DE2244080A1 - Verfahren und vorrichtung zur durchfuehrung von chemischen und/oder biologischen reaktionen - Google Patents
Verfahren und vorrichtung zur durchfuehrung von chemischen und/oder biologischen reaktionenInfo
- Publication number
- DE2244080A1 DE2244080A1 DE2244080A DE2244080A DE2244080A1 DE 2244080 A1 DE2244080 A1 DE 2244080A1 DE 2244080 A DE2244080 A DE 2244080A DE 2244080 A DE2244080 A DE 2244080A DE 2244080 A1 DE2244080 A1 DE 2244080A1
- Authority
- DE
- Germany
- Prior art keywords
- antigen
- antibody
- die plate
- container
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 238000006243 chemical reaction Methods 0.000 title claims description 62
- 239000000126 substance Substances 0.000 title claims description 13
- 238000000034 method Methods 0.000 title claims description 7
- 239000000427 antigen Substances 0.000 claims description 44
- 102000036639 antigens Human genes 0.000 claims description 44
- 108091007433 antigens Proteins 0.000 claims description 44
- 239000007788 liquid Substances 0.000 claims description 40
- 239000000463 material Substances 0.000 claims description 32
- 239000002250 absorbent Substances 0.000 claims description 10
- 230000002745 absorbent Effects 0.000 claims description 10
- 239000000376 reactant Substances 0.000 claims description 10
- 239000011159 matrix material Substances 0.000 claims description 9
- 230000002285 radioactive effect Effects 0.000 claims description 9
- 239000000835 fiber Substances 0.000 claims description 7
- 239000000706 filtrate Substances 0.000 claims description 5
- 230000000717 retained effect Effects 0.000 claims description 5
- 108010088751 Albumins Proteins 0.000 claims description 4
- 102000009027 Albumins Human genes 0.000 claims description 4
- 238000010521 absorption reaction Methods 0.000 claims description 4
- 239000007795 chemical reaction product Substances 0.000 claims description 4
- 239000011248 coating agent Substances 0.000 claims description 4
- 238000000576 coating method Methods 0.000 claims description 4
- 238000001914 filtration Methods 0.000 claims description 4
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 claims description 4
- 229910052740 iodine Inorganic materials 0.000 claims description 4
- 239000000872 buffer Substances 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- 102000018997 Growth Hormone Human genes 0.000 claims description 2
- 108010051696 Growth Hormone Proteins 0.000 claims description 2
- 102000004877 Insulin Human genes 0.000 claims description 2
- 108090001061 Insulin Proteins 0.000 claims description 2
- 230000000274 adsorptive effect Effects 0.000 claims description 2
- 238000004891 communication Methods 0.000 claims description 2
- 239000000122 growth hormone Substances 0.000 claims description 2
- 229940125396 insulin Drugs 0.000 claims description 2
- 239000011630 iodine Substances 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims 2
- 239000000203 mixture Substances 0.000 claims 1
- 238000000163 radioactive labelling Methods 0.000 claims 1
- 239000000941 radioactive substance Substances 0.000 claims 1
- 239000003446 ligand Substances 0.000 description 15
- 239000003153 chemical reaction reagent Substances 0.000 description 11
- 238000001179 sorption measurement Methods 0.000 description 8
- LTMHDMANZUZIPE-PUGKRICDSA-N digoxin Chemical compound C1[C@H](O)[C@H](O)[C@@H](C)O[C@H]1O[C@@H]1[C@@H](C)O[C@@H](O[C@@H]2[C@H](O[C@@H](O[C@@H]3C[C@@H]4[C@]([C@@H]5[C@H]([C@]6(CC[C@@H]([C@@]6(C)[C@H](O)C5)C=5COC(=O)C=5)O)CC4)(C)CC3)C[C@@H]2O)C)C[C@@H]1O LTMHDMANZUZIPE-PUGKRICDSA-N 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- LTMHDMANZUZIPE-AMTYYWEZSA-N Digoxin Natural products O([C@H]1[C@H](C)O[C@H](O[C@@H]2C[C@@H]3[C@@](C)([C@@H]4[C@H]([C@]5(O)[C@](C)([C@H](O)C4)[C@H](C4=CC(=O)OC4)CC5)CC3)CC2)C[C@@H]1O)[C@H]1O[C@H](C)[C@@H](O[C@H]2O[C@@H](C)[C@H](O)[C@@H](O)C2)[C@@H](O)C1 LTMHDMANZUZIPE-AMTYYWEZSA-N 0.000 description 5
- 229960005156 digoxin Drugs 0.000 description 5
- LTMHDMANZUZIPE-UHFFFAOYSA-N digoxine Natural products C1C(O)C(O)C(C)OC1OC1C(C)OC(OC2C(OC(OC3CC4C(C5C(C6(CCC(C6(C)C(O)C5)C=5COC(=O)C=5)O)CC4)(C)CC3)CC2O)C)CC1O LTMHDMANZUZIPE-UHFFFAOYSA-N 0.000 description 5
- 239000004033 plastic Substances 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- 239000003463 adsorbent Substances 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 229920002678 cellulose Polymers 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 238000004108 freeze drying Methods 0.000 description 3
- 239000012133 immunoprecipitate Substances 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000003365 glass fiber Substances 0.000 description 2
- 230000005484 gravity Effects 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- 238000011835 investigation Methods 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 239000000123 paper Substances 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 239000011148 porous material Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 239000000700 radioactive tracer Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 210000002966 serum Anatomy 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 1
- 241000283074 Equus asinus Species 0.000 description 1
- 102000006395 Globulins Human genes 0.000 description 1
- 108010044091 Globulins Proteins 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000012888 bovine serum Substances 0.000 description 1
- 241001233037 catfish Species 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229920002521 macromolecule Polymers 0.000 description 1
- 239000003550 marker Substances 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- QYSGYZVSCZSLHT-UHFFFAOYSA-N octafluoropropane Chemical compound FC(F)(F)C(F)(F)C(F)(F)F QYSGYZVSCZSLHT-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 229920001184 polypeptide Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000012087 reference standard solution Substances 0.000 description 1
- 230000009870 specific binding Effects 0.000 description 1
- 150000003431 steroids Chemical class 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
Classifications
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01T—MEASUREMENT OF NUCLEAR OR X-RADIATION
- G01T7/00—Details of radiation-measuring instruments
- G01T7/02—Collecting means for receiving or storing samples to be investigated and possibly directly transporting the samples to the measuring arrangement; particularly for investigating radioactive fluids
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S436/00—Chemistry: analytical and immunological testing
- Y10S436/804—Radioisotope, e.g. radioimmunoassay
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S436/00—Chemistry: analytical and immunological testing
- Y10S436/815—Test for named compound or class of compounds
- Y10S436/817—Steroids or hormones
Landscapes
- Chemical & Material Sciences (AREA)
- Analytical Chemistry (AREA)
- Physics & Mathematics (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Physics & Mathematics (AREA)
- High Energy & Nuclear Physics (AREA)
- Molecular Biology (AREA)
- Spectroscopy & Molecular Physics (AREA)
- Investigating Or Analysing Biological Materials (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB4197271A GB1420916A (en) | 1971-09-08 | 1971-09-08 | Performance of chemical or biological reactions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2244080A1 true DE2244080A1 (de) | 1973-03-15 |
Family
ID=10422244
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2244080A Ceased DE2244080A1 (de) | 1971-09-08 | 1972-09-08 | Verfahren und vorrichtung zur durchfuehrung von chemischen und/oder biologischen reaktionen |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3888629A (enExample) |
| JP (1) | JPS595863B2 (enExample) |
| CA (1) | CA983358A (enExample) |
| CH (1) | CH575122A5 (enExample) |
| DE (1) | DE2244080A1 (enExample) |
| IT (1) | IT1006557B (enExample) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3137014A1 (de) * | 1981-09-17 | 1983-03-24 | Merck Patent Gmbh, 6100 Darmstadt | "testsystem und verfahren zur bestimmung von inhaltsstoffen von fluessigkeiten". |
| US4869875A (en) * | 1981-07-06 | 1989-09-26 | Skov Per S | Method of detecting or determining histamine in histamine containing materials, particularly body fluids and an analytical agent for use in such method |
| US4939153A (en) * | 1989-01-25 | 1990-07-03 | Radian Corporation | Saturation monitor and process |
| WO1990008950A1 (en) * | 1989-01-25 | 1990-08-09 | Radian Corporation | Saturation monitor and process |
Families Citing this family (126)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4017597A (en) * | 1974-10-30 | 1977-04-12 | Monsanto Company | Unitized solid phase immunoassay kit and method |
| US4094647A (en) * | 1976-07-02 | 1978-06-13 | Thyroid Diagnostics, Inc. | Test device |
| US4244694A (en) * | 1978-03-31 | 1981-01-13 | Union Carbide Corporation | Reactor/separator device for use in automated solid phase immunoassay |
| US4238471A (en) * | 1978-07-12 | 1980-12-09 | Becton, Dickinson And Company | Assay for thyroid hormone binding capacity |
| US4235601A (en) * | 1979-01-12 | 1980-11-25 | Thyroid Diagnostics, Inc. | Test device and method for its use |
| US4230664A (en) * | 1979-01-23 | 1980-10-28 | Technion Research & Development Foundation Ltd. | Test pack kit for immunoassay |
| US4366241A (en) * | 1980-08-07 | 1982-12-28 | Syva Company | Concentrating zone method in heterogeneous immunoassays |
| CA1183450A (en) * | 1980-10-30 | 1985-03-05 | Alfred C. Greenquist | Homogeneous specific binding assay device and method |
| US4517288A (en) * | 1981-01-23 | 1985-05-14 | American Hospital Supply Corp. | Solid phase system for ligand assay |
| JPS57200862A (en) * | 1981-06-05 | 1982-12-09 | Fuji Photo Film Co Ltd | Mutilayer analysis element utilizing unique binding reaction |
| JPS5877843U (ja) * | 1981-11-20 | 1983-05-26 | 株式会社三協精機製作所 | テ−プレコ−ダ |
| USRE34405E (en) * | 1983-08-01 | 1993-10-12 | Abbott Laboratories | Determination of analytes in particle-containing medium |
| US4632901A (en) * | 1984-05-11 | 1986-12-30 | Hybritech Incorporated | Method and apparatus for immunoassays |
| US4603109A (en) * | 1984-06-01 | 1986-07-29 | Norton Company | Method and apparatus for contacting reactants in chemical and biological reactions |
| FI861149L (fi) * | 1984-08-28 | 1986-03-19 | Hybritech Inc | Medel foer diagnostiska analyser. |
| DE3446636A1 (de) * | 1984-12-20 | 1986-06-26 | Boehringer Mannheim Gmbh, 6800 Mannheim | Verfahren zur herstellung eines immunreaktiven poroesen traegermaterials |
| CA1272127A (en) * | 1985-04-04 | 1990-07-31 | Hybritech Incorporated | Solid phase system for use in ligand-receptor assays |
| US4824784A (en) * | 1985-04-08 | 1989-04-25 | Hygeia Sciences, Incorporated | Chromogenic solution for immunoassay |
| EP0221105A1 (en) * | 1985-04-29 | 1987-05-13 | Hichem Diagnostics, Inc., Dba Bural Technologies | Diagnostic test kit |
| US4623461A (en) * | 1985-05-31 | 1986-11-18 | Murex Corporation | Transverse flow diagnostic device |
| IL78854A (en) * | 1985-05-31 | 1991-11-21 | Murex Corp | Biological fluid diagnostic device |
| US5063151A (en) * | 1985-09-20 | 1991-11-05 | Biometallics, Inc. | Immunoassay method and kit |
| TW203120B (enExample) * | 1985-10-04 | 1993-04-01 | Abbott Lab | |
| US4790640A (en) * | 1985-10-11 | 1988-12-13 | Nason Frederic L | Laboratory slide |
| US5501949A (en) * | 1985-12-10 | 1996-03-26 | Murex Diagnostics Corporation | Particle bound binding component immunoassay |
| US4868108A (en) * | 1985-12-12 | 1989-09-19 | Hygeia Sciences, Incorporated | Multiple-antibody detection of antigen |
| JPS63501983A (ja) * | 1985-12-12 | 1988-08-04 | デニソン マニユフアクチユアリング カンパニ− | 試験物質の測定 |
| WO1987007384A1 (en) * | 1986-05-30 | 1987-12-03 | Quidel | Enzyme immunoassay device |
| DE3620653A1 (de) * | 1986-06-20 | 1987-12-23 | Boehringer Mannheim Gmbh | Verfahren zur herstellung eines immunreaktiven traegermaterials fuer die heterogene immunologische analyse |
| US5120504A (en) * | 1986-07-14 | 1992-06-09 | Hybritech Incorporated | Apparatus for immunoassays with vent chennels in the container side wall |
| CA1288690C (en) * | 1986-07-14 | 1991-09-10 | Virginia Petro-Roy | Apparatus and process for immunoassays |
| WO1988001374A1 (en) * | 1986-08-19 | 1988-02-25 | Angenics Inc. | Agglutination reaction method and apparatus |
| US5763262A (en) * | 1986-09-18 | 1998-06-09 | Quidel Corporation | Immunodiagnostic device |
| US20010023075A1 (en) * | 1992-04-03 | 2001-09-20 | Siu-Yin Wong | A immunodiagnositc device having a dessicant incorporated therein |
| EP0260965B2 (en) * | 1986-09-18 | 2002-01-16 | Pacific Biotech Inc. | Immunodiagnostic device |
| US4789526A (en) * | 1986-12-15 | 1988-12-06 | Pall Corporation | Vacuum diagnostic device |
| US4976926A (en) * | 1986-12-15 | 1990-12-11 | Pall Corporation | Vacuum diagnostic device |
| US5079142A (en) * | 1987-01-23 | 1992-01-07 | Synbiotics Corporation | Orthogonal flow immunoassays and devices |
| US4797260A (en) * | 1987-01-27 | 1989-01-10 | V-Tech, Inc. | Antibody testing system |
| US4833087A (en) * | 1987-02-27 | 1989-05-23 | Eastman Kodak Company | Disposable container configured to produce uniform signal |
| US4828980A (en) * | 1987-09-18 | 1989-05-09 | Eastman Kodak Company | Membrane structure coated with low pI protein or carbohydrate and methods of making and use |
| JPS63142755U (enExample) * | 1987-03-12 | 1988-09-20 | ||
| US4857453A (en) * | 1987-04-07 | 1989-08-15 | Syntex (U.S.A.) Inc. | Immunoassay device |
| US5447837A (en) * | 1987-08-05 | 1995-09-05 | Calypte, Inc. | Multi-immunoassay diagnostic system for antigens or antibodies or both |
| WO1989001626A1 (fr) * | 1987-08-19 | 1989-02-23 | Flemming Gmbh | Procede et dispositif de depistage d'un antigene ou d'un anticorps dans un specimen liquide |
| DE3727590A1 (de) * | 1987-08-19 | 1989-03-02 | Flemming Gmbh | Verfahren und vorrichtung zur ermittlung eines antigens oder antikoerpers in einer fluessigen probe |
| US4923680A (en) * | 1987-09-18 | 1990-05-08 | Eastman Kodak Company | Test device containing an immunoassay filter with a flow-delaying polymer |
| US4912034A (en) * | 1987-09-21 | 1990-03-27 | Biogenex Laboratories | Immunoassay test device and method |
| US5006464A (en) * | 1987-10-01 | 1991-04-09 | E-Y Laboratories, Inc. | Directed flow diagnostic device and method |
| DE3735684A1 (de) * | 1987-10-22 | 1989-05-03 | Boehringer Mannheim Gmbh | Immunreaktives traegermaterial und verfahren zu seiner herstellung |
| EP0313833B1 (en) * | 1987-10-29 | 1993-01-07 | Hygeia Sciences, Inc. | Disposable pre-packaged device for conducting immunoassay procedures |
| US4999163A (en) * | 1987-10-29 | 1991-03-12 | Hygeia Sciences, Inc. | Disposable, pre-packaged device for conducting immunoassay procedures |
| US5256372A (en) * | 1987-11-06 | 1993-10-26 | Idexx Corporation | Dipstick test device including a removable filter assembly |
| JPH01126544A (ja) * | 1987-11-11 | 1989-05-18 | Hitachi Ltd | 生化学分析方法及び装置 |
| US4818677A (en) * | 1987-12-03 | 1989-04-04 | Monoclonal Antibodies, Inc. | Membrane assay using focused sample application |
| US4963325A (en) * | 1988-05-06 | 1990-10-16 | Hygeia Sciences, Inc. | Swab expressor immunoassay device |
| US5137804A (en) * | 1988-05-10 | 1992-08-11 | E. I. Du Pont De Nemours And Company | Assay device and immunoassay |
| US5374524A (en) * | 1988-05-10 | 1994-12-20 | E. I. Du Pont De Nemours And Company | Solution sandwich hybridization, capture and detection of amplified nucleic acids |
| AU2684488A (en) | 1988-06-27 | 1990-01-04 | Carter-Wallace, Inc. | Test device and method for colored particle immunoassay |
| WO1990000251A1 (en) * | 1988-06-30 | 1990-01-11 | Bio-Metric Systems, Inc. | Pressure-assisted analytical apparatus and method |
| US5096809A (en) * | 1988-07-25 | 1992-03-17 | Pacific Biotech, Inc. | Whole blood assays using porous membrane support devices |
| US4877586A (en) * | 1988-07-27 | 1989-10-31 | Eastman Kodak Company | Sliding test device for assays |
| US4959197A (en) * | 1988-09-07 | 1990-09-25 | Bio-Rad Laboratories, Inc. | Filter canister for immunoassays |
| EP0442872A4 (en) * | 1988-11-14 | 1992-08-05 | Idexx Corp. | Dual absorbent analyte detection |
| MY104234A (en) * | 1988-11-17 | 1994-02-28 | Becton Dickinson Co | Immunoassay on a preblocked solid surface |
| US5106761A (en) * | 1989-03-13 | 1992-04-21 | International Canine Genetics, Inc. | Method for detecting molecules in a liquid medium |
| US4933092A (en) * | 1989-04-07 | 1990-06-12 | Abbott Laboratories | Methods and devices for the separation of plasma or serum from whole blood |
| US5064541A (en) * | 1989-04-07 | 1991-11-12 | Abbott Laboratories | Devices and methods for the collection of a predetermined volume of plasma or serum |
| US5147609A (en) * | 1989-05-19 | 1992-09-15 | Pb Diagnostic Systems, Inc. | Assay element |
| WO1990014163A1 (en) * | 1989-05-24 | 1990-11-29 | Ensys, Inc. | Method and apparatus for detecting environmental contaminants |
| US5225163A (en) * | 1989-08-18 | 1993-07-06 | Angenics, Inc. | Reaction apparatus employing gravitational flow |
| US5185127A (en) * | 1989-09-21 | 1993-02-09 | Becton, Dickinson And Company | Test device including flow control means |
| US5622870A (en) * | 1989-11-27 | 1997-04-22 | Behringwerke Ag | Device and method for completing a fluidic circuit |
| US5279935A (en) * | 1990-03-01 | 1994-01-18 | Becton, Dickinson And Company | Method of immunossay including deactivation of endogenous alkaline phosphatase |
| US5922615A (en) | 1990-03-12 | 1999-07-13 | Biosite Diagnostics Incorporated | Assay devices comprising a porous capture membrane in fluid-withdrawing contact with a nonabsorbent capillary network |
| US5139934A (en) * | 1990-05-25 | 1992-08-18 | Becton, Dickinson And Company | Substrate composition and method for solid phase urease immunoassay |
| US5212065A (en) * | 1990-10-25 | 1993-05-18 | International Diagnostic Systems, Corp. | Rapid assay device |
| CA2065719A1 (en) | 1991-04-30 | 1992-10-31 | John B. Findlay | Nucleic acid amplification and detection methods using rapid polymerase chain reaction cycle |
| US5877028A (en) * | 1991-05-29 | 1999-03-02 | Smithkline Diagnostics, Inc. | Immunochromatographic assay device |
| US5468648A (en) * | 1991-05-29 | 1995-11-21 | Smithkline Diagnostics, Inc. | Interrupted-flow assay device |
| US5998220A (en) * | 1991-05-29 | 1999-12-07 | Beckman Coulter, Inc. | Opposable-element assay devices, kits, and methods employing them |
| US5607863A (en) * | 1991-05-29 | 1997-03-04 | Smithkline Diagnostics, Inc. | Barrier-controlled assay device |
| US6168956B1 (en) | 1991-05-29 | 2001-01-02 | Beckman Coulter, Inc. | Multiple component chromatographic assay device |
| US5869345A (en) * | 1991-05-29 | 1999-02-09 | Smithkline Diagnostics, Inc. | Opposable-element assay device employing conductive barrier |
| US5726010A (en) * | 1991-07-31 | 1998-03-10 | Idexx Laboratories, Inc. | Reversible flow chromatographic binding assay |
| US6007999A (en) * | 1991-07-31 | 1999-12-28 | Idexx Laboratories, Inc. | Reversible flow chromatographic binding assay |
| US5427739A (en) * | 1992-08-27 | 1995-06-27 | Schering-Plough Healthcare Products, Inc. | Apparatus for performing immunoassays |
| US5354692A (en) * | 1992-09-08 | 1994-10-11 | Pacific Biotech, Inc. | Analyte detection device including a hydrophobic barrier for improved fluid flow |
| US5976824A (en) * | 1993-11-24 | 1999-11-02 | Abbott Laboratories | Method and apparatus for collecting a cell sample from a liquid specimen |
| US5578459A (en) * | 1993-11-24 | 1996-11-26 | Abbott Laboratories | Method and apparatus for collecting a cell sample from a liquid specimen |
| AU2201295A (en) * | 1994-04-08 | 1995-10-30 | Amicon, Inc. | Method and apparatus for isolation and purification of biologically active complexes |
| US5589344A (en) | 1994-06-15 | 1996-12-31 | Johnson & Johnson Clinical Diagnostics, Inc. | Test kit and method for competitive specific binding assay |
| US20010051350A1 (en) | 1995-05-02 | 2001-12-13 | Albert Nazareth | Diagnostic detection device and method |
| US5833860A (en) * | 1995-08-28 | 1998-11-10 | Millipore Investment Holdings Limited | Centrifugal adsorptive sample preparation device and method |
| EP0972073A1 (en) * | 1996-09-25 | 2000-01-19 | Universal Healthwatch, Inc. | Diagnostic test devices with improved fluid movement and resistance to interferences |
| US5879951A (en) * | 1997-01-29 | 1999-03-09 | Smithkline Diagnostics, Inc. | Opposable-element assay device employing unidirectional flow |
| US5939252A (en) * | 1997-05-09 | 1999-08-17 | Lennon; Donald J. | Detachable-element assay device |
| US6437563B1 (en) | 1997-11-21 | 2002-08-20 | Quantum Design, Inc. | Method and apparatus for making measurements of accumulations of magnetically susceptible particles combined with analytes |
| US6780617B2 (en) | 2000-12-29 | 2004-08-24 | Chen & Chen, Llc | Sample processing device and method |
| US7799521B2 (en) * | 1998-06-24 | 2010-09-21 | Chen & Chen, Llc | Thermal cycling |
| US6893562B2 (en) * | 2000-05-05 | 2005-05-17 | Millipore Corporation | Underdrain for filtration membrane |
| AT5044U1 (de) * | 2001-05-10 | 2002-02-25 | Medsystems Diagnostics Gmbh | Quantitativer einschritt immuntest in lyophilisierter form |
| JP4513085B2 (ja) | 2001-09-11 | 2010-07-28 | アイキューム インク | 試料の容器 |
| US6904701B2 (en) * | 2002-02-15 | 2005-06-14 | The Regents Of The University Of California | Flask and method for drying biological materials |
| CA2515075C (en) | 2003-02-05 | 2012-10-02 | Iquum, Inc. | Sample processing |
| ITMI20030643A1 (it) | 2003-04-01 | 2004-10-02 | Copan Innovation Ltd | Tampone per il prelievo di campioni biologici |
| DE10344229A1 (de) * | 2003-09-24 | 2005-05-19 | Steag Microparts Gmbh | Mikrostruktuierte Vorrichtung zum entnehmbaren Speichern von kleinen Flüssigkeitsmengen und Verfahren zum Entnehmen der in dieser Vorrichtung gespeicherten Flüssigkeit |
| ATE497837T1 (de) * | 2004-04-09 | 2011-02-15 | Vivebio Llc | Vorrichtungen und verfahren für abnahme, lagerung und transport von biologischen proben |
| WO2007039120A1 (en) * | 2005-09-20 | 2007-04-12 | Georg-August-Universität Göttingen | Disinfection system |
| US7927828B2 (en) * | 2005-10-17 | 2011-04-19 | Spidertech, a division of Stoecker & associates, LLC | Immunoassay for venom detection including noninvasive sample collection |
| US20070224701A1 (en) * | 2006-02-16 | 2007-09-27 | Becton, Dickinson And Company | Combination vertical and lateral flow immunoassay device |
| GB2435510A (en) | 2006-02-23 | 2007-08-29 | Mologic Ltd | Enzyme detection product and methods |
| GB2435512A (en) * | 2006-02-23 | 2007-08-29 | Mologic Ltd | A binding assay and assay device |
| GB2435511A (en) * | 2006-02-23 | 2007-08-29 | Mologic Ltd | Protease detection |
| GB2437311A (en) * | 2006-04-07 | 2007-10-24 | Mologic Ltd | A protease detection product |
| CA2740902C (en) | 2008-10-17 | 2016-10-04 | Medmira Inc. | Downward or vertical flow diagnostic device and assay |
| IT1401447B1 (it) * | 2010-06-09 | 2013-07-26 | Copan Italia Spa | Metodo per il trasferimento quantitativo di analiti |
| IT1403618B1 (it) | 2011-01-05 | 2013-10-31 | Copan Italia Spa | Procedimento per realizzare un dispositivo per il prelievo ed il trasferimento di campioni per biologia molecolare |
| ES2905353T3 (es) | 2013-03-15 | 2022-04-08 | Abbott Lab | Gestor de reactivos automatizado de un sistema analizador de diagnóstico |
| WO2014144759A1 (en) | 2013-03-15 | 2014-09-18 | Abbott Laboratories | Linear track diagnostic analyzer |
| US9513303B2 (en) | 2013-03-15 | 2016-12-06 | Abbott Laboratories | Light-blocking system for a diagnostic analyzer |
| US9588114B2 (en) | 2013-04-23 | 2017-03-07 | Montecito Bio Sciences Ltd | Flow through testing system with pressure indicator |
| US9927443B2 (en) | 2015-04-10 | 2018-03-27 | Conquerab Inc. | Risk assessment for therapeutic drugs |
| US9903866B2 (en) | 2016-04-05 | 2018-02-27 | Conquerab Inc. | Portable devices for detection of antibodies against therapeutic drugs |
| CN110168366A (zh) * | 2017-01-04 | 2019-08-23 | 新加坡科技研究局 | 用于基于颗粒的生物测定的过筛垂直流系统 |
| US20200166459A1 (en) * | 2018-11-22 | 2020-05-28 | Kaya17 Inc. | Differential filtration spectroscopic detection based immunoassay and a novel cartridge for diagnostic detection of bio-particles |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3206602A (en) * | 1960-05-02 | 1965-09-14 | Byron T Eberle | Apparatus for measuring the binding capacity of serum proteins |
| US3451777A (en) * | 1965-08-20 | 1969-06-24 | Walter Di Giulio | Method and apparatus for determining the thyroid hormone content of blood |
| US3615222A (en) * | 1968-09-04 | 1971-10-26 | New England Nuclear Corp | Method and apparatus for measuring the amount of a component in a biological fluid |
| US3640687A (en) * | 1969-07-23 | 1972-02-08 | Oxford Lab | Chromatography method and apparatus |
| US3743482A (en) * | 1970-12-30 | 1973-07-03 | Nuclear Med Lab | Method and apparatus for determining thyroid function |
| JPS4919840A (enExample) * | 1972-06-13 | 1974-02-21 |
-
1972
- 1972-09-07 IT IT28915/72A patent/IT1006557B/it active
- 1972-09-07 CA CA151,114A patent/CA983358A/en not_active Expired
- 1972-09-08 DE DE2244080A patent/DE2244080A1/de not_active Ceased
- 1972-09-08 US US287344A patent/US3888629A/en not_active Expired - Lifetime
- 1972-09-08 CH CH1327172A patent/CH575122A5/xx not_active IP Right Cessation
- 1972-09-08 JP JP7290868A patent/JPS595863B2/ja not_active Expired
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4869875A (en) * | 1981-07-06 | 1989-09-26 | Skov Per S | Method of detecting or determining histamine in histamine containing materials, particularly body fluids and an analytical agent for use in such method |
| DE3137014A1 (de) * | 1981-09-17 | 1983-03-24 | Merck Patent Gmbh, 6100 Darmstadt | "testsystem und verfahren zur bestimmung von inhaltsstoffen von fluessigkeiten". |
| US4939153A (en) * | 1989-01-25 | 1990-07-03 | Radian Corporation | Saturation monitor and process |
| WO1990008950A1 (en) * | 1989-01-25 | 1990-08-09 | Radian Corporation | Saturation monitor and process |
Also Published As
| Publication number | Publication date |
|---|---|
| IT1006557B (it) | 1976-10-20 |
| JPS595863B2 (ja) | 1984-02-07 |
| CA983358A (en) | 1976-02-10 |
| US3888629A (en) | 1975-06-10 |
| JPS4837191A (enExample) | 1973-06-01 |
| CH575122A5 (enExample) | 1976-04-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2244080A1 (de) | Verfahren und vorrichtung zur durchfuehrung von chemischen und/oder biologischen reaktionen | |
| DE69931595T2 (de) | Trocknungsmittel | |
| DE2751588C3 (de) | Verfahren zur Bestimmung eines Liganden oder der Liganden-Bindungskapazität in einem flüssigen Medium | |
| DE4323672A1 (de) | Vorrichtung zur gleichzeitigen Bestimmung von Analyten | |
| EP0054679B1 (de) | Verwendung von Reagenzstreifen zur Herstellung von Reagenzlösungen | |
| DE112004000843B4 (de) | Festphasen-Extraktionsvorrichtung | |
| DE2612948C2 (de) | Wiederbenutzbares immobilisiertes Immunoadsorbens für ein Verfahren zur quantitativen Analyse der Antigenkonzentration einer Probenlösung | |
| DE69732131T2 (de) | Immuno-Assay-Vorrichtung mit teilbarem Gehäuse | |
| EP0374684B1 (de) | Testträger zur analytischen Untersuchung einer Probenflüssigkeit mit Hilfe einer spezifischen Bindungsreaktion zweier bioaffiner Bindungspartner und entsprechendes Testverfahren | |
| DE2716880A1 (de) | Verfahren und vorrichtung zum trennen eines partikelanteils von einem einen fluessigkeitsanteil enthaltenden gemisch | |
| DE3029579A1 (de) | Mittel zur abtrennung von plasma oder serum aus vollblut | |
| DE2123210A1 (de) | Verfahren und Vorrichtung zur Durchführung von chemischen und/oder biologischen Reaktionen | |
| DE29603737U1 (de) | Assayvorrichtungen | |
| DE4015589A1 (de) | Vorrichtung und deren verwendung zur abtrennung von plasma aus vollblut | |
| DE3715485A1 (de) | Stabilisierung von ss-galactosidase | |
| DE2421035B2 (de) | Diagnostiziermittel zur durchfuehrung radioimmunologischer bestimmungen | |
| DE2751589A1 (de) | Verfahren zur bestimmung eines liganden oder der liganden-bindungskapazitaet in einem fluessigen medium | |
| DE2233814C3 (de) | Verfahren und Vorrichtung zum Vorbereiten einer Gesamtflüssigkeitsprobe auf die Probenanalyse | |
| DE3608883C1 (de) | Chromatographische Saeule fuer immunologische Untersuchungsverfahren | |
| DE2523207A1 (de) | Verfahren zur bestimmung von antikoerpern | |
| DE2953265A1 (de) | Miniatur-reaktions-behaelter und verfahren und vorrichtung zur einfuehrung eines mikrovolumens einer fluessigkeit in diesen behaelter | |
| DE69005023T2 (de) | Applikatorröhrchen mit einem Filter. | |
| DE2927421A1 (de) | Gasdosimeter | |
| DE10153925B4 (de) | Testgerät zum Nachweis von pharmakologisch wirksamen Verbindungen aus Speichel | |
| DE3320522C2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8128 | New person/name/address of the agent |
Representative=s name: EISENFUEHR, G., DIPL.-ING. SPEISER, D., DIPL.-ING. |
|
| 8178 | Suspension cancelled | ||
| AF | Is addition to no. |
Ref country code: DE Ref document number: 2123210 Format of ref document f/p: P |
|
| 8131 | Rejection |