DE2207635A1 - Polylactidhaltige pharmazeutische Zubereitungen - Google Patents
Polylactidhaltige pharmazeutische ZubereitungenInfo
- Publication number
- DE2207635A1 DE2207635A1 DE19722207635 DE2207635A DE2207635A1 DE 2207635 A1 DE2207635 A1 DE 2207635A1 DE 19722207635 DE19722207635 DE 19722207635 DE 2207635 A DE2207635 A DE 2207635A DE 2207635 A1 DE2207635 A1 DE 2207635A1
- Authority
- DE
- Germany
- Prior art keywords
- polymer
- radical
- drug
- preparation according
- pharmaceutical preparation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000000825 pharmaceutical preparation Substances 0.000 title claims description 12
- 229920000747 poly(lactic acid) Polymers 0.000 title description 20
- 229920000642 polymer Polymers 0.000 claims description 75
- 239000003814 drug Substances 0.000 claims description 50
- 229940079593 drug Drugs 0.000 claims description 42
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 claims description 24
- 239000004480 active ingredient Substances 0.000 claims description 18
- 239000003380 propellant Substances 0.000 claims description 16
- -1 alkylene radical Chemical class 0.000 claims description 13
- 239000004310 lactic acid Substances 0.000 claims description 12
- 235000014655 lactic acid Nutrition 0.000 claims description 12
- 238000002360 preparation method Methods 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- WHBMMWSBFZVSSR-UHFFFAOYSA-N 3-hydroxybutyric acid Chemical compound CC(O)CC(O)=O WHBMMWSBFZVSSR-UHFFFAOYSA-N 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- 239000003242 anti bacterial agent Substances 0.000 claims description 4
- 229940121363 anti-inflammatory agent Drugs 0.000 claims description 4
- 239000002260 anti-inflammatory agent Substances 0.000 claims description 4
- 239000007788 liquid Substances 0.000 claims description 3
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims description 3
- UUFQTNFCRMXOAE-UHFFFAOYSA-N 1-methylmethylene Chemical compound C[CH] UUFQTNFCRMXOAE-UHFFFAOYSA-N 0.000 claims description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 2
- 230000003110 anti-inflammatory effect Effects 0.000 claims description 2
- 230000003115 biocidal effect Effects 0.000 claims description 2
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 claims description 2
- 229940126601 medicinal product Drugs 0.000 claims description 2
- HZVOZRGWRWCICA-UHFFFAOYSA-N methanediyl Chemical compound [CH2] HZVOZRGWRWCICA-UHFFFAOYSA-N 0.000 claims description 2
- 150000008282 halocarbons Chemical class 0.000 claims 1
- 239000002904 solvent Substances 0.000 description 31
- 239000002245 particle Substances 0.000 description 15
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- JJTUDXZGHPGLLC-UHFFFAOYSA-N lactide Chemical compound CC1OC(=O)C(C)OC1=O JJTUDXZGHPGLLC-UHFFFAOYSA-N 0.000 description 11
- 239000000203 mixture Substances 0.000 description 11
- 239000000243 solution Substances 0.000 description 11
- 229920001577 copolymer Polymers 0.000 description 10
- 238000000034 method Methods 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 7
- 239000008187 granular material Substances 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 239000011248 coating agent Substances 0.000 description 6
- 238000000576 coating method Methods 0.000 description 6
- 206010052428 Wound Diseases 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 235000019198 oils Nutrition 0.000 description 5
- 238000006116 polymerization reaction Methods 0.000 description 5
- 239000007921 spray Substances 0.000 description 5
- 238000005507 spraying Methods 0.000 description 5
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 4
- 239000004604 Blowing Agent Substances 0.000 description 4
- 208000027418 Wounds and injury Diseases 0.000 description 4
- 125000004122 cyclic group Chemical group 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 239000003755 preservative agent Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000001464 adherent effect Effects 0.000 description 3
- 239000000443 aerosol Substances 0.000 description 3
- GSCLMSFRWBPUSK-UHFFFAOYSA-N beta-Butyrolactone Chemical compound CC1CC(=O)O1 GSCLMSFRWBPUSK-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 235000013305 food Nutrition 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 239000000178 monomer Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000001694 spray drying Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000375 suspending agent Substances 0.000 description 3
- 239000002562 thickening agent Substances 0.000 description 3
- RKDVKSZUMVYZHH-UHFFFAOYSA-N 1,4-dioxane-2,5-dione Chemical compound O=C1COC(=O)CO1 RKDVKSZUMVYZHH-UHFFFAOYSA-N 0.000 description 2
- JJTUDXZGHPGLLC-IMJSIDKUSA-N 4511-42-6 Chemical group C[C@@H]1OC(=O)[C@H](C)OC1=O JJTUDXZGHPGLLC-IMJSIDKUSA-N 0.000 description 2
- JGZVUTYDEVUNMK-UHFFFAOYSA-N 5-carboxy-2',7'-dichlorofluorescein Chemical compound C12=CC(Cl)=C(O)C=C2OC2=CC(O)=C(Cl)C=C2C21OC(=O)C1=CC(C(=O)O)=CC=C21 JGZVUTYDEVUNMK-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 229920001244 Poly(D,L-lactide) Polymers 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 238000000889 atomisation Methods 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- BLFLLBZGZJTVJG-UHFFFAOYSA-N benzocaine Chemical compound CCOC(=O)C1=CC=C(N)C=C1 BLFLLBZGZJTVJG-UHFFFAOYSA-N 0.000 description 2
- SESFRYSPDFLNCH-UHFFFAOYSA-N benzyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OCC1=CC=CC=C1 SESFRYSPDFLNCH-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- OSASVXMJTNOKOY-UHFFFAOYSA-N chlorobutanol Chemical compound CC(C)(O)C(Cl)(Cl)Cl OSASVXMJTNOKOY-UHFFFAOYSA-N 0.000 description 2
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 239000002537 cosmetic Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 229960003750 ethyl chloride Drugs 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 210000000245 forearm Anatomy 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 150000001261 hydroxy acids Chemical class 0.000 description 2
- 150000002596 lactones Chemical class 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000011159 matrix material Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- 239000004014 plasticizer Substances 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 229960005205 prednisolone Drugs 0.000 description 2
- OIGNJSKKLXVSLS-VWUMJDOOSA-N prednisolone Chemical compound O=C1C=C[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 OIGNJSKKLXVSLS-VWUMJDOOSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- NOOLISFMXDJSKH-UTLUCORTSA-N (+)-Neomenthol Chemical compound CC(C)[C@@H]1CC[C@@H](C)C[C@@H]1O NOOLISFMXDJSKH-UTLUCORTSA-N 0.000 description 1
- DSSYKIVIOFKYAU-XCBNKYQSSA-N (R)-camphor Chemical compound C1C[C@@]2(C)C(=O)C[C@@H]1C2(C)C DSSYKIVIOFKYAU-XCBNKYQSSA-N 0.000 description 1
- AFENDNXGAFYKQO-VKHMYHEASA-N (S)-2-hydroxybutyric acid Chemical compound CC[C@H](O)C(O)=O AFENDNXGAFYKQO-VKHMYHEASA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- RGMMREBHCYXQMA-UHFFFAOYSA-N 2-hydroxyheptanoic acid Chemical compound CCCCCC(O)C(O)=O RGMMREBHCYXQMA-UHFFFAOYSA-N 0.000 description 1
- NYHNVHGFPZAZGA-UHFFFAOYSA-N 2-hydroxyhexanoic acid Chemical compound CCCCC(O)C(O)=O NYHNVHGFPZAZGA-UHFFFAOYSA-N 0.000 description 1
- JYZJYKOZGGEXSX-UHFFFAOYSA-N 2-hydroxymyristic acid Chemical compound CCCCCCCCCCCCC(O)C(O)=O JYZJYKOZGGEXSX-UHFFFAOYSA-N 0.000 description 1
- KIHBGTRZFAVZRV-UHFFFAOYSA-N 2-hydroxyoctadecanoic acid Chemical compound CCCCCCCCCCCCCCCCC(O)C(O)=O KIHBGTRZFAVZRV-UHFFFAOYSA-N 0.000 description 1
- JKRDADVRIYVCCY-UHFFFAOYSA-N 2-hydroxyoctanoic acid Chemical compound CCCCCCC(O)C(O)=O JKRDADVRIYVCCY-UHFFFAOYSA-N 0.000 description 1
- KVZLHPXEUGJPAH-UHFFFAOYSA-N 2-oxidanylpropanoic acid Chemical compound CC(O)C(O)=O.CC(O)C(O)=O KVZLHPXEUGJPAH-UHFFFAOYSA-N 0.000 description 1
- GZYXPXGNODDCBD-UHFFFAOYSA-N 3,3,6,6-tetramethyl-1,4-dioxane-2,5-dione Chemical compound CC1(C)OC(=O)C(C)(C)OC1=O GZYXPXGNODDCBD-UHFFFAOYSA-N 0.000 description 1
- ULKFLOVGORAZDI-UHFFFAOYSA-N 3,3-dimethyloxetan-2-one Chemical compound CC1(C)COC1=O ULKFLOVGORAZDI-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 108010001478 Bacitracin Proteins 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 101100462138 Brassica napus OlnB1 gene Proteins 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- 241000723346 Cinnamomum camphora Species 0.000 description 1
- NOOLISFMXDJSKH-UHFFFAOYSA-N DL-menthol Natural products CC(C)C1CCC(C)CC1O NOOLISFMXDJSKH-UHFFFAOYSA-N 0.000 description 1
- 102000016911 Deoxyribonucleases Human genes 0.000 description 1
- 108010053770 Deoxyribonucleases Proteins 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- 108010088842 Fibrinolysin Proteins 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- WJOHZNCJWYWUJD-IUGZLZTKSA-N Fluocinonide Chemical compound C1([C@@H](F)C2)=CC(=O)C=C[C@]1(C)[C@]1(F)[C@@H]2[C@@H]2C[C@H]3OC(C)(C)O[C@@]3(C(=O)COC(=O)C)[C@@]2(C)C[C@@H]1O WJOHZNCJWYWUJD-IUGZLZTKSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- NNJVILVZKWQKPM-UHFFFAOYSA-N Lidocaine Chemical compound CCN(CC)CC(=O)NC1=C(C)C=CC=C1C NNJVILVZKWQKPM-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 244000062730 Melissa officinalis Species 0.000 description 1
- 235000010654 Melissa officinalis Nutrition 0.000 description 1
- 229930193140 Neomycin Natural products 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 101150048735 POL3 gene Proteins 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 208000003251 Pruritus Diseases 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- VJHCJDRQFCCTHL-UHFFFAOYSA-N acetic acid 2,3,4,5,6-pentahydroxyhexanal Chemical compound CC(O)=O.OCC(O)C(O)C(O)C(O)C=O VJHCJDRQFCCTHL-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229940061720 alpha hydroxy acid Drugs 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 239000003263 anabolic agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 229940125715 antihistaminic agent Drugs 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 229960003071 bacitracin Drugs 0.000 description 1
- 229930184125 bacitracin Natural products 0.000 description 1
- CLKOFPXJLQSYAH-ABRJDSQDSA-N bacitracin A Chemical compound C1SC([C@@H](N)[C@@H](C)CC)=N[C@@H]1C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CCC(O)=O)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]1C(=O)N[C@H](CCCN)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CC=2N=CNC=2)C(=O)N[C@H](CC(O)=O)C(=O)N[C@@H](CC(N)=O)C(=O)NCCCC1 CLKOFPXJLQSYAH-ABRJDSQDSA-N 0.000 description 1
- 150000001553 barium compounds Chemical class 0.000 description 1
- 229960000686 benzalkonium chloride Drugs 0.000 description 1
- 229960005274 benzocaine Drugs 0.000 description 1
- 229960002903 benzyl benzoate Drugs 0.000 description 1
- CADWTSSKOVRVJC-UHFFFAOYSA-N benzyl(dimethyl)azanium;chloride Chemical compound [Cl-].C[NH+](C)CC1=CC=CC=C1 CADWTSSKOVRVJC-UHFFFAOYSA-N 0.000 description 1
- 150000001277 beta hydroxy acids Chemical class 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- VEZXCJBBBCKRPI-UHFFFAOYSA-N beta-propiolactone Chemical compound O=C1CCO1 VEZXCJBBBCKRPI-UHFFFAOYSA-N 0.000 description 1
- 229960002537 betamethasone Drugs 0.000 description 1
- UREBDLICKHMUKA-DVTGEIKXSA-N betamethasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)C[C@@H]2O UREBDLICKHMUKA-DVTGEIKXSA-N 0.000 description 1
- 229960000074 biopharmaceutical Drugs 0.000 description 1
- 230000001680 brushing effect Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 229960000846 camphor Drugs 0.000 description 1
- 229930008380 camphor Natural products 0.000 description 1
- MSUOLNSQHLHDAS-UHFFFAOYSA-N cerebronic acid Chemical compound CCCCCCCCCCCCCCCCCCCCCCC(O)C(O)=O MSUOLNSQHLHDAS-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229960004926 chlorobutanol Drugs 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 229940124558 contraceptive agent Drugs 0.000 description 1
- 239000003433 contraceptive agent Substances 0.000 description 1
- 238000013270 controlled release Methods 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- UGMCXQCYOVCMTB-UHFFFAOYSA-K dihydroxy(stearato)aluminium Chemical compound CCCCCCCCCCCCCCCCCC(=O)O[Al](O)O UGMCXQCYOVCMTB-UHFFFAOYSA-K 0.000 description 1
- IEJIGPNLZYLLBP-UHFFFAOYSA-N dimethyl carbonate Chemical compound COC(=O)OC IEJIGPNLZYLLBP-UHFFFAOYSA-N 0.000 description 1
- PCHPORCSPXIHLZ-UHFFFAOYSA-N diphenhydramine hydrochloride Chemical compound [Cl-].C=1C=CC=CC=1C(OCC[NH+](C)C)C1=CC=CC=C1 PCHPORCSPXIHLZ-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000003974 emollient agent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 229940088598 enzyme Drugs 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 229940001501 fibrinolysin Drugs 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 229960001347 fluocinolone acetonide Drugs 0.000 description 1
- FEBLZLNTKCEFIT-VSXGLTOVSA-N fluocinolone acetonide Chemical compound C1([C@@H](F)C2)=CC(=O)C=C[C@]1(C)[C@]1(F)[C@@H]2[C@@H]2C[C@H]3OC(C)(C)O[C@@]3(C(=O)CO)[C@@]2(C)C[C@@H]1O FEBLZLNTKCEFIT-VSXGLTOVSA-N 0.000 description 1
- 229960000785 fluocinonide Drugs 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 150000001281 gamma hydroxy acids Chemical class 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-M hexanoate Chemical compound CCCCCC([O-])=O FUZZWVXGSFPDMH-UHFFFAOYSA-M 0.000 description 1
- 230000001632 homeopathic effect Effects 0.000 description 1
- 239000007970 homogeneous dispersion Substances 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 230000036512 infertility Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000011872 intimate mixture Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000007803 itching Effects 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000000865 liniment Substances 0.000 description 1
- 239000003589 local anesthetic agent Substances 0.000 description 1
- 229960005015 local anesthetics Drugs 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229940041616 menthol Drugs 0.000 description 1
- 239000002207 metabolite Substances 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 229960001047 methyl salicylate Drugs 0.000 description 1
- 239000003094 microcapsule Substances 0.000 description 1
- 229960004927 neomycin Drugs 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000003883 ointment base Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- 229920001432 poly(L-lactide) Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920002959 polymer blend Polymers 0.000 description 1
- 239000000244 polyoxyethylene sorbitan monooleate Substances 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 229960000380 propiolactone Drugs 0.000 description 1
- 239000004405 propyl p-hydroxybenzoate Substances 0.000 description 1
- 229960003415 propylparaben Drugs 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- VIDTVPHHDGRGAF-UHFFFAOYSA-N selenium sulfide Chemical compound [Se]=S VIDTVPHHDGRGAF-UHFFFAOYSA-N 0.000 description 1
- 229960005265 selenium sulfide Drugs 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000003431 steroids Chemical class 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- GAAKLDANOSASAM-UHFFFAOYSA-N undec-10-enoic acid;zinc Chemical compound [Zn].OC(=O)CCCCCCCCC=C GAAKLDANOSASAM-UHFFFAOYSA-N 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000000341 volatile oil Substances 0.000 description 1
- 238000005550 wet granulation Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229940072358 xylocaine Drugs 0.000 description 1
- 239000011667 zinc carbonate Substances 0.000 description 1
- 235000004416 zinc carbonate Nutrition 0.000 description 1
- 229910000010 zinc carbonate Inorganic materials 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
- 229940118257 zinc undecylenate Drugs 0.000 description 1
- IPSRAFUHLHIWAR-UHFFFAOYSA-N zinc;ethane Chemical group [Zn+2].[CH2-]C.[CH2-]C IPSRAFUHLHIWAR-UHFFFAOYSA-N 0.000 description 1
- PCHQDTOLHOFHHK-UHFFFAOYSA-L zinc;hydrogen carbonate Chemical compound [Zn+2].OC([O-])=O.OC([O-])=O PCHQDTOLHOFHHK-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/02—Polyesters derived from hydroxycarboxylic acids or from polycarboxylic acids and polyhydroxy compounds
- C08G63/06—Polyesters derived from hydroxycarboxylic acids or from polycarboxylic acids and polyhydroxy compounds derived from hydroxycarboxylic acids
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/20—Pills, tablets, discs, rods
- A61K9/2004—Excipients; Inactive ingredients
- A61K9/2022—Organic macromolecular compounds
- A61K9/2031—Organic macromolecular compounds obtained otherwise than by reactions only involving carbon-to-carbon unsaturated bonds, e.g. polyethylene glycol, polyethylene oxide, poloxamers
- A61K9/204—Polyesters, e.g. poly(lactide-co-glycolide)
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/70—Web, sheet or filament bases ; Films; Fibres of the matrix type containing drug
- A61K9/7015—Drug-containing film-forming compositions, e.g. spray-on
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Veterinary Medicine (AREA)
- General Health & Medical Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Engineering & Computer Science (AREA)
- Public Health (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Medicinal Preparation (AREA)
- Polyesters Or Polycarbonates (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US11808171A | 1971-02-23 | 1971-02-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2207635A1 true DE2207635A1 (de) | 1972-08-31 |
Family
ID=22376416
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722207635 Withdrawn DE2207635A1 (de) | 1971-02-23 | 1972-02-18 | Polylactidhaltige pharmazeutische Zubereitungen |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3755558A (OSRAM) |
| CA (1) | CA950828A (OSRAM) |
| DE (1) | DE2207635A1 (OSRAM) |
| FR (1) | FR2126270B1 (OSRAM) |
| GB (1) | GB1351409A (OSRAM) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2640905A1 (de) * | 1975-09-12 | 1977-03-17 | Anic Spa | Verfahren zum okkludieren von substanzen verschiedener art in feinfaserige gefuege |
| AT382076B (de) * | 1982-10-15 | 1987-01-12 | Chemie Linz Ag | Verfahren zur herstellung von presslingen mit retardierter wirkstofffreisetzung |
| DE4112489A1 (de) * | 1991-04-17 | 1992-10-22 | Christian Dr Med Juergens | Resorbierbare, physiologisch unbedenkliche copolymere und deren verwendung |
| DE4229924A1 (de) * | 1991-04-17 | 1994-03-10 | Juergens Christian Dr Med | Verwendung von resorbierbaren Lactidcopolymeren |
| US5576418A (en) * | 1992-06-29 | 1996-11-19 | Jurgens; Christian | Resorbable biocompatible copolymers and their use |
Families Citing this family (114)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3962414A (en) * | 1972-04-27 | 1976-06-08 | Alza Corporation | Structured bioerodible drug delivery device |
| US3914402A (en) * | 1973-06-14 | 1975-10-21 | Alza Corp | Ophthalmic dosage form, for releasing medication over time |
| US4001388A (en) * | 1973-06-14 | 1977-01-04 | Alza Corporation | Ophthalmological bioerodible drug dispensing formulation |
| AR205997A1 (es) * | 1973-11-21 | 1976-06-23 | American Cyanamid Co | Resina de poliester normalmente solida biodegradable e hidrolizable |
| US3960152A (en) * | 1974-01-21 | 1976-06-01 | American Cyanamid Company | Surgical sutures of unsymmetrically substituted 1,4-dioxane-2,5-diones |
| US4076798A (en) * | 1975-05-29 | 1978-02-28 | American Cyanamid Company | High molecular weight polyester resin, the method of making the same and the use thereof as a pharmaceutical composition |
| US4011312A (en) * | 1975-06-25 | 1977-03-08 | American Home Products Corporation | Prolonged release drug form for the treatment of bovine mastitis |
| US4115544A (en) * | 1976-08-18 | 1978-09-19 | Alza Corporation | Ocular system made of bioerodible esters having linear ether |
| US4328204A (en) * | 1977-03-02 | 1982-05-04 | Ethicon, Inc. | Absorbable polymer-drug compounds and method for making same |
| WO1978000011A1 (fr) * | 1977-06-07 | 1978-12-21 | Garching Instrumente | Forme d'implant medicamenteux et procede de preparation |
| US4186189A (en) * | 1977-09-28 | 1980-01-29 | Ethicon, Inc. | Absorbable pharmaceutical compositions based on poly(alkylene oxalates) |
| US4585651A (en) * | 1978-10-17 | 1986-04-29 | Stolle Research & Development Corporation | Active/passive immunization of the internal female reproductive organs |
| US4732763A (en) * | 1978-10-17 | 1988-03-22 | Stolle Research And Development Corporation | Active/passive immunization of the internal female reproductive organs |
| AU534665B2 (en) * | 1979-09-12 | 1984-02-09 | Eli Lilly And Company | Method |
| US4293539A (en) * | 1979-09-12 | 1981-10-06 | Eli Lilly And Company | Controlled release formulations and method of treatment |
| AU539230B2 (en) * | 1979-09-12 | 1984-09-20 | Eli Lilly And Company | Parasitic formulations and method |
| DE3378250D1 (en) * | 1982-04-22 | 1988-11-24 | Ici Plc | Continuous release formulations |
| US5248700A (en) * | 1982-05-14 | 1993-09-28 | Akzo Nv | Active agent containing solid structures for prolonged release of active agents |
| DE3218150C2 (de) * | 1982-05-14 | 1986-09-25 | Akzo Gmbh, 5600 Wuppertal | Wirkstoff enthaltender Körper für die Langzeitabgabe sowie Verfahren zu dessen Herstellung |
| JPS6045522B2 (ja) * | 1982-12-08 | 1985-10-09 | 憲司 中村 | 化粧用具 |
| JP2551756B2 (ja) * | 1985-05-07 | 1996-11-06 | 武田薬品工業株式会社 | ポリオキシカルボン酸エステルおよびその製造法 |
| IN166447B (OSRAM) * | 1985-11-27 | 1990-05-12 | Ethicon Inc | |
| EP0225162B1 (en) * | 1985-11-27 | 1992-01-22 | Ethicon, Inc. | Inhibition of post-surgical adhesion formation by the topical administration of non-steroidal anti-inflammatory drug |
| US4889722A (en) * | 1985-12-16 | 1989-12-26 | Ethicon, Inc. | Method for inhibiting post-surgical adhesion formation by the topical administration of tissue plasminogen activator |
| KR870005646A (ko) * | 1985-12-16 | 1987-07-06 | 로버트 엘. 미니어 | 수술후 유착형성 억제방법 |
| JPS62228021A (ja) * | 1986-02-24 | 1987-10-06 | エチコン・インコ−ポレ−テツド | 手術後の癒着の形成を防止または減少する方法 |
| DE3620685A1 (de) * | 1986-06-20 | 1987-12-23 | Henkel Kgaa | Neue mittel zur abdeckung unverletzter und/oder verletzter bereiche menschlicher oder tierischer haut |
| US5985354A (en) | 1995-06-07 | 1999-11-16 | Brown University Research Foundation | Preparation of multiwall polymeric microcapsules from hydrophilic polymers |
| DE3734223A1 (de) * | 1987-10-09 | 1989-04-20 | Boehringer Ingelheim Kg | Implantierbares, biologisch abbaubares wirkstofffreigabesystem |
| US5424346A (en) * | 1988-08-08 | 1995-06-13 | Ecopol, Llc | Biodegradable replacement of crystal polystyrene |
| US5216050A (en) * | 1988-08-08 | 1993-06-01 | Biopak Technology, Ltd. | Blends of polyactic acid |
| US6323307B1 (en) | 1988-08-08 | 2001-11-27 | Cargill Dow Polymers, Llc | Degradation control of environmentally degradable disposable materials |
| US5180765A (en) * | 1988-08-08 | 1993-01-19 | Biopak Technology, Ltd. | Biodegradable packaging thermoplastics from lactides |
| US5252642A (en) * | 1989-03-01 | 1993-10-12 | Biopak Technology, Ltd. | Degradable impact modified polyactic acid |
| US5444113A (en) * | 1988-08-08 | 1995-08-22 | Ecopol, Llc | End use applications of biodegradable polymers |
| US5502158A (en) * | 1988-08-08 | 1996-03-26 | Ecopol, Llc | Degradable polymer composition |
| US5632727A (en) * | 1988-10-03 | 1997-05-27 | Atrix Laboratories, Inc. | Biodegradable film dressing and method for its formation |
| US5725491A (en) * | 1988-10-03 | 1998-03-10 | Atrix Laboratories, Inc. | Method of forming a biodegradable film dressing on tissue |
| US4938763B1 (en) * | 1988-10-03 | 1995-07-04 | Atrix Lab Inc | Biodegradable in-situ forming implants and method of producing the same |
| US5633002A (en) * | 1988-10-04 | 1997-05-27 | Boehringer Ingelheim Gmbh | Implantable, biodegradable system for releasing active substance |
| US5487897A (en) * | 1989-07-24 | 1996-01-30 | Atrix Laboratories, Inc. | Biodegradable implant precursor |
| USRE37950E1 (en) | 1990-04-24 | 2002-12-31 | Atrix Laboratories | Biogradable in-situ forming implants and methods of producing the same |
| US6353030B1 (en) | 1990-08-01 | 2002-03-05 | Novartis Ag | Relating to organic compounds |
| EP0509203A3 (en) | 1991-04-17 | 1993-04-14 | Christian Dr. Med. Juergens | Resorbable, physiologically acceptable copolymers and their use |
| TW247878B (OSRAM) * | 1991-07-02 | 1995-05-21 | Takeda Pharm Industry Co Ltd | |
| US5142023A (en) * | 1992-01-24 | 1992-08-25 | Cargill, Incorporated | Continuous process for manufacture of lactide polymers with controlled optical purity |
| US5258488A (en) * | 1992-01-24 | 1993-11-02 | Cargill, Incorporated | Continuous process for manufacture of lactide polymers with controlled optical purity |
| US6326458B1 (en) | 1992-01-24 | 2001-12-04 | Cargill, Inc. | Continuous process for the manufacture of lactide and lactide polymers |
| US5247058A (en) * | 1992-01-24 | 1993-09-21 | Cargill, Incorporated | Continuous process for manufacture of lactide polymers with controlled optical purity |
| US6005067A (en) * | 1992-01-24 | 1999-12-21 | Cargill Incorporated | Continuous process for manufacture of lactide polymers with controlled optical purity |
| US5247059A (en) * | 1992-01-24 | 1993-09-21 | Cargill, Incorporated | Continuous process for the manufacture of a purified lactide from esters of lactic acid |
| US5876452A (en) * | 1992-02-14 | 1999-03-02 | Board Of Regents, University Of Texas System | Biodegradable implant |
| US6013853A (en) * | 1992-02-14 | 2000-01-11 | The University Of Texas System | Continuous release polymeric implant carrier |
| EP0560014A1 (en) * | 1992-03-12 | 1993-09-15 | Atrix Laboratories, Inc. | Biodegradable film dressing and method for its formation |
| US5700485A (en) | 1992-09-10 | 1997-12-23 | Children's Medical Center Corporation | Prolonged nerve blockade by the combination of local anesthetic and glucocorticoid |
| DE69331387T2 (de) * | 1992-09-10 | 2002-08-22 | Childrens Medical Center | Biodegradierbare polymeren matrizen mit verzoegerter freisetzung von lokalanaesthetika |
| US5922340A (en) * | 1992-09-10 | 1999-07-13 | Children's Medical Center Corporation | High load formulations and methods for providing prolonged local anesthesia |
| EP0615555B1 (en) * | 1992-10-02 | 2001-03-21 | Cargill, Incorporated | A melt-stable lactide polymer fabric and process for manufacture thereof |
| US5338822A (en) * | 1992-10-02 | 1994-08-16 | Cargill, Incorporated | Melt-stable lactide polymer composition and process for manufacture thereof |
| AU5296393A (en) * | 1992-10-02 | 1994-04-26 | Cargill Incorporated | Paper having a melt-stable lactide polymer coating and process for manufacture thereof |
| US6005068A (en) | 1992-10-02 | 1999-12-21 | Cargill Incorporated | Melt-stable amorphous lactide polymer film and process for manufacture thereof |
| TW333456B (en) | 1992-12-07 | 1998-06-11 | Takeda Pharm Ind Co Ltd | A pharmaceutical composition of sustained-release preparation the invention relates to a pharmaceutical composition of sustained-release preparation which comprises a physiologically active peptide. |
| US5714573A (en) * | 1995-01-19 | 1998-02-03 | Cargill, Incorporated | Impact modified melt-stable lactide polymer compositions and processes for manufacture thereof |
| US5618850A (en) * | 1995-03-09 | 1997-04-08 | Focal, Inc. | Hydroxy-acid cosmetics |
| US5722950A (en) * | 1995-06-07 | 1998-03-03 | Atrix Laboratories, Inc. | Method for remote delivery of an aerosolized liquid |
| MX9700850A (es) * | 1995-06-09 | 1997-09-30 | Euro Celtique Sa | Formulaciones y metodos para proporcionar anestesia local prolongada. |
| DE19600095A1 (de) | 1996-01-03 | 1997-07-10 | Christian Dr Med Juergens | Verwendung von Lactidpolymeren zur Adhäsionsprophylaxe |
| WO1997049391A1 (en) | 1996-06-24 | 1997-12-31 | Euro-Celtique, S.A. | Methods for providing safe local anesthesia |
| US5756651A (en) * | 1996-07-17 | 1998-05-26 | Chronopol, Inc. | Impact modified polylactide |
| US6046187A (en) * | 1996-09-16 | 2000-04-04 | Children's Medical Center Corporation | Formulations and methods for providing prolonged local anesthesia |
| US5955097A (en) * | 1996-10-18 | 1999-09-21 | Virotex Corporation | Pharmaceutical preparation applicable to mucosal surfaces and body tissues |
| US5858531A (en) * | 1996-10-24 | 1999-01-12 | Bio Syntech | Method for preparation of polymer microparticles free of organic solvent traces |
| US6126919A (en) | 1997-02-07 | 2000-10-03 | 3M Innovative Properties Company | Biocompatible compounds for pharmaceutical drug delivery systems |
| US5945126A (en) * | 1997-02-13 | 1999-08-31 | Oakwood Laboratories L.L.C. | Continuous microsphere process |
| US6248345B1 (en) | 1997-07-02 | 2001-06-19 | Euro-Celtique, S.A. | Prolonged anesthesia in joints and body spaces |
| US7128927B1 (en) | 1998-04-14 | 2006-10-31 | Qlt Usa, Inc. | Emulsions for in-situ delivery systems |
| US6143314A (en) * | 1998-10-28 | 2000-11-07 | Atrix Laboratories, Inc. | Controlled release liquid delivery compositions with low initial drug burst |
| US6270802B1 (en) | 1998-10-28 | 2001-08-07 | Oakwood Laboratories L.L.C. | Method and apparatus for formulating microspheres and microcapsules |
| DE59910844D1 (de) | 1999-08-18 | 2004-11-18 | Juergens Christian | Resorbierbare Copolylactide und ihre Verwendung |
| US8226598B2 (en) * | 1999-09-24 | 2012-07-24 | Tolmar Therapeutics, Inc. | Coupling syringe system and methods for obtaining a mixed composition |
| ES2491866T3 (es) * | 1999-11-15 | 2014-09-08 | Piramal Healthcare (Canada) Limited | Disolución biopolimérica acuosa autogelificante controlada por la temperatura y dependiente del pH |
| DK1294414T3 (da) | 2000-06-29 | 2006-07-24 | Biosyntech Canada Inc | Præparat og fremgangsmåde til heling og regenerering af brusk og andre væv |
| CN1269870C (zh) * | 2000-08-07 | 2006-08-16 | 和光纯药工业株式会社 | 乳酸聚合物及其制备方法 |
| US20040091540A1 (en) * | 2000-11-15 | 2004-05-13 | Desrosiers Eric Andre | Method for restoring a damaged or degenerated intervertebral disc |
| WO2002058670A1 (en) * | 2001-01-25 | 2002-08-01 | Euroceltique S.A. | Local anesthetic, and method of use |
| WO2002100357A1 (en) * | 2001-06-12 | 2002-12-19 | Trial Corporation | Cosmetic |
| TW200526267A (en) * | 2001-06-29 | 2005-08-16 | Takeda Chemical Industries Ltd | Controlled release composition and method of producing the same |
| US8603514B2 (en) | 2002-04-11 | 2013-12-10 | Monosol Rx, Llc | Uniform films for rapid dissolve dosage form incorporating taste-masking compositions |
| US20070281003A1 (en) | 2001-10-12 | 2007-12-06 | Fuisz Richard C | Polymer-Based Films and Drug Delivery Systems Made Therefrom |
| US7357891B2 (en) | 2001-10-12 | 2008-04-15 | Monosol Rx, Llc | Process for making an ingestible film |
| US20110033542A1 (en) | 2009-08-07 | 2011-02-10 | Monosol Rx, Llc | Sublingual and buccal film compositions |
| US20190328679A1 (en) | 2001-10-12 | 2019-10-31 | Aquestive Therapeutics, Inc. | Uniform films for rapid-dissolve dosage form incorporating anti-tacking compositions |
| US7910641B2 (en) | 2001-10-12 | 2011-03-22 | Monosol Rx, Llc | PH modulated films for delivery of actives |
| US10285910B2 (en) | 2001-10-12 | 2019-05-14 | Aquestive Therapeutics, Inc. | Sublingual and buccal film compositions |
| US8765167B2 (en) | 2001-10-12 | 2014-07-01 | Monosol Rx, Llc | Uniform films for rapid-dissolve dosage form incorporating anti-tacking compositions |
| US8900498B2 (en) | 2001-10-12 | 2014-12-02 | Monosol Rx, Llc | Process for manufacturing a resulting multi-layer pharmaceutical film |
| US8900497B2 (en) | 2001-10-12 | 2014-12-02 | Monosol Rx, Llc | Process for making a film having a substantially uniform distribution of components |
| US11207805B2 (en) | 2001-10-12 | 2021-12-28 | Aquestive Therapeutics, Inc. | Process for manufacturing a resulting pharmaceutical film |
| US7264822B2 (en) * | 2002-04-03 | 2007-09-04 | Poly-Med, Inc. | Conjugated drug-polymer coated stent |
| WO2003090807A1 (en) * | 2002-04-24 | 2003-11-06 | Poly-Med, Inc. | Multifaceted endovascular stent coating for preventing restenosis |
| CA2819769C (en) | 2003-07-18 | 2016-06-28 | Oakwood Laboratories, L.L.C. | Prevention of molecular weight reduction of the polymer, impurity formation and gelling in polymer compositions |
| AU2006329819A1 (en) * | 2005-12-27 | 2007-07-05 | Monosol Rx Llc | pH modulated films for delivery of actives |
| EA016176B1 (ru) | 2006-12-18 | 2012-02-28 | Такеда Фармасьютикал Компани Лимитед | Композиция с замедленным высвобождением и способ её получения |
| EP2598553B1 (en) * | 2010-07-26 | 2016-04-27 | Université de Genève | Compositions comprising polymers prepared from 2-hydroxyalkyl acids |
| US9149959B2 (en) | 2010-10-22 | 2015-10-06 | Monosol Rx, Llc | Manufacturing of small film strips |
| DE102013209897A1 (de) * | 2013-05-28 | 2014-12-04 | Henkel Ag & Co. Kgaa | Kosmetisches Hautpflegemittel |
| US12427121B2 (en) | 2016-05-05 | 2025-09-30 | Aquestive Therapeutics, Inc. | Enhanced delivery epinephrine compositions |
| US11273131B2 (en) | 2016-05-05 | 2022-03-15 | Aquestive Therapeutics, Inc. | Pharmaceutical compositions with enhanced permeation |
| CA3022840A1 (en) | 2016-05-05 | 2017-11-09 | Aquestive Therapeutics, Inc. | Enhanced delivery epinephrine compositions |
| US12433850B2 (en) | 2016-05-05 | 2025-10-07 | Aquestive Therapeutics, Inc. | Enhanced delivery epinephrine and prodrug compositions |
| IT201700058311A1 (it) | 2017-05-29 | 2018-11-29 | Bio Lo Ga Srl | Formulazione a base di vitamina E o di un suo estere per il trattamento di biofilm batterici e fungini |
| US20210196648A1 (en) * | 2019-12-31 | 2021-07-01 | Industrial Technology Research Institute | Drug-containing multilayer film and method for forming the same |
| DE102020215294A1 (de) * | 2020-12-03 | 2022-06-23 | Polymedics Innovations Gmbh | Pflasterzubereitung, Polymerfilm, Sprühpflastersprühvorrichtung, Verfahren zur Herstellung eines Polymerfaservlieses, Polymerfaservlies und Verwendungen der Pflasterzubereitung |
| EP4422607A4 (en) | 2021-10-25 | 2025-09-03 | Aquestive Therapeutics Inc | ORAL AND NASAL COMPOSITIONS AND METHODS OF TREATMENT |
-
1971
- 1971-02-23 US US00118081A patent/US3755558A/en not_active Expired - Lifetime
-
1972
- 1972-02-08 CA CA134,263,A patent/CA950828A/en not_active Expired
- 1972-02-18 DE DE19722207635 patent/DE2207635A1/de not_active Withdrawn
- 1972-02-22 FR FR7205884A patent/FR2126270B1/fr not_active Expired
- 1972-02-23 GB GB839572A patent/GB1351409A/en not_active Expired
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2640905A1 (de) * | 1975-09-12 | 1977-03-17 | Anic Spa | Verfahren zum okkludieren von substanzen verschiedener art in feinfaserige gefuege |
| AT382076B (de) * | 1982-10-15 | 1987-01-12 | Chemie Linz Ag | Verfahren zur herstellung von presslingen mit retardierter wirkstofffreisetzung |
| DE4112489A1 (de) * | 1991-04-17 | 1992-10-22 | Christian Dr Med Juergens | Resorbierbare, physiologisch unbedenkliche copolymere und deren verwendung |
| DE4229924A1 (de) * | 1991-04-17 | 1994-03-10 | Juergens Christian Dr Med | Verwendung von resorbierbaren Lactidcopolymeren |
| DE4230154A1 (de) * | 1991-04-17 | 1994-03-10 | Juergens Christian Dr Med | Verwendung von Lactidpolymeren zur Wundabdeckung |
| US5576418A (en) * | 1992-06-29 | 1996-11-19 | Jurgens; Christian | Resorbable biocompatible copolymers and their use |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1351409A (en) | 1974-05-01 |
| FR2126270A1 (OSRAM) | 1972-10-06 |
| FR2126270B1 (OSRAM) | 1975-11-28 |
| CA950828A (en) | 1974-07-09 |
| US3755558A (en) | 1973-08-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2207635A1 (de) | Polylactidhaltige pharmazeutische Zubereitungen | |
| DE2051580C3 (de) | Für die parenterale Verabreichung geeignete wirkstoffhaltige pharmazeutische Zubereitungen | |
| DE69332210T2 (de) | Biologisch abbaubares, schmelzgesponnenes abgabesystem zur kontrollierten freisetzung | |
| DE69110150T2 (de) | Mikrokapseln mit verzögerter Wirkstoffabgabe. | |
| DE68904326T2 (de) | Physiologisch aktive substanzen enthaltende mikrosphaeren des polymilchsaeuretyps sowie verfahren zu deren herstellung. | |
| DE3382587T2 (de) | Injizierbares langwirkendes mikroteilchen-praeparat zur verabreichung entzuendungshemmender mittel. | |
| DE2842088A1 (de) | Arzneimittel mit verzoegerter wirkstoffabgabe | |
| AT395584B (de) | Verfahren zur herstellung neuer ester | |
| DE69129770T2 (de) | Biologisch abbaubare hochmolekulare Polymere, ihre Herstellung und ihre Verwendung | |
| DE60220519T2 (de) | Mizellares arzneistoffverabreichungssystem für hydrophobe arzneistoffe | |
| EP0797609A1 (de) | Polyester | |
| DE3486029T2 (de) | Ifn-praeparat mit verzoegerter abgabe fuer parentale verabreichung. | |
| DE3345314A1 (de) | Oligomere hydroxycarbonsaeurederivate, deren herstellung und verwendung | |
| DE2933250A1 (de) | Abdeckmaterial | |
| DE2842089A1 (de) | Arzneimittel mit verzoegerter wirkstoffabgabe | |
| JPH08505836A (ja) | 表面活性剤を含有しない生体再吸収性重合体微小球、その製造及び薬剤としてその応用 | |
| DE2809034A1 (de) | Cokondensate von aktive wasserstoffatome enthaltenden arzneistoffen mit polyestern oder mischpolyestern | |
| WO2002038646A2 (de) | Neue polyester, verfahren zu ihrer herstellung und aus den polyestern hergestellte depot-arzneiformen | |
| EP0094513B1 (de) | Wirkstoff enthaltender Körper für die Langzeitabgabe | |
| DE2721603A1 (de) | Beschichtete koernchen aus alkalimetallsalzen der polyacrylsaeure und verfahren zu ihrer herstellung | |
| DE3782117T2 (de) | Verkapselung von trh bzw. dessen analoga. | |
| EP0108882B1 (de) | Presslinge mit retardierter Wirkstofffreisetzung und Verfahren zu deren Herstellung | |
| DE3841397C2 (OSRAM) | ||
| EP0509203A2 (de) | Resorbierbare, physiologisch unbedenkliche Copolymere und deren Verwendung | |
| DE69321215T2 (de) | Ester aus pektin und pektinische saure |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8161 | Application of addition to: |
Ref document number: 2051580 Country of ref document: DE Format of ref document f/p: P |
|
| 8130 | Withdrawal |