DE2265666C2 - Pleuromutilin-Derivate, deren Herstellung und pharmazeutische Zubereitung - Google Patents
Pleuromutilin-Derivate, deren Herstellung und pharmazeutische ZubereitungInfo
- Publication number
- DE2265666C2 DE2265666C2 DE2265666A DE2265666A DE2265666C2 DE 2265666 C2 DE2265666 C2 DE 2265666C2 DE 2265666 A DE2265666 A DE 2265666A DE 2265666 A DE2265666 A DE 2265666A DE 2265666 C2 DE2265666 C2 DE 2265666C2
- Authority
- DE
- Germany
- Prior art keywords
- formula
- alkyl
- compound
- nitrogen atom
- above meaning
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000004519 manufacturing process Methods 0.000 title claims description 7
- ZRZNJUXESFHSIO-VYTKZBNOSA-N pleuromutilin Chemical class C([C@H]([C@]1(C)[C@@H](C[C@@](C)(C=C)[C@@H](O)[C@@H]2C)OC(=O)CO)C)C[C@]32[C@H]1C(=O)CC3 ZRZNJUXESFHSIO-VYTKZBNOSA-N 0.000 title claims description 4
- 239000000825 pharmaceutical preparation Substances 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims description 33
- 238000000034 method Methods 0.000 claims description 21
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 17
- 150000003839 salts Chemical class 0.000 claims description 16
- 239000002253 acid Substances 0.000 claims description 14
- 229910052757 nitrogen Inorganic materials 0.000 claims description 11
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 239000001301 oxygen Substances 0.000 claims description 6
- 229910052717 sulfur Inorganic materials 0.000 claims description 6
- 239000011593 sulfur Substances 0.000 claims description 6
- 125000000623 heterocyclic group Chemical group 0.000 claims description 5
- 125000005842 heteroatom Chemical group 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 2
- 229920002554 vinyl polymer Polymers 0.000 claims description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 33
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- 239000000243 solution Substances 0.000 description 15
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- -1 bromoformyl Chemical group 0.000 description 12
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 11
- 239000000126 substance Substances 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 230000002401 inhibitory effect Effects 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 239000012442 inert solvent Substances 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- RXKJFZQQPQGTFL-UHFFFAOYSA-N dihydroxyacetone Chemical compound OCC(=O)CO RXKJFZQQPQGTFL-UHFFFAOYSA-N 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 125000000872 2-diethylaminoethoxy group Chemical group [H]C([H])([H])C([H])([H])N(C([H])([H])C([H])([H])[H])C([H])([H])C([H])([H])O* 0.000 description 2
- LQLJZSJKRYTKTP-UHFFFAOYSA-N 2-dimethylaminoethyl chloride hydrochloride Chemical compound Cl.CN(C)CCCl LQLJZSJKRYTKTP-UHFFFAOYSA-N 0.000 description 2
- 229920001817 Agar Polymers 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 239000008272 agar Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- XMEVHPAGJVLHIG-FMZCEJRJSA-N chembl454950 Chemical compound [Cl-].C1=CC=C2[C@](O)(C)[C@H]3C[C@H]4[C@H]([NH+](C)C)C(O)=C(C(N)=O)C(=O)[C@@]4(O)C(O)=C3C(=O)C2=C1O XMEVHPAGJVLHIG-FMZCEJRJSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000013207 serial dilution Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical compound [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 2
- 229960004989 tetracycline hydrochloride Drugs 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- RAGSWDIQBBZLLL-UHFFFAOYSA-N 2-chloroethyl(diethyl)azanium;chloride Chemical compound Cl.CCN(CC)CCCl RAGSWDIQBBZLLL-UHFFFAOYSA-N 0.000 description 1
- VMKYTRPNOVFCGZ-UHFFFAOYSA-N 2-sulfanylphenol Chemical compound OC1=CC=CC=C1S VMKYTRPNOVFCGZ-UHFFFAOYSA-N 0.000 description 1
- LJQNMDZRCXJETK-UHFFFAOYSA-N 3-chloro-n,n-dimethylpropan-1-amine;hydron;chloride Chemical compound Cl.CN(C)CCCCl LJQNMDZRCXJETK-UHFFFAOYSA-N 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 238000000023 Kugelrohr distillation Methods 0.000 description 1
- 206010023567 Labyrinthitis Diseases 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 241000204031 Mycoplasma Species 0.000 description 1
- 241000204022 Mycoplasma gallisepticum Species 0.000 description 1
- 241000204048 Mycoplasma hominis Species 0.000 description 1
- 241000204003 Mycoplasmatales Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- BELBBZDIHDAJOR-UHFFFAOYSA-N Phenolsulfonephthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2S(=O)(=O)O1 BELBBZDIHDAJOR-UHFFFAOYSA-N 0.000 description 1
- OBUUFWIMEGVAQS-UHFFFAOYSA-N Pleuromutenol Natural products CC1C(O)C(C)(C=C)CC(O)C2(C)C(C)CCC31C2C(=O)CC3 OBUUFWIMEGVAQS-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- DSVGQVZAZSZEEX-UHFFFAOYSA-N [C].[Pt] Chemical compound [C].[Pt] DSVGQVZAZSZEEX-UHFFFAOYSA-N 0.000 description 1
- ZXPSRPAUXQIYID-UHFFFAOYSA-N [N].[Na] Chemical compound [N].[Na] ZXPSRPAUXQIYID-UHFFFAOYSA-N 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 125000005041 acyloxyalkyl group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000000845 anti-microbial effect Effects 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 244000052616 bacterial pathogen Species 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000036765 blood level Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- RTOIPDPHQXGIRG-JKZASVEESA-N dihydropleuromutilin Chemical compound C[C@H]1[C@H](O)[C@@](CC)(C)C[C@@H](OC(=O)CO)C2(C)[C@H](C)CCC31CCC(=O)[C@H]32 RTOIPDPHQXGIRG-JKZASVEESA-N 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000003651 drinking water Substances 0.000 description 1
- 235000020188 drinking water Nutrition 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 229960003531 phenolsulfonphthalein Drugs 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000012746 preparative thin layer chromatography Methods 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 229960002771 retapamulin Drugs 0.000 description 1
- STZYTFJPGGDRJD-NHUWBDDWSA-N retapamulin Chemical compound C([C@H]([C@@]1(C)[C@@H](C[C@@](C)(C=C)[C@@H](O)[C@@H]2C)OC(=O)CS[C@@H]3C[C@H]4CC[C@H](N4C)C3)C)C[C@]32[C@H]1C(=O)CC3 STZYTFJPGGDRJD-NHUWBDDWSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Substances SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/50—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton
- C07C323/51—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton
- C07C323/57—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being further substituted by nitrogen atoms, not being part of nitro or nitroso groups
- C07C323/58—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being further substituted by nitrogen atoms, not being part of nitro or nitroso groups with amino groups bound to the carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1445171A CH559719A5 (en) | 1971-10-05 | 1971-10-05 | Pleuromutilin derivs - with antibacterial activity |
| CH1445071A CH560180A5 (en) | 1971-10-05 | 1971-10-05 | Pleuromutilin derivs - with antibacterial activity |
| CH773972A CH568272A5 (en) | 1972-05-25 | 1972-05-25 | (Para-substd phenoxy- or phenylthio-acetoxy)-pleuromutilin deriv - prepd by reacting para-hydroxy or-mercapto cpds with e.g. aminoalkyl halides |
| CH774072A CH575375A5 (Direct) | 1972-05-25 | 1972-05-25 | |
| CH773872A CH572893A5 (en) | 1972-05-25 | 1972-05-25 | Pleuromutilin derivs - with antibacterial activity |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2265666C2 true DE2265666C2 (de) | 1983-02-03 |
Family
ID=27509313
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2265666A Expired DE2265666C2 (de) | 1971-10-05 | 1972-10-02 | Pleuromutilin-Derivate, deren Herstellung und pharmazeutische Zubereitung |
| DE2248237A Expired DE2248237C2 (de) | 1971-10-05 | 1972-10-02 | Pleuromutilin-Derivate, deren Herstellung und pharmazeutische Zubereitung |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2248237A Expired DE2248237C2 (de) | 1971-10-05 | 1972-10-02 | Pleuromutilin-Derivate, deren Herstellung und pharmazeutische Zubereitung |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4278674A (Direct) |
| JP (1) | JPS577147B2 (Direct) |
| BE (1) | BE789629A (Direct) |
| BG (2) | BG21386A3 (Direct) |
| CA (1) | CA979447A (Direct) |
| DD (1) | DD100706A5 (Direct) |
| DE (2) | DE2265666C2 (Direct) |
| DK (1) | DK139720B (Direct) |
| FI (1) | FI58635C (Direct) |
| FR (1) | FR2157828B1 (Direct) |
| GB (1) | GB1410505A (Direct) |
| HU (1) | HU168436B (Direct) |
| IE (1) | IE37699B1 (Direct) |
| IL (1) | IL40494A (Direct) |
| NL (1) | NL177403C (Direct) |
| NO (3) | NO136459C (Direct) |
| OA (1) | OA04192A (Direct) |
| PH (1) | PH11870A (Direct) |
| RO (2) | RO67478A (Direct) |
| SE (3) | SE398348B (Direct) |
Families Citing this family (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3987194A (en) * | 1975-05-12 | 1976-10-19 | E. R. Squibb & Sons, Inc. | Use of pleuromutilin derivatives for the treatment of swine dysentery |
| DE2823712C2 (de) | 1978-05-31 | 1987-04-09 | Sandoz-Patent-GmbH, 7850 Lörrach | Verfahren zur Herstellung von Pleuromutilin-Derivaten |
| FR2428030A1 (fr) * | 1978-06-06 | 1980-01-04 | Sandoz Sa | Procede de preparation de derives de la pleuromutiline |
| JPS56168463A (en) * | 1980-05-30 | 1981-12-24 | Iwao Koyama | Telephone set |
| LU82738A1 (fr) * | 1980-08-29 | 1982-05-10 | Continental Pharma | Derives d'aminothiols,leur preparation et utilisation ainsi que compositions contenant ces derives |
| JPS60121870A (ja) * | 1983-12-06 | 1985-06-29 | Matsushita Electric Ind Co Ltd | インタ−ホン装置 |
| JPS62137952A (ja) * | 1985-12-12 | 1987-06-20 | Sakuragi Kunio | 電話機 |
| JPH01105238U (Direct) * | 1988-01-05 | 1989-07-14 | ||
| ES2205072T3 (es) * | 1996-01-03 | 2004-05-01 | Smithkline Beecham Plc | Derivados carbamoiloxi de mutilina y su uso como agentes antibacterianos. |
| FR2746012B1 (fr) * | 1996-03-13 | 1998-05-22 | Utilisation de la tiamuline pour la preparation d'un medicament comme agent de reversion de la multichimioresistance cancereuse | |
| UY25225A1 (es) * | 1997-10-29 | 2000-12-29 | Smithkline Beecham Plc | Derivados de pleuromutilina utiles como agentes antimicrobianos |
| WO2000027790A1 (en) * | 1998-11-11 | 2000-05-18 | Smithkline Beecham P.L.C. | Mutilin compounds |
| AU3036200A (en) * | 1998-12-18 | 2000-07-12 | Smithkline Beecham Plc | Mutilin 14-ester derivatives having antibacterial activity |
| GB9912657D0 (en) * | 1999-06-01 | 1999-07-28 | Smithkline Beecham Plc | Novel compounds |
| GB9918037D0 (en) * | 1999-07-30 | 1999-09-29 | Biochemie Gmbh | Organic compounds |
| GB0017031D0 (en) * | 2000-07-11 | 2000-08-30 | Biochemie Gmbh | Antimicrobials |
| PE20020676A1 (es) * | 2000-09-13 | 2002-08-27 | Biochemie Gmbh | Compuestos de mutilina como antibacterianos |
| GB0207495D0 (en) * | 2002-03-28 | 2002-05-08 | Biochemie Gmbh | Organic compounds |
| GB0308114D0 (en) * | 2003-04-08 | 2003-05-14 | Glaxo Group Ltd | Novel compounds |
| DE602004024417D1 (de) * | 2003-09-03 | 2010-01-14 | Glaxo Group Ltd | Neues verfahren zur herstellung von pleuromutilinderivaten |
| GB0504314D0 (en) * | 2005-03-02 | 2005-04-06 | Glaxo Group Ltd | Novel polymorph |
| EP1860943A4 (en) * | 2005-03-10 | 2008-06-18 | Smithkline Beecham Corp | NOVEL PROCEDURE |
| GB0513058D0 (en) * | 2005-06-27 | 2005-08-03 | Sandoz Ag | Organic compounds |
| EP1808431A1 (en) * | 2006-01-16 | 2007-07-18 | Nabriva Therapeutics Forschungs GmbH | Mutilin derivatives and their use as pharmaceutical |
| WO2008117796A1 (ja) * | 2007-03-28 | 2008-10-02 | Dainippon Sumitomo Pharma Co., Ltd. | 新規ムチリン誘導体 |
| CN101434567B (zh) * | 2008-12-19 | 2012-10-24 | 李扬 | 一种二乙氨基乙硫醇的制备方法 |
| CN103709115A (zh) * | 2012-10-09 | 2014-04-09 | 山东亨利医药科技有限责任公司 | 截短侧耳素类抗生素衍生物 |
| KR101745225B1 (ko) | 2012-12-03 | 2017-06-08 | 화이자 인코포레이티드 | 선택적인 안드로겐 수용체 조절인자 |
| CN104447449B (zh) * | 2014-12-30 | 2016-06-15 | 陕西师范大学 | 一锅法合成泰妙菌素的方法 |
| CN110981769B (zh) * | 2019-12-19 | 2022-02-18 | 江苏威凌生化科技有限公司 | 一种制备泰秒菌素的方法 |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7010444A (Direct) * | 1969-07-25 | 1971-01-27 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4107164A (en) * | 1971-10-05 | 1978-08-15 | Sandoz Ltd. | Certain pleuromulilin ester derivatives |
| US4032530A (en) * | 1971-10-05 | 1977-06-28 | Sandoz Ltd. | Certain pleuromutilins |
| US3919290A (en) * | 1972-10-03 | 1975-11-11 | Sandoz Ltd | Substituted 14-desoxy-mutilins |
-
0
- BE BE789629D patent/BE789629A/xx not_active IP Right Cessation
-
1972
- 1972-09-26 SE SE7212374A patent/SE398348B/xx unknown
- 1972-09-26 DK DK475372AA patent/DK139720B/da not_active IP Right Cessation
- 1972-09-26 FI FI2645/72A patent/FI58635C/fi active
- 1972-09-27 NO NO3453/72A patent/NO136459C/no unknown
- 1972-09-29 PH PH13949A patent/PH11870A/en unknown
- 1972-09-29 NL NLAANVRAGE7213254,A patent/NL177403C/xx not_active IP Right Cessation
- 1972-10-02 DE DE2265666A patent/DE2265666C2/de not_active Expired
- 1972-10-02 DE DE2248237A patent/DE2248237C2/de not_active Expired
- 1972-10-02 GB GB4525972A patent/GB1410505A/en not_active Expired
- 1972-10-03 IE IE1339/72A patent/IE37699B1/xx unknown
- 1972-10-03 RO RO7281505A patent/RO67478A/ro unknown
- 1972-10-03 CA CA153,116A patent/CA979447A/en not_active Expired
- 1972-10-03 RO RO7281506A patent/RO67479A/ro unknown
- 1972-10-03 HU HUSA2407A patent/HU168436B/hu unknown
- 1972-10-04 BG BG023481A patent/BG21386A3/xx unknown
- 1972-10-04 BG BG023482A patent/BG20773A3/xx unknown
- 1972-10-04 OA OA54711A patent/OA04192A/xx unknown
- 1972-10-04 IL IL40494A patent/IL40494A/en unknown
- 1972-10-04 JP JP9913872A patent/JPS577147B2/ja not_active Expired
- 1972-10-05 FR FR7235340A patent/FR2157828B1/fr not_active Expired
- 1972-10-05 DD DD166051A patent/DD100706A5/xx unknown
-
1973
- 1973-12-04 NO NO4618/73A patent/NO137440C/no unknown
- 1973-12-04 NO NO4617/73A patent/NO136837C/no unknown
-
1975
- 1975-08-26 SE SE7509456A patent/SE424074B/xx unknown
- 1975-08-26 SE SE7509457A patent/SE419984B/xx unknown
-
1979
- 1979-11-29 US US06/098,333 patent/US4278674A/en not_active Expired - Lifetime
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7010444A (Direct) * | 1969-07-25 | 1971-01-27 |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2265666C2 (de) | Pleuromutilin-Derivate, deren Herstellung und pharmazeutische Zubereitung | |
| CH637398A5 (de) | Verfahren zur herstellung von maytansinoidverbindungen. | |
| CH648037A5 (de) | Imidazo-rifamycin-derivate mit antibakterieller wirksamkeit. | |
| DE3007006C2 (de) | Chinoloncarbonsäurederivate, deren Salze, Verfahren zu deren Herstellung und diese Derivate enthaltende Mittel | |
| CH649300A5 (de) | Ergopeptinderivate, ihre herstellung und verwendung. | |
| CH639096A5 (en) | Cephalosporin derivatives, process for their preparation and pharmaceutical preparations containing them | |
| DD202151A5 (de) | Verfahren zur herstellung von piroxicam | |
| DE2455353A1 (de) | Substituierte alpha-aminooxycarbonsaeurehydrazidderivate und ihre saeureadditionssalze sowie ihre verwendung und verfahren zur herstellung derselben | |
| EP0285681B1 (de) | Verfahren zur Herstellung von Nitroethenderivaten | |
| DE3132475C2 (Direct) | ||
| CH630061A5 (en) | Process for the preparation of an antibiotic derivative | |
| EP0211157B1 (de) | Isoxazolderivate, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutischen Präparate | |
| DE1804983A1 (de) | Verfahren zur Herstellung von Cephalosporansaeurederivaten | |
| DE2713586A1 (de) | Neue organische verbindungen, verfahren zu ihrer herstellung und ihre verwendung | |
| CH630903A5 (en) | Process for preparing novel derivatives of 1,2,3,4,4a,10b-hexahydrobenzo(f)isoquinoline. | |
| DD253616A5 (de) | Verfahren zur herstellung von neuen pleunromutilinderivaten | |
| CH648320A5 (de) | Cytostatische verbindungen, verfahren zu ihrer herstellung sowie diese verbindungen enthaltende arzneimittel. | |
| DE2500692C3 (de) | Derivate des 4-Amidoalkylen-4'oxy diphenyle | |
| DE2455432A1 (de) | Substituierte alpha-aminooxyhydroxamsaeurederivate sowie ihre verwendung und verfahren zur herstellung derselben | |
| DD292256A5 (de) | Verfahren zur herstellung von benzoxazolinonen | |
| DE102004005106A1 (de) | Sorbifuranone, Sorbivineton, Sorbivinetol und Derivate dieser Verbindungen, Verfahren zu ihrer Herstellung, sie enthaltende Arzneimittel und deren Verwendung | |
| DE2821189A1 (de) | Coriolinderivate, deren herstellung und diese enthaltende pharmazeutische praeparate | |
| CH560180A5 (en) | Pleuromutilin derivs - with antibacterial activity | |
| AT360159B (de) | Verfahren zur herstellung von neuen 4''-amino- -oleandomycinen | |
| DE2508251A1 (de) | Neue derivate des indols, verfahren zu deren herstellung sowie diese enthaltende arzneimittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OI | Miscellaneous see part 1 | ||
| OI | Miscellaneous see part 1 | ||
| OD | Request for examination | ||
| AC | Divided out of |
Ref country code: DE Ref document number: 2248237 Format of ref document f/p: P |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |