DE2202486C3 - Verfahren zur Herstellung von Derivaten von 10,11-Dihydro-dibenzo [bfl azepinon-10 - Google Patents
Verfahren zur Herstellung von Derivaten von 10,11-Dihydro-dibenzo [bfl azepinon-10Info
- Publication number
- DE2202486C3 DE2202486C3 DE2202486A DE2202486A DE2202486C3 DE 2202486 C3 DE2202486 C3 DE 2202486C3 DE 2202486 A DE2202486 A DE 2202486A DE 2202486 A DE2202486 A DE 2202486A DE 2202486 C3 DE2202486 C3 DE 2202486C3
- Authority
- DE
- Germany
- Prior art keywords
- ecm
- carbon atoms
- anhydrous
- solution
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000002360 preparation method Methods 0.000 title claims description 11
- 238000000034 method Methods 0.000 title claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 21
- 150000002148 esters Chemical class 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 27
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 25
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- 239000012153 distilled water Substances 0.000 description 12
- 235000019441 ethanol Nutrition 0.000 description 10
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 8
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 8
- 229910052744 lithium Inorganic materials 0.000 description 8
- WAEMHISTVIYWOY-UHFFFAOYSA-N 2-(2-methylanilino)benzoic acid Chemical compound CC1=CC=CC=C1NC1=CC=CC=C1C(O)=O WAEMHISTVIYWOY-UHFFFAOYSA-N 0.000 description 7
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 7
- 238000009835 boiling Methods 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 5
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- -1 hexamethylphosphoric acid Chemical compound 0.000 description 5
- YDGSUPBDGKOGQT-UHFFFAOYSA-N lithium;dimethylazanide Chemical compound [Li+].C[N-]C YDGSUPBDGKOGQT-UHFFFAOYSA-N 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 239000012300 argon atmosphere Substances 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 125000000623 heterocyclic group Chemical group 0.000 description 4
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 4
- 229910052753 mercury Inorganic materials 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 239000008096 xylene Substances 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 229940098779 methanesulfonic acid Drugs 0.000 description 3
- QFTCUEDXEQPNHF-UHFFFAOYSA-N methyl 2-(2-methylanilino)benzoate Chemical compound COC(=O)C1=CC=CC=C1NC1=CC=CC=C1C QFTCUEDXEQPNHF-UHFFFAOYSA-N 0.000 description 3
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 150000001412 amines Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 239000001530 fumaric acid Substances 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 2
- DWNRISLZVCBTRN-UHFFFAOYSA-N lithium;piperidin-1-ide Chemical compound [Li]N1CCCCC1 DWNRISLZVCBTRN-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 150000003385 sodium Chemical class 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 description 1
- ZSMRRZONCYIFNB-UHFFFAOYSA-N 6,11-dihydro-5h-benzo[b][1]benzazepine Chemical compound C1CC2=CC=CC=C2NC2=CC=CC=C12 ZSMRRZONCYIFNB-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- UZVGSSNIUNSOFA-UHFFFAOYSA-N dibenzofuran-1-carboxylic acid Chemical class O1C2=CC=CC=C2C2=C1C=CC=C2C(=O)O UZVGSSNIUNSOFA-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- VFNOXQPPJXXRNB-UHFFFAOYSA-N hydroxymethyl dihydrogen phosphate Chemical compound OCOP(O)(O)=O VFNOXQPPJXXRNB-UHFFFAOYSA-N 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- DLENDKSMPIEGPF-UHFFFAOYSA-N lithium piperidine Chemical compound [Li+].C1CCNCC1 DLENDKSMPIEGPF-UHFFFAOYSA-N 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 125000005948 methanesulfonyloxy group Chemical group 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 238000000053 physical method Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D223/00—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom
- C07D223/14—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D223/18—Dibenzazepines; Hydrogenated dibenzazepines
- C07D223/22—Dibenz [b, f] azepines; Hydrogenated dibenz [b, f] azepines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7101647A FR2122305B1 (OSRAM) | 1971-01-19 | 1971-01-19 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2202486A1 DE2202486A1 (de) | 1972-08-03 |
| DE2202486B2 DE2202486B2 (de) | 1978-08-17 |
| DE2202486C3 true DE2202486C3 (de) | 1979-04-26 |
Family
ID=9070505
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2202486A Expired DE2202486C3 (de) | 1971-01-19 | 1972-01-19 | Verfahren zur Herstellung von Derivaten von 10,11-Dihydro-dibenzo [bfl azepinon-10 |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US3821197A (OSRAM) |
| JP (1) | JPS4837037B2 (OSRAM) |
| AT (1) | AT313905B (OSRAM) |
| AU (1) | AU454492B2 (OSRAM) |
| BE (1) | BE778208A (OSRAM) |
| CA (1) | CA953722A (OSRAM) |
| CH (1) | CH546766A (OSRAM) |
| CS (1) | CS167963B2 (OSRAM) |
| DD (1) | DD98928A5 (OSRAM) |
| DE (1) | DE2202486C3 (OSRAM) |
| ES (1) | ES399022A1 (OSRAM) |
| FR (1) | FR2122305B1 (OSRAM) |
| GB (1) | GB1328602A (OSRAM) |
| HU (1) | HU163154B (OSRAM) |
| IE (1) | IE36061B1 (OSRAM) |
| IL (1) | IL38568A (OSRAM) |
| IT (1) | IT995024B (OSRAM) |
| NL (1) | NL157301B (OSRAM) |
| SU (1) | SU435613A3 (OSRAM) |
| ZA (1) | ZA72304B (OSRAM) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2198942B1 (OSRAM) * | 1972-09-12 | 1975-03-14 | Rhone Poulenc Ind | |
| JPS5274934U (OSRAM) * | 1975-11-29 | 1977-06-04 | ||
| JPS5435220Y2 (OSRAM) * | 1975-12-16 | 1979-10-26 | ||
| US20090320724A1 (en) * | 2008-06-27 | 2009-12-31 | Walburn William L | Swivel base with installation aid |
-
1971
- 1971-01-19 FR FR7101647A patent/FR2122305B1/fr not_active Expired
-
1972
- 1972-01-11 NL NL7200407.A patent/NL157301B/xx not_active IP Right Cessation
- 1972-01-11 SU SU1732456A patent/SU435613A3/ru active
- 1972-01-17 JP JP47006848A patent/JPS4837037B2/ja not_active Expired
- 1972-01-17 CA CA132,616*7A patent/CA953722A/en not_active Expired
- 1972-01-17 CS CS285A patent/CS167963B2/cs unknown
- 1972-01-17 AU AU38004/72A patent/AU454492B2/en not_active Expired
- 1972-01-17 US US00218528A patent/US3821197A/en not_active Expired - Lifetime
- 1972-01-17 IE IE60/72A patent/IE36061B1/xx unknown
- 1972-01-17 IL IL38568A patent/IL38568A/xx unknown
- 1972-01-18 HU HURO640A patent/HU163154B/hu unknown
- 1972-01-18 BE BE778208A patent/BE778208A/xx not_active IP Right Cessation
- 1972-01-18 CH CH72672A patent/CH546766A/fr not_active IP Right Cessation
- 1972-01-18 GB GB242572A patent/GB1328602A/en not_active Expired
- 1972-01-18 DD DD160393A patent/DD98928A5/xx unknown
- 1972-01-19 ES ES399022A patent/ES399022A1/es not_active Expired
- 1972-01-19 AT AT42572A patent/AT313905B/de not_active IP Right Cessation
- 1972-01-19 IT IT19557/72A patent/IT995024B/it active
- 1972-01-19 DE DE2202486A patent/DE2202486C3/de not_active Expired
- 1972-08-22 ZA ZA720304*[A patent/ZA72304B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL38568A0 (en) | 1972-03-28 |
| CH546766A (fr) | 1974-03-15 |
| FR2122305A1 (OSRAM) | 1972-09-01 |
| US3821197A (en) | 1974-06-28 |
| JPS4714187A (OSRAM) | 1972-08-04 |
| GB1328602A (en) | 1973-08-30 |
| BE778208A (fr) | 1972-07-18 |
| IL38568A (en) | 1975-05-22 |
| CS167963B2 (OSRAM) | 1976-05-28 |
| HU163154B (OSRAM) | 1973-06-28 |
| NL7200407A (OSRAM) | 1972-07-21 |
| AT313905B (de) | 1974-03-11 |
| IT995024B (it) | 1975-11-10 |
| IE36061B1 (en) | 1976-08-04 |
| JPS4837037B2 (OSRAM) | 1973-11-08 |
| ZA72304B (en) | 1972-09-27 |
| AU3800472A (en) | 1973-07-19 |
| DD98928A5 (OSRAM) | 1973-07-12 |
| AU454492B2 (en) | 1974-10-31 |
| IE36061L (en) | 1972-07-19 |
| NL157301B (nl) | 1978-07-17 |
| ES399022A1 (es) | 1974-11-16 |
| SU435613A3 (OSRAM) | 1974-07-05 |
| DE2202486A1 (de) | 1972-08-03 |
| FR2122305B1 (OSRAM) | 1973-11-30 |
| DE2202486B2 (de) | 1978-08-17 |
| CA953722A (en) | 1974-08-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH417574A (de) | Verfahren zur Herstellung therapeutisch wirksamer Dibenzocycloheptanderivate | |
| DE2202486B2 (de) | Verfahren zur Herstellung von Derivaten von 10,11-Dihydro-dibenzo [bfl azepinon-10 | |
| DE1793693B2 (OSRAM) | ||
| CH643843A5 (de) | Phenthiazin-derivate, verfahren zu ihrer herstellung und sie enthaltende pharmazeutische praeparate. | |
| DE2331665A1 (de) | Dialkylaminoalkylester von arylaliphatischen saeuren und ihre saeureadditionssalze und verfahren zu deren herstellung | |
| DE2412798A1 (de) | Neue phenylpropylaminderivate und verfahren zu ihrer herstellung | |
| DE2820687C2 (de) | Substituierte Chinolizidinderivate, Verfahren zu deren Herstellung und diese enthaltende Mittel | |
| AT226724B (de) | Verfahren zur Herstellung von neuen 1-Aza-thioxanthen-Derivaten | |
| AT259553B (de) | Verfahren zur Herstellung von Indolderivaten | |
| DE2606789A1 (de) | Oxoindanylpropionsaeuren und verfahren zu ihrer herstellung | |
| AT328445B (de) | Verfahren zur herstellung neuer 4- (1-alkyl-4-piperidyliden) -4h-benzo (4,5) cyclohepta (1,2-b)thiophen-10 (9h) -on verbindungen und ihrer saureadditionssalze | |
| DE1568253C (de) | N substituierte 1,2 Diphenyl 2 acyloxy 3 amino methyl butene | |
| AT208357B (de) | Verfahren zur Herstellung von neuen, esterartigen Piperidinderivaten | |
| DE2511621A1 (de) | Verfahren zur herstellung neuer heterocyclischer verbindungen | |
| AT330779B (de) | Verfahren zur herstellung von neuen chinolinessigsaurederivaten und ihren salzen | |
| CH638490A5 (de) | Anilide mit hustenhemmender wirkung und verfahren zur herstellung derselben. | |
| DE672435C (de) | Verfahren zur Isomerisierung des í¸5,6-Dehydroandrosterons und sich davon ableitender Verbindungen | |
| AT231434B (de) | Verfahren zur Herstellung von neuen Malonsäurederivaten | |
| DE2340160A1 (de) | Norbornanderivate | |
| AT243268B (de) | Verfahren zur Herstellung von neuen Benzochinolizin-Derivaten | |
| AT208866B (de) | Verfahren zur Herstellung von neuen Phenthiazinverbindungen | |
| CH529755A (de) | Verfahren zur Herstellung des neuen 4-Benzoyl-4-hydroxy-3-phenylpiperidins | |
| DE1906781A1 (de) | Substituierte 3-Benzazocin-6-one und Verfahren zu ihrer Herstellung | |
| CH346543A (de) | Verfahren zur Herstellung von neuen Piperidinderivaten | |
| CH526546A (de) | Verfahren zur Herstellung neuer 3-Phenylpiperidinderivate |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |