DE2162990C3 - Verfahren zur Herstellung von Acyloxydodecatrienen - Google Patents
Verfahren zur Herstellung von AcyloxydodecatrienenInfo
- Publication number
- DE2162990C3 DE2162990C3 DE2162990A DE2162990A DE2162990C3 DE 2162990 C3 DE2162990 C3 DE 2162990C3 DE 2162990 A DE2162990 A DE 2162990A DE 2162990 A DE2162990 A DE 2162990A DE 2162990 C3 DE2162990 C3 DE 2162990C3
- Authority
- DE
- Germany
- Prior art keywords
- palladium
- acetoxy
- octadiene
- butadiene
- dodecatriene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 12
- 238000004519 manufacturing process Methods 0.000 title claims description 5
- ZTJHDEXGCKAXRZ-FNORWQNLSA-N (3e)-octa-1,3,7-triene Chemical group C=CCC\C=C\C=C ZTJHDEXGCKAXRZ-FNORWQNLSA-N 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 67
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 53
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 52
- 238000006243 chemical reaction Methods 0.000 description 35
- 229910052763 palladium Inorganic materials 0.000 description 24
- 229960000583 acetic acid Drugs 0.000 description 23
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 21
- 150000001412 amines Chemical class 0.000 description 20
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 18
- 239000003054 catalyst Substances 0.000 description 16
- 238000004458 analytical method Methods 0.000 description 11
- 125000004432 carbon atom Chemical group C* 0.000 description 9
- -1 pivalic acid; alicyclic carboxylic acids Chemical class 0.000 description 9
- CSSYVPGEVYWPNO-UHFFFAOYSA-N octa-1,7-dien-3-yl acetate Chemical compound CC(=O)OC(C=C)CCCC=C CSSYVPGEVYWPNO-UHFFFAOYSA-N 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 239000007858 starting material Substances 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 7
- 229940043279 diisopropylamine Drugs 0.000 description 7
- 150000002941 palladium compounds Chemical class 0.000 description 7
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 6
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 5
- HITROERJXNWVOI-SOFGYWHQSA-N (5e)-octa-1,5-diene Chemical compound CC\C=C\CCC=C HITROERJXNWVOI-SOFGYWHQSA-N 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 238000010521 absorption reaction Methods 0.000 description 4
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 239000005711 Benzoic acid Substances 0.000 description 3
- 101150065749 Churc1 gene Proteins 0.000 description 3
- 102100038239 Protein Churchill Human genes 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000003710 aryl alkyl group Chemical group 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 235000010233 benzoic acid Nutrition 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- LHNPXOLHUSNPAA-UHFFFAOYSA-N dodeca-2,7,11-trienyl acetate Chemical compound C(C)(=O)OCC=CCCCC=CCCC=C LHNPXOLHUSNPAA-UHFFFAOYSA-N 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- ZTJHDEXGCKAXRZ-UHFFFAOYSA-N octa-1,3,7-triene Chemical class C=CCCC=CC=C ZTJHDEXGCKAXRZ-UHFFFAOYSA-N 0.000 description 3
- JQLPDQFKERTHHT-UHFFFAOYSA-N octa-1,6-dien-3-yl acetate Chemical compound CC=CCCC(C=C)OC(C)=O JQLPDQFKERTHHT-UHFFFAOYSA-N 0.000 description 3
- 150000002940 palladium Chemical class 0.000 description 3
- 150000003003 phosphines Chemical class 0.000 description 3
- 235000019260 propionic acid Nutrition 0.000 description 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 3
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- 101150003085 Pdcl gene Proteins 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- NZNMSOFKMUBTKW-UHFFFAOYSA-N cyclohexanecarboxylic acid Chemical compound OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 description 2
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 2
- AROLPIKSWUDGGT-UHFFFAOYSA-N dodeca-1,3,5-trienyl acetate Chemical compound CCCCCCC=CC=CC=COC(C)=O AROLPIKSWUDGGT-UHFFFAOYSA-N 0.000 description 2
- HTGCAHVYWCZOIF-UHFFFAOYSA-N dodeca-1,7,11-trien-3-yl acetate Chemical compound C(C)(=O)OC(C=C)CCCC=CCCC=C HTGCAHVYWCZOIF-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- RDOHPVPONNHSPH-UHFFFAOYSA-N octa-2,7-dienyl acetate Chemical compound CC(=O)OCC=CCCCC=C RDOHPVPONNHSPH-UHFFFAOYSA-N 0.000 description 2
- 239000013110 organic ligand Substances 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 2
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 description 2
- MHVJRKBZMUDEEV-APQLOABGSA-N (+)-Pimaric acid Chemical compound [C@H]1([C@](CCC2)(C)C(O)=O)[C@@]2(C)[C@H]2CC[C@](C=C)(C)C=C2CC1 MHVJRKBZMUDEEV-APQLOABGSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- SBRKJHGLTNJTJL-UHFFFAOYSA-N 1-hexoxyocta-1,3-diene Chemical class CCCCCCOC=CC=CCCCC SBRKJHGLTNJTJL-UHFFFAOYSA-N 0.000 description 1
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical group CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 description 1
- CNPURSDMOWDNOQ-UHFFFAOYSA-N 4-methoxy-7h-pyrrolo[2,3-d]pyrimidin-2-amine Chemical compound COC1=NC(N)=NC2=C1C=CN2 CNPURSDMOWDNOQ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- HATNHXGSNQQGHI-UHFFFAOYSA-N CC(OC(CCC=CCCCC=C)C=C)=O Chemical compound CC(OC(CCC=CCCCC=C)C=C)=O HATNHXGSNQQGHI-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 241001474977 Palla Species 0.000 description 1
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 1
- ACIAHEMYLLBZOI-ZZXKWVIFSA-N Unsaturated alcohol Chemical compound CC\C(CO)=C/C ACIAHEMYLLBZOI-ZZXKWVIFSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003957 anion exchange resin Substances 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 239000013522 chelant Substances 0.000 description 1
- 150000004697 chelate complex Chemical class 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- VZFUCHSFHOYXIS-UHFFFAOYSA-N cycloheptane carboxylic acid Natural products OC(=O)C1CCCCCC1 VZFUCHSFHOYXIS-UHFFFAOYSA-N 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 230000000447 dimerizing effect Effects 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- YKPLAKAYUFVNJL-UHFFFAOYSA-N dodeca-1,7,11-trien-3-yl propanoate Chemical compound C(CC)(=O)OC(C=C)CCCC=CCCC=C YKPLAKAYUFVNJL-UHFFFAOYSA-N 0.000 description 1
- OEICYYWWZQAPDR-UHFFFAOYSA-N dodeca-2,7,11-trienyl benzoate Chemical compound C(C1=CC=CC=C1)(=O)OCC=CCCCC=CCCC=C OEICYYWWZQAPDR-UHFFFAOYSA-N 0.000 description 1
- CBUVCECWYIXIEY-UHFFFAOYSA-N dodeca-2,7,11-trienyl propanoate Chemical compound C(CC)(=O)OCC=CCCCC=CCCC=C CBUVCECWYIXIEY-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 150000002527 isonitriles Chemical class 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- RMOHMQVMVRYTQX-UHFFFAOYSA-N octa-1,6-dien-3-yl benzoate Chemical compound C(C1=CC=CC=C1)(=O)OC(C=C)CCC=CC RMOHMQVMVRYTQX-UHFFFAOYSA-N 0.000 description 1
- PZUUERYZWGMXIK-UHFFFAOYSA-N octa-1,6-dien-3-yl propanoate Chemical compound C(CC)(=O)OC(C=C)CCC=CC PZUUERYZWGMXIK-UHFFFAOYSA-N 0.000 description 1
- DIXXOIOSLQCKNB-UHFFFAOYSA-N octa-1,7-dien-3-yl benzoate Chemical compound C=CCCCC(C=C)OC(=O)C1=CC=CC=C1 DIXXOIOSLQCKNB-UHFFFAOYSA-N 0.000 description 1
- PJIJZOGRGGZYKB-UHFFFAOYSA-N octa-2,7-dienyl benzoate Chemical compound C=CCCCC=CCOC(=O)C1=CC=CC=C1 PJIJZOGRGGZYKB-UHFFFAOYSA-N 0.000 description 1
- MDUWNAYGBZIVFS-UHFFFAOYSA-N octa-2,7-dienyl propanoate Chemical compound CCC(=O)OCC=CCCCC=C MDUWNAYGBZIVFS-UHFFFAOYSA-N 0.000 description 1
- IOQPZZOEVPZRBK-UHFFFAOYSA-N octan-1-amine Chemical compound CCCCCCCCN IOQPZZOEVPZRBK-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- JKDRQYIYVJVOPF-FDGPNNRMSA-L palladium(ii) acetylacetonate Chemical compound [Pd+2].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O JKDRQYIYVJVOPF-FDGPNNRMSA-L 0.000 description 1
- ZOUWOGOTHLRRLS-UHFFFAOYSA-N palladium;phosphane Chemical compound P.[Pd] ZOUWOGOTHLRRLS-UHFFFAOYSA-N 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- XQZYPMVTSDWCCE-UHFFFAOYSA-N phthalonitrile Chemical compound N#CC1=CC=CC=C1C#N XQZYPMVTSDWCCE-UHFFFAOYSA-N 0.000 description 1
- 229920006391 phthalonitrile polymer Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- NESLWCLHZZISNB-UHFFFAOYSA-M sodium phenolate Chemical compound [Na+].[O-]C1=CC=CC=C1 NESLWCLHZZISNB-UHFFFAOYSA-M 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Substances C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 1
- 150000004992 toluidines Chemical class 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- WLPUWLXVBWGYMZ-UHFFFAOYSA-N tricyclohexylphosphine Chemical compound C1CCCCC1P(C1CCCCC1)C1CCCCC1 WLPUWLXVBWGYMZ-UHFFFAOYSA-N 0.000 description 1
- 150000005671 trienes Chemical class 0.000 description 1
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/04—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides onto unsaturated carbon-to-carbon bonds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP45125874A JPS4915245B1 (enExample) | 1970-12-30 | 1970-12-30 | |
| JP46018561A JPS5025449B1 (enExample) | 1971-03-29 | 1971-03-29 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2162990A1 DE2162990A1 (de) | 1972-07-27 |
| DE2162990B2 DE2162990B2 (de) | 1973-11-29 |
| DE2162990C3 true DE2162990C3 (de) | 1974-06-27 |
Family
ID=26355254
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2162990A Expired DE2162990C3 (de) | 1970-12-30 | 1971-12-18 | Verfahren zur Herstellung von Acyloxydodecatrienen |
Country Status (6)
| Country | Link |
|---|---|
| US (2) | US3798260A (enExample) |
| DE (1) | DE2162990C3 (enExample) |
| FR (2) | FR2124652A5 (enExample) |
| GB (2) | GB1352767A (enExample) |
| IT (2) | IT954155B (enExample) |
| NL (2) | NL172056C (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2436131A1 (fr) * | 1978-09-15 | 1980-04-11 | Rhone Poulenc Ind | Nouveaux composes undecadienes fonctionnalises comportant un substituant du type methylene et leur procede de fabrication |
| JPS5815940A (ja) * | 1981-07-23 | 1983-01-29 | Eisai Co Ltd | ポリプレニル系化合物およびその製造方法ならびにそれを含有する医薬 |
| GB8428347D0 (en) * | 1984-11-09 | 1984-12-19 | Shell Int Research | Dimerization of olefins |
| GB8704338D0 (en) * | 1987-02-24 | 1987-04-01 | Shell Int Research | Dimerization of olefins |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3088985A (en) * | 1957-09-02 | 1963-05-07 | Studiengesellschaft Kohle Mbh | New open-chain trimer and the production thereof |
| US3407224A (en) * | 1965-05-14 | 1968-10-22 | Shell Oil Co | Ester production |
| US3562314A (en) * | 1966-12-27 | 1971-02-09 | Thomas M Shryne | Production of 2,7-octadienyl carboxylates |
| US3541177A (en) * | 1967-03-15 | 1970-11-17 | Japan Synthetic Rubber Co Ltd | Process for the preparation of butadiene dimer |
| US3458562A (en) * | 1967-03-22 | 1969-07-29 | Dow Chemical Co | Palladium catalyzed reaction of 1,2-alkadienes with 1-alkynes |
| US3534088A (en) * | 1967-08-14 | 1970-10-13 | Union Carbide Corp | Synthesis of octyl esters and alcohols |
| US3691249A (en) * | 1970-10-07 | 1972-09-12 | Universal Oil Prod Co | Dimerization of diolefinic compounds |
| US3673270A (en) * | 1970-12-11 | 1972-06-27 | Du Pont | Hydrogenation of 1,3,7-octatriene to 1,6-octadiene and 1,5-octadiene with certain chromium carbonyl catalysts |
-
1971
- 1971-12-13 US US00207649A patent/US3798260A/en not_active Expired - Lifetime
- 1971-12-15 IT IT32454/71A patent/IT954155B/it active
- 1971-12-18 DE DE2162990A patent/DE2162990C3/de not_active Expired
- 1971-12-20 NL NLAANVRAGE7117448,A patent/NL172056C/xx not_active IP Right Cessation
- 1971-12-21 GB GB5935571A patent/GB1352767A/en not_active Expired
- 1971-12-21 FR FR7145914A patent/FR2124652A5/fr not_active Expired
- 1971-12-23 IT IT32851/71A patent/IT944313B/it active
- 1971-12-27 US US00212748A patent/US3789066A/en not_active Expired - Lifetime
- 1971-12-29 GB GB6058171A patent/GB1352530A/en not_active Expired
- 1971-12-30 NL NL7118158A patent/NL7118158A/xx not_active Application Discontinuation
- 1971-12-30 FR FR7147555A patent/FR2121152A5/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US3789066A (en) | 1974-01-29 |
| NL7117448A (enExample) | 1972-07-04 |
| DE2162990B2 (de) | 1973-11-29 |
| US3798260A (en) | 1974-03-19 |
| GB1352530A (en) | 1974-05-08 |
| FR2121152A5 (enExample) | 1972-08-18 |
| FR2124652A5 (enExample) | 1972-09-22 |
| NL7118158A (enExample) | 1972-07-04 |
| IT944313B (it) | 1973-04-20 |
| NL172056C (nl) | 1983-07-01 |
| GB1352767A (en) | 1974-05-08 |
| NL172056B (nl) | 1983-02-01 |
| IT954155B (it) | 1973-08-30 |
| DE2162990A1 (de) | 1972-07-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP1417212B1 (de) | NEUE PHOSPHITVERBINDUNGEN UND DEREN Rh-KOMPLEXE | |
| WO2014056736A1 (de) | Gemisch von bisphosphiten und dessen verwendung als katalysatorgemisch in der hydroformylierung | |
| DE2658216B2 (de) | Verfahren zur Herstellung von Monocarbonsäureanhydriden | |
| DE2109025C3 (de) | Verfahren zur Herstellung von | |
| DE2104626C2 (de) | Verfahren zur Herstellung eines Additionsproduktes eines konjugierten Diens und einer Verbindung mit endständiger Venylgruppe | |
| DE1144268B (de) | Verfahren zur Herstellung von Cyclooctadien-(1, 5) aus Butadien | |
| DE1418672A1 (de) | Verfahren zur Herstellung von Oligomeren von 1,3-Dienen | |
| DE2162990C3 (de) | Verfahren zur Herstellung von Acyloxydodecatrienen | |
| DD201672A5 (de) | Verfahren zur herstellung von estern beta, gamma-ungesaettigter carbonsaeuren | |
| DE2114544A1 (de) | Verfahren zur Herstellung von Carbonsäuren oder Estern | |
| DE2431378C2 (de) | Verfahren zur Herstellung von 4-Methyl-1-penten | |
| DE2445119C2 (de) | Verfahren zur Herstellung von Butyraldehyden | |
| DE1668326A1 (de) | Verfahren zur Herstellung eines Butadiendimeren | |
| DE1943453A1 (de) | Verfahren zur Herstellung von Octadienylestern | |
| DE2402222C2 (de) | Verfahren zur Herstellung von 1,3,6-Octatrienen | |
| DE2154370C3 (de) | Verfahren zur Herstellung von Äthern des 2,6-Dimethyl-2,7-octadien-1-ols und einige dieser Äther | |
| DE2063038A1 (enExample) | ||
| DE3213940A1 (de) | Verfahren zur herstellung von nonenen oder zur gleichzeitigen herstellung von nonenen und dodecenen aus propen | |
| DE19544133C2 (de) | Verfahren zur Herstellung von Allylalkoholen | |
| DE2162992C3 (de) | Verfahren zur Herstellung von Acyloxydodecatrienen | |
| DE3122796C2 (de) | Verfahren zur Herstellung von Carbonsäurealkylestern | |
| DE3317013A1 (de) | Verfahren zur herstellung von lactonen | |
| DE2310808A1 (de) | Verfahren zur herstellung von carbonsaeuren | |
| DE2061352A1 (de) | Verfahren zur Herstellung von Isoprendimeren | |
| DE3151454C2 (de) | Verfahren zur Herstellung von Ethylidendiacetat |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 | ||
| 8339 | Ceased/non-payment of the annual fee |