DE2308015B2 - Verfahren zur Herstellung von Polyisocyanaten mit Biuretstruktur - Google Patents
Verfahren zur Herstellung von Polyisocyanaten mit BiuretstrukturInfo
- Publication number
- DE2308015B2 DE2308015B2 DE2308015A DE2308015A DE2308015B2 DE 2308015 B2 DE2308015 B2 DE 2308015B2 DE 2308015 A DE2308015 A DE 2308015A DE 2308015 A DE2308015 A DE 2308015A DE 2308015 B2 DE2308015 B2 DE 2308015B2
- Authority
- DE
- Germany
- Prior art keywords
- weight
- biuret
- parts
- diisocyanate
- nco
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 239000005056 polyisocyanate Substances 0.000 title claims description 91
- 229920001228 polyisocyanate Polymers 0.000 title claims description 91
- OHJMTUPIZMNBFR-UHFFFAOYSA-N biuret Chemical group NC(=O)NC(N)=O OHJMTUPIZMNBFR-UHFFFAOYSA-N 0.000 title claims description 88
- 238000000034 method Methods 0.000 title claims description 71
- 230000008569 process Effects 0.000 title claims description 37
- 238000004519 manufacturing process Methods 0.000 title claims description 14
- 125000005442 diisocyanate group Chemical group 0.000 claims description 44
- 238000006243 chemical reaction Methods 0.000 claims description 39
- 239000003795 chemical substances by application Substances 0.000 claims description 26
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 19
- 239000012948 isocyanate Substances 0.000 claims description 15
- 150000002513 isocyanates Chemical class 0.000 claims description 12
- 239000003054 catalyst Substances 0.000 claims description 10
- 150000001875 compounds Chemical group 0.000 claims description 10
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 claims description 10
- 150000002894 organic compounds Chemical class 0.000 claims description 4
- 239000000376 reactant Substances 0.000 claims description 3
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 46
- RRAMGCGOFNQTLD-UHFFFAOYSA-N hexamethylene diisocyanate Chemical compound O=C=NCCCCCCN=C=O RRAMGCGOFNQTLD-UHFFFAOYSA-N 0.000 description 36
- 239000005057 Hexamethylene diisocyanate Substances 0.000 description 34
- 239000000203 mixture Substances 0.000 description 26
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 24
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 14
- 239000000047 product Substances 0.000 description 14
- 239000000243 solution Substances 0.000 description 13
- 230000015572 biosynthetic process Effects 0.000 description 12
- 239000002904 solvent Substances 0.000 description 12
- XSQUKJJJFZCRTK-UHFFFAOYSA-N urea group Chemical group NC(=O)N XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 12
- 229910052757 nitrogen Inorganic materials 0.000 description 10
- 239000010409 thin film Substances 0.000 description 10
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 239000003973 paint Substances 0.000 description 8
- 150000001412 amines Chemical class 0.000 description 7
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 6
- OBETXYAYXDNJHR-UHFFFAOYSA-N 2-Ethylhexanoic acid Chemical compound CCCCC(CC)C(O)=O OBETXYAYXDNJHR-UHFFFAOYSA-N 0.000 description 6
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 6
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 6
- 235000013877 carbamide Nutrition 0.000 description 6
- 239000004922 lacquer Substances 0.000 description 6
- -1 2,6-diisocyanatocaproic acid ester Chemical class 0.000 description 5
- 125000001931 aliphatic group Chemical group 0.000 description 5
- 239000006227 byproduct Substances 0.000 description 5
- DKVNPHBNOWQYFE-UHFFFAOYSA-N carbamodithioic acid Chemical class NC(S)=S DKVNPHBNOWQYFE-UHFFFAOYSA-N 0.000 description 5
- 229920000728 polyester Polymers 0.000 description 5
- RTTZISZSHSCFRH-UHFFFAOYSA-N 1,3-bis(isocyanatomethyl)benzene Chemical compound O=C=NCC1=CC=CC(CN=C=O)=C1 RTTZISZSHSCFRH-UHFFFAOYSA-N 0.000 description 4
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 4
- 239000004202 carbamide Substances 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 239000001569 carbon dioxide Substances 0.000 description 4
- 229910002092 carbon dioxide Inorganic materials 0.000 description 4
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 4
- 239000010408 film Substances 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 4
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- MSXVEPNJUHWQHW-UHFFFAOYSA-N 2-methylbutan-2-ol Chemical compound CCC(C)(C)O MSXVEPNJUHWQHW-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 3
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 3
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 3
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 3
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 3
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 3
- 239000012159 carrier gas Substances 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 230000008030 elimination Effects 0.000 description 3
- 238000003379 elimination reaction Methods 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- FUZZWVXGSFPDMH-UHFFFAOYSA-M hexanoate Chemical compound CCCCCC([O-])=O FUZZWVXGSFPDMH-UHFFFAOYSA-M 0.000 description 3
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 3
- 230000014759 maintenance of location Effects 0.000 description 3
- 238000001556 precipitation Methods 0.000 description 3
- 150000003141 primary amines Chemical class 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- 239000011877 solvent mixture Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- 150000003509 tertiary alcohols Chemical class 0.000 description 3
- 229940113165 trimethylolpropane Drugs 0.000 description 3
- 150000003672 ureas Chemical class 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- XSJFAAMNRIJDGN-UHFFFAOYSA-N 1,2-bis(isocyanatomethyl)cyclobutane Chemical compound O=C=NCC1CCC1CN=C=O XSJFAAMNRIJDGN-UHFFFAOYSA-N 0.000 description 2
- GYUYTUBGTICBEE-UHFFFAOYSA-N 1,3-bis(3-isocyanatopropoxy)-2,2-dimethylpropane Chemical compound O=C=NCCCOCC(C)(C)COCCCN=C=O GYUYTUBGTICBEE-UHFFFAOYSA-N 0.000 description 2
- KATOLVAXCGIBLO-UHFFFAOYSA-N 1,3-dibenzylurea Chemical compound C=1C=CC=CC=1CNC(=O)NCC1=CC=CC=C1 KATOLVAXCGIBLO-UHFFFAOYSA-N 0.000 description 2
- GWEHVDNNLFDJLR-UHFFFAOYSA-N 1,3-diphenylurea Chemical compound C=1C=CC=CC=1NC(=O)NC1=CC=CC=C1 GWEHVDNNLFDJLR-UHFFFAOYSA-N 0.000 description 2
- OHLKMGYGBHFODF-UHFFFAOYSA-N 1,4-bis(isocyanatomethyl)benzene Chemical compound O=C=NCC1=CC=C(CN=C=O)C=C1 OHLKMGYGBHFODF-UHFFFAOYSA-N 0.000 description 2
- DFPJRUKWEPYFJT-UHFFFAOYSA-N 1,5-diisocyanatopentane Chemical compound O=C=NCCCCCN=C=O DFPJRUKWEPYFJT-UHFFFAOYSA-N 0.000 description 2
- VGWGUWAXGYAJKO-UHFFFAOYSA-N 1-carbamoyl-1,3,3-triisocyanatourea Chemical compound O=C=NN(C(=O)N)C(=O)N(N=C=O)N=C=O VGWGUWAXGYAJKO-UHFFFAOYSA-N 0.000 description 2
- VZDIRINETBAVAV-UHFFFAOYSA-N 2,4-diisocyanato-1-methylcyclohexane Chemical compound CC1CCC(N=C=O)CC1N=C=O VZDIRINETBAVAV-UHFFFAOYSA-N 0.000 description 2
- LEARFTRDZQQTDN-UHFFFAOYSA-N 2-[4-(2-hydroxypropan-2-yl)phenyl]propan-2-ol Chemical compound CC(C)(O)C1=CC=C(C(C)(C)O)C=C1 LEARFTRDZQQTDN-UHFFFAOYSA-N 0.000 description 2
- XLLIQLLCWZCATF-UHFFFAOYSA-N 2-methoxyethyl acetate Chemical compound COCCOC(C)=O XLLIQLLCWZCATF-UHFFFAOYSA-N 0.000 description 2
- KDSNLYIMUZNERS-UHFFFAOYSA-N 2-methylpropanamine Chemical compound CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 description 2
- FRDAATYAJDYRNW-UHFFFAOYSA-N 3-methyl-3-pentanol Chemical compound CCC(C)(O)CC FRDAATYAJDYRNW-UHFFFAOYSA-N 0.000 description 2
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical compound CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 2
- OWIKHYCFFJSOEH-UHFFFAOYSA-N Isocyanic acid Chemical compound N=C=O OWIKHYCFFJSOEH-UHFFFAOYSA-N 0.000 description 2
- LGDSHSYDSCRFAB-UHFFFAOYSA-N Methyl isothiocyanate Chemical compound CN=C=S LGDSHSYDSCRFAB-UHFFFAOYSA-N 0.000 description 2
- MGJKQDOBUOMPEZ-UHFFFAOYSA-N N,N'-dimethylurea Chemical compound CNC(=O)NC MGJKQDOBUOMPEZ-UHFFFAOYSA-N 0.000 description 2
- JGCUIOIXGKBHJU-UHFFFAOYSA-N N=C=O.N=C=O.NC(N)=O Chemical compound N=C=O.N=C=O.NC(N)=O JGCUIOIXGKBHJU-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- IJCVBMSXIPFVLH-UHFFFAOYSA-N [C].S=O Chemical compound [C].S=O IJCVBMSXIPFVLH-UHFFFAOYSA-N 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000001361 adipic acid Substances 0.000 description 2
- 235000011037 adipic acid Nutrition 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- XLJMAIOERFSOGZ-UHFFFAOYSA-N anhydrous cyanic acid Natural products OC#N XLJMAIOERFSOGZ-UHFFFAOYSA-N 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- KORSJDCBLAPZEQ-UHFFFAOYSA-N dicyclohexylmethane-4,4'-diisocyanate Chemical compound C1CC(N=C=O)CCC1CC1CCC(N=C=O)CC1 KORSJDCBLAPZEQ-UHFFFAOYSA-N 0.000 description 2
- HDITUCONWLWUJR-UHFFFAOYSA-N diethylazanium;chloride Chemical compound [Cl-].CC[NH2+]CC HDITUCONWLWUJR-UHFFFAOYSA-N 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 235000019256 formaldehyde Nutrition 0.000 description 2
- 238000005194 fractionation Methods 0.000 description 2
- ACCCMOQWYVYDOT-UHFFFAOYSA-N hexane-1,1-diol Chemical compound CCCCCC(O)O ACCCMOQWYVYDOT-UHFFFAOYSA-N 0.000 description 2
- VURPSIJHXNVCNZ-UHFFFAOYSA-N isocyanic acid;urea Chemical class N=C=O.NC(N)=O VURPSIJHXNVCNZ-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- 238000005191 phase separation Methods 0.000 description 2
- 230000002028 premature Effects 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000013049 sediment Substances 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 2
- 150000003585 thioureas Chemical class 0.000 description 2
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 2
- KPWKPGFLZGMMFX-ZJUUUORDSA-N (1s,4r)-1,7,7-trimethyl-2-oxo-3-oxabicyclo[2.2.1]heptane-4-carboxylic acid Chemical group C1C[C@@]2(C(O)=O)OC(=O)[C@]1(C)C2(C)C KPWKPGFLZGMMFX-ZJUUUORDSA-N 0.000 description 1
- GHXPTDPKJYFMOE-UHFFFAOYSA-N 1,2-bis(isocyanatomethyl)cyclohexane Chemical compound O=C=NCC1CCCCC1CN=C=O GHXPTDPKJYFMOE-UHFFFAOYSA-N 0.000 description 1
- QKOWXXDOHMJOMQ-UHFFFAOYSA-N 1,3,5-tris(6-isocyanatohexyl)biuret Chemical compound O=C=NCCCCCCNC(=O)N(CCCCCCN=C=O)C(=O)NCCCCCCN=C=O QKOWXXDOHMJOMQ-UHFFFAOYSA-N 0.000 description 1
- GNQKHBSIBXSFFD-UHFFFAOYSA-N 1,3-diisocyanatocyclohexane Chemical compound O=C=NC1CCCC(N=C=O)C1 GNQKHBSIBXSFFD-UHFFFAOYSA-N 0.000 description 1
- AWHORBWDEKTQAX-UHFFFAOYSA-N 1,3-dipropylurea Chemical compound CCCNC(=O)NCCC AWHORBWDEKTQAX-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- OVBFMUAFNIIQAL-UHFFFAOYSA-N 1,4-diisocyanatobutane Chemical compound O=C=NCCCCN=C=O OVBFMUAFNIIQAL-UHFFFAOYSA-N 0.000 description 1
- OOHUQUVFZAKVIC-UHFFFAOYSA-N 1,9-diisocyanato-5-methyl-5-propylnonane Chemical compound O=C=NCCCCC(C)(CCC)CCCCN=C=O OOHUQUVFZAKVIC-UHFFFAOYSA-N 0.000 description 1
- ZSIDYKPHUAPROJ-UHFFFAOYSA-N 1-(3-isocyanatopropoxy)-2-(3-isocyanatopropoxymethyl)-2-methylpentane Chemical compound O=C=NCCCOCC(C)(CCC)COCCCN=C=O ZSIDYKPHUAPROJ-UHFFFAOYSA-N 0.000 description 1
- BFLWAUWLGJKDMJ-UHFFFAOYSA-N 1-butyl-3-ethylurea Chemical compound CCCCNC(=O)NCC BFLWAUWLGJKDMJ-UHFFFAOYSA-N 0.000 description 1
- YKLDLMXTBHWMPV-UHFFFAOYSA-N 1-cyclohexyl-3-methylurea Chemical compound CNC(=O)NC1CCCCC1 YKLDLMXTBHWMPV-UHFFFAOYSA-N 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- OVOUKWFJRHALDD-UHFFFAOYSA-N 2-[2-(2-acetyloxyethoxy)ethoxy]ethyl acetate Chemical compound CC(=O)OCCOCCOCCOC(C)=O OVOUKWFJRHALDD-UHFFFAOYSA-N 0.000 description 1
- SVONRAPFKPVNKG-UHFFFAOYSA-N 2-ethoxyethyl acetate Chemical compound CCOCCOC(C)=O SVONRAPFKPVNKG-UHFFFAOYSA-N 0.000 description 1
- LCKLCAPXAGJHJQ-UHFFFAOYSA-N 2-isocyanatohexanoic acid Chemical compound CCCCC(C(O)=O)N=C=O LCKLCAPXAGJHJQ-UHFFFAOYSA-N 0.000 description 1
- ZQXSFZAMFNRZOQ-UHFFFAOYSA-N 2-methylpropan-2-ol;hydrate Chemical compound O.CC(C)(C)O ZQXSFZAMFNRZOQ-UHFFFAOYSA-N 0.000 description 1
- FAXDZWQIWUSWJH-UHFFFAOYSA-N 3-methoxypropan-1-amine Chemical compound COCCCN FAXDZWQIWUSWJH-UHFFFAOYSA-N 0.000 description 1
- ROLMZTIHUMKEAI-UHFFFAOYSA-N 4,5-difluoro-2-hydroxybenzonitrile Chemical compound OC1=CC(F)=C(F)C=C1C#N ROLMZTIHUMKEAI-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical compound NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 239000004971 Cross linker Substances 0.000 description 1
- NOTFZGFABLVTIG-UHFFFAOYSA-N Cyclohexylethyl acetate Chemical compound CC(=O)OCCC1CCCCC1 NOTFZGFABLVTIG-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 239000005058 Isophorone diisocyanate Substances 0.000 description 1
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methyl-N-phenylamine Natural products CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- 229920002396 Polyurea Polymers 0.000 description 1
- 239000004972 Polyurethane varnish Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 241000589614 Pseudomonas stutzeri Species 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- KHQFIFVVFLDTSH-UHFFFAOYSA-N [bis(2-hydroxyethyl)amino]azanium;chloride Chemical compound [Cl-].OCC[NH+](N)CCO KHQFIFVVFLDTSH-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- BIVUUOPIAYRCAP-UHFFFAOYSA-N aminoazanium;chloride Chemical compound Cl.NN BIVUUOPIAYRCAP-UHFFFAOYSA-N 0.000 description 1
- 239000001099 ammonium carbonate Substances 0.000 description 1
- 235000012501 ammonium carbonate Nutrition 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- KTUQUZJOVNIKNZ-UHFFFAOYSA-N butan-1-ol;hydrate Chemical compound O.CCCCO KTUQUZJOVNIKNZ-UHFFFAOYSA-N 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- ICXXXLGATNSZAV-UHFFFAOYSA-N butylazanium;chloride Chemical compound [Cl-].CCCC[NH3+] ICXXXLGATNSZAV-UHFFFAOYSA-N 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- XJUODVCCAFKILC-UHFFFAOYSA-N carbon dioxide;methanamine Chemical compound NC.O=C=O XJUODVCCAFKILC-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- JQVDAXLFBXTEQA-UHFFFAOYSA-O dibutylazanium Chemical compound CCCC[NH2+]CCCC JQVDAXLFBXTEQA-UHFFFAOYSA-O 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- JRBPAEWTRLWTQC-UHFFFAOYSA-N dodecylamine Chemical compound CCCCCCCCCCCCN JRBPAEWTRLWTQC-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- UJQARJSVWVMOSD-UHFFFAOYSA-N ethyl n-aminocarbamate;hydrochloride Chemical compound Cl.CCOC(=O)NN UJQARJSVWVMOSD-UHFFFAOYSA-N 0.000 description 1
- SKEHVMZPBBGBAO-UHFFFAOYSA-N ethylhydrazine;hydrochloride Chemical compound Cl.CCNN SKEHVMZPBBGBAO-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- JXYZHMPRERWTPM-UHFFFAOYSA-N hydron;morpholine;chloride Chemical compound Cl.C1COCCN1 JXYZHMPRERWTPM-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- ULNRRNBMNIIOJK-UHFFFAOYSA-N isocyanatourea Chemical compound NC(=O)NN=C=O ULNRRNBMNIIOJK-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- NIMLQBUJDJZYEJ-UHFFFAOYSA-N isophorone diisocyanate Chemical compound CC1(C)CC(N=C=O)CC(C)(CN=C=O)C1 NIMLQBUJDJZYEJ-UHFFFAOYSA-N 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000008164 mustard oil Substances 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- WHIVNJATOVLWBW-UHFFFAOYSA-N n-butan-2-ylidenehydroxylamine Chemical compound CCC(C)=NO WHIVNJATOVLWBW-UHFFFAOYSA-N 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- 238000006454 non catalyzed reaction Methods 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920002432 poly(vinyl methyl ether) polymer Polymers 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920005906 polyester polyol Polymers 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 150000003139 primary aliphatic amines Chemical class 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000003678 scratch resistant effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- NQRYJNQNLNOLGT-UHFFFAOYSA-N tetrahydropyridine hydrochloride Natural products C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- HFFLGKNGCAIQMO-UHFFFAOYSA-N trichloroacetaldehyde Chemical compound ClC(Cl)(Cl)C=O HFFLGKNGCAIQMO-UHFFFAOYSA-N 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- PTMFUWGXPRYYMC-UHFFFAOYSA-N triethylazanium;formate Chemical compound OC=O.CCN(CC)CC PTMFUWGXPRYYMC-UHFFFAOYSA-N 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 238000004383 yellowing Methods 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C273/00—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C273/18—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas
- C07C273/1854—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas by reactions not involving the formation of the N-C(O)-N- moiety
- C07C273/1863—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas by reactions not involving the formation of the N-C(O)-N- moiety from urea
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C273/00—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C273/18—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas
- C07C273/1872—Preparation of compounds comprising a -N-C(O)-N-C(O)-N- moiety
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/70—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen characterised by the isocyanates or isothiocyanates used
- C08G18/72—Polyisocyanates or polyisothiocyanates
- C08G18/77—Polyisocyanates or polyisothiocyanates having heteroatoms in addition to the isocyanate or isothiocyanate nitrogen and oxygen or sulfur
- C08G18/78—Nitrogen
- C08G18/7806—Nitrogen containing -N-C=0 groups
- C08G18/7818—Nitrogen containing -N-C=0 groups containing ureum or ureum derivative groups
- C08G18/7831—Nitrogen containing -N-C=0 groups containing ureum or ureum derivative groups containing biuret groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Polyurethanes Or Polyureas (AREA)
Priority Applications (23)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2308015A DE2308015B2 (de) | 1973-02-17 | 1973-02-17 | Verfahren zur Herstellung von Polyisocyanaten mit Biuretstruktur |
| CA192,254A CA1024990A (en) | 1973-02-17 | 1974-02-08 | Process for the production of polysocyanates with a bluret structure |
| US441778A US3903127A (en) | 1973-02-17 | 1974-02-12 | Process for the production of polyisocyanates with a biuret structure |
| AU65504/74A AU492109B2 (en) | 1974-02-12 | Process for the production of polyisocyanates with a biuret structure | |
| CH204074A CH585704A5 (enExample) | 1973-02-17 | 1974-02-14 | |
| DD176554A DD112462A5 (enExample) | 1973-02-17 | 1974-02-14 | |
| SE7401968A SE419541B (sv) | 1973-02-17 | 1974-02-14 | Sett att framstella polyisocyanater med biuretstruktur |
| GB698174A GB1441882A (en) | 1973-02-17 | 1974-02-15 | Process for the production of polyisocyanates with a biuret structur |
| SU1999878A SU505353A3 (ru) | 1973-02-17 | 1974-02-15 | Способ получени биуретовых полиизоцианатов |
| LU69395A LU69395A1 (enExample) | 1973-02-17 | 1974-02-15 | |
| BE140945A BE811074A (fr) | 1973-02-17 | 1974-02-15 | Procede de preparation de polyisocyanates avec une structure de biuret |
| BR1136/74A BR7401136D0 (pt) | 1973-02-17 | 1974-02-15 | Processo para a preparacao de poliisocianatos com estrutura de biureto |
| IT48395/74A IT1002953B (it) | 1973-02-17 | 1974-02-15 | Procedimento per la produzione di poliisocianati con struttura di biureto |
| HUBA3028A HU168360B (en) | 1973-02-17 | 1974-02-15 | Process for production of polirozyanates of biuret construction |
| NLAANVRAGE7402141,A NL179727C (nl) | 1973-02-17 | 1974-02-15 | Werkwijze ter bereiding van polyisocyanaten met biureetstructuur en werkwijze ter bereiding van daaruit vervaardigde polyurethankunststoffen. |
| AT122174A AT337200B (de) | 1973-02-17 | 1974-02-15 | Verfahren zur herstellung von polyisocyanaten mit biuretstruktur |
| FR7405245A FR2218357B1 (enExample) | 1973-02-17 | 1974-02-15 | |
| PL1974168851A PL92999B1 (enExample) | 1973-02-17 | 1974-02-16 | |
| JP49018159A JPS49134629A (enExample) | 1973-02-17 | 1974-02-16 | |
| ES423324A ES423324A1 (es) | 1973-02-17 | 1974-02-16 | Procedimiento para la obtencion de poliisocianatos de es- tructura biuret. |
| CS1165A CS174126B2 (enExample) | 1973-02-17 | 1974-02-18 | |
| SE7405961A SE419451B (sv) | 1973-02-17 | 1974-05-03 | Flytande skumreglerat tvettmedel |
| US05/578,557 US3976622A (en) | 1973-02-17 | 1975-05-19 | Process for the production of polyisocyanates with a biuret structure |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2308015A DE2308015B2 (de) | 1973-02-17 | 1973-02-17 | Verfahren zur Herstellung von Polyisocyanaten mit Biuretstruktur |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2308015A1 DE2308015A1 (de) | 1974-09-12 |
| DE2308015B2 true DE2308015B2 (de) | 1980-07-31 |
Family
ID=5872332
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2308015A Ceased DE2308015B2 (de) | 1973-02-17 | 1973-02-17 | Verfahren zur Herstellung von Polyisocyanaten mit Biuretstruktur |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US3903127A (enExample) |
| JP (1) | JPS49134629A (enExample) |
| AT (1) | AT337200B (enExample) |
| BE (1) | BE811074A (enExample) |
| BR (1) | BR7401136D0 (enExample) |
| CA (1) | CA1024990A (enExample) |
| CH (1) | CH585704A5 (enExample) |
| CS (1) | CS174126B2 (enExample) |
| DD (1) | DD112462A5 (enExample) |
| DE (1) | DE2308015B2 (enExample) |
| ES (1) | ES423324A1 (enExample) |
| FR (1) | FR2218357B1 (enExample) |
| GB (1) | GB1441882A (enExample) |
| HU (1) | HU168360B (enExample) |
| IT (1) | IT1002953B (enExample) |
| LU (1) | LU69395A1 (enExample) |
| NL (1) | NL179727C (enExample) |
| PL (1) | PL92999B1 (enExample) |
| SE (1) | SE419541B (enExample) |
| SU (1) | SU505353A3 (enExample) |
Families Citing this family (99)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2308015B2 (de) * | 1973-02-17 | 1980-07-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Polyisocyanaten mit Biuretstruktur |
| JPS539206B2 (enExample) * | 1974-05-20 | 1978-04-04 | ||
| US4147714A (en) * | 1976-03-10 | 1979-04-03 | Bayer Aktiengesellschaft | Process for the preparation of polyisocyanates which contain biuret groups |
| US4181782A (en) * | 1976-05-04 | 1980-01-01 | Bayer Aktiengesellschaft | Preparation of polyisocyanates having biuret groups and their use in synthetic foamed resins and lacquers |
| DE2619548A1 (de) * | 1976-05-04 | 1977-11-24 | Bayer Ag | Verfahren zur herstellung von biuretgruppen aufweisenden polyisocyanaten |
| US4062833A (en) * | 1976-08-23 | 1977-12-13 | The Dow Chemical Company | Biuret polyisocyanates |
| DE2641448A1 (de) * | 1976-09-15 | 1978-03-16 | Bayer Ag | Verfahren zur herstellung von urethan- und biuretgruppen enthaltenden polyisocyanaten |
| US4192936A (en) * | 1976-12-03 | 1980-03-11 | Bayer Aktiengesellschaft | Preparation of polyisocyanates containing biuret groups |
| DE2654745A1 (de) * | 1976-12-03 | 1978-06-08 | Bayer Ag | Verfahren zur herstellung von biuretgruppen aufweisenden polyisocyanaten |
| DE2655048A1 (de) * | 1976-12-04 | 1978-06-08 | Bayer Ag | Mikroverkapselung mit modifizierten aliphatischen polyisocyanaten |
| US4072702A (en) * | 1976-12-06 | 1978-02-07 | The United States Of America As Represented By The Secretary Of The Army | Tri-functional isocyanate crosslinking agents for hydroxy-terminated polybutadiene binders |
| BE864326A (fr) * | 1977-03-01 | 1978-08-28 | Asahi Chemical Ind | Procede pour preparer un polyisocyanate organique |
| DE2730513A1 (de) * | 1977-07-06 | 1979-01-25 | Bayer Ag | Verfahren zur herstellung von modifizierten polyisocyanaten |
| US4221877A (en) * | 1978-01-27 | 1980-09-09 | Texaco Development Corp. | Modified diphenylmethane diisocyanates useful in polyurethanes or polyisocyanurates |
| US4411262A (en) * | 1978-04-21 | 1983-10-25 | Bayer Aktiengesellschaft | Constructional material |
| DE2856826A1 (de) * | 1978-12-30 | 1980-07-17 | Bayer Ag | Verfahren zur herstellung von biuret- und/oder hoehere polyuretgruppen aufweisenden polyisecyanaten, die nach diesem verfahren erhaeltlichen verbindungen, sowie ihre verwendung als aufbaukomponente bei der herstellung von polyurethankunststoffen |
| DE2856864A1 (de) * | 1978-12-30 | 1980-07-24 | Bayer Ag | Neue polyisocyanate, ein verfahren zu ihrer herstellung und ihre verwendung |
| US4218390A (en) * | 1979-05-09 | 1980-08-19 | Brusilovsky Mikhail G | Method for preparing biuret-structure polyisocyanates |
| US4290969A (en) * | 1980-08-14 | 1981-09-22 | Asahi Kasei Kogyo Kabushiki Kaisha | Process for the continuous production of polyisocyanate |
| JPS5742782A (en) * | 1980-08-28 | 1982-03-10 | Asahi Chem Ind Co Ltd | Preparation of organic polyisocyanate composition |
| DE3228721A1 (de) * | 1982-07-31 | 1984-02-02 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von modifizierten polyisocyanaten und ihre verwendung |
| JPS5995259A (ja) * | 1982-11-20 | 1984-06-01 | Asahi Chem Ind Co Ltd | 有機ポリイソシアネ−ト及びその製造方法 |
| DE3440912A1 (de) * | 1984-11-09 | 1986-05-15 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von waermefarbbestaendigen aliphatischen und/oder cycloaliphatischen diisocyanaten und ihre verwendung zur herstellung von farbverbesserten, modifizierten polyisocyanaten |
| US4816600A (en) * | 1985-08-09 | 1989-03-28 | Ici Americas Inc. | Isocyanate compositions obtained from reaction of isocyanates with blocked polamines |
| DE3700209A1 (de) * | 1987-01-07 | 1988-07-21 | Bayer Ag | Verfahren zur herstellung von polyisocyanaten mit biuretstruktur |
| GB2203159B (en) * | 1987-04-03 | 1990-12-12 | Asahi Chemical Ind | An isocyanurate polyisocyanate and its use as a curing agent for a two-component polyurethane composition |
| GB2233707A (en) * | 1989-05-26 | 1991-01-16 | Link 51 Ltd | Door assembly |
| DE3926389A1 (de) * | 1989-08-10 | 1991-02-14 | Bayer Ag | Estergruppen aufweisende polyisocyanate oder polyisocyanatgemische, ein verfahren zur herstellung derartiger polyisocyanate oder polyisocyanatgemische und ihre verwendung in polyurethanlacken |
| DE4422569A1 (de) | 1994-06-28 | 1996-01-04 | Bayer Ag | Bisulfit-blockierte Polyisocyanate als Gerbstoffe |
| DE4426131A1 (de) | 1994-07-22 | 1996-01-25 | Bayer Ag | Lichtechte, lösemittelfreie Polyurethan-Beschichtungsmittel und ihre Verwendung |
| DE4441190A1 (de) * | 1994-11-18 | 1996-05-23 | Teroson Gmbh | Primer für lackierte Oberflächen |
| US5489704A (en) | 1994-08-29 | 1996-02-06 | Bayer Corporation | Polyisocyanate/polyamine mixtures and their use for the production of polyurea coatings |
| DE4439421A1 (de) | 1994-11-04 | 1996-05-09 | Huels Chemische Werke Ag | Neue harnstoffgruppenhaltige Polyamine und Verfahren zu ihrer Herstellung |
| US5523376A (en) | 1994-12-21 | 1996-06-04 | Bayer Corporation | Coating compositions based on aldimines and polyisocyanates containing uretdione groups |
| DE19505035A1 (de) * | 1995-02-15 | 1996-08-22 | Basf Ag | Verfahren zur Herstellung biurethgruppen-haltigen Polyisocyanaten |
| US5561200A (en) | 1995-05-23 | 1996-10-01 | Bayer Corporation | Blocked polyisocyanates with improved thermal stability |
| DE19545634A1 (de) | 1995-12-07 | 1997-06-12 | Bayer Ag | Festkörperreiche Bindemittelkombinationen |
| US5789519A (en) * | 1996-04-12 | 1998-08-04 | Bayer Corporation | High viscosity, high equivalent weight polyisocyanate mixtures containing allophanate and isocyanurate groups and their use in coating compositions |
| DE19624821A1 (de) * | 1996-06-21 | 1998-01-02 | Bayer Ag | Verfahren zur Gerbung von Leder |
| DE19858733A1 (de) | 1998-12-18 | 2000-06-21 | Bayer Ag | Wäßrige 2 K-PUR-Systeme mit erhöhter Schlagzähigkeit und guten Beständigkeitseigenschaften, ein Verfahren zu deren Herstellung und deren Verwendung |
| DE19955129A1 (de) | 1999-11-17 | 2001-05-23 | Bayer Ag | Neue, festkörperreiche Bindemittelkombinationen und deren Verwendung |
| AT408658B (de) | 1999-12-23 | 2002-02-25 | Solutia Austria Gmbh | Wässriges überzugsmittel |
| DE10008928A1 (de) | 2000-02-25 | 2001-08-30 | Degussa | Transparente oder pigmentierte Pulverlacke mit Vernetzern aus Hydroxyalkylamiden und blockierten, nicht aromatischen Polyisocyanaten |
| JP4514293B2 (ja) * | 2000-07-13 | 2010-07-28 | 旭化成ケミカルズ株式会社 | ビウレット型ポリイソシアネート組成物及びその製造方法 |
| BR0212992A (pt) * | 2001-09-21 | 2004-09-21 | Du Pont | Processo para a preparação de poliisocianatos, composição dos mesmos, composição de revestimento, substrato revestido e substrato automotivo |
| DE10152294A1 (de) * | 2001-10-26 | 2003-05-08 | Solutia Austria Gmbh Werndorf | Hochmolekulare Polyurethan-Dispersionen |
| US6852905B2 (en) | 2001-11-15 | 2005-02-08 | Paragon Trade Brands, Inc. | Fluid handling layers made from foam and absorbent articles containing same |
| AT411062B (de) * | 2001-11-19 | 2003-09-25 | Solutia Austria Gmbh | Beschichtungsmittel |
| DE10216896A1 (de) * | 2002-04-17 | 2003-11-13 | Goldschmidt Ag Th | Wässrige Polysiloxan-Polyurethan-Dispersion, ihre Herstellung und Verwendung in Beschichtungsmitteln |
| US20080064829A1 (en) * | 2002-09-20 | 2008-03-13 | Adams Jerome T | Preparation and use of biuret-containing polyisocyanates as cross-linking agents for coatings |
| DE10322620A1 (de) * | 2003-05-20 | 2004-12-16 | Bayer Materialscience Ag | Festkörperreiche Bindemittelkombinationen für kratzfeste Decklacke |
| DE10322911A1 (de) * | 2003-05-21 | 2004-12-16 | Bayer Materialscience Ag | Verfestigungsstabile blockierte Polyisocyanate |
| AT500555B1 (de) * | 2003-06-13 | 2009-11-15 | Cytec Surface Specialties At | Selbstvernetzende wässrige polyurethandispersionen |
| AT412648B (de) | 2003-06-27 | 2005-05-25 | Surface Specialties Austria | Wasserverdünnbare polyurethandispersionen |
| DE10334723A1 (de) * | 2003-07-30 | 2005-02-24 | Bayer Materialscience Ag | Neue Bindemittelkombination für hochbeständige Kunststofflacke |
| DE10348380A1 (de) * | 2003-10-17 | 2005-06-02 | Bayer Materialscience Ag | Mit sekundären Aminen blockierte Polyisocyanate mit Biuretstruktur |
| US20050137374A1 (en) * | 2003-12-17 | 2005-06-23 | Roesler Richard R. | Two-component water-borne adhesive |
| US20050137322A1 (en) * | 2003-12-17 | 2005-06-23 | Roesler Richard R. | Silane modified two-component polyurethane coating |
| US20050158131A1 (en) * | 2004-01-20 | 2005-07-21 | Markusch Peter H. | Geotextile/polyurethane composites based on blocked isocyanate compositions |
| US20050277732A1 (en) * | 2004-06-14 | 2005-12-15 | Yu Poli C | Two-component coating composition |
| US20050288431A1 (en) * | 2004-06-25 | 2005-12-29 | Gindin Lyubov K | Polyurethane dispersion prepared from a high acid functional polyester |
| US20050288430A1 (en) * | 2004-06-25 | 2005-12-29 | Gindin Lyubov K | Polyurethane dispersions with high acid content |
| US20060014890A1 (en) * | 2004-07-14 | 2006-01-19 | Zielinski David P | Polyisocyanates with improved compatibility with high hydroxyl content polyols |
| US20060011295A1 (en) * | 2004-07-14 | 2006-01-19 | Karsten Danielmeier | Aspartic ester functional compounds |
| DE102004050284A1 (de) | 2004-10-15 | 2006-04-27 | Lanxess Deutschland Gmbh | Isocyanat-basierende Gerbstoffe |
| US20060089481A1 (en) * | 2004-10-21 | 2006-04-27 | Roesler Richard R | Blocked biuretized isocyanates |
| US20060089480A1 (en) * | 2004-10-21 | 2006-04-27 | Roesler Richard R | Biuretized isocyanates and blocked biuretized isocyanates |
| US7371807B2 (en) * | 2004-10-21 | 2008-05-13 | Bayer Materialscience Llc | Blocked biuretized isocyanates |
| DE102004056849A1 (de) * | 2004-11-25 | 2006-06-08 | Bayer Materialscience Ag | Neue Polyisocyanatgemische, ein Verfahren zu ihrer Herstellung und ihre Verwendung als Härterkomponente in Polyurethanlacken |
| EP1849810A1 (en) * | 2006-04-27 | 2007-10-31 | Cytec Surface Specialties Austria GmbH | Oil based aqueous polyurethane dispersions |
| EP2024455B1 (en) * | 2006-05-16 | 2018-04-04 | Coatings Foreign IP Co. LLC | Highly productive coating composition for automotive refinishing |
| US20090131581A1 (en) * | 2007-11-19 | 2009-05-21 | Wylie Amy S | Aqueous, stain-resistant coating compositions |
| US20090176907A1 (en) | 2008-01-08 | 2009-07-09 | Ramesh Subramanian | Direct-to-metal radiation curable compositions |
| DE102008052765A1 (de) * | 2008-10-22 | 2010-04-29 | Bayer Materialscience Ag | Feuchtigkeitshärtende Polyisocyanatmischungen |
| US20120003454A1 (en) | 2009-01-14 | 2012-01-05 | Bayer Materialscience Llc | Long-fiber thermoset composite with low orange peel |
| DE102009007194A1 (de) | 2009-02-03 | 2010-08-05 | Bayer Materialscience Ag | Flexible Beschichtungen |
| DE102009007228A1 (de) | 2009-02-03 | 2010-08-05 | Bayer Materialscience Ag | Beschichtungen |
| EP2239286A1 (de) | 2009-04-08 | 2010-10-13 | Bayer MaterialScience AG | Wässrige Bindemittel-Dispersion für Zweikomponenten-Lacke |
| US20110045219A1 (en) * | 2009-08-18 | 2011-02-24 | Bayer Materialscience Llc | Coating compositions for glass substrates |
| KR20120093158A (ko) | 2009-09-26 | 2012-08-22 | 세게티스, 인코포레이티드. | 케탈 락톤 및 옥소카르복실릭 케탈과 트리메틸올 화합물의 입체특이성 부가물, 이를 포함하는 중합체, 제조 방법, 및 이의 용도 |
| US9080074B2 (en) | 2010-03-19 | 2015-07-14 | Bayer Materialscience Llc | Low temperature curing polyuretdione compositions |
| DE102010031682A1 (de) | 2010-07-20 | 2012-01-26 | Bayer Materialscience Ag | Bindemittelkombinationen für konstruktive Trinkwasserrohrbeschichtungen |
| EP2415879A1 (de) | 2010-08-06 | 2012-02-08 | LANXESS Deutschland GmbH | Zusammensetzungen enthaltend wenigstens eine Carbamoylsulfonatgruppen-haltige Verbindung und ihre Verwendung als Gerbstoffe |
| EP2508626A1 (de) | 2011-04-04 | 2012-10-10 | LANXESS Deutschland GmbH | Feste, partikuläre Gerbstoffpräparationen |
| EP2508627A1 (de) | 2011-04-04 | 2012-10-10 | LANXESS Deutschland GmbH | Festes, partikuläres Material auf Basis Carbamoylsulfonatgruppen-haltiger Verbindungen |
| EP2540753A1 (de) | 2011-06-29 | 2013-01-02 | LANXESS Deutschland GmbH | Zusammensetzung auf Basis Carbamoylsulfonatgruppen-haltiger Verbindungen |
| US8354151B1 (en) | 2011-07-06 | 2013-01-15 | Bayer Materialscience Llc | Waterborne polyurethane coating compositions |
| WO2013006606A2 (en) | 2011-07-06 | 2013-01-10 | Bayer Materialscience Llc | Free radical curable waterborne glass coating compositions |
| US8343601B1 (en) | 2011-07-06 | 2013-01-01 | Bayer Materialscience Llc | Waterborne polyurethane coating compositions |
| EP2557181A1 (de) | 2011-08-12 | 2013-02-13 | LANXESS Deutschland GmbH | Verfahren zum Hydrophobieren von collagenfaserhaltigen Substraten |
| EP2557224A1 (de) | 2011-08-12 | 2013-02-13 | LANXESS Deutschland GmbH | Verfahren zum Färben von collagenfaserhaltigen Substraten |
| DE102011088149A1 (de) | 2011-12-09 | 2013-06-13 | Evonik Industries Ag | Beschichteter Verbundkörper, umfassend ein Verbundmaterial |
| US20140199491A1 (en) | 2013-01-15 | 2014-07-17 | Allnex Ip S.À.R.L. | One-component, dual-cure conformal coating compositions |
| CN106661174A (zh) | 2014-08-22 | 2017-05-10 | 科思创有限公司 | 使用多腔模具的模内涂覆方法和由此涂覆的基材 |
| EP3118234A1 (en) | 2015-07-15 | 2017-01-18 | ALLNEX AUSTRIA GmbH | Coating compositions |
| US20200061875A1 (en) | 2017-04-07 | 2020-02-27 | Covestro Llc | Processes for in-mold coating of polymer substrates |
| KR20190141668A (ko) | 2017-04-19 | 2019-12-24 | 코베스트로 엘엘씨 | 반사 코팅 및 중합체 기재로의 그의 적용을 위한 금형내 방법 |
| CN112409215A (zh) * | 2020-11-16 | 2021-02-26 | 中海油常州涂料化工研究院有限公司 | 采用微通道反应器合成缩二脲多异氰酸酯的方法及其应用 |
| WO2025174788A1 (en) | 2024-02-13 | 2025-08-21 | Covestro Llc | Insert molding and in-mold coating over substrates with pressure sensitive elements |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL238495A (enExample) * | 1958-04-24 | |||
| DE1090196B (de) * | 1959-07-15 | 1960-10-06 | Bayer Ag | Verfahren zur Herstellung von physiologisch unbedenklichen Mono- oder Polyisocyanaten mit geringem Dampfdruck |
| BE600268A (fr) * | 1960-06-13 | 1961-06-16 | Teves Kg Alfred | Machine rotative à ailettes. |
| GB994890A (en) * | 1961-12-18 | 1965-06-10 | Ici Ltd | New organic polyisocyanates and their manufacture |
| NL294647A (enExample) * | 1962-06-27 | |||
| BE637578A (enExample) * | 1962-09-19 | |||
| DE1227003B (de) * | 1962-11-29 | 1966-10-20 | Bayer Ag | Verfahren zur Herstellung von Polyisocyanaten mit Carbamylbiuret-Struktur |
| DE1174759B (de) * | 1963-02-08 | 1964-07-30 | Bayer Ag | Verfahren zur Herstellung von Polyisocyanaten mit Biuretstruktur |
| DE1174760B (de) * | 1963-02-18 | 1964-07-30 | Bayer Ag | Verfahren zur Herstellung von Polyisocyanaten mit Biuret-Struktur |
| DE1227004B (de) * | 1963-04-13 | 1966-10-20 | Bayer Ag | Verfahren zur Herstellung von mehr als zweiwertigen Isocyanaten mit Biuretstruktur- bzw. Carbamylbiuretstruktur |
| US3124605A (en) * | 1963-12-05 | 1964-03-10 | Biuret polyisocyanates | |
| US3358010A (en) * | 1964-03-11 | 1967-12-12 | Mobay Chemical Corp | Biuret polyisocyanates |
| FR1480911A (fr) * | 1965-05-24 | 1967-05-12 | Bayer Ag | Procédé de préparation de polyisocyanates d'urées acylés |
| DE1230778B (de) * | 1965-05-24 | 1966-12-22 | Bayer Ag | Verfahren zur Herstellung von acylierten Harnstoffpolyisocyanaten |
| DE2308015B2 (de) * | 1973-02-17 | 1980-07-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Polyisocyanaten mit Biuretstruktur |
-
1973
- 1973-02-17 DE DE2308015A patent/DE2308015B2/de not_active Ceased
-
1974
- 1974-02-08 CA CA192,254A patent/CA1024990A/en not_active Expired
- 1974-02-12 US US441778A patent/US3903127A/en not_active Expired - Lifetime
- 1974-02-14 DD DD176554A patent/DD112462A5/xx unknown
- 1974-02-14 CH CH204074A patent/CH585704A5/xx not_active IP Right Cessation
- 1974-02-14 SE SE7401968A patent/SE419541B/xx unknown
- 1974-02-15 HU HUBA3028A patent/HU168360B/hu unknown
- 1974-02-15 BR BR1136/74A patent/BR7401136D0/pt unknown
- 1974-02-15 GB GB698174A patent/GB1441882A/en not_active Expired
- 1974-02-15 AT AT122174A patent/AT337200B/de not_active IP Right Cessation
- 1974-02-15 IT IT48395/74A patent/IT1002953B/it active
- 1974-02-15 LU LU69395A patent/LU69395A1/xx unknown
- 1974-02-15 FR FR7405245A patent/FR2218357B1/fr not_active Expired
- 1974-02-15 NL NLAANVRAGE7402141,A patent/NL179727C/xx not_active IP Right Cessation
- 1974-02-15 BE BE140945A patent/BE811074A/xx unknown
- 1974-02-15 SU SU1999878A patent/SU505353A3/ru active
- 1974-02-16 PL PL1974168851A patent/PL92999B1/pl unknown
- 1974-02-16 JP JP49018159A patent/JPS49134629A/ja active Pending
- 1974-02-16 ES ES423324A patent/ES423324A1/es not_active Expired
- 1974-02-18 CS CS1165A patent/CS174126B2/cs unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SU505353A3 (ru) | 1976-02-28 |
| DE2308015A1 (de) | 1974-09-12 |
| US3903127A (en) | 1975-09-02 |
| AT337200B (de) | 1977-06-10 |
| PL92999B1 (enExample) | 1977-04-30 |
| LU69395A1 (enExample) | 1974-10-01 |
| CH585704A5 (enExample) | 1977-03-15 |
| AU6550474A (en) | 1975-08-14 |
| DD112462A5 (enExample) | 1975-04-12 |
| JPS49134629A (enExample) | 1974-12-25 |
| HU168360B (en) | 1976-04-28 |
| GB1441882A (en) | 1976-07-07 |
| BE811074A (fr) | 1974-08-16 |
| NL7402141A (enExample) | 1974-08-20 |
| CS174126B2 (enExample) | 1977-03-31 |
| SE419541B (sv) | 1981-08-10 |
| FR2218357B1 (enExample) | 1977-09-30 |
| FR2218357A1 (enExample) | 1974-09-13 |
| CA1024990A (en) | 1978-01-24 |
| US3903127B1 (enExample) | 1985-05-28 |
| NL179727C (nl) | 1986-11-03 |
| ATA122174A (de) | 1976-10-15 |
| NL179727B (nl) | 1986-06-02 |
| ES423324A1 (es) | 1976-04-16 |
| BR7401136D0 (pt) | 1974-11-19 |
| IT1002953B (it) | 1976-05-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2308015B2 (de) | Verfahren zur Herstellung von Polyisocyanaten mit Biuretstruktur | |
| EP0000348B1 (de) | Polyuret-Polyisocyanate, Verfahren zu deren Herstellung, sowie deren Verwendung bei der Herstellung von Polyurethankunststoffen. | |
| EP0013880B1 (de) | Neue Isocyanato-isocyanurate, ein Verfahren zu ihrer Herstellung sowie ihre Verwendung als Isocyanatkomponente in Polyurethan-Lacken | |
| EP0000016B1 (de) | Verfahren zur Herstellung von Allophanatgruppen aufweisenden Polyisocyanaten und ihre Verwendung als Aufbaukomponente | |
| EP0712840B1 (de) | Allophanatgruppen aufweisende Polyisocyanate | |
| DE69116599T2 (de) | Polyisocyanatoisocyanurat, Verfahren zu seiner Herstellung und seine Verwendung | |
| EP0010589A1 (de) | Verfahren zur Herstellung von Isocyanuratgruppen aufweisenden Polyisocyanaten und ihre Verwendung als Isocyanatkomponente in Polyurethanlacken | |
| DE1174759B (de) | Verfahren zur Herstellung von Polyisocyanaten mit Biuretstruktur | |
| DE2612783C3 (de) | Biurete, Verfahren zu ihrer Herstellung und deren Verwendung | |
| EP0010248A1 (de) | Isocyanatgemisch und seine Verwendung als Bindemittel in Einkomponenten-Lacken | |
| EP0193828B1 (de) | Isocyanuratgruppen aufweisende Polyisocyanate, ein Verfahren zu ihrer Herstellung und ihre Verwendung als Isocyanatkomponente in Polyurethanlacken | |
| DE2325825A1 (de) | Hochvernetzte, licht- und lagerstabile polyurethandispersionen | |
| EP0012973B1 (de) | Verfahren zur Herstellung von Biuret- und/oder höhere Polyuretgruppen aufweisenden Polyisocyanaten, die nach diesem Verfahren erhältlichen Verbindungen, sowie ihre Verwendung als Aufbaukomponente bei der Herstellung von Polyurethankunststoffen | |
| DE2342603C3 (de) | Verfahren zur Herstellung von Malonsäuredialkylesterblockierten Biuretpolyisocyanaten sowie deren Verwendung | |
| EP0406604B1 (de) | Verfahren zur Herstellung eines Beschichtungsmittels | |
| DE1227004B (de) | Verfahren zur Herstellung von mehr als zweiwertigen Isocyanaten mit Biuretstruktur- bzw. Carbamylbiuretstruktur | |
| DE3133865C2 (de) | Verfahren zur Herstellung einer organischen Polyisocyanat-Zusammensetzung sowie deren Verwendung | |
| EP0465900A1 (de) | Im wesentlichen aus Bisoxazolanen bestehende Oxazolangemische, ein Verfahren zu deren Herstellung und ihre Verwendung als Härter für Isocyanatgruppen aufweisende Kunststoffvorläufer | |
| EP0012970B1 (de) | Neue Polyisocyanate, ein Verfahren zu ihrer Herstellung und ihre Verwendung | |
| EP0183150B1 (de) | Verfahren zur Herstellung von modifizierten Polyisocyanaten und ihre Verwendung in Polyurethananlacken | |
| DE2654745A1 (de) | Verfahren zur herstellung von biuretgruppen aufweisenden polyisocyanaten | |
| DE2619548A1 (de) | Verfahren zur herstellung von biuretgruppen aufweisenden polyisocyanaten | |
| DE2437130A1 (de) | Gegen monomerenrueckspaltung stabilisiertes biuretpolyisocyanat-gemisch | |
| EP0162347B1 (de) | Neue cycloaliphatische Triisocyanate, ein Verfahren zu ihrer Herstellung und ihre Verwendung bei der Herstellung von Polyurethankunststoffen | |
| EP0082973B1 (de) | Neue biuretgruppenhaltige Polyisocyanate sowie ein Verfahren zu deren Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8235 | Patent refused |