DE2144908C2 - 5-(3- oder 4-Aminobenzolsulfonylamino)-benzimidazolone-(2) und Verfahren zu ihrer Herstellung - Google Patents
5-(3- oder 4-Aminobenzolsulfonylamino)-benzimidazolone-(2) und Verfahren zu ihrer HerstellungInfo
- Publication number
- DE2144908C2 DE2144908C2 DE2144908A DE2144908A DE2144908C2 DE 2144908 C2 DE2144908 C2 DE 2144908C2 DE 2144908 A DE2144908 A DE 2144908A DE 2144908 A DE2144908 A DE 2144908A DE 2144908 C2 DE2144908 C2 DE 2144908C2
- Authority
- DE
- Germany
- Prior art keywords
- och
- acetaminobenzene
- sulfochloride
- group
- benzimidazolones
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 4-aminobenzenesulfonylamino Chemical group 0.000 title description 19
- 238000000034 method Methods 0.000 title description 8
- 238000002360 preparation method Methods 0.000 title description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 17
- 239000000460 chlorine Substances 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000000049 pigment Substances 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- 125000001246 bromo group Chemical group Br* 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 239000001257 hydrogen Substances 0.000 description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 125000005843 halogen group Chemical group 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- QOMNJPSRBRDQSU-UHFFFAOYSA-N 5-aminobenzimidazol-2-one Chemical class C1=C(N)C=CC2=NC(=O)N=C21 QOMNJPSRBRDQSU-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- KERKSHQWMCWPBT-UHFFFAOYSA-N n-phenylacetamide;sulfurochloridic acid Chemical compound OS(Cl)(=O)=O.CC(=O)NC1=CC=CC=C1 KERKSHQWMCWPBT-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- MWWNNNAOGWPTQY-UHFFFAOYSA-N 3-nitrobenzenesulfonyl chloride Chemical compound [O-][N+](=O)C1=CC=CC(S(Cl)(=O)=O)=C1 MWWNNNAOGWPTQY-UHFFFAOYSA-N 0.000 description 1
- QMJIZLZFBGRSAS-UHFFFAOYSA-N 4-acetamido-2,5-dimethoxybenzenesulfonyl chloride Chemical compound COC1=CC(S(Cl)(=O)=O)=C(OC)C=C1NC(C)=O QMJIZLZFBGRSAS-UHFFFAOYSA-N 0.000 description 1
- ZQPVMSLLKQTRMG-UHFFFAOYSA-N 4-acetamidobenzenesulfonic acid Chemical class CC(=O)NC1=CC=C(S(O)(=O)=O)C=C1 ZQPVMSLLKQTRMG-UHFFFAOYSA-N 0.000 description 1
- RAUWPNXIALNKQM-UHFFFAOYSA-N 4-nitro-1,2-phenylenediamine Chemical class NC1=CC=C([N+]([O-])=O)C=C1N RAUWPNXIALNKQM-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- BJOYQUZSULSNEU-UHFFFAOYSA-N N-(2,5-dichlorophenyl)acetamide sulfurochloridic acid Chemical compound S(=O)(=O)(O)Cl.ClC1=CC=C(C(=C1)NC(=O)C)Cl BJOYQUZSULSNEU-UHFFFAOYSA-N 0.000 description 1
- LUGKRCUVLXLLSE-UHFFFAOYSA-N N-(2-chlorophenyl)acetamide sulfurochloridic acid Chemical compound S(=O)(=O)(O)Cl.ClC1=C(C=CC=C1)NC(=O)C LUGKRCUVLXLLSE-UHFFFAOYSA-N 0.000 description 1
- BAGQNTHZGJYEDV-UHFFFAOYSA-N N-(2-ethylphenyl)acetamide sulfurochloridic acid Chemical compound S(=O)(=O)(O)Cl.C(C)C1=C(C=CC=C1)NC(=O)C BAGQNTHZGJYEDV-UHFFFAOYSA-N 0.000 description 1
- ARKBRYPYROVXJJ-UHFFFAOYSA-N N-(4-chloro-2-ethylphenyl)acetamide sulfurochloridic acid Chemical compound S(=O)(=O)(O)Cl.ClC1=CC(=C(C=C1)NC(=O)C)CC ARKBRYPYROVXJJ-UHFFFAOYSA-N 0.000 description 1
- 125000003047 N-acetyl group Chemical group 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- SDVOYVKZDWUBIL-UHFFFAOYSA-N S(=O)(=O)(O)Cl.COC1=C(C=CC=C1)NC(=O)C Chemical compound S(=O)(=O)(O)Cl.COC1=C(C=CC=C1)NC(=O)C SDVOYVKZDWUBIL-UHFFFAOYSA-N 0.000 description 1
- PDGAPKZNFCWSPX-UHFFFAOYSA-N S(=O)(=O)(O)Cl.COC1=CC=C(C(=C1)NC(C)=O)OC Chemical compound S(=O)(=O)(O)Cl.COC1=CC=C(C(=C1)NC(C)=O)OC PDGAPKZNFCWSPX-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 150000008061 acetanilides Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- IDWLQQCLPXEHCU-UHFFFAOYSA-N aniline;sulfurochloridic acid Chemical class OS(Cl)(=O)=O.NC1=CC=CC=C1 IDWLQQCLPXEHCU-UHFFFAOYSA-N 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- IYMAUEAFOBSGCY-UHFFFAOYSA-N benzene;sulfurochloridic acid Chemical class OS(Cl)(=O)=O.C1=CC=CC=C1 IYMAUEAFOBSGCY-UHFFFAOYSA-N 0.000 description 1
- 150000008107 benzenesulfonic acids Chemical class 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- 150000008641 benzimidazolones Chemical class 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- DEKPYXUDJRABNK-UHFFFAOYSA-N dimethyl 5-aminobenzene-1,3-dicarboxylate Chemical compound COC(=O)C1=CC(N)=CC(C(=O)OC)=C1 DEKPYXUDJRABNK-UHFFFAOYSA-N 0.000 description 1
- 239000000986 disperse dye Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 150000002148 esters Chemical group 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/24—Benzimidazoles; Hydrogenated benzimidazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D235/26—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2144908A DE2144908C2 (de) | 1971-09-08 | 1971-09-08 | 5-(3- oder 4-Aminobenzolsulfonylamino)-benzimidazolone-(2) und Verfahren zu ihrer Herstellung |
| CH1305672A CH588470A5 (enExample) | 1971-09-08 | 1972-09-05 | |
| CH1391976A CH593946A5 (enExample) | 1971-09-08 | 1972-09-05 | |
| US00286774A US3767643A (en) | 1971-09-08 | 1972-09-06 | 5-(aminobenzenesulfonylamino)-benzimidazolone |
| IT28886/72A IT967208B (it) | 1971-09-08 | 1972-09-06 | 5 aminobenzensolfonilamino benzi midazoloni e processo per la loro preparazione |
| JP47088747A JPS4834162A (enExample) | 1971-09-08 | 1972-09-06 | |
| FR7231930A FR2152228A5 (enExample) | 1971-09-08 | 1972-09-08 | |
| GB4186372A GB1399627A (en) | 1971-09-08 | 1972-09-08 | 5-amino-benzenesulphonylamino-benzimidazolones and process for their preparation |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2144908A DE2144908C2 (de) | 1971-09-08 | 1971-09-08 | 5-(3- oder 4-Aminobenzolsulfonylamino)-benzimidazolone-(2) und Verfahren zu ihrer Herstellung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2144908A1 DE2144908A1 (de) | 1973-03-15 |
| DE2144908C2 true DE2144908C2 (de) | 1982-12-09 |
Family
ID=5818994
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2144908A Expired DE2144908C2 (de) | 1971-09-08 | 1971-09-08 | 5-(3- oder 4-Aminobenzolsulfonylamino)-benzimidazolone-(2) und Verfahren zu ihrer Herstellung |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3767643A (enExample) |
| JP (1) | JPS4834162A (enExample) |
| CH (2) | CH593946A5 (enExample) |
| DE (1) | DE2144908C2 (enExample) |
| FR (1) | FR2152228A5 (enExample) |
| GB (1) | GB1399627A (enExample) |
| IT (1) | IT967208B (enExample) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4052410A (en) * | 1973-05-29 | 1977-10-04 | Ciba-Geigy Corporation | Iminoisoindoline pigments |
| JPS5721777B2 (enExample) * | 1973-10-20 | 1982-05-10 | ||
| JPS5146919A (en) * | 1974-10-18 | 1976-04-22 | Matsushita Electric Industrial Co Ltd | Jaketsutoshikijikishiitono seizohoho |
| JPS51111333U (enExample) * | 1975-03-05 | 1976-09-08 | ||
| JPS51121027U (enExample) * | 1975-03-20 | 1976-10-01 | ||
| JPS563832Y2 (enExample) * | 1975-04-21 | 1981-01-28 | ||
| JPS5210313U (enExample) * | 1975-07-11 | 1977-01-25 | ||
| JPS5212804A (en) * | 1975-07-21 | 1977-01-31 | Yoshiro Nakamatsu | Recording unit for computor, etc. |
| JPS5258519A (en) * | 1975-11-08 | 1977-05-14 | Nakamatsu Yoshiro | Flexible disk jacket system |
| JPS5855580B2 (ja) * | 1975-11-08 | 1983-12-10 | ナカマツ ヨシロウ | フレキシブルデイスクインタ−ライナシステム |
| JPS5856170B2 (ja) * | 1975-11-08 | 1983-12-13 | ナカマツ ヨシロウ | フレキシブルデイスクウチバリツキジヤケツトシステム |
| JPS5281814U (enExample) * | 1975-12-17 | 1977-06-18 | ||
| JPS52169319U (enExample) * | 1976-06-15 | 1977-12-22 | ||
| JPS531302U (enExample) * | 1976-06-23 | 1978-01-09 | ||
| JPS538214U (enExample) * | 1976-07-06 | 1978-01-24 | ||
| JPS5315311U (enExample) * | 1976-07-21 | 1978-02-08 | ||
| JPS53113246U (enExample) * | 1977-02-17 | 1978-09-09 | ||
| JPS5730408Y2 (enExample) * | 1977-03-01 | 1982-07-03 | ||
| JPS558151Y2 (enExample) * | 1978-02-10 | 1980-02-22 | ||
| JPS54124521U (enExample) * | 1978-02-20 | 1979-08-31 | ||
| JPS5839558Y2 (ja) * | 1978-12-25 | 1983-09-06 | 東京磁気印刷株式会社 | 磁気記録媒体 |
| JPS5642825Y2 (enExample) * | 1980-03-13 | 1981-10-07 | ||
| JPS5783569U (enExample) * | 1980-11-05 | 1982-05-24 | ||
| JPS57113459A (en) * | 1980-12-31 | 1982-07-14 | Sony Corp | Rotary sheet guide device |
| HU207051B (en) * | 1987-12-30 | 1993-03-01 | Chinoin Gyogyszer Es Vegyeszet | Process for producing 4-chloro-3-sulfamoylbenzoic acid hydrazides and pharmaceutical compositions comprising such compounds |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1644231A1 (de) * | 1967-10-27 | 1970-12-10 | Hoechst Ag | Wasserunloeslicher Monoazofarbstoff und Verfahren zu seiner Herstellung |
| DE1769517A1 (de) * | 1968-06-05 | 1971-07-01 | Hoechst Ag | Verfahren zum Faerben von geformten Gebilden aus aromatischen Polyestern,Polyamiden oder Celluloseacetat |
-
1971
- 1971-09-08 DE DE2144908A patent/DE2144908C2/de not_active Expired
-
1972
- 1972-09-05 CH CH1391976A patent/CH593946A5/xx not_active IP Right Cessation
- 1972-09-05 CH CH1305672A patent/CH588470A5/xx not_active IP Right Cessation
- 1972-09-06 US US00286774A patent/US3767643A/en not_active Expired - Lifetime
- 1972-09-06 IT IT28886/72A patent/IT967208B/it active
- 1972-09-06 JP JP47088747A patent/JPS4834162A/ja active Pending
- 1972-09-08 GB GB4186372A patent/GB1399627A/en not_active Expired
- 1972-09-08 FR FR7231930A patent/FR2152228A5/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1399627A (en) | 1975-07-02 |
| US3767643A (en) | 1973-10-23 |
| FR2152228A5 (enExample) | 1973-04-20 |
| DE2144908A1 (de) | 1973-03-15 |
| JPS4834162A (enExample) | 1973-05-16 |
| CH588470A5 (enExample) | 1977-06-15 |
| CH593946A5 (enExample) | 1977-12-30 |
| IT967208B (it) | 1974-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2144908C2 (de) | 5-(3- oder 4-Aminobenzolsulfonylamino)-benzimidazolone-(2) und Verfahren zu ihrer Herstellung | |
| DE1544460C3 (de) | Bis-(acetoacetyl)-arylendiamiddisazopigmente | |
| US2078387A (en) | Diazo amino compounds | |
| DE2935974A1 (de) | Disazoverbindungen, verfahren zu ihrer herstellung und ihre verwendung | |
| DE959748C (de) | Verfahren zur Herstellung neuer Monoazofarbstoffe | |
| DE827102C (de) | Verfahren zur Herstellung von Nitrofarbstoffen | |
| DE60215767T2 (de) | Acetoxymethylsulfon oder vinylsulfon enthaltende reaktive dispersionsfarbstoffe und verfahren zu ihrer herstellung | |
| US2233873A (en) | Azo dyestuff intermediates | |
| DE888733C (de) | Verfahren zur Herstellung von substantiven 2, 3-Oxynaphthoesaeure-aryliden | |
| DE2521649C2 (de) | 3-Amino-4-carbalkoxybenzoesäure- 4'-phenoxyanilide, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2658329A1 (de) | Nitroamine, verfahren zu ihrer herstellung und ihre verwendung als diazokomponenten | |
| DE1644270C3 (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE2521655C2 (de) | Azoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2436032A1 (de) | Neue aromatische o-hydroxyaldehyde, verfahren zu ihrer herstellung und ihre verwendung | |
| DE1644401C (de) | Monoazofarbstoffe und Verfahren zur Herstellung und Verwendung von Monoazofarbstoffen | |
| DE1644401B1 (de) | Monoazofarbstoffe und Verfahren zur Herstellung und Verwendung von Monoazofarbstoffen | |
| US1969850A (en) | Condensation product from hydroaromatic ring ketones | |
| US2239565A (en) | Diazo-evelno compotjnds | |
| DE879273C (de) | Verfahren zur Herstellung neuer Disazofarbstoffe | |
| AT204146B (de) | Verfahren zur Herstellung von kupplungsfähigen Phthalocyaninderivaten | |
| DE2042498B2 (de) | Styrylfarbstoffe | |
| CH626376A5 (enExample) | ||
| US2465979A (en) | N-substituted amides of 2-hydroxy-3-naphthoic acids | |
| CH351281A (de) | Verfahren zur Herstellung von Diazoaminoverbindungen | |
| DE1111317B (de) | Verfahren zur Herstellung von Monoazofarbstoffen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8339 | Ceased/non-payment of the annual fee |