DE2341895C3 - Polymermischungen auf Basis von Polyamiden, Phosphorverbindungen und Alkalimetallverbindungen mit verringerter Gelbildung - Google Patents
Polymermischungen auf Basis von Polyamiden, Phosphorverbindungen und Alkalimetallverbindungen mit verringerter GelbildungInfo
- Publication number
- DE2341895C3 DE2341895C3 DE2341895A DE2341895A DE2341895C3 DE 2341895 C3 DE2341895 C3 DE 2341895C3 DE 2341895 A DE2341895 A DE 2341895A DE 2341895 A DE2341895 A DE 2341895A DE 2341895 C3 DE2341895 C3 DE 2341895C3
- Authority
- DE
- Germany
- Prior art keywords
- polyamide
- acid
- alkali metal
- sodium
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920002647 polyamide Polymers 0.000 title claims description 63
- 239000004952 Polyamide Substances 0.000 title claims description 58
- 150000001339 alkali metal compounds Chemical class 0.000 title claims description 25
- 150000003018 phosphorus compounds Chemical class 0.000 title claims description 11
- 230000015572 biosynthetic process Effects 0.000 title description 44
- 230000002829 reductive effect Effects 0.000 title description 10
- 229920002959 polymer blend Polymers 0.000 title description 3
- 229910052698 phosphorus Inorganic materials 0.000 claims description 46
- 239000011574 phosphorus Substances 0.000 claims description 46
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 18
- 229910052783 alkali metal Inorganic materials 0.000 claims description 18
- 150000001340 alkali metals Chemical class 0.000 claims description 18
- 239000000203 mixture Substances 0.000 claims description 18
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 125000003118 aryl group Chemical group 0.000 claims description 11
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 11
- 150000002431 hydrogen Chemical class 0.000 claims description 9
- ACVYVLVWPXVTIT-UHFFFAOYSA-N phosphinic acid Chemical class O[PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-N 0.000 claims description 7
- XRBCRPZXSCBRTK-UHFFFAOYSA-N phosphonous acid Chemical class OPO XRBCRPZXSCBRTK-UHFFFAOYSA-N 0.000 claims description 5
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical class OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 claims description 5
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 125000004122 cyclic group Chemical group 0.000 claims description 3
- 150000003009 phosphonic acids Chemical class 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 73
- 239000000499 gel Substances 0.000 description 51
- 229920000642 polymer Polymers 0.000 description 51
- 230000003292 diminished effect Effects 0.000 description 39
- 239000000654 additive Substances 0.000 description 33
- -1 phosphorus compound Chemical class 0.000 description 33
- 239000011734 sodium Substances 0.000 description 31
- 239000002253 acid Substances 0.000 description 28
- 238000006116 polymerization reaction Methods 0.000 description 28
- 229910052708 sodium Inorganic materials 0.000 description 28
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 26
- 229940083608 sodium hydroxide Drugs 0.000 description 25
- 235000011121 sodium hydroxide Nutrition 0.000 description 25
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 21
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 18
- 239000003112 inhibitor Substances 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- 230000000694 effects Effects 0.000 description 12
- 238000001879 gelation Methods 0.000 description 12
- KWSLGOVYXMQPPX-UHFFFAOYSA-N 5-[3-(trifluoromethyl)phenyl]-2h-tetrazole Chemical compound FC(F)(F)C1=CC=CC(C2=NNN=N2)=C1 KWSLGOVYXMQPPX-UHFFFAOYSA-N 0.000 description 11
- 239000001361 adipic acid Substances 0.000 description 11
- 235000011037 adipic acid Nutrition 0.000 description 11
- 229910052751 metal Inorganic materials 0.000 description 11
- 239000002184 metal Substances 0.000 description 11
- 229910001379 sodium hypophosphite Inorganic materials 0.000 description 11
- 238000009987 spinning Methods 0.000 description 11
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 10
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 10
- 150000001875 compounds Chemical class 0.000 description 10
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 10
- 239000012153 distilled water Substances 0.000 description 9
- 150000003839 salts Chemical class 0.000 description 9
- 150000008064 anhydrides Chemical class 0.000 description 8
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 8
- JOQAMSDLZYQHMX-UHFFFAOYSA-L disodium;dioxido-oxo-phenyl-$l^{5}-phosphane Chemical compound [Na+].[Na+].[O-]P([O-])(=O)C1=CC=CC=C1 JOQAMSDLZYQHMX-UHFFFAOYSA-L 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 230000002401 inhibitory effect Effects 0.000 description 6
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 5
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 5
- 239000004760 aramid Substances 0.000 description 5
- 229920003235 aromatic polyamide Polymers 0.000 description 5
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 5
- 230000015556 catabolic process Effects 0.000 description 5
- 238000006731 degradation reaction Methods 0.000 description 5
- 235000011007 phosphoric acid Nutrition 0.000 description 5
- 150000003254 radicals Chemical class 0.000 description 5
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 4
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 4
- QLZHNIAADXEJJP-UHFFFAOYSA-N Phenylphosphonic acid Chemical compound OP(O)(=O)C1=CC=CC=C1 QLZHNIAADXEJJP-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- FDLQZKYLHJJBHD-UHFFFAOYSA-N [3-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=CC(CN)=C1 FDLQZKYLHJJBHD-UHFFFAOYSA-N 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- VRIZGLPHNWWKPU-UHFFFAOYSA-N disodium;dioxido(phenyl)phosphane Chemical compound [Na+].[Na+].[O-]P([O-])C1=CC=CC=C1 VRIZGLPHNWWKPU-UHFFFAOYSA-N 0.000 description 4
- 235000019253 formic acid Nutrition 0.000 description 4
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 4
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 4
- 229910052744 lithium Inorganic materials 0.000 description 4
- 150000002739 metals Chemical class 0.000 description 4
- 229910052700 potassium Inorganic materials 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- 150000003335 secondary amines Chemical class 0.000 description 4
- KIMPPGSMONZDMN-UHFFFAOYSA-N sodium;dihydrogen phosphite Chemical compound [Na+].OP(O)[O-] KIMPPGSMONZDMN-UHFFFAOYSA-N 0.000 description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 206010026749 Mania Diseases 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 150000005690 diesters Chemical class 0.000 description 3
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- CGNKSELPNJJTSM-UHFFFAOYSA-N phenylphosphonous acid Chemical compound OP(O)C1=CC=CC=C1 CGNKSELPNJJTSM-UHFFFAOYSA-N 0.000 description 3
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 3
- 238000012549 training Methods 0.000 description 3
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 239000004677 Nylon Substances 0.000 description 2
- 229920002302 Nylon 6,6 Polymers 0.000 description 2
- KVCWSJZUKMSPLM-UHFFFAOYSA-N O.O[PH2]=O Chemical compound O.O[PH2]=O KVCWSJZUKMSPLM-UHFFFAOYSA-N 0.000 description 2
- 229920006121 Polyxylylene adipamide Polymers 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 230000000903 blocking effect Effects 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- DJHASRVNBMMHLB-UHFFFAOYSA-N ethoxy(phenyl)phosphinite Chemical compound CCOP([O-])C1=CC=CC=C1 DJHASRVNBMMHLB-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 210000003608 fece Anatomy 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 238000005187 foaming Methods 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 2
- 229920001778 nylon Polymers 0.000 description 2
- 230000036961 partial effect Effects 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 230000000737 periodic effect Effects 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- 229910001380 potassium hypophosphite Inorganic materials 0.000 description 2
- CRGPNLUFHHUKCM-UHFFFAOYSA-M potassium phosphinate Chemical compound [K+].[O-]P=O CRGPNLUFHHUKCM-UHFFFAOYSA-M 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- 229910052761 rare earth metal Inorganic materials 0.000 description 2
- 150000002910 rare earth metals Chemical class 0.000 description 2
- 230000003014 reinforcing effect Effects 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 230000002195 synergetic effect Effects 0.000 description 2
- 238000013519 translation Methods 0.000 description 2
- RSSDWSPWORHGIE-UHFFFAOYSA-N $l^{1}-phosphanylbenzene Chemical compound [P]C1=CC=CC=C1 RSSDWSPWORHGIE-UHFFFAOYSA-N 0.000 description 1
- LTHNHFOGQMKPOV-UHFFFAOYSA-N 2-ethylhexan-1-amine Chemical compound CCCCC(CC)CN LTHNHFOGQMKPOV-UHFFFAOYSA-N 0.000 description 1
- RPKCLSMBVQLWIN-UHFFFAOYSA-N 2-n-methylbenzene-1,2-diamine Chemical compound CNC1=CC=CC=C1N RPKCLSMBVQLWIN-UHFFFAOYSA-N 0.000 description 1
- AXNUJYHFQHQZBE-UHFFFAOYSA-N 3-methylbenzene-1,2-diamine Chemical compound CC1=CC=CC(N)=C1N AXNUJYHFQHQZBE-UHFFFAOYSA-N 0.000 description 1
- KFIRODWJCYBBHY-UHFFFAOYSA-N 3-nitrophthalic acid Chemical compound OC(=O)C1=CC=CC([N+]([O-])=O)=C1C(O)=O KFIRODWJCYBBHY-UHFFFAOYSA-N 0.000 description 1
- CCTOEAMRIIXGDJ-UHFFFAOYSA-N 4-hydroxy-2-benzofuran-1,3-dione Chemical compound OC1=CC=CC2=C1C(=O)OC2=O CCTOEAMRIIXGDJ-UHFFFAOYSA-N 0.000 description 1
- DGRGLKZMKWPMOH-UHFFFAOYSA-N 4-methylbenzene-1,2-diamine Chemical compound CC1=CC=C(N)C(N)=C1 DGRGLKZMKWPMOH-UHFFFAOYSA-N 0.000 description 1
- HQQTZCPKNZVLFF-UHFFFAOYSA-N 4h-1,2-benzoxazin-3-one Chemical group C1=CC=C2ONC(=O)CC2=C1 HQQTZCPKNZVLFF-UHFFFAOYSA-N 0.000 description 1
- GVNWZKBFMFUVNX-UHFFFAOYSA-N Adipamide Chemical compound NC(=O)CCCCC(N)=O GVNWZKBFMFUVNX-UHFFFAOYSA-N 0.000 description 1
- BKFZAJOPNQJYCO-UHFFFAOYSA-M C(C)(=O)[O-].[Na+].[O-]CC.[Na+] Chemical compound C(C)(=O)[O-].[Na+].[O-]CC.[Na+] BKFZAJOPNQJYCO-UHFFFAOYSA-M 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-N Metaphosphoric acid Chemical compound OP(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-N 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical class O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- ZVMOCBJJUNRMNF-UHFFFAOYSA-M [K+].CCOP([O-])=O Chemical compound [K+].CCOP([O-])=O ZVMOCBJJUNRMNF-UHFFFAOYSA-M 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 159000000009 barium salts Chemical class 0.000 description 1
- PHIBEYMUALDAQI-UHFFFAOYSA-N benzylphosphinic acid Chemical compound OP(=O)CC1=CC=CC=C1 PHIBEYMUALDAQI-UHFFFAOYSA-N 0.000 description 1
- 238000009530 blood pressure measurement Methods 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 230000036461 convulsion Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 150000003972 cyclic carboxylic anhydrides Chemical class 0.000 description 1
- AZSFNUJOCKMOGB-UHFFFAOYSA-N cyclotriphosphoric acid Chemical compound OP1(=O)OP(O)(=O)OP(O)(=O)O1 AZSFNUJOCKMOGB-UHFFFAOYSA-N 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- VZEGPPPCKHRYGO-UHFFFAOYSA-N diethoxyphosphorylbenzene Chemical compound CCOP(=O)(OCC)C1=CC=CC=C1 VZEGPPPCKHRYGO-UHFFFAOYSA-N 0.000 description 1
- KTLIMPGQZDZPSB-UHFFFAOYSA-N diethylphosphinic acid Chemical compound CCP(O)(=O)CC KTLIMPGQZDZPSB-UHFFFAOYSA-N 0.000 description 1
- ZJIPHXXDPROMEF-UHFFFAOYSA-N dihydroxyphosphanyl dihydrogen phosphite Chemical compound OP(O)OP(O)O ZJIPHXXDPROMEF-UHFFFAOYSA-N 0.000 description 1
- GOJNABIZVJCYFL-UHFFFAOYSA-N dimethylphosphinic acid Chemical compound CP(C)(O)=O GOJNABIZVJCYFL-UHFFFAOYSA-N 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-N diphosphoric acid Chemical compound OP(O)(=O)OP(O)(O)=O XPPKVPWEQAFLFU-UHFFFAOYSA-N 0.000 description 1
- CVFJNXQOIZKPMG-UHFFFAOYSA-L dipotassium;dioxido-oxo-phenyl-$l^{5}-phosphane Chemical compound [K+].[K+].[O-]P([O-])(=O)C1=CC=CC=C1 CVFJNXQOIZKPMG-UHFFFAOYSA-L 0.000 description 1
- IIRVGTWONXBBAW-UHFFFAOYSA-M disodium;dioxido(oxo)phosphanium Chemical compound [Na+].[Na+].[O-][P+]([O-])=O IIRVGTWONXBBAW-UHFFFAOYSA-M 0.000 description 1
- ILRSCQWREDREME-UHFFFAOYSA-N dodecanamide Chemical compound CCCCCCCCCCCC(N)=O ILRSCQWREDREME-UHFFFAOYSA-N 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- GATNOFPXSDHULC-UHFFFAOYSA-N ethylphosphonic acid Chemical compound CCP(O)(O)=O GATNOFPXSDHULC-UHFFFAOYSA-N 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 229910052733 gallium Inorganic materials 0.000 description 1
- 239000012760 heat stabilizer Substances 0.000 description 1
- MUTGBJKUEZFXGO-UHFFFAOYSA-N hexahydrophthalic anhydride Chemical compound C1CCCC2C(=O)OC(=O)C21 MUTGBJKUEZFXGO-UHFFFAOYSA-N 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000011031 large-scale manufacturing process Methods 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- 229910001383 lithium hypophosphite Inorganic materials 0.000 description 1
- JILPJDVXYVTZDQ-UHFFFAOYSA-N lithium methoxide Chemical compound [Li+].[O-]C JILPJDVXYVTZDQ-UHFFFAOYSA-N 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 239000006224 matting agent Substances 0.000 description 1
- 238000002074 melt spinning Methods 0.000 description 1
- BCDIWLCKOCHCIH-UHFFFAOYSA-M methylphosphinate Chemical compound CP([O-])=O BCDIWLCKOCHCIH-UHFFFAOYSA-M 0.000 description 1
- BDRTVPCFKSUHCJ-UHFFFAOYSA-N molecular hydrogen;potassium Chemical compound [K].[H][H] BDRTVPCFKSUHCJ-UHFFFAOYSA-N 0.000 description 1
- XONPDZSGENTBNJ-UHFFFAOYSA-N molecular hydrogen;sodium Chemical compound [Na].[H][H] XONPDZSGENTBNJ-UHFFFAOYSA-N 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- RPGWZZNNEUHDAQ-UHFFFAOYSA-N phenylphosphine Chemical compound PC1=CC=CC=C1 RPGWZZNNEUHDAQ-UHFFFAOYSA-N 0.000 description 1
- PZLQMPWJJGSROS-UHFFFAOYSA-N phosphorous acid;hydrate Chemical compound O.OP(O)O PZLQMPWJJGSROS-UHFFFAOYSA-N 0.000 description 1
- 229920000052 poly(p-xylylene) Polymers 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 229940005657 pyrophosphoric acid Drugs 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- YPPQYORGOMWNMX-UHFFFAOYSA-L sodium phosphonate pentahydrate Chemical compound [Na+].[Na+].[O-]P([O-])=O YPPQYORGOMWNMX-UHFFFAOYSA-L 0.000 description 1
- SYXYWTXQFUUWLP-UHFFFAOYSA-N sodium;butan-1-olate Chemical compound [Na+].CCCC[O-] SYXYWTXQFUUWLP-UHFFFAOYSA-N 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 1
- 125000006839 xylylene group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/49—Phosphorus-containing compounds
- C08K5/51—Phosphorus bound to oxygen
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyamides (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP47083118A JPS5124297B2 (OSRAM) | 1972-08-19 | 1972-08-19 | |
| JP8985372A JPS5141906B2 (OSRAM) | 1972-09-07 | 1972-09-07 | |
| JP9755872A JPS5125065B2 (OSRAM) | 1972-09-27 | 1972-09-27 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2341895A1 DE2341895A1 (de) | 1974-02-28 |
| DE2341895B2 DE2341895B2 (de) | 1978-01-19 |
| DE2341895C3 true DE2341895C3 (de) | 1978-09-28 |
Family
ID=27304131
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2341895A Expired DE2341895C3 (de) | 1972-08-19 | 1973-08-18 | Polymermischungen auf Basis von Polyamiden, Phosphorverbindungen und Alkalimetallverbindungen mit verringerter Gelbildung |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3872055A (OSRAM) |
| DE (1) | DE2341895C3 (OSRAM) |
| FR (1) | FR2196369B1 (OSRAM) |
| GB (1) | GB1439646A (OSRAM) |
| IT (1) | IT996604B (OSRAM) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IE39220B1 (en) * | 1973-05-14 | 1978-08-30 | Ici Ltd | Improved polyamide compositions |
| US5380774A (en) * | 1989-11-28 | 1995-01-10 | Hoechst Celanese Corporation | Nylon molding compositions exhibiting improved protection against UV-light degradation |
| US5194578A (en) * | 1990-06-21 | 1993-03-16 | E.I. Du Pont De Nemours And Company | Fiber-forming copolyamide from 2-methyl-pentamethylene diamine |
| US5116919A (en) * | 1990-12-05 | 1992-05-26 | E. I. Du Pont De Nemours And Company | Process for increasing the relative viscosity of polyamides with reduced thermal degradation |
| US5185428A (en) * | 1991-06-21 | 1993-02-09 | E. I. Du Pont De Nemours And Company | Copolyadipamide containing pentamethyleneadipamide units and products prepared therefrom |
| US5162491A (en) * | 1991-06-21 | 1992-11-10 | E. I. Du Pont De Nemours And Company | Copolyadipamide containing trimethylhexamethyleneadipamide units |
| US5110900A (en) * | 1991-06-21 | 1992-05-05 | E. I Du Pont De Nemours And Company | Copolyadipamide containing ethyltetramethyleneadipamide units |
| DE69400136D1 (de) * | 1993-02-18 | 1996-05-15 | Du Pont | Polyamide mit verbessertem farbverhalten und verbesserter verarbeitbarkeit und verfahren zu ihrer herstellung |
| US5852086A (en) * | 1996-09-30 | 1998-12-22 | The Goodyear Tire & Rubber Company | Polyamide-acrylonitrile butadiene blends with reduced gel and antigel agent |
| US20020037377A1 (en) | 1998-02-03 | 2002-03-28 | Schmidt Steven L. | Enhanced oxygen-scavenging polymers, and packaging made therefrom |
| EP1354906B1 (en) * | 2002-04-19 | 2012-12-05 | Mitsubishi Gas Chemical Company, Inc. | Polyamide resin |
| KR100934555B1 (ko) * | 2002-06-03 | 2009-12-29 | 토요 보세키 가부시기가이샤 | 폴리에스테르 조성물 및 그것으로 되는 폴리에스테르포장재료 |
| KR20070012634A (ko) * | 2003-12-26 | 2007-01-26 | 토요 보세키 가부시기가이샤 | 폴리아미드 수지 조성물 |
| JP4857634B2 (ja) * | 2005-07-22 | 2012-01-18 | 三菱瓦斯化学株式会社 | ポリアミド樹脂 |
| KR101374984B1 (ko) | 2006-05-31 | 2014-03-14 | 미츠비시 가스 가가쿠 가부시키가이샤 | 폴리아미드 수지 조성물 |
| EP2573139B1 (en) * | 2010-05-17 | 2018-07-25 | Mitsubishi Gas Chemical Company, Inc. | Polyamide resin composition |
| EP2573140B1 (en) * | 2010-05-17 | 2018-12-12 | Mitsubishi Gas Chemical Company, Inc. | Polyamide resin composition |
| KR101823560B1 (ko) | 2011-02-24 | 2018-01-30 | 미쯔비시 가스 케미칼 컴파니, 인코포레이티드 | 마스터 배치, 및 마스터 배치를 이용한 폴리아미드 수지 조성물의 제조 방법 |
| WO2014126110A1 (ja) * | 2013-02-13 | 2014-08-21 | 三菱瓦斯化学株式会社 | 多層ボトル及びその製造方法 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2884414A (en) * | 1959-04-28 | Composition and method of stabilizing | ||
| US2906726A (en) * | 1954-09-28 | 1959-09-29 | Exxon Research Engineering Co | Color stabilization of resins with alkali |
| US3240751A (en) * | 1960-06-03 | 1966-03-15 | Monsanto Co | Stabilization of phosphites and epoxy resins containing phosphites by alkaline earthmetal oxides |
| BE621848A (OSRAM) * | 1961-08-28 | |||
| NL122899C (OSRAM) * | 1961-11-24 | |||
| US3274151A (en) * | 1962-11-21 | 1966-09-20 | Schweizerische Viscose | Polyamides containing a combination of (1) a phenol, (2) a phosphorus acid salt or ester, (3) a manganese salt, and (4) a dicarboxylic acid as stabilizers |
| GB1163086A (en) * | 1966-03-07 | 1969-09-04 | Ici Ltd | Polyamides. |
| US3384615A (en) * | 1966-05-16 | 1968-05-21 | Grace W R & Co | Stabilization of polyamides |
| US3640970A (en) * | 1968-02-19 | 1972-02-08 | Teijin Ltd | Process for preparation of polyamides |
| US3595829A (en) * | 1968-03-11 | 1971-07-27 | Ici Ltd | Polyamides |
| US3692867A (en) * | 1971-03-10 | 1972-09-19 | Allied Chem | Filament comprising a polymer blend of polyester and polyanide containing an organic phosphorus compound |
-
1973
- 1973-08-15 US US388698A patent/US3872055A/en not_active Expired - Lifetime
- 1973-08-16 GB GB3873973A patent/GB1439646A/en not_active Expired
- 1973-08-17 IT IT69464/73A patent/IT996604B/it active
- 1973-08-18 DE DE2341895A patent/DE2341895C3/de not_active Expired
- 1973-08-20 FR FR7330166A patent/FR2196369B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IT996604B (it) | 1975-12-10 |
| DE2341895B2 (de) | 1978-01-19 |
| FR2196369B1 (OSRAM) | 1978-09-08 |
| DE2341895A1 (de) | 1974-02-28 |
| US3872055A (en) | 1975-03-18 |
| FR2196369A1 (OSRAM) | 1974-03-15 |
| GB1439646A (en) | 1976-06-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2341895C3 (de) | Polymermischungen auf Basis von Polyamiden, Phosphorverbindungen und Alkalimetallverbindungen mit verringerter Gelbildung | |
| DE69915741T2 (de) | Verfahren zur Herstellung von Polyamiden | |
| DE69400136T2 (de) | Polyamide mit verbessertem farbverhalten und verbesserter verarbeitbarkeit und verfahren zu ihrer herstellung | |
| DE69500807T3 (de) | Verfahren zur herstellung von polyamiden mit verbesserter färbung und verarbeitung | |
| DE69122409T2 (de) | Verfahren zur erhöhung der relativen viskosität von polyamiden | |
| EP2992035B1 (de) | Verfahren zur herstellung von hochviskosen polyamiden | |
| DE1302706B (OSRAM) | ||
| DE2420681A1 (de) | Polyamid-zusammensetzung mit verbessertem kristallisationsverhalten, verfahren zur herstellung derselben und damit erzeugte formkoerper | |
| DE1257425B (de) | Verfahren zum Waermestabilisieren von Polyamiden | |
| DE2641705C2 (de) | Verfahren zur Herstellung von Oxymethylencopolymeren | |
| DE2924024A1 (de) | Fluessige zusammensetzung zur lichtund waermestabilisierung von polyamiden, verfahren zu deren herstellung und deren verwendung zum stabilisieren von polyamiden | |
| DE2449713A1 (de) | Verfahren zur herstellung von copolyamiden | |
| DE1170639B (de) | Verfahren zur Stabilisierung von Polyamiden | |
| DE1232735B (de) | Verfahren zur Erhoehung der Farbaufnahmefaehigkeit von Polyamiden aus Lactamen fuer saure Farbstoffe | |
| DE1445283A1 (de) | Verfahren zur Wiederaufbereitung von Abfallpolymerisat | |
| DE2164307A1 (de) | Permanent antistatische polyamidmassen | |
| DE1295127B (de) | Verfahren zum Spinnen von Polyamidfaeden | |
| DE1645156A1 (de) | Verfahren zur Herstellung anorganischer Koordinationspolymerer | |
| DE1770799A1 (de) | Verfahren zur Neutralisation aromatischer Polyamide | |
| DE2344676A1 (de) | Durch kationische farbstoffe faerbbares, synthetisches, lineares polycarbonsaeureamid | |
| US4043974A (en) | Process for stabilizing polyamides | |
| EP1244829A1 (de) | Verfahren zur herstellung von hydrolysestabilisierten monofilamenten aus polyester und deren verwendung | |
| AT269481B (de) | Hitzestabilisierte Polyamide | |
| DE2030030C3 (de) | Polyamidformmasse und deren Verwendung | |
| DE1917359A1 (de) | Verfahren zur Herstellung von Textilfaeden bzw. -fasern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |