Ltd | Hexahydro-1,3,5-triazine-2,4-diones |
| BE788872A (fr) * | 1971-09-16 | 1973-03-15 | Du Pont | Nouvelles 1,3, 5-triazinediones, leur preparation et compositions herbicides les contenant |
| IL42095A0 (en) * | 1972-05-24 | 1973-07-30 | Du Pont | Novel 1,3,5-triazinediones,their preparation and their use as herbicides |
| IL42103A (en) * | 1972-05-24 | 1976-05-31 | Du Pont | 6-amino-s-triazine-2,4-(1h,3h)-diones and corresponding 4-thio compounds,their preparation and their use as herbicides |
| US3873540A (en) * | 1973-01-22 | 1975-03-25 | Du Pont | 1,3,5-triazinediones |
| US3855219A (en) * | 1972-07-03 | 1974-12-17 | Du Pont | 1,3,5-triazinediones |
| US3983116A (en) * | 1973-04-05 | 1976-09-28 | E. I. Du Pont De Nemours And Company | Herbicidal triazines |
| US3933815A (en) * | 1974-06-24 | 1976-01-20 | E. I. Du Pont De Nemours And Company | Trifluoromethyl triazines |
-
1972
- 1972-11-06 DE DE2254200A patent/DE2254200C2/de not_active Expired
-
1973
- 1973-10-18 US US05/407,693 patent/US4056527A/en not_active Expired - Lifetime
- 1973-10-24 PH PH15153A patent/PH11488A/en unknown
- 1973-10-31 YU YU02834/73A patent/YU283473A/xx unknown
- 1973-11-01 IL IL7343536A patent/IL43536A/en unknown
- 1973-11-01 CS CS737524A patent/CS187386B2/cs unknown
- 1973-11-02 SU SU731969697A patent/SU762759A3/ru active
- 1973-11-02 IT IT30895/73A patent/IT1046112B/it active
- 1973-11-02 BG BG024913A patent/BG20539A3/xx unknown
- 1973-11-02 DD DD174431A patent/DD112344A5/xx unknown
- 1973-11-02 FI FI3392/73A patent/FI56683C/fi active
- 1973-11-03 RO RO197376523A patent/RO72337A/ro unknown
- 1973-11-05 CH CH880277A patent/CH596767A5/xx not_active IP Right Cessation
- 1973-11-05 BR BR8613/73A patent/BR7308613D0/pt unknown
- 1973-11-05 IE IE1985/73A patent/IE38471B1/xx unknown
- 1973-11-05 TR TR17724A patent/TR17724A/xx unknown
- 1973-11-05 EG EG417/73A patent/EG11056A/xx active
- 1973-11-05 DK DK597873A patent/DK136067C/da not_active IP Right Cessation
- 1973-11-05 NO NO734255A patent/NO140061C/no unknown
- 1973-11-05 AR AR250846A patent/AR213259A1/es active
- 1973-11-05 GB GB5123173A patent/GB1397888A/en not_active Expired
- 1973-11-05 AU AU62167/73A patent/AU497238B2/en not_active Expired
- 1973-11-05 LU LU68742A patent/LU68742A1/xx unknown
- 1973-11-05 NL NLAANVRAGE7315118,A patent/NL177111C/xx active Search and Examination
- 1973-11-05 CH CH1552373A patent/CH596765A5/xx not_active IP Right Cessation
- 1973-11-05 PL PL1973166334A patent/PL91285B1/pl unknown
- 1973-11-05 ZA ZA738488A patent/ZA738488B/xx unknown
- 1973-11-06 BE BE137446A patent/BE806964A/xx not_active IP Right Cessation
- 1973-11-06 AT AT932973A patent/AT328790B/de not_active IP Right Cessation
- 1973-11-06 FR FR7339335A patent/FR2205517B1/fr not_active Expired
- 1973-11-06 HU HUBA2990A patent/HU169963B/hu unknown
- 1973-11-07 ES ES420258A patent/ES420258A1/es not_active Expired
- 1973-12-11 SE SE7315000A patent/SE404800B/xx unknown
-
1975
- 1975-12-02 KE KE2585*UA patent/KE2585A/xx unknown
-
1976
- 1976-04-15 ES ES447080A patent/ES447080A1/es not_active Expired
- 1976-12-31 MY MY197636A patent/MY7600036A/xx unknown
-
1984
