DE2147417A1 - alpha Aminobenzylpemcillin pem cillanatsalze - Google Patents
alpha Aminobenzylpemcillin pem cillanatsalzeInfo
- Publication number
- DE2147417A1 DE2147417A1 DE19712147417 DE2147417A DE2147417A1 DE 2147417 A1 DE2147417 A1 DE 2147417A1 DE 19712147417 DE19712147417 DE 19712147417 DE 2147417 A DE2147417 A DE 2147417A DE 2147417 A1 DE2147417 A1 DE 2147417A1
- Authority
- DE
- Germany
- Prior art keywords
- group
- salts
- methyl
- penicillin
- salts according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000003839 salts Chemical class 0.000 title claims description 25
- -1 alpha aminobenzyl Chemical group 0.000 title claims description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 18
- 125000003118 aryl group Chemical group 0.000 claims description 13
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000001153 fluoro group Chemical group F* 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical class [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- 239000004744 fabric Substances 0.000 claims 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- 229930182555 Penicillin Natural products 0.000 description 25
- 229940049954 penicillin Drugs 0.000 description 22
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 13
- 239000000243 solution Substances 0.000 description 12
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 10
- 125000000129 anionic group Chemical group 0.000 description 8
- 159000000000 sodium salts Chemical group 0.000 description 8
- 239000000203 mixture Substances 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical class Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 108010087702 Penicillinase Proteins 0.000 description 6
- 125000001309 chloro group Chemical group Cl* 0.000 description 6
- 239000000470 constituent Substances 0.000 description 6
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 6
- 229950009506 penicillinase Drugs 0.000 description 5
- 150000003952 β-lactams Chemical class 0.000 description 5
- 241000894006 Bacteria Species 0.000 description 4
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 150000002960 penicillins Chemical class 0.000 description 4
- 229960000723 ampicillin Drugs 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical group C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- LQOLIRLGBULYKD-JKIFEVAISA-N cloxacillin Chemical compound N([C@@H]1C(N2[C@H](C(C)(C)S[C@@H]21)C(O)=O)=O)C(=O)C1=C(C)ON=C1C1=CC=CC=C1Cl LQOLIRLGBULYKD-JKIFEVAISA-N 0.000 description 2
- 229960003326 cloxacillin Drugs 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000000575 pesticide Substances 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- XRCKXULNIUSXFZ-HYSWKAIVSA-N (2s,5r,6r)-6-[[2-(2,6-dichlorophenyl)-4-methylpyrazole-3-carbonyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound N([C@@H]1C(N2[C@H](C(C)(C)S[C@@H]21)C(O)=O)=O)C(=O)C1=C(C)C=NN1C1=C(Cl)C=CC=C1Cl XRCKXULNIUSXFZ-HYSWKAIVSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- UIOFUWFRIANQPC-JKIFEVAISA-N Floxacillin Chemical group N([C@@H]1C(N2[C@H](C(C)(C)S[C@@H]21)C(O)=O)=O)C(=O)C1=C(C)ON=C1C1=C(F)C=CC=C1Cl UIOFUWFRIANQPC-JKIFEVAISA-N 0.000 description 1
- 241000295644 Staphylococcaceae Species 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000005042 acyloxymethyl group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000013066 combination product Substances 0.000 description 1
- 229940127555 combination product Drugs 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- YFAGHNZHGGCZAX-JKIFEVAISA-N dicloxacillin Chemical group N([C@@H]1C(N2[C@H](C(C)(C)S[C@@H]21)C(O)=O)=O)C(=O)C1=C(C)ON=C1C1=C(Cl)C=CC=C1Cl YFAGHNZHGGCZAX-JKIFEVAISA-N 0.000 description 1
- 229960001585 dicloxacillin Drugs 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 229960004273 floxacillin Drugs 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- DXVUYOAEDJXBPY-NFFDBFGFSA-N hetacillin Chemical compound C1([C@@H]2C(=O)N(C(N2)(C)C)[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 DXVUYOAEDJXBPY-NFFDBFGFSA-N 0.000 description 1
- 229960003884 hetacillin Drugs 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- UXZAJSZFFARTEI-GUMHCPJTSA-N methyl (2R,3S)-3-(methanesulfonamido)-2-[(4-phenylcyclohexyl)oxymethyl]piperidine-1-carboxylate Chemical compound COC(=O)N1CCC[C@H](NS(C)(=O)=O)[C@@H]1COC1CCC(CC1)c1ccccc1 UXZAJSZFFARTEI-GUMHCPJTSA-N 0.000 description 1
- GPXLMGHLHQJAGZ-JTDSTZFVSA-N nafcillin Chemical compound C1=CC=CC2=C(C(=O)N[C@@H]3C(N4[C@H](C(C)(C)S[C@@H]43)C(O)=O)=O)C(OCC)=CC=C21 GPXLMGHLHQJAGZ-JTDSTZFVSA-N 0.000 description 1
- 229960000515 nafcillin Drugs 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- UWYHMGVUTGAWSP-JKIFEVAISA-N oxacillin Chemical compound N([C@@H]1C(N2[C@H](C(C)(C)S[C@@H]21)C(O)=O)=O)C(=O)C1=C(C)ON=C1C1=CC=CC=C1 UWYHMGVUTGAWSP-JKIFEVAISA-N 0.000 description 1
- 229960001019 oxacillin Drugs 0.000 description 1
- 239000006069 physical mixture Substances 0.000 description 1
- 210000002381 plasma Anatomy 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB4502770 | 1970-09-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2147417A1 true DE2147417A1 (de) | 1972-03-23 |
Family
ID=10435589
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712147417 Pending DE2147417A1 (de) | 1970-09-22 | 1971-09-22 | alpha Aminobenzylpemcillin pem cillanatsalze |
Country Status (6)
| Country | Link |
|---|---|
| BE (1) | BE772832A (enExample) |
| DE (1) | DE2147417A1 (enExample) |
| FR (1) | FR2107862B1 (enExample) |
| GB (1) | GB1297555A (enExample) |
| IE (1) | IE35496B1 (enExample) |
| ZA (1) | ZA715329B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3019244A1 (de) * | 1979-05-21 | 1980-12-04 | Leo Pharm Prod Ltd | Neue penicillansaeurederivate und verfahren zu deren herstellung |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4421731A (en) * | 1982-09-29 | 1983-12-20 | United States Gypsum Company | Process for purifying phosphogypsum |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE539145A (enExample) * |
-
1970
- 1970-09-22 GB GB4502770A patent/GB1297555A/en not_active Expired
-
1971
- 1971-08-05 IE IE996/71A patent/IE35496B1/xx unknown
- 1971-08-10 ZA ZA715329A patent/ZA715329B/xx unknown
- 1971-09-20 BE BE772832A patent/BE772832A/xx unknown
- 1971-09-21 FR FR7133884A patent/FR2107862B1/fr not_active Expired
- 1971-09-22 DE DE19712147417 patent/DE2147417A1/de active Pending
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3019244A1 (de) * | 1979-05-21 | 1980-12-04 | Leo Pharm Prod Ltd | Neue penicillansaeurederivate und verfahren zu deren herstellung |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1297555A (enExample) | 1972-11-22 |
| FR2107862B1 (enExample) | 1975-08-01 |
| IE35496L (en) | 1972-03-22 |
| FR2107862A1 (enExample) | 1972-05-12 |
| BE772832A (fr) | 1972-03-20 |
| IE35496B1 (en) | 1976-03-03 |
| ZA715329B (en) | 1972-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2700091C2 (enExample) | ||
| DE816950C (de) | Stabilisierte Halogensilberemulsionen | |
| DE3209276A1 (de) | Arzneimittel mit antihypoxischer und ischaemie-protektiver wirkung | |
| DE2302866C2 (de) | N-substituierte 4-nitrophenyl-2,6-dialkyl-1,4-dihydropyridin-3,5-dicarboxylate | |
| DE2147417A1 (de) | alpha Aminobenzylpemcillin pem cillanatsalze | |
| DE1793501A1 (de) | Neue carbonsaeureamidgruppenhaltige Verbindungen,Verfahren zu ihrer Herstellung und Verwendung | |
| DE2366237C2 (de) | 4-[2-(2-Methoxynicotinamido)äthyl]-1-piperidinsulfonamid | |
| DE2237832A1 (de) | Verfahren zur herstellung von 4hydroxymethyl-1-keto-1,2-dihydrophthalazin | |
| DE1934392B2 (de) | Neue 2-Pyridylthioamide und Verfahren zu ihrer Herstellung | |
| AT374198B (de) | Verfahren zur herstellung neuer 2-substituierter mercaptoimidazolderivate, ihrer n-oxyde und ihrer salze | |
| DE4119982A1 (de) | 1,3-bis-carbamoylimidazoliumverbindungen und verfahren zum haerten von gelatine enthaltenden schichten | |
| DE2834624A1 (de) | Neue 1,4-dihydropyridazin-3-carbonsaeurederivate, verfahren zu ihrer herstellung und verwendung als arzneimittel | |
| AT343129B (de) | Verfahren zur herstellung von neuen 4- (beta-ureidoathyl)- benzolsulfonylharnstoffen und deren salzen | |
| AT353281B (de) | Verfahren zur herstellung von neuen 4-(beta- -ureidoaethyl)-benzolsulfonylharnstoffen und deren salzen | |
| DE2614137C2 (de) | Benzo[b]thien(2)-ylaminoäthylketone, Verfahren zu ihrer Herstellung, sowie diese enthaltende Arzneimittel | |
| DE2046087A1 (de) | Neue cycloaliphatische difunküonelle stickstoffhaltige Sulfonsäureester, ein Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel | |
| AT240861B (de) | Verfahren zur Herstellung neuer Sulfonamide | |
| AT375933B (de) | Verfahren zur herstellung neuer 2-substituierter mercaptoimidazolderivate und ihrer salze | |
| EP0498334B1 (de) | 2,4- und 2,5-Bis-tetrazolylpyridine, Verfahren zu deren Herstellung sowie deren Verwendung als Arzneimittel | |
| DE1203781B (de) | Verfahren zur Herstellung von trypanocid wirksamen Phenanthridiniumderivaten | |
| AT266159B (de) | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen und von deren Salzen | |
| AT336617B (de) | Verfahren zur herstellung von neuen heterocyclischen verbindungen | |
| AT358060B (de) | Verfahren zur herstellung von neuen (1,2- -dihydro-2-oxo-nicotinamido)-alkylbenzolsulfo- nylharnstoffen und von deren salzen | |
| AT236413B (de) | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen | |
| AT254871B (de) | Verfahren zur Herstellung von Bis-(4-hydroxymethyl-5-hydroxy-6-methyl-3-pyridyl-methyl)-disulfid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |