DE2165764A1 - Lichtempfindliche, photographische Silberhalogenidmaterialien - Google Patents
Lichtempfindliche, photographische SilberhalogenidmaterialienInfo
- Publication number
- DE2165764A1 DE2165764A1 DE19712165764 DE2165764A DE2165764A1 DE 2165764 A1 DE2165764 A1 DE 2165764A1 DE 19712165764 DE19712165764 DE 19712165764 DE 2165764 A DE2165764 A DE 2165764A DE 2165764 A1 DE2165764 A1 DE 2165764A1
- Authority
- DE
- Germany
- Prior art keywords
- silver halide
- group
- emulsion
- light
- dye
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 Silver halide Chemical class 0.000 title claims description 63
- 229910052709 silver Inorganic materials 0.000 title claims description 45
- 239000004332 silver Substances 0.000 title claims description 45
- 239000000463 material Substances 0.000 title claims description 23
- 229910052751 metal Inorganic materials 0.000 claims description 17
- 239000002184 metal Substances 0.000 claims description 17
- 150000001875 compounds Chemical class 0.000 claims description 10
- 230000001235 sensitizing effect Effects 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 5
- 230000000737 periodic effect Effects 0.000 claims description 4
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 3
- 125000004429 atom Chemical group 0.000 claims description 3
- 239000011230 binding agent Substances 0.000 claims description 3
- 125000001434 methanylylidene group Chemical group [H]C#[*] 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 125000003107 substituted aryl group Chemical group 0.000 claims description 3
- IMSODMZESSGVBE-UHFFFAOYSA-N 2-Oxazoline Chemical compound C1CN=CO1 IMSODMZESSGVBE-UHFFFAOYSA-N 0.000 claims 1
- 239000000839 emulsion Substances 0.000 description 56
- 239000000975 dye Substances 0.000 description 33
- 230000035945 sensitivity Effects 0.000 description 24
- 229910052741 iridium Inorganic materials 0.000 description 16
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 15
- 238000000034 method Methods 0.000 description 15
- 230000000052 comparative effect Effects 0.000 description 13
- 150000002736 metal compounds Chemical class 0.000 description 11
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 8
- 229910052700 potassium Inorganic materials 0.000 description 8
- 239000011591 potassium Substances 0.000 description 8
- 150000003839 salts Chemical class 0.000 description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 5
- 238000011161 development Methods 0.000 description 5
- 230000018109 developmental process Effects 0.000 description 5
- 230000005070 ripening Effects 0.000 description 5
- 206010070834 Sensitisation Diseases 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000004848 polyfunctional curative Substances 0.000 description 4
- 230000008313 sensitization Effects 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- 125000003504 2-oxazolinyl group Chemical group O1C(=NCC1)* 0.000 description 3
- 229920002799 BoPET Polymers 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- 235000010724 Wisteria floribunda Nutrition 0.000 description 3
- SJOOOZPMQAWAOP-UHFFFAOYSA-N [Ag].BrCl Chemical compound [Ag].BrCl SJOOOZPMQAWAOP-UHFFFAOYSA-N 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 229910052724 xenon Inorganic materials 0.000 description 3
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 3
- LUMLZKVIXLWTCI-NSCUHMNNSA-N (e)-2,3-dichloro-4-oxobut-2-enoic acid Chemical compound OC(=O)C(\Cl)=C(/Cl)C=O LUMLZKVIXLWTCI-NSCUHMNNSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 101150003085 Pdcl gene Proteins 0.000 description 2
- 229910021604 Rhodium(III) chloride Inorganic materials 0.000 description 2
- 239000012190 activator Substances 0.000 description 2
- 230000005540 biological transmission Effects 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- ZAKLKBFCSHJIRI-UHFFFAOYSA-N mucochloric acid Natural products OC1OC(=O)C(Cl)=C1Cl ZAKLKBFCSHJIRI-UHFFFAOYSA-N 0.000 description 2
- KBJMLQFLOWQJNF-UHFFFAOYSA-N nickel(ii) nitrate Chemical compound [Ni+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O KBJMLQFLOWQJNF-UHFFFAOYSA-N 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- GPNDARIEYHPYAY-UHFFFAOYSA-N palladium(ii) nitrate Chemical compound [Pd+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O GPNDARIEYHPYAY-UHFFFAOYSA-N 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 230000035699 permeability Effects 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229920000139 polyethylene terephthalate Polymers 0.000 description 2
- 239000005020 polyethylene terephthalate Substances 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- 239000001397 quillaja saponaria molina bark Substances 0.000 description 2
- SONJTKJMTWTJCT-UHFFFAOYSA-K rhodium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Rh+3] SONJTKJMTWTJCT-UHFFFAOYSA-K 0.000 description 2
- 229930182490 saponin Natural products 0.000 description 2
- 150000007949 saponins Chemical class 0.000 description 2
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- AWDBHOZBRXWRKS-UHFFFAOYSA-N tetrapotassium;iron(6+);hexacyanide Chemical compound [K+].[K+].[K+].[K+].[Fe+6].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] AWDBHOZBRXWRKS-UHFFFAOYSA-N 0.000 description 2
- YHMYGUUIMTVXNW-UHFFFAOYSA-N 1,3-dihydrobenzimidazole-2-thione Chemical compound C1=CC=C2NC(S)=NC2=C1 YHMYGUUIMTVXNW-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- 125000000143 2-carboxyethyl group Chemical group [H]OC(=O)C([H])([H])C([H])([H])* 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- ZXTHWIZHGLNEPG-UHFFFAOYSA-N 2-phenyl-4,5-dihydro-1,3-oxazole Chemical group O1CCN=C1C1=CC=CC=C1 ZXTHWIZHGLNEPG-UHFFFAOYSA-N 0.000 description 1
- KOAMXHRRVFDWRQ-UHFFFAOYSA-N 4,4-dimethyl-5h-1,3-oxazole Chemical group CC1(C)COC=N1 KOAMXHRRVFDWRQ-UHFFFAOYSA-N 0.000 description 1
- SXIFAEWFOJETOA-UHFFFAOYSA-N 4-hydroxy-butyl Chemical group [CH2]CCCO SXIFAEWFOJETOA-UHFFFAOYSA-N 0.000 description 1
- ZVNPWFOVUDMGRP-UHFFFAOYSA-N 4-methylaminophenol sulfate Chemical compound OS(O)(=O)=O.CNC1=CC=C(O)C=C1.CNC1=CC=C(O)C=C1 ZVNPWFOVUDMGRP-UHFFFAOYSA-N 0.000 description 1
- CIIILUMBZOGKDF-UHFFFAOYSA-N 5-methyl-4,5-dihydro-1,3-oxazole Chemical group CC1CN=CO1 CIIILUMBZOGKDF-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 229910021638 Iridium(III) chloride Inorganic materials 0.000 description 1
- 241001397173 Kali <angiosperm> Species 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 229910021586 Nickel(II) chloride Inorganic materials 0.000 description 1
- 229910021605 Palladium(II) bromide Inorganic materials 0.000 description 1
- 206010034960 Photophobia Diseases 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 229910021607 Silver chloride Inorganic materials 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 1
- 229910001864 baryta Inorganic materials 0.000 description 1
- 238000005282 brightening Methods 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- RKBAPHPQTADBIK-UHFFFAOYSA-N cobalt;hexacyanide Chemical compound [Co].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] RKBAPHPQTADBIK-UHFFFAOYSA-N 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- OAGAGESCFZXSJR-UHFFFAOYSA-L dichloroosmium Chemical compound Cl[Os]Cl OAGAGESCFZXSJR-UHFFFAOYSA-L 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- XOLNQIIEFUNTQC-UHFFFAOYSA-H dipotassium;hexachlororuthenium(2-) Chemical compound [Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[K+].[K+].[Ru+4] XOLNQIIEFUNTQC-UHFFFAOYSA-H 0.000 description 1
- MQRJBSHKWOFOGF-UHFFFAOYSA-L disodium;carbonate;hydrate Chemical compound O.[Na+].[Na+].[O-]C([O-])=O MQRJBSHKWOFOGF-UHFFFAOYSA-L 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000002344 gold compounds Chemical class 0.000 description 1
- 238000005286 illumination Methods 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- MILUBEOXRNEUHS-UHFFFAOYSA-N iridium(3+) Chemical compound [Ir+3] MILUBEOXRNEUHS-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 1
- 208000013469 light sensitivity Diseases 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 239000003595 mist Substances 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 description 1
- 231100001160 nonlethal Toxicity 0.000 description 1
- 210000001331 nose Anatomy 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- INIOZDBICVTGEO-UHFFFAOYSA-L palladium(ii) bromide Chemical compound Br[Pd]Br INIOZDBICVTGEO-UHFFFAOYSA-L 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 150000003057 platinum Chemical class 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000010076 replication Effects 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- YBCAZPLXEGKKFM-UHFFFAOYSA-K ruthenium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Ru+3] YBCAZPLXEGKKFM-UHFFFAOYSA-K 0.000 description 1
- ZUNKMNLKJXRCDM-UHFFFAOYSA-N silver bromoiodide Chemical compound [Ag].IBr ZUNKMNLKJXRCDM-UHFFFAOYSA-N 0.000 description 1
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- CALMYRPSSNRCFD-UHFFFAOYSA-J tetrachloroiridium Chemical compound Cl[Ir](Cl)(Cl)Cl CALMYRPSSNRCFD-UHFFFAOYSA-J 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- DANYXEHCMQHDNX-UHFFFAOYSA-K trichloroiridium Chemical compound Cl[Ir](Cl)Cl DANYXEHCMQHDNX-UHFFFAOYSA-K 0.000 description 1
- 230000025594 tube development Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/005—Silver halide emulsions; Preparation thereof; Physical treatment thereof; Incorporation of additives therein
- G03C1/06—Silver halide emulsions; Preparation thereof; Physical treatment thereof; Incorporation of additives therein with non-macromolecular additives
- G03C1/08—Sensitivity-increasing substances
- G03C1/10—Organic substances
- G03C1/12—Methine and polymethine dyes
- G03C1/22—Methine and polymethine dyes with an even number of CH groups
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/005—Silver halide emulsions; Preparation thereof; Physical treatment thereof; Incorporation of additives therein
- G03C1/06—Silver halide emulsions; Preparation thereof; Physical treatment thereof; Incorporation of additives therein with non-macromolecular additives
- G03C1/08—Sensitivity-increasing substances
- G03C1/09—Noble metals or mercury; Salts or compounds thereof; Sulfur, selenium or tellurium, or compounds thereof, e.g. for chemical sensitising
Landscapes
- Physics & Mathematics (AREA)
- Chemical & Material Sciences (AREA)
- Spectroscopy & Molecular Physics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Fax Reproducing Arrangements (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP45123036A JPS4914265B1 (enExample) | 1970-12-30 | 1970-12-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2165764A1 true DE2165764A1 (de) | 1972-07-20 |
Family
ID=14850608
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712165764 Pending DE2165764A1 (de) | 1970-12-30 | 1971-12-30 | Lichtempfindliche, photographische Silberhalogenidmaterialien |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3790390A (enExample) |
| JP (1) | JPS4914265B1 (enExample) |
| BE (1) | BE777530A (enExample) |
| CA (1) | CA971815A (enExample) |
| DE (1) | DE2165764A1 (enExample) |
| FR (1) | FR2121086A5 (enExample) |
| GB (1) | GB1367700A (enExample) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3982950A (en) * | 1971-12-28 | 1976-09-28 | Fuji Photo Film Co., Ltd. | Silver halide photographic emulsion for use in flash exposure |
| US4160669A (en) * | 1975-03-17 | 1979-07-10 | Teiji Habu | Argon laser flash exposure of spectrally sensitized silver halide photographic material |
| JPS51139323A (en) * | 1975-05-27 | 1976-12-01 | Konishiroku Photo Ind Co Ltd | Silver halide photographic emulsifier for scintilation exposure |
| GB8609135D0 (en) * | 1986-04-15 | 1986-05-21 | Minnesota Mining & Mfg | Silver halide photographic materials |
| GB8610382D0 (en) * | 1986-04-28 | 1986-06-04 | Minnesota Mining & Mfg | Silver halide photographic materials |
| GB8624704D0 (en) * | 1986-10-15 | 1986-11-19 | Minnesota Mining & Mfg | High contrast scanner photographic elements |
| US4835093A (en) * | 1988-04-08 | 1989-05-30 | Eastman Kodak Company | Internally doped silver halide emulsions |
| US4945035A (en) * | 1988-04-08 | 1990-07-31 | Eastman Kodak Company | Photographic emulsions containing internally modified silver halide grains |
| US4933272A (en) * | 1988-04-08 | 1990-06-12 | Eastman Kodak Company | Photographic emulsions containing internally modified silver halide grains |
| US4937180A (en) * | 1988-04-08 | 1990-06-26 | Eastman Kodak Company | Photographic emulsions containing internally modified silver halide grains |
| US4981781A (en) * | 1989-08-28 | 1991-01-01 | Eastman Kodak Company | Photographic emulsions containing internally modified silver halide grains |
| US5037732A (en) * | 1989-08-28 | 1991-08-06 | Eastman Kodak Company | Photographic emulsions containing internally modified silver halide grains |
| US5132203A (en) * | 1991-03-11 | 1992-07-21 | Eastman Kodak Company | Tabular grain emulsions containing laminar halide strata |
| US5264336A (en) * | 1991-04-10 | 1993-11-23 | Eastman Kodak Company | Silver brom(oiod)ide emulsions of increased sensitivity in the near infrared |
| US5268264A (en) * | 1991-04-10 | 1993-12-07 | Eastman Kodak Company | Spectrally sensitized octahedral emulsions with buried shell sensitization |
| US5320938A (en) * | 1992-01-27 | 1994-06-14 | Eastman Kodak Company | High chloride tabular grain emulsions and processes for their preparation |
| JPH06110148A (ja) * | 1992-04-30 | 1994-04-22 | Eastman Kodak Co | 乳剤の相反則不軌の低減方法およびその方法により製造されたハロゲン化銀乳剤を含んでなる写真要素 |
| US5360712A (en) * | 1993-07-13 | 1994-11-01 | Eastman Kodak Company | Internally doped silver halide emulsions and processes for their preparation |
| US5434043A (en) * | 1994-05-09 | 1995-07-18 | Minnesota Mining And Manufacturing Company | Photothermographic element with pre-formed iridium-doped silver halide grains |
| US5457021A (en) * | 1994-05-16 | 1995-10-10 | Eastman Kodak Company | Internally doped high chloride {100} tabular grain emulsions |
| US5462849A (en) * | 1994-10-27 | 1995-10-31 | Eastman Kodak Company | Silver halide emulsions with doped epitaxy |
| US5518872A (en) * | 1994-11-09 | 1996-05-21 | Eastman Kodak Company | Emulsion and photographic element |
| JP3444704B2 (ja) * | 1995-10-26 | 2003-09-08 | 富士写真フイルム株式会社 | ハロゲン化銀写真感光材料 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2078233A (en) * | 1934-09-14 | 1937-04-27 | Eastman Kodak Co | Photographic emulsion |
| US2448060A (en) * | 1945-08-30 | 1948-08-31 | Eastman Kodak Co | Photographic emulsions sensitized with salts of metals of group viii of the periodicarrangement of the elements |
| FR57512E (fr) * | 1945-08-30 | 1953-01-29 | Kodak Pathe | Perfectionnements aux produits antivoile pour les émulsions photographiques |
| GB1074433A (en) * | 1964-08-11 | 1967-07-05 | Ilford Ltd | Merocyanine dyestuffs |
| DE1447587A1 (de) * | 1964-10-15 | 1969-03-20 | Agfa Gevaert Ag | Optisch sensibilisierte lichtempfindliche Materialien |
-
1970
- 1970-12-30 JP JP45123036A patent/JPS4914265B1/ja active Pending
-
1971
- 1971-12-29 FR FR7147340A patent/FR2121086A5/fr not_active Expired
- 1971-12-30 US US00214216A patent/US3790390A/en not_active Expired - Lifetime
- 1971-12-30 GB GB6082871A patent/GB1367700A/en not_active Expired
- 1971-12-30 CA CA131,368A patent/CA971815A/en not_active Expired
- 1971-12-30 BE BE777530A patent/BE777530A/xx unknown
- 1971-12-30 DE DE19712165764 patent/DE2165764A1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| JPS4914265B1 (enExample) | 1974-04-06 |
| FR2121086A5 (enExample) | 1972-08-18 |
| GB1367700A (en) | 1974-09-18 |
| BE777530A (fr) | 1972-04-17 |
| US3790390A (en) | 1974-02-05 |
| CA971815A (en) | 1975-07-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2165764A1 (de) | Lichtempfindliche, photographische Silberhalogenidmaterialien | |
| DE1286900B (de) | Gruenempfindliche supersensibilisierte Silberhalogenidemulsion | |
| DE1123557B (de) | Lichtentwickelbares, direkt aufzeichnendes photographisches Material, insbesondere fuer oszillographische Aufzeichnungen | |
| DE1245729C2 (de) | Verfahren zum optischen Aufhellen von beschichtetem Papier | |
| DE3144313A1 (de) | Photographische silberhalogenidemulsion, verfahren zu ihrer herstelung und sie enthaltendes lichtempfindliches photographisches silberhalogenidmaterial | |
| DE2538602A1 (de) | Neue radiographische aufzeichnungsmaterialien und die herstellung von roentgenaufnahmen | |
| DE3539930A1 (de) | Lichtempfindliches photographisches silberhalogenidmaterial | |
| DE2133868A1 (de) | Spektrale Sensibilisierung direktpositiver Silberhalogenidemulsionen | |
| DE2614352A1 (de) | Radiographisches verfahren und empfindliches material hierfuer | |
| DE1772026A1 (de) | Photographisches Aufzeichnungsmaterial | |
| DE1472870C3 (de) | Photographisches Aufzeichnungsmaterial | |
| DE1945450A1 (de) | Verfahren zur Herstellung photographischer Bilder | |
| DE2113346A1 (de) | Direktpositivemulsionen mit verbesserter Strahlungsempfindlichkeit | |
| DE2128296C3 (de) | Spektral sensibilisierte photographische Silberhalogenidemulsion | |
| DE2063669C3 (de) | Photographisches Aufzeichnungsmaterial mit einer spektral sensibilisierten Silberhalogenidemulsionsschicht | |
| DE1597637A1 (de) | Direkt aufzeichnendes fotografisches Material | |
| DE2107119C3 (de) | Verfahren zur Herstellung eines direktpositiven Aufzeichnungsmaterials | |
| DE1177484B (de) | Verfahren zur Herstellung lichtentwickelbarer, direkt aufzeichnender Silberhalogenidemulsionen | |
| DE69615967T2 (de) | Photographisches Silberhalogenid-Hochkontrastmaterial | |
| DE1945409A1 (de) | Verfahren zur Herstellung photographischer Bilder | |
| DE2333111A1 (de) | Verbesserte photographische direktpositivemulsionen und verfahren zu deren herstellung | |
| DE2611086A1 (de) | Photographische silberhalogenidemulsion | |
| DE1912332A1 (de) | Photographisches Aufzeichnungsmaterial | |
| DE2112728B2 (de) | Photographisches aufzeichnungsmaterial | |
| DE1797239C3 (de) | Verfahren zur Herstellung einer photographischen direktpositiven Silberhalogenidemulsionsschicht E.I. du Pont de Nemours and Co |