- 1984-05-10 JP JP59091989A patent/JPS6034953A/ja active Granted
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4356024A (en) | 1980-02-20 | 1982-10-26 | Bayer Aktiengesellschaft | Process for the preparation of 1-amino-1,3,5-triazine-2,4(1H, 3H)-dione compounds |
| US4426523A (en) | 1981-02-24 | 1984-01-17 | Bayer Aktiengesellschaft | Preparation of 1-amino-1,3,5-triazine-2,4(1H, 3H)-diones |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2254200C2 (de) | Tetrahydro-1,3,5-triazin-2,6-dione, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide | |
| EP0121082B1 (de) | Guanidin-Derivate | |
| EP0131258A2 (de) | Neue N-Alkoxy- N-Alkylsulfonylaminosulfonylharnstoffe, und neue (Pyrimido) Triazino-thiatriazinoxide als Vorprodukte | |
| DE1670912B2 (de) | Herbizide Mittel auf Basis von 1,2,4-Triazin-5-onen | |
| DE2207549B2 (de) | 1-Aminouracile und deren Salze, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| DE2138031C3 (de) | Verfahren zur Herstellung von 1.2.4-Triazin-5-onen | |
| DE2107757C3 (de) | 4-Amino-1,2,4-triazin-5-one, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| DD295522A5 (de) | 5-Alkyl-1,3,4-Thiadiazole, Verfahren zu ihrer Herstellung und Verwendung als Schädlingsbekämpfungsmittel | |
| DE2326358C3 (de) | 6-Amino-s-triazin-2,4(1H,3H)-dione und deren Thioanaloge, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung unerwünschter Vegetation | |
| EP0056969A2 (de) | Substituierte Phenylsulfonylharnstoff-Derivate, Verfahren und neue Zwischenprodukte zu deren Herstellung sowie diese Derivate als Wirkstoffe enthaltende herbizide Mittel | |
| DE1670924B2 (de) | 1,2,4-thiadiazolyl-harnstoffderivate | |
| DE3014353A1 (de) | Trisubstituierte cyanguanidine, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide | |
| DE2824126C2 (de) | Tetrahydro-1,3,5-thiadiazin-4-on-Verbindungen | |
| DE2834879A1 (de) | 1,2,3-triazolcarbonsaeureamide, verfahren zur herstellung dieser verbindungen sowie diese enthaltende biozide mittel | |
| DE2344134A1 (de) | Kohlensaeurederivate des 2-mercapto-4,5dichlor-thiazols, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide | |
| EP0475236A1 (de) | N-Acylpyrrolidin-Derivate | |
| DE1795117C3 (de) | lmidazolidin-2-on-1 -carbonsäureamide, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| DE3431920A1 (de) | Substituierte carbonylphenylsulfonylguanidine | |
| EP0344684A2 (de) | Pyridazinonderivate, Verfahren zu ihrer Herstellung, sie enthaltende Mittel und ihre Verwendung im Pflanzenschutz | |
| DD228160A5 (de) | Herbizide und wachstumsregulierende mittel | |
| DE2236339A1 (de) | Verfahren zur herstellung von alphacyan-hydrazonen | |
| DE1962797C3 (de) | ||
| DD246246A5 (de) | Herbizide mittel | |
| DE3502926A1 (de) | Thiocyanatomethylthio-gruppen enthaltende verbindungen | |
| EP0148755B1 (de) | 2-Phenoxy-phenylsulfonylisocyanat |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8125 | Change of the main classification |
Ipc: C07D251/20 |
|
| 8126 | Change of the secondary classification |
Free format text: A01N 43/66 C07D251/38 C07D251/46 |
|
| D2 | Grant after examination | ||
| 8339 | Ceased/non-payment of the annual fee |