DE2107650B2 - Verfahren zur Herstellung von 7-Acylamido-S-methyl-ceph-S-em^-Carbonsäurederivaten - Google Patents
Verfahren zur Herstellung von 7-Acylamido-S-methyl-ceph-S-em^-CarbonsäurederivatenInfo
- Publication number
- DE2107650B2 DE2107650B2 DE2107650A DE2107650A DE2107650B2 DE 2107650 B2 DE2107650 B2 DE 2107650B2 DE 2107650 A DE2107650 A DE 2107650A DE 2107650 A DE2107650 A DE 2107650A DE 2107650 B2 DE2107650 B2 DE 2107650B2
- Authority
- DE
- Germany
- Prior art keywords
- sulfoxide
- acid
- acylamido
- tri
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000000034 method Methods 0.000 title claims description 23
- 238000002360 preparation method Methods 0.000 title claims description 5
- -1 benzyl ester Chemical class 0.000 claims description 61
- 239000002253 acid Substances 0.000 claims description 19
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 18
- 150000003462 sulfoxides Chemical class 0.000 claims description 18
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 claims description 14
- LIKFHECYJZWXFJ-UHFFFAOYSA-N dimethyldichlorosilane Chemical compound C[Si](C)(Cl)Cl LIKFHECYJZWXFJ-UHFFFAOYSA-N 0.000 claims description 12
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 9
- 239000005051 trimethylchlorosilane Substances 0.000 claims description 7
- 238000010438 heat treatment Methods 0.000 claims description 5
- 229930186147 Cephalosporin Natural products 0.000 claims description 4
- 229940124587 cephalosporin Drