DE2142757A1 - Verfahren zur Polymerisation von 2-Pyrrolidon - Google Patents
Verfahren zur Polymerisation von 2-PyrrolidonInfo
- Publication number
- DE2142757A1 DE2142757A1 DE19712142757 DE2142757A DE2142757A1 DE 2142757 A1 DE2142757 A1 DE 2142757A1 DE 19712142757 DE19712142757 DE 19712142757 DE 2142757 A DE2142757 A DE 2142757A DE 2142757 A1 DE2142757 A1 DE 2142757A1
- Authority
- DE
- Germany
- Prior art keywords
- pyrrolidone
- polymer
- adduct
- minutes
- weight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 title claims description 58
- 238000000034 method Methods 0.000 title claims description 9
- 238000006116 polymerization reaction Methods 0.000 title description 18
- 229920000642 polymer Polymers 0.000 claims description 38
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 18
- 239000000835 fiber Substances 0.000 claims description 18
- 239000000178 monomer Substances 0.000 claims description 18
- 239000002685 polymerization catalyst Substances 0.000 claims description 17
- 229920001007 Nylon 4 Polymers 0.000 claims description 15
- 229910052783 alkali metal Inorganic materials 0.000 claims description 15
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 claims description 12
- 150000001340 alkali metals Chemical class 0.000 claims description 11
- -1 lactam salt Chemical class 0.000 claims description 10
- 239000001569 carbon dioxide Substances 0.000 claims description 9
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 9
- 239000000155 melt Substances 0.000 claims description 5
- 238000001125 extrusion Methods 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims description 2
- 239000000654 additive Substances 0.000 claims 1
- 230000000996 additive effect Effects 0.000 claims 1
- 230000000379 polymerizing effect Effects 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 11
- 239000012190 activator Substances 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 238000000354 decomposition reaction Methods 0.000 description 8
- 238000004821 distillation Methods 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 5
- DQAKJEWZWDQURW-UHFFFAOYSA-N pyrrolidonecarboxylic acid Chemical compound OC(=O)N1CCCC1=O DQAKJEWZWDQURW-UHFFFAOYSA-N 0.000 description 5
- 238000009987 spinning Methods 0.000 description 5
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- YLHUPYSUKYAIBW-UHFFFAOYSA-N 1-acetylpyrrolidin-2-one Chemical compound CC(=O)N1CCCC1=O YLHUPYSUKYAIBW-UHFFFAOYSA-N 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 238000002074 melt spinning Methods 0.000 description 3
- MEXQWQLMJYIYPG-UHFFFAOYSA-M potassium;2-oxopyrrolidine-1-carboxylate Chemical compound [K+].[O-]C(=O)N1CCCC1=O MEXQWQLMJYIYPG-UHFFFAOYSA-M 0.000 description 3
- 238000001556 precipitation Methods 0.000 description 3
- 125000001453 quaternary ammonium group Chemical group 0.000 description 3
- BYEAHWXPCBROCE-UHFFFAOYSA-N 1,1,1,3,3,3-hexafluoropropan-2-ol Chemical compound FC(F)(F)C(O)C(F)(F)F BYEAHWXPCBROCE-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 230000001376 precipitating effect Effects 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- HYRLWUFWDYFEES-UHFFFAOYSA-M sodium;2-oxopyrrolidine-1-carboxylate Chemical compound [Na+].[O-]C(=O)N1CCCC1=O HYRLWUFWDYFEES-UHFFFAOYSA-M 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- WGTYBPLFGIVFAS-UHFFFAOYSA-M tetramethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C WGTYBPLFGIVFAS-UHFFFAOYSA-M 0.000 description 2
- 238000002411 thermogravimetry Methods 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- AWJXEUXVDUIDEV-UHFFFAOYSA-N 1-chloropyrrolidin-2-one Chemical compound ClN1CCCC1=O AWJXEUXVDUIDEV-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000003855 acyl compounds Chemical class 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- OSNDUYDDOHEKEE-UHFFFAOYSA-N azepane-2,7-dione Chemical compound O=C1CCCCC(=O)N1 OSNDUYDDOHEKEE-UHFFFAOYSA-N 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 238000012662 bulk polymerization Methods 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- IMDXZWRLUZPMDH-UHFFFAOYSA-N dichlorophenylphosphine Chemical compound ClP(Cl)C1=CC=CC=C1 IMDXZWRLUZPMDH-UHFFFAOYSA-N 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229910021476 group 6 element Inorganic materials 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical group [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- GLXDVVHUTZTUQK-UHFFFAOYSA-M lithium;hydroxide;hydrate Chemical compound [Li+].O.[OH-] GLXDVVHUTZTUQK-UHFFFAOYSA-M 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 238000001139 pH measurement Methods 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- YBTMSVKMINMVAZ-UHFFFAOYSA-N pocl3 benzene Chemical compound ClP(Cl)(Cl)=O.C1=CC=CC=C1 YBTMSVKMINMVAZ-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000000518 rheometry Methods 0.000 description 1
- 150000003334 secondary amides Chemical class 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 238000010557 suspension polymerization reaction Methods 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
- C08G69/02—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids
- C08G69/08—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from amino-carboxylic acids
- C08G69/14—Lactams
- C08G69/24—Pyrrolidones or piperidones
-
- D—TEXTILES; PAPER
- D01—NATURAL OR MAN-MADE THREADS OR FIBRES; SPINNING
- D01F—CHEMICAL FEATURES IN THE MANUFACTURE OF ARTIFICIAL FILAMENTS, THREADS, FIBRES, BRISTLES OR RIBBONS; APPARATUS SPECIALLY ADAPTED FOR THE MANUFACTURE OF CARBON FILAMENTS
- D01F6/00—Monocomponent artificial filaments or the like of synthetic polymers; Manufacture thereof
- D01F6/58—Monocomponent artificial filaments or the like of synthetic polymers; Manufacture thereof from homopolycondensation products
- D01F6/60—Monocomponent artificial filaments or the like of synthetic polymers; Manufacture thereof from homopolycondensation products from polyamides
- D01F6/605—Monocomponent artificial filaments or the like of synthetic polymers; Manufacture thereof from homopolycondensation products from polyamides from aromatic polyamides
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- General Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Polyamides (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US6947170A | 1970-09-03 | 1970-09-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2142757A1 true DE2142757A1 (de) | 1972-03-09 |
Family
ID=22089189
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712142757 Withdrawn DE2142757A1 (de) | 1970-09-03 | 1971-08-26 | Verfahren zur Polymerisation von 2-Pyrrolidon |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3721652A (enExample) |
| JP (1) | JPS5519932B1 (enExample) |
| AR (1) | AR202263A1 (enExample) |
| BE (1) | BE772063R (enExample) |
| BR (1) | BR7105804D0 (enExample) |
| CA (1) | CA951045A (enExample) |
| DE (1) | DE2142757A1 (enExample) |
| GB (2) | GB1375206A (enExample) |
| IT (1) | IT1008010B (enExample) |
| ZA (1) | ZA715898B (enExample) |
Families Citing this family (41)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT995045B (it) * | 1973-07-23 | 1975-11-10 | Montedison Spa | Procedimento per la polimeriz zazione del pirrolidone |
| US4104260A (en) * | 1974-07-12 | 1978-08-01 | Pusztaszeri Stephen F | Poly-2-pyrrolidone prepared with inert drying agent |
| US4013626A (en) * | 1975-03-17 | 1977-03-22 | Chevron Research Company | Process for preparing polypyrrolidone wherein polypyrrolidone is washed with 2-pyrrolidone |
| US4125523A (en) * | 1975-06-11 | 1978-11-14 | Chevron Research Company | Catalyst for polymerization of 2-pyrrolidone |
| US4264503A (en) * | 1975-06-20 | 1981-04-28 | Chevron Research Company | Polymerization process using a sodium carboxylactamate catalyst |
| US4075182A (en) * | 1975-08-25 | 1978-02-21 | Chevron Research Company | Process for the preparation of a catalyst containing pyrrolidone composition |
| US4105645A (en) * | 1975-09-15 | 1978-08-08 | Barson Corp. | Polymerization of 2-pyrrolidone with alkaline catalyst and SO2 chain initiator |
| US4100145A (en) * | 1975-11-28 | 1978-07-11 | Chevron Research Company | Polymerization of 2-pyrrolidone with catalyst prepared from the reaction product of CO2 and anhydrous potassium pyrrolidonate |
| US4113851A (en) * | 1976-04-15 | 1978-09-12 | Leveen Harry H | Microbiocidal composition and articles prepared therefrom |
| US4098774A (en) * | 1976-05-19 | 1978-07-04 | Chevron Research Company | Quaternary ammonium catalyst system for the polymerization of 2-pyrrolidone |
| US4101447A (en) * | 1976-09-20 | 1978-07-18 | Chevron Research Company | Pyrrolidone polymerization catalyst system |
| US4192939A (en) * | 1976-09-20 | 1980-03-11 | Chevron Research Company | Phosphonium catalyst system for the polymerization of 2-pyrrolidone |
| US4218558A (en) * | 1976-09-20 | 1980-08-19 | Chevron Research Company | Pyrrolidone polymerization catalyst system |
| US4100146A (en) * | 1976-09-20 | 1978-07-11 | Chevron Research Company | Phosphonium catalyst system for the polymerization of 2-pyrrolidone |
| US4076696A (en) * | 1976-12-09 | 1978-02-28 | Chevron Research Company | Extrusion of polypyrrolidone |
| US4071486A (en) * | 1976-12-20 | 1978-01-31 | Chevron Research Company | Epoxide thermal stabilization additive for polypyrrolidone |
| US4162242A (en) * | 1977-03-28 | 1979-07-24 | Chevron Research Company | Polyol stabilization additive for polypyrrolidone |
| US4174366A (en) * | 1977-03-28 | 1979-11-13 | Chevron Research Company | Method of making reinforced concrete |
| US4130521A (en) * | 1977-04-25 | 1978-12-19 | Chevron Research Company | Densification of polypyrrolidone |
| US4185961A (en) * | 1977-11-14 | 1980-01-29 | Chevron Research Company | Polypyrrolidone fiber treatment |
| NL7800587A (nl) * | 1978-01-18 | 1979-07-20 | Stamicarbon | Werkwijze voor de bereiding van polypyrrolidon. |
| US4215211A (en) * | 1978-01-23 | 1980-07-29 | Chevron Research Company | Polymerization of 2-pyrrolidone with CO2 /SO2 |
| US4180650A (en) * | 1978-04-21 | 1979-12-25 | Chevron Research Company | Nitrothiophene-accelerated lactam polymerization |
| US4171426A (en) * | 1978-04-21 | 1979-10-16 | Chevron Research Company | Triarylmethylhalide-accelerated lactam polymerization |
| US4171425A (en) * | 1978-04-21 | 1979-10-16 | Chevron Research Company | Nitrobenzene-accelerated lactam polymerization |
| US4217442A (en) * | 1978-04-24 | 1980-08-12 | Barnes Arthur C | Polymerization of 2-pyrrolidone with alkali metal pyrrolidonates and certain quaternary ammonium salts |
| EP0032995A3 (en) * | 1978-04-24 | 1981-08-19 | Arthur Conard Barnes | Polymerization of 2-pyrrolidone with alkali metal pyrrolidonates and polymerization products thus obtained |
| US4269665A (en) * | 1979-05-17 | 1981-05-26 | Barnes Carl E | Drying quaternary ammonium compounds |
| US4243777A (en) * | 1978-08-04 | 1981-01-06 | Chevron Research Company | Polypyrrolidone alloys |
| NL7902966A (nl) * | 1979-04-14 | 1980-10-16 | Stamicarbon | Werkwijze voor het polymeriseren van pyrrolidon. |
| US4247683A (en) * | 1979-10-15 | 1981-01-27 | Barnes Carl E | Polymerization of 2-pyrrolidone with quaternary ammonium accelerator by recovering and reusing same |
| US4268660A (en) * | 1979-10-15 | 1981-05-19 | Barnes Carl E | Accelerated polymerization of 2-pyrrolidone |
| US4247684A (en) * | 1979-10-15 | 1981-01-27 | Barnes Carl E | Polymerization of 2-pyrrolidone with cesium or rubidium catalyst |
| US4281105A (en) * | 1979-12-17 | 1981-07-28 | Barnes Carl E | Formation of particulate polypyrrolidone |
| US4247685A (en) * | 1980-01-21 | 1981-01-27 | Barnes Carl E | Continuous bulk polymerization of 2-pyrrolidone |
| JPS6043369B2 (ja) * | 1982-03-04 | 1985-09-27 | 宇部興産株式会社 | 耐衝撃性ポリアミドの製法 |
| US4677189A (en) * | 1986-03-11 | 1987-06-30 | Dsm Rim Nylon Vof | Lactam polymerization initiators |
| US4695611A (en) * | 1986-03-11 | 1987-09-22 | Dsm Rim Nylon V.O.F. | Lactam polymerization initiators |
| FR2912751B1 (fr) * | 2007-02-16 | 2012-07-13 | Arkema France | Procede de preparation de polylactones et polylactames |
| FR2912752B1 (fr) * | 2007-02-16 | 2012-10-05 | Arkema France | Procede de preparation d'un copolymere d'au moins un monomere cyclique |
| KR102262539B1 (ko) * | 2017-11-14 | 2021-06-08 | 한화솔루션 주식회사 | 활성화제 투입 방식 조절을 통한 폴리아마이드 제조방법 및 이에 의해 제조된 폴리아마이드 |
-
1970
- 1970-09-03 US US00069471A patent/US3721652A/en not_active Expired - Lifetime
-
1971
- 1971-08-26 DE DE19712142757 patent/DE2142757A1/de not_active Withdrawn
- 1971-09-01 BE BE772063A patent/BE772063R/xx active
- 1971-09-01 IT IT7132599Q patent/IT1008010B/it active
- 1971-09-01 CA CA121,891,A patent/CA951045A/en not_active Expired
- 1971-09-02 GB GB4101971A patent/GB1375206A/en not_active Expired
- 1971-09-02 ZA ZA715898A patent/ZA715898B/xx unknown
- 1971-09-02 GB GB2208974A patent/GB1375207A/en not_active Expired
- 1971-09-02 BR BR5804/71A patent/BR7105804D0/pt unknown
- 1971-09-02 AR AR237736A patent/AR202263A1/es active
- 1971-09-03 JP JP6798171A patent/JPS5519932B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| BE772063R (fr) | 1972-03-01 |
| CA951045A (en) | 1974-07-09 |
| IT1008010B (it) | 1976-11-10 |
| GB1375207A (enExample) | 1974-11-27 |
| AR202263A1 (es) | 1975-05-30 |
| BR7105804D0 (pt) | 1973-03-29 |
| JPS5519932B1 (enExample) | 1980-05-29 |
| ZA715898B (en) | 1973-03-28 |
| US3721652A (en) | 1973-03-20 |
| GB1375206A (enExample) | 1974-11-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2142757A1 (de) | Verfahren zur Polymerisation von 2-Pyrrolidon | |
| DE2661036C2 (de) | Verfahren zur Herstellung von Fasern aus Poly-p-phenylenterephthalamid | |
| DE69122409T2 (de) | Verfahren zur erhöhung der relativen viskosität von polyamiden | |
| DE2837687A1 (de) | Verfahren zur herstellung von zur fertigung von erzeugnissen durch giessen, extrudieren oder verspinnen verwendbaren polyaether-ester-amid-ketten | |
| DE1570927A1 (de) | Verfahren zum Polymerisieren von 2-Pyrrolidon | |
| DE1260683B (de) | Verfahren zur Herstellung von Faeden und Fasern aus Polyamiden | |
| DE3043114C2 (enExample) | ||
| DE1937385A1 (de) | Verfahren zur Herstellung von hochmolekularen Polyaethern | |
| DE1495848A1 (de) | Verfahren zur Herstellung von Polyamiden | |
| DE1745165B2 (de) | Amidhydrazidpolykondensat und verfahren zu dessen herstellung | |
| DE69412857T2 (de) | Durch starke, nichtionische Base katalysierte Ringöffnungspolymerisation von Lactamen | |
| EP0050811B1 (de) | Verfahren zur Herstellung anionischer Copolymerisate aus cyclischen Kohlensäureestern und Lactamen und deren Verwendung | |
| DE1770888B2 (de) | Verfahren zur Herstellung von Polyamiden | |
| DE1294020B (de) | Verfahren zur Herstellung von Polyamiden durch Polymerisation von e-Caprolactum | |
| DE2557360A1 (de) | Blockcopolymerisat und verfahren zu seiner herstellung | |
| EP1266925B1 (de) | Flüssigkatalysator | |
| DE2329383A1 (de) | Verfahren zur anionischen polymerisation von pyrrolidon | |
| DE844349C (de) | Verfahren zur Herstellung von Polyamiden aus Lactamen | |
| DE2059882A1 (de) | Verfahren zum Polymerisieren von Lactamen | |
| DE2434964A1 (de) | Verfahren zur anionischen polymerisation von pyrrolidon | |
| DE69009337T2 (de) | Polyamid-Zusammensetzung. | |
| DE1745238A1 (de) | Polyamid bildende,lagerfaehige Gemische aus Lactamen und Katalysatoren | |
| DE1221448B (de) | Verfahren zur Herstellung von Copolymerisaten | |
| DE1911834A1 (de) | Polymerisation von 2-Pyrrolidon | |
| DE2311982B2 (de) | Verfahren zur Herstellung von homogenen modifizierten Polycaprolactamen und deren Verwendung für Fäden und Fasern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8130 | Withdrawal |