DE2109798C3 - N-3-Carbamoyloxyphenyl-Thiolcarbamate sowie diese enthaltendes herbizides Mittel - Google Patents
N-3-Carbamoyloxyphenyl-Thiolcarbamate sowie diese enthaltendes herbizides MittelInfo
- Publication number
- DE2109798C3 DE2109798C3 DE2109798A DE2109798A DE2109798C3 DE 2109798 C3 DE2109798 C3 DE 2109798C3 DE 2109798 A DE2109798 A DE 2109798A DE 2109798 A DE2109798 A DE 2109798A DE 2109798 C3 DE2109798 C3 DE 2109798C3
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- ethyl
- thiocarbamate
- phenyl
- carbamoyloxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004009 herbicide Substances 0.000 title claims description 5
- 150000001875 compounds Chemical group 0.000 claims description 17
- -1 dimethylphenyl Chemical group 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000000068 chlorophenyl group Chemical group 0.000 claims description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000003944 tolyl group Chemical group 0.000 claims description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 claims 1
- NMCTUHZAVTWCQR-UHFFFAOYSA-N phenyl n-thiophen-2-ylcarbamate Chemical compound C=1C=CC=CC=1OC(=O)NC1=CC=CS1 NMCTUHZAVTWCQR-UHFFFAOYSA-N 0.000 claims 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims 1
- 241000196324 Embryophyta Species 0.000 description 14
- 239000004480 active ingredient Substances 0.000 description 9
- 239000003795 chemical substances by application Substances 0.000 description 8
- 230000002363 herbicidal effect Effects 0.000 description 6
- 238000000034 method Methods 0.000 description 5
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- GNVMUORYQLCPJZ-UHFFFAOYSA-M Thiocarbamate Chemical compound NC([S-])=O GNVMUORYQLCPJZ-UHFFFAOYSA-M 0.000 description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 4
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 238000011282 treatment Methods 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- LCEYJTJDZROKOK-UHFFFAOYSA-N (3-hydroxyphenyl)carbamic acid Chemical compound OC(=O)NC1=CC=CC(O)=C1 LCEYJTJDZROKOK-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241000219318 Amaranthus Species 0.000 description 1
- 235000011293 Brassica napus Nutrition 0.000 description 1
- 240000008100 Brassica rapa Species 0.000 description 1
- 235000000540 Brassica rapa subsp rapa Nutrition 0.000 description 1
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical class NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 1
- 241000748465 Galinsoga Species 0.000 description 1
- 241000520028 Lamium Species 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 1
- 244000042664 Matricaria chamomilla Species 0.000 description 1
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 240000003705 Senecio vulgaris Species 0.000 description 1
- 240000005498 Setaria italica Species 0.000 description 1
- 235000007226 Setaria italica Nutrition 0.000 description 1
- 240000003768 Solanum lycopersicum Species 0.000 description 1
- 240000006694 Stellaria media Species 0.000 description 1
- 241001062472 Stokellia anisodon Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- RYAGRZNBULDMBW-UHFFFAOYSA-L calcium;3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Ca+2].COC1=CC=CC(CC(CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O RYAGRZNBULDMBW-UHFFFAOYSA-L 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical class OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- WUDNUHPRLBTKOJ-UHFFFAOYSA-N ethyl isocyanate Chemical compound CCN=C=O WUDNUHPRLBTKOJ-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 150000007530 organic bases Chemical group 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 210000002741 palatine tonsil Anatomy 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- BMBJSXKEXRFGAV-UHFFFAOYSA-N phenylcarbamothioic s-acid Chemical compound SC(=O)NC1=CC=CC=C1 BMBJSXKEXRFGAV-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 230000009528 severe injury Effects 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C333/00—Derivatives of thiocarbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C333/02—Monothiocarbamic acids; Derivatives thereof
- C07C333/08—Monothiocarbamic acids; Derivatives thereof having nitrogen atoms of thiocarbamic groups bound to carbon atoms of six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (25)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2109798A DE2109798C3 (de) | 1971-02-23 | 1971-02-23 | N-3-Carbamoyloxyphenyl-Thiolcarbamate sowie diese enthaltendes herbizides Mittel |
| LU64679D LU64679A1 (en:Method) | 1971-02-23 | 1972-01-28 | |
| ZA720714A ZA72714B (en) | 1971-02-23 | 1972-02-03 | Substituted phenylthiocarbamates |
| CS758A CS167341B2 (en:Method) | 1971-02-23 | 1972-02-07 | |
| AU38828/72A AU476470B2 (en) | 1971-02-23 | 1972-02-09 | Substituted phenylthiocarbamate |
| YU361/72A YU39578B (en) | 1971-02-23 | 1972-02-14 | Process for obtaining new substituted phenythiocarbamates |
| GB670572A GB1385802A (en) | 1971-02-23 | 1972-02-14 | Substituted phenylthiocarbamates |
| IT20572/72A IT948534B (it) | 1971-02-23 | 1972-02-15 | Fenilcarbammat sostituiti parati colarmente utili come erbicidi |
| SE7201800A SE371641B (en:Method) | 1971-02-23 | 1972-02-15 | |
| IE201/72A IE36115B1 (en) | 1971-02-23 | 1972-02-17 | Substituted phenylthiocarbamates |
| IL46111A IL46111A (en) | 1971-02-23 | 1972-02-20 | Substituted s-alkyl n-(carbamoyl-oxyphenyl)-thiocarbamate |
| IL38799A IL38799A (en) | 1971-02-23 | 1972-02-20 | Substituted s-alkyl n-(carbamoyloxyphenyl)thiocarbamates |
| DD161035A DD95303A5 (en:Method) | 1971-02-23 | 1972-02-22 | |
| NO531/72A NO135472C (en:Method) | 1971-02-23 | 1972-02-22 | |
| ES400057A ES400057A1 (es) | 1971-02-23 | 1972-02-22 | Procedimiento para la preparacion de nuevos feniltiocarba- matos sustituidos. |
| FR7205872A FR2127692A5 (en:Method) | 1971-02-23 | 1972-02-22 | |
| DK82072*#A DK132114C (da) | 1971-02-23 | 1972-02-22 | Substituerede phenylthiocarbamater til anvendelse i herbicider |
| SU7201751717A SU578820A3 (ru) | 1971-02-23 | 1972-02-23 | Гербицидное средство |
| NL7202392A NL7202392A (en:Method) | 1971-02-23 | 1972-02-23 | |
| JP1884172A JPS5612602B1 (en:Method) | 1971-02-23 | 1972-02-23 | |
| BE779739A BE779739A (fr) | 1971-02-23 | 1972-02-23 | Thiocarbamates de phenyle substitues, et leur procede de preparation |
| AT147072A AT315568B (de) | 1971-02-23 | 1972-02-23 | Herbizide Mittel |
| HUSCHE376*1A HU164148B (en:Method) | 1971-02-23 | 1972-02-23 | |
| CA135,380A CA975777A (en) | 1971-02-23 | 1972-02-23 | Herbicidal substituted phenylthiocarbamates |
| CH260372A CH564906A5 (en:Method) | 1971-02-23 | 1972-02-23 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2109798A DE2109798C3 (de) | 1971-02-23 | 1971-02-23 | N-3-Carbamoyloxyphenyl-Thiolcarbamate sowie diese enthaltendes herbizides Mittel |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2109798A1 DE2109798A1 (de) | 1972-08-31 |
| DE2109798B2 DE2109798B2 (de) | 1979-04-19 |
| DE2109798C3 true DE2109798C3 (de) | 1979-12-20 |
Family
ID=5800253
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2109798A Expired DE2109798C3 (de) | 1971-02-23 | 1971-02-23 | N-3-Carbamoyloxyphenyl-Thiolcarbamate sowie diese enthaltendes herbizides Mittel |
Country Status (24)
| Country | Link |
|---|---|
| JP (1) | JPS5612602B1 (en:Method) |
| AT (1) | AT315568B (en:Method) |
| AU (1) | AU476470B2 (en:Method) |
| BE (1) | BE779739A (en:Method) |
| CA (1) | CA975777A (en:Method) |
| CH (1) | CH564906A5 (en:Method) |
| CS (1) | CS167341B2 (en:Method) |
| DD (1) | DD95303A5 (en:Method) |
| DE (1) | DE2109798C3 (en:Method) |
| DK (1) | DK132114C (en:Method) |
| ES (1) | ES400057A1 (en:Method) |
| FR (1) | FR2127692A5 (en:Method) |
| GB (1) | GB1385802A (en:Method) |
| HU (1) | HU164148B (en:Method) |
| IE (1) | IE36115B1 (en:Method) |
| IL (2) | IL46111A (en:Method) |
| IT (1) | IT948534B (en:Method) |
| LU (1) | LU64679A1 (en:Method) |
| NL (1) | NL7202392A (en:Method) |
| NO (1) | NO135472C (en:Method) |
| SE (1) | SE371641B (en:Method) |
| SU (1) | SU578820A3 (en:Method) |
| YU (1) | YU39578B (en:Method) |
| ZA (1) | ZA72714B (en:Method) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2310648C3 (de) * | 1973-03-01 | 1982-05-06 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Diurethane, Verfahren zur Herstellung dieser Verbindungen sowie diese enthaltende selektive herbizide Mittel |
| DE2341079C2 (de) * | 1973-08-10 | 1982-05-06 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | m-Diurethane und selektive herbizide Mittel enthaltend diese Verbindungen als Wirkstoffe |
-
1971
- 1971-02-23 DE DE2109798A patent/DE2109798C3/de not_active Expired
-
1972
- 1972-01-28 LU LU64679D patent/LU64679A1/xx unknown
- 1972-02-03 ZA ZA720714A patent/ZA72714B/xx unknown
- 1972-02-07 CS CS758A patent/CS167341B2/cs unknown
- 1972-02-09 AU AU38828/72A patent/AU476470B2/en not_active Expired
- 1972-02-14 YU YU361/72A patent/YU39578B/xx unknown
- 1972-02-14 GB GB670572A patent/GB1385802A/en not_active Expired
- 1972-02-15 SE SE7201800A patent/SE371641B/xx unknown
- 1972-02-15 IT IT20572/72A patent/IT948534B/it active
- 1972-02-17 IE IE201/72A patent/IE36115B1/xx unknown
- 1972-02-20 IL IL46111A patent/IL46111A/en unknown
- 1972-02-20 IL IL38799A patent/IL38799A/en unknown
- 1972-02-22 NO NO531/72A patent/NO135472C/no unknown
- 1972-02-22 DD DD161035A patent/DD95303A5/xx unknown
- 1972-02-22 FR FR7205872A patent/FR2127692A5/fr not_active Expired
- 1972-02-22 ES ES400057A patent/ES400057A1/es not_active Expired
- 1972-02-22 DK DK82072*#A patent/DK132114C/da not_active IP Right Cessation
- 1972-02-23 HU HUSCHE376*1A patent/HU164148B/hu unknown
- 1972-02-23 BE BE779739A patent/BE779739A/xx not_active IP Right Cessation
- 1972-02-23 CH CH260372A patent/CH564906A5/xx not_active IP Right Cessation
- 1972-02-23 NL NL7202392A patent/NL7202392A/xx not_active Application Discontinuation
- 1972-02-23 SU SU7201751717A patent/SU578820A3/ru active
- 1972-02-23 JP JP1884172A patent/JPS5612602B1/ja active Pending
- 1972-02-23 CA CA135,380A patent/CA975777A/en not_active Expired
- 1972-02-23 AT AT147072A patent/AT315568B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| IL38799A0 (en) | 1972-04-27 |
| FR2127692A5 (en:Method) | 1972-10-13 |
| GB1385802A (en) | 1975-02-26 |
| CS167341B2 (en:Method) | 1976-04-29 |
| AT315568B (de) | 1974-05-27 |
| ES400057A1 (es) | 1974-12-16 |
| DK132114B (da) | 1975-10-27 |
| LU64679A1 (en:Method) | 1972-06-26 |
| NO135472B (en:Method) | 1977-01-03 |
| DE2109798B2 (de) | 1979-04-19 |
| IE36115L (en) | 1972-08-23 |
| NO135472C (en:Method) | 1977-04-13 |
| YU39578B (en) | 1985-03-20 |
| DD95303A5 (en:Method) | 1973-01-20 |
| SU578820A3 (ru) | 1977-10-30 |
| JPS5612602B1 (en:Method) | 1981-03-23 |
| DK132114C (da) | 1976-03-22 |
| CH564906A5 (en:Method) | 1975-08-15 |
| IT948534B (it) | 1973-06-11 |
| BE779739A (fr) | 1972-08-23 |
| NL7202392A (en:Method) | 1972-08-25 |
| AU476470B2 (en) | 1976-09-23 |
| CA975777A (en) | 1975-10-07 |
| YU36172A (en) | 1982-05-31 |
| IL38799A (en) | 1976-06-30 |
| ZA72714B (en) | 1972-10-25 |
| IE36115B1 (en) | 1976-08-18 |
| SE371641B (en:Method) | 1974-11-25 |
| HU164148B (en:Method) | 1973-12-28 |
| IL46111A (en) | 1976-06-30 |
| AU3882872A (en) | 1973-08-16 |
| DE2109798A1 (de) | 1972-08-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1567151C3 (de) | Diurethane, Verfahren zur Herstellung dieser Verbindungen sowie diese enthaltende herbizide Mittel | |
| DE1518815A1 (de) | Herbizid und Verfahren zu dessen Herstellung | |
| DE2108975C3 (de) | N-Acyl-Diurethane sowie diese enthaltendes herbizides Mittel | |
| CH623031A5 (en:Method) | ||
| DE2109798C3 (de) | N-3-Carbamoyloxyphenyl-Thiolcarbamate sowie diese enthaltendes herbizides Mittel | |
| DE2341079C2 (de) | m-Diurethane und selektive herbizide Mittel enthaltend diese Verbindungen als Wirkstoffe | |
| DE2151766A1 (de) | Phenoxycarbonsaeureamide | |
| DE1593520C3 (de) | 3-(Carbamoyloxyphenyl)-harnstoffe bzw. -thioharnstoffe, diese enthaltende Mittel mit selektiver herbizider Wirkung sowie Verfahren zu deren Herstellung | |
| DE2121957C3 (de) | Diurethane sowie diese enthaltende herbizide Mittel | |
| DE2557552C2 (de) | Diurethane und herbizide Mittel, enthaltend diese Verbindungen als Wirkstoffe | |
| DE2045907C3 (de) | Biscarbamate und Herbizide, die sie als Wirkstoff enthalten | |
| DE2131401B2 (de) | Herbizides Gemisch auf Benzothiadiazinondioxid-Basis | |
| EP0019156A1 (de) | Substituierte Harnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung als Pflanzenbakterizide | |
| DE2320362A1 (de) | Dichlorthiazolylharnstoffe, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide | |
| DE2407634A1 (de) | N- eckige klammer auf 3-tert.-butyl-1, 2,4-thiadiazolyl-(5) eckige klammer zu -harnstoffe, verfahren zu ihrer herstellung sowie ihre verwendung als selektive herbizide | |
| DE2042110C3 (de) | Substituierte Phenylthionocarbamate, Verfahren zu ihrer Herstellung und solche Carbamate enthaltende herbizide Mittel | |
| DE2310648C3 (de) | Diurethane, Verfahren zur Herstellung dieser Verbindungen sowie diese enthaltende selektive herbizide Mittel | |
| DE1913043C3 (de) | Substituierte Phenylcarbamate | |
| DE2843691A1 (de) | Diurethane, verfahren zur herstellung dieser verbindungen sowie diese enthaltende selektive herbizide mittel | |
| CH645344A5 (de) | N-(2-propinyl)-carbanilsaeure-(3-methoxycarbonylaminophenyl)-ester, verfahren zur herstellung dieser verbindungen sowie diese enthaltende selektive herbizide mittel. | |
| DE2745968A1 (de) | Mittel zur entblaetterung von pflanzen | |
| DE1793752C3 (de) | Diurethane sowie diese enthaltende herbizide Mittel | |
| DE2120087A1 (en) | Selective-herbicidal nitrobenzaldoxime carbamates - - for weed control in root crop culture | |
| DE1768835C3 (de) | N-Pheny l-K-methy l-NT-alkenoxyharnstoffe und diese enthaltende Herbizide | |
| DE2310649B2 (de) | Diurethane sowie diese enthaltende selektive herbizide Mittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |