DE2129104C3 - Bildwiedergabevorrichtung, die eine Lösung eines reversibel reduzierbaren organischen Stoffes enthält - Google Patents
Bildwiedergabevorrichtung, die eine Lösung eines reversibel reduzierbaren organischen Stoffes enthältInfo
- Publication number
- DE2129104C3 DE2129104C3 DE2129104A DE2129104A DE2129104C3 DE 2129104 C3 DE2129104 C3 DE 2129104C3 DE 2129104 A DE2129104 A DE 2129104A DE 2129104 A DE2129104 A DE 2129104A DE 2129104 C3 DE2129104 C3 DE 2129104C3
- Authority
- DE
- Germany
- Prior art keywords
- image display
- display device
- group
- image
- solution
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000126 substance Substances 0.000 title claims description 24
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 120
- 150000001875 compounds Chemical class 0.000 claims description 22
- 239000000243 solution Substances 0.000 claims description 15
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 239000002904 solvent Substances 0.000 claims description 12
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N 1,4-Benzenediol Natural products OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 claims description 11
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 230000003287 optical effect Effects 0.000 claims description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- 150000005208 1,4-dihydroxybenzenes Chemical class 0.000 claims description 7
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 7
- 229910052796 boron Inorganic materials 0.000 claims description 7
- STOSPPMGXZPHKP-UHFFFAOYSA-N tetrachlorohydroquinone Chemical compound OC1=C(Cl)C(Cl)=C(O)C(Cl)=C1Cl STOSPPMGXZPHKP-UHFFFAOYSA-N 0.000 claims description 7
- 239000002253 acid Substances 0.000 claims description 6
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 6
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 6
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 6
- 150000001450 anions Chemical class 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- -1 halogen ion Chemical class 0.000 claims description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 4
- 239000002671 adjuvant Substances 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 230000015572 biosynthetic process Effects 0.000 claims description 3
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052737 gold Inorganic materials 0.000 claims description 3
- 239000010931 gold Substances 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 229910003437 indium oxide Inorganic materials 0.000 claims description 3
- PJXISJQVUVHSOJ-UHFFFAOYSA-N indium(iii) oxide Chemical compound [O-2].[O-2].[O-2].[In+3].[In+3] PJXISJQVUVHSOJ-UHFFFAOYSA-N 0.000 claims description 3
- 230000003647 oxidation Effects 0.000 claims description 3
- 238000007254 oxidation reaction Methods 0.000 claims description 3
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 claims description 3
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 229910052697 platinum Inorganic materials 0.000 claims description 3
- 230000002441 reversible effect Effects 0.000 claims description 3
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 claims description 3
- 229910001887 tin oxide Inorganic materials 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 229910019142 PO4 Inorganic materials 0.000 claims description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 2
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 claims description 2
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- 239000000010 aprotic solvent Substances 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000002560 nitrile group Chemical group 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 229910052763 palladium Inorganic materials 0.000 claims description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 2
- 239000010452 phosphate Substances 0.000 claims description 2
- 239000012047 saturated solution Substances 0.000 claims description 2
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 claims description 2
- 125000004417 unsaturated alkyl group Chemical group 0.000 claims description 2
- 238000012217 deletion Methods 0.000 claims 3
- 230000037430 deletion Effects 0.000 claims 3
- 239000012752 auxiliary agent Substances 0.000 claims 2
- 239000012442 inert solvent Substances 0.000 claims 2
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 claims 2
- 238000007086 side reaction Methods 0.000 claims 2
- GDDNTTHUKVNJRA-UHFFFAOYSA-N 3-bromo-3,3-difluoroprop-1-ene Chemical compound FC(F)(Br)C=C GDDNTTHUKVNJRA-UHFFFAOYSA-N 0.000 claims 1
- PODJSIAAYWCBDV-UHFFFAOYSA-N 5,6-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),5,7,9,11(15),12-octaene Chemical compound C1=NN=C2C=CC3=CC=CC4=CC=C1C2=C43 PODJSIAAYWCBDV-UHFFFAOYSA-N 0.000 claims 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims 1
- 239000003513 alkali Substances 0.000 claims 1
- 230000005281 excited state Effects 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 229910017053 inorganic salt Inorganic materials 0.000 claims 1
- QTWZICCBKBYHDM-UHFFFAOYSA-N leucomethylene blue Chemical compound C1=C(N(C)C)C=C2SC3=CC(N(C)C)=CC=C3NC2=C1 QTWZICCBKBYHDM-UHFFFAOYSA-N 0.000 claims 1
- 230000001795 light effect Effects 0.000 claims 1
- 238000004020 luminiscence type Methods 0.000 claims 1
- 238000000034 method Methods 0.000 claims 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 1
- 239000005416 organic matter Substances 0.000 claims 1
- 230000008447 perception Effects 0.000 claims 1
- 238000010791 quenching Methods 0.000 claims 1
- 230000000171 quenching effect Effects 0.000 claims 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 26
- 239000011521 glass Substances 0.000 description 11
- 239000000463 material Substances 0.000 description 5
- QTQLUUDYDWDXNA-UHFFFAOYSA-N 1-ethyl-4-(1-ethylpyridin-1-ium-4-yl)pyridin-1-ium Chemical compound C1=C[N+](CC)=CC=C1C1=CC=[N+](CC)C=C1 QTQLUUDYDWDXNA-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical class [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 3
- 229910006404 SnO 2 Inorganic materials 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 125000006850 spacer group Chemical group 0.000 description 3
- AYNPIRVEWMUJDE-UHFFFAOYSA-N 2,5-dichlorohydroquinone Chemical compound OC1=CC(Cl)=C(O)C=C1Cl AYNPIRVEWMUJDE-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000003822 epoxy resin Substances 0.000 description 2
- ZTOMUSMDRMJOTH-UHFFFAOYSA-N glutaronitrile Chemical compound N#CCCCC#N ZTOMUSMDRMJOTH-UHFFFAOYSA-N 0.000 description 2
- 239000005337 ground glass Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 239000004922 lacquer Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 2
- 229920000647 polyepoxide Polymers 0.000 description 2
- 150000005837 radical ions Chemical class 0.000 description 2
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- 125000001894 2,4,6-trinitrophenyl group Chemical group [H]C1=C(C(*)=C(C([H])=C1[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O 0.000 description 1
- MLIWQXBKMZNZNF-UHFFFAOYSA-N 2,6-bis[(4-azidophenyl)methylidene]-4-methylcyclohexan-1-one Chemical compound O=C1C(=CC=2C=CC(=CC=2)N=[N+]=[N-])CC(C)CC1=CC1=CC=C(N=[N+]=[N-])C=C1 MLIWQXBKMZNZNF-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- MPAIWVOBMLSHQA-UHFFFAOYSA-N 3,6-dihydroxybenzene-1,2-dicarbonitrile Chemical compound OC1=CC=C(O)C(C#N)=C1C#N MPAIWVOBMLSHQA-UHFFFAOYSA-N 0.000 description 1
- QWHRAHNZHJBIBS-UHFFFAOYSA-N 5,6-dichloro-1,4-dihydroxycyclohexa-2,4-diene-1,2-dicarbonitrile Chemical compound OC1=C(Cl)C(Cl)C(O)(C#N)C(C#N)=C1 QWHRAHNZHJBIBS-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229910020366 ClO 4 Inorganic materials 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 101150050048 SNCB gene Proteins 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- KVVUARWKIXKGCA-UHFFFAOYSA-N acetonitrile;propanenitrile Chemical compound CC#N.CCC#N KVVUARWKIXKGCA-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- DCZFGQYXRKMVFG-UHFFFAOYSA-N cyclohexane-1,4-dione Chemical compound O=C1CCC(=O)CC1 DCZFGQYXRKMVFG-UHFFFAOYSA-N 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000007772 electrode material Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920001195 polyisoprene Polymers 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- RUOJZAUFBMNUDX-UHFFFAOYSA-N propylene carbonate Chemical compound CC1COC(=O)O1 RUOJZAUFBMNUDX-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000006479 redox reaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 125000003698 tetramethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/06—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom
- C07D213/22—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom containing two or more pyridine rings directly linked together, e.g. bipyridyl
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K9/00—Tenebrescent materials, i.e. materials for which the range of wavelengths for energy absorption is changed as a result of excitation by some form of energy
- C09K9/02—Organic tenebrescent materials
-
- G—PHYSICS
- G02—OPTICS
- G02F—OPTICAL DEVICES OR ARRANGEMENTS FOR THE CONTROL OF LIGHT BY MODIFICATION OF THE OPTICAL PROPERTIES OF THE MEDIA OF THE ELEMENTS INVOLVED THEREIN; NON-LINEAR OPTICS; FREQUENCY-CHANGING OF LIGHT; OPTICAL LOGIC ELEMENTS; OPTICAL ANALOGUE/DIGITAL CONVERTERS
- G02F1/00—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics
- G02F1/01—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour
- G02F1/15—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour based on an electrochromic effect
- G02F1/1503—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour based on an electrochromic effect caused by oxidation-reduction reactions in organic liquid solutions, e.g. viologen solutions
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Physics & Mathematics (AREA)
- Nonlinear Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Materials Engineering (AREA)
- Engineering & Computer Science (AREA)
- General Physics & Mathematics (AREA)
- Optics & Photonics (AREA)
- Electrochromic Elements, Electrophoresis, Or Variable Reflection Or Absorption Elements (AREA)
- Devices For Indicating Variable Information By Combining Individual Elements (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL7009521.A NL166053C (nl) | 1970-06-27 | 1970-06-27 | Beeldweergeefinrichting. |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2129104A1 DE2129104A1 (de) | 1972-01-05 |
| DE2129104B2 DE2129104B2 (de) | 1979-07-19 |
| DE2129104C3 true DE2129104C3 (de) | 1980-03-27 |
Family
ID=19810435
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2129104A Expired DE2129104C3 (de) | 1970-06-27 | 1971-06-11 | Bildwiedergabevorrichtung, die eine Lösung eines reversibel reduzierbaren organischen Stoffes enthält |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3806229A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS5317556B1 (cg-RX-API-DMAC7.html) |
| BE (1) | BE769092A (cg-RX-API-DMAC7.html) |
| CA (1) | CA950653A (cg-RX-API-DMAC7.html) |
| DE (1) | DE2129104C3 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2099990A5 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1302000A (cg-RX-API-DMAC7.html) |
| NL (1) | NL166053C (cg-RX-API-DMAC7.html) |
| SE (1) | SE374969B (cg-RX-API-DMAC7.html) |
Families Citing this family (99)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3975285A (en) * | 1972-10-30 | 1976-08-17 | Hodogaya Chemical Co., Ltd. | Liquid crystal composition |
| GB1407133A (en) * | 1973-03-16 | 1975-09-24 | Ici Ltd | Devices |
| NL167774C (nl) * | 1973-05-04 | 1982-01-18 | Philips Nv | Beeldweergeefcel, alsmede werkwijze voor de bereiding van verbindingen, welke toegepast kunnen worden in deze beeldweergeefcel. |
| US3932298A (en) * | 1973-07-19 | 1976-01-13 | Temple University | Nematic liquid crystals with charge-transfer acceptors as dopants |
| NL7411935A (nl) * | 1973-09-21 | 1975-03-25 | Matsushita Electric Industrial Co Ltd | Kleurenvertoningsinrichting. |
| GB1506560A (en) * | 1974-03-15 | 1978-04-05 | Ici Ltd | Device |
| FR2266541B1 (cg-RX-API-DMAC7.html) * | 1974-04-05 | 1979-10-19 | Anvar | |
| US3961842A (en) * | 1974-09-20 | 1976-06-08 | Texas Instruments Incorporated | Regenerating electrode for electrochromic display cell |
| US3950077A (en) * | 1974-09-20 | 1976-04-13 | Texas Instruments Incorporated | Lead reference and counter electrode for an electrochromic display |
| GB1512284A (en) * | 1975-03-13 | 1978-06-01 | Ici Ltd | Electrochromic display devices |
| US4034550A (en) * | 1975-04-08 | 1977-07-12 | Kabushiki Kaisha Suwa Seikosha | Electronic wristwatch digital display |
| US4088393A (en) * | 1975-12-31 | 1978-05-09 | Omron Tateisi Electronics Co. | Field effect mode liquid crystal display materials |
| JPS52100381A (en) * | 1976-02-20 | 1977-08-23 | Dainippon Toryo Co Ltd | Electrochromic display element |
| US4116535A (en) * | 1976-05-10 | 1978-09-26 | U.S. Philips Corporation | Picture display cell with memory effect |
| CH604195A5 (cg-RX-API-DMAC7.html) * | 1976-09-14 | 1978-08-31 | Ebauches Sa | |
| US4093358A (en) * | 1976-12-27 | 1978-06-06 | International Business Machines Corporation | High efficiency electrochromic display device |
| US4212518A (en) * | 1977-02-13 | 1980-07-15 | Canon Kabushiki Kaisha | Image display device |
| GB1564264A (en) * | 1977-04-19 | 1980-04-02 | Ibm | Electrochromic display device |
| US4110015A (en) * | 1977-05-25 | 1978-08-29 | American Cyanamid Company | Electrolytes for use in electrochromic devices |
| US4090782A (en) * | 1977-05-31 | 1978-05-23 | International Business Machines Corporation | Electrochromic display devices comprising thienylidene pyrazoline compounds |
| US4142783A (en) * | 1977-05-31 | 1979-03-06 | International Business Machines Corporation | Reversible electrochromic display device having memory |
| DE2827688A1 (de) * | 1977-06-28 | 1979-01-04 | Dainippon Toryo Kk | Elektrochrome masse und sie enthaltende elektrochrome anzeigevorrichtung |
| GB2004381A (en) * | 1977-09-09 | 1979-03-28 | Samokhin A | Electrolyte for displays using electrochromic transition metal oxides |
| US4187003A (en) * | 1977-11-02 | 1980-02-05 | International Business Machines Corporation | Electrolyte for electrochromic display device |
| JPS5928359B2 (ja) * | 1978-02-15 | 1984-07-12 | キヤノン株式会社 | 像表示装置 |
| US4139276A (en) * | 1978-03-27 | 1979-02-13 | International Business Machines Corporation | Electrochromic display devices comprising substituted fluorene compounds |
| GB2047421B (en) * | 1978-11-20 | 1983-04-20 | Matsushita Electric Industrial Co Ltd | Electrochromic display device |
| JPS5580483A (en) * | 1978-12-11 | 1980-06-17 | Ibm | Electrochromic display element |
| US4249013A (en) * | 1979-01-26 | 1981-02-03 | Bell Telephone Laboratories, Incorporated | Conjugatively linked tetrathiafulvalenes and method for preparation thereof |
| GB2051393A (en) * | 1979-05-23 | 1981-01-14 | Ibm | Electrochromic electrolyte |
| WO1981001287A1 (fr) * | 1979-11-07 | 1981-05-14 | Fujisawa Pharmaceutical Co | Derives de viologene et leurs polymeres |
| JPS58133788A (ja) * | 1982-02-01 | 1983-08-09 | Semiconductor Energy Lab Co Ltd | 電解質溶液 |
| US4773742A (en) * | 1984-05-15 | 1988-09-27 | Canon Kabushiki Kaisha | Display method with fatly acid ester host molecule |
| JPH0610734B2 (ja) | 1984-05-15 | 1994-02-09 | キヤノン株式会社 | 表示媒体 |
| JPS6295559U (cg-RX-API-DMAC7.html) * | 1985-12-03 | 1987-06-18 | ||
| US5282077A (en) * | 1986-03-31 | 1994-01-25 | Gentex Corporation | Variable reflectance mirror |
| US5128799B1 (en) * | 1986-03-31 | 1996-11-05 | Gentex Corp | Variable reflectance motor vehicle mirror |
| US4902108A (en) * | 1986-03-31 | 1990-02-20 | Gentex Corporation | Single-compartment, self-erasing, solution-phase electrochromic devices, solutions for use therein, and uses thereof |
| US4917477A (en) * | 1987-04-06 | 1990-04-17 | Gentex Corporation | Automatic rearview mirror system for automotive vehicles |
| US5115346A (en) * | 1988-02-12 | 1992-05-19 | Donnelly Corporation | Anti-scatter, ultraviolet protected, anti-misting, electro-optical rearview mirror |
| US5073012A (en) * | 1988-02-12 | 1991-12-17 | Donnelly Corporation | Anti-scatter, ultraviolet protected, anti-misting, electro-optical assemblies |
| US5239406A (en) * | 1988-02-12 | 1993-08-24 | Donnelly Corporation | Near-infrared reflecting, ultraviolet protected, safety protected, electrochromic vehicular glazing |
| US5355245A (en) * | 1988-02-12 | 1994-10-11 | Donnelly Corporation | Ultraviolet protected electrochemichromic rearview mirror |
| US5140455A (en) * | 1989-11-29 | 1992-08-18 | Donnelly Corporation | High performance electrochemichromic solutions and devices thereof |
| US5066112A (en) * | 1989-12-21 | 1991-11-19 | Donnelly Corporation | Perimeter coated, electro-optic mirror |
| US5076674A (en) * | 1990-03-09 | 1991-12-31 | Donnelly Corporation | Reduced first surface reflectivity electrochromic/electrochemichromic rearview mirror assembly |
| US5239405A (en) * | 1991-09-06 | 1993-08-24 | Donnelly Corporation | Electrochemichromic solutions, processes for preparing and using the same, and devices manufactured with the same |
| US5233461A (en) * | 1991-09-06 | 1993-08-03 | Donnelly Corporation | Methods for sealing electrochromic devices and devices manufactured thereby |
| US5500760A (en) * | 1991-09-06 | 1996-03-19 | Donnelly Corporation | Electrochemichromic solutions, processes for preparing and using the same, and devices manufactured with the same |
| US5253109A (en) * | 1992-04-27 | 1993-10-12 | Donnelly Corporation | Electro-optic device with constant light transmitting area |
| US5900275A (en) * | 1992-07-15 | 1999-05-04 | Donnelly Corporation | Method for reducing haze in tin oxide transparent conductive coatings |
| US5277986A (en) * | 1992-07-15 | 1994-01-11 | Donnelly Corporation | Method for depositing high performing electrochromic layers |
| US5285060A (en) * | 1992-12-15 | 1994-02-08 | Donnelly Corporation | Display for automatic rearview mirror |
| DE69426040T2 (de) * | 1993-02-26 | 2001-05-17 | Donnelly Corp., Holland | Elektrochrome polymerische Festfilme, Herstellung elektrochromer Vorrichtungen mit solchen Filmen, und Verfahren zur Herstellung solcher Festfilme und Vorrichtungen |
| US5910854A (en) | 1993-02-26 | 1999-06-08 | Donnelly Corporation | Electrochromic polymeric solid films, manufacturing electrochromic devices using such solid films, and processes for making such solid films and devices |
| US5668663A (en) | 1994-05-05 | 1997-09-16 | Donnelly Corporation | Electrochromic mirrors and devices |
| US20050213187A1 (en) * | 1994-08-25 | 2005-09-29 | University Of Iowa Research Foundation | Methods for forming magnetically modified electrodes and articles produced thereby |
| US6891563B2 (en) | 1996-05-22 | 2005-05-10 | Donnelly Corporation | Vehicular vision system |
| US6172613B1 (en) | 1998-02-18 | 2001-01-09 | Donnelly Corporation | Rearview mirror assembly incorporating vehicle information display |
| US6124886A (en) | 1997-08-25 | 2000-09-26 | Donnelly Corporation | Modular rearview mirror assembly |
| US6326613B1 (en) | 1998-01-07 | 2001-12-04 | Donnelly Corporation | Vehicle interior mirror assembly adapted for containing a rain sensor |
| US8294975B2 (en) | 1997-08-25 | 2012-10-23 | Donnelly Corporation | Automotive rearview mirror assembly |
| DE19750404C2 (de) | 1997-11-14 | 1999-10-07 | Bayer Ag | Flachkammer zur Befüllung mit fluiden Medien |
| US6445287B1 (en) | 2000-02-28 | 2002-09-03 | Donnelly Corporation | Tire inflation assistance monitoring system |
| US8288711B2 (en) | 1998-01-07 | 2012-10-16 | Donnelly Corporation | Interior rearview mirror system with forwardly-viewing camera and a control |
| US6693517B2 (en) | 2000-04-21 | 2004-02-17 | Donnelly Corporation | Vehicle mirror assembly communicating wirelessly with vehicle accessories and occupants |
| US6329925B1 (en) | 1999-11-24 | 2001-12-11 | Donnelly Corporation | Rearview mirror assembly with added feature modular display |
| US6477464B2 (en) | 2000-03-09 | 2002-11-05 | Donnelly Corporation | Complete mirror-based global-positioning system (GPS) navigation solution |
| ATE385609T1 (de) * | 1999-09-29 | 2008-02-15 | Fujifilm Corp | Elektrolyt-zusammensetzung, photoelektrische umwandlungsvorrichtung und photoelektrochemische zelle |
| US7004593B2 (en) | 2002-06-06 | 2006-02-28 | Donnelly Corporation | Interior rearview mirror system with compass |
| AU2001243285A1 (en) | 2000-03-02 | 2001-09-12 | Donnelly Corporation | Video mirror systems incorporating an accessory module |
| US7370983B2 (en) | 2000-03-02 | 2008-05-13 | Donnelly Corporation | Interior mirror assembly with display |
| US7167796B2 (en) * | 2000-03-09 | 2007-01-23 | Donnelly Corporation | Vehicle navigation system for use with a telematics system |
| US6643050B2 (en) | 2000-06-13 | 2003-11-04 | Ppg Industries Ohio, Inc. | Colored electrochromic transparent window assemblies |
| ES2287266T3 (es) | 2001-01-23 | 2007-12-16 | Donnelly Corporation | Sistema de iluminacion de vehiculos mejorado. |
| US7581859B2 (en) | 2005-09-14 | 2009-09-01 | Donnelly Corp. | Display device for exterior rearview mirror |
| US7255451B2 (en) | 2002-09-20 | 2007-08-14 | Donnelly Corporation | Electro-optic mirror cell |
| CA2441266A1 (en) | 2001-03-19 | 2002-09-26 | Dow Global Technologies Inc. | Electrochromic display device and compositions useful in making such devices |
| WO2003005118A1 (en) | 2001-07-02 | 2003-01-16 | Loctite Corporation | Epoxy-based composition |
| US6744549B2 (en) * | 2002-03-19 | 2004-06-01 | Dow Global Technologies Inc. | Electrochromic display device |
| US6918674B2 (en) | 2002-05-03 | 2005-07-19 | Donnelly Corporation | Vehicle rearview mirror system |
| US7329013B2 (en) | 2002-06-06 | 2008-02-12 | Donnelly Corporation | Interior rearview mirror system with compass |
| WO2004026633A2 (en) | 2002-09-20 | 2004-04-01 | Donnelly Corporation | Mirror reflective element assembly |
| US7310177B2 (en) | 2002-09-20 | 2007-12-18 | Donnelly Corporation | Electro-optic reflective element assembly |
| US7289037B2 (en) | 2003-05-19 | 2007-10-30 | Donnelly Corporation | Mirror assembly for vehicle |
| US7446924B2 (en) | 2003-10-02 | 2008-11-04 | Donnelly Corporation | Mirror reflective element assembly including electronic component |
| US7308341B2 (en) | 2003-10-14 | 2007-12-11 | Donnelly Corporation | Vehicle communication system |
| US7855821B2 (en) * | 2004-11-15 | 2010-12-21 | Gentex Corporation | Electrochromic compounds and associated media and devices |
| EP1883855B1 (en) | 2005-05-16 | 2011-07-20 | Donnelly Corporation | Vehicle mirror assembly with indicia at reflective element |
| CN101535087B (zh) | 2005-11-01 | 2013-05-15 | 唐纳利公司 | 具有显示装置的内部后视镜 |
| JP2007328278A (ja) * | 2006-06-09 | 2007-12-20 | Fuji Xerox Co Ltd | 表示方法、表示媒体、及び表示素子 |
| AU2006344725A1 (en) * | 2006-06-23 | 2007-12-27 | E. I. Du Pont De Nemours And Company | Amorphous polymers with pendant chromogenic groups |
| US7884995B2 (en) * | 2007-06-27 | 2011-02-08 | Gentex Corporation | Electrochromic device having an improved fill port plug |
| US8345345B2 (en) | 2007-06-27 | 2013-01-01 | Gentex Corporation | Electrochromic device having an improved fill port plug |
| US8154418B2 (en) | 2008-03-31 | 2012-04-10 | Magna Mirrors Of America, Inc. | Interior rearview mirror system |
| US9487144B2 (en) | 2008-10-16 | 2016-11-08 | Magna Mirrors Of America, Inc. | Interior mirror assembly with display |
| US9205780B2 (en) | 2010-02-04 | 2015-12-08 | Magna Mirrors Of America, Inc. | Electro-optic rearview mirror assembly for vehicle |
| US9057925B2 (en) | 2013-03-15 | 2015-06-16 | Gentex Corporation | Fill port plugs for electrochromic devices |
| US9454054B2 (en) | 2013-11-18 | 2016-09-27 | Magna Mirrors Of America, Inc. | Electro-optic mirror element and process of making same |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3458305A (en) * | 1966-08-24 | 1969-07-29 | Gulf Research Development Co | Bispyridinium compounds as herbicides |
-
1970
- 1970-06-27 NL NL7009521.A patent/NL166053C/xx not_active IP Right Cessation
-
1971
- 1971-06-11 DE DE2129104A patent/DE2129104C3/de not_active Expired
- 1971-06-23 CA CA116,391,A patent/CA950653A/en not_active Expired
- 1971-06-23 SE SE7108197A patent/SE374969B/xx unknown
- 1971-06-23 US US00155871A patent/US3806229A/en not_active Expired - Lifetime
- 1971-06-24 GB GB2970371A patent/GB1302000A/en not_active Expired
- 1971-06-25 BE BE769092A patent/BE769092A/xx not_active IP Right Cessation
- 1971-06-25 JP JP4577171A patent/JPS5317556B1/ja active Pending
- 1971-06-28 FR FR7123463A patent/FR2099990A5/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CA950653A (en) | 1974-07-09 |
| NL166053C (nl) | 1981-06-15 |
| DE2129104B2 (de) | 1979-07-19 |
| FR2099990A5 (cg-RX-API-DMAC7.html) | 1972-03-17 |
| NL166053B (nl) | 1981-01-15 |
| DE2129104A1 (de) | 1972-01-05 |
| SE374969B (cg-RX-API-DMAC7.html) | 1975-03-24 |
| NL7009521A (cg-RX-API-DMAC7.html) | 1971-12-29 |
| JPS5317556B1 (cg-RX-API-DMAC7.html) | 1978-06-09 |
| US3806229A (en) | 1974-04-23 |
| GB1302000A (cg-RX-API-DMAC7.html) | 1973-01-04 |
| BE769092A (fr) | 1971-12-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2129104C3 (de) | Bildwiedergabevorrichtung, die eine Lösung eines reversibel reduzierbaren organischen Stoffes enthält | |
| DE2419223C3 (de) | Bildwiedergabezelle | |
| DE2718910C2 (de) | Bildwiedergabezelle mit Speicherwirkung | |
| DE69816601T2 (de) | Konjugierte polymer in einem oxidierten zustand | |
| DE2029463B2 (de) | Bildaufzeichnungs- und/oder wiedergabevorrichtung | |
| EP0467846B1 (de) | Neue elektrochrome Stoffzusammensetzungen auf der Basis von Diketopyrrolopyrrolen | |
| DE2511314A1 (de) | Elektrochromie-anordnung und dafuer geeignete elektrochrome medien | |
| DE2756769A1 (de) | Reversible elektrochromische anzeigevorrichtung | |
| CH643074A5 (de) | Elektrochrome masse und deren verwendung zur herstellung einer elektrochromen anzeigevorrichtung. | |
| DE2401974B2 (de) | Fluessigkristallanzeigeelement | |
| DE2846101C2 (cg-RX-API-DMAC7.html) | ||
| DE2741702A1 (de) | Verfahren zum aussteuern einer elektrochromatischen anzeigevorrichtung und elektrochromatische anzeigevorrichtung hierfuer | |
| DE2638491B2 (de) | Elektrochrome anzeigevorrichtung | |
| DE591455C (de) | Verfahren zur elektrochemischen Erzeugung bestaendiger Bild- und Schriftzeichen, insbesondere fuer die Zwecke der Bildtelegraphie | |
| DE2616625C3 (de) | Vorrichtung zur Direktanzeige eines sichtbare Bildes | |
| DE2552847C3 (de) | Zur Anwendung in einer Farbwiedergabe-Vorrichtung geeignete Fliissigkritall-Zusammensetzung und deren Verwendung | |
| DE2946792C2 (de) | Elektrochrome Anzeigevorrichtung | |
| DE19956228A1 (de) | Elektrochrome Vorrichtung mit verbessertem Schaltverhalten | |
| DE2523832A1 (de) | Elektrochrome anzeigevorrichtung mit elektrolyten und verfahren zur herstellung derselben | |
| CH627038A5 (cg-RX-API-DMAC7.html) | ||
| DE1522556A1 (de) | Elektrographisches Druckverfahren | |
| DE2610528A1 (de) | Elektrochromievorrichtung und -medium | |
| DE2446241A1 (de) | Farbwiedergabevorrichtung | |
| DE2612039A1 (de) | Darstellungsvorrichtung | |
| DE69810776T2 (de) | Elektrochrome vorrichtung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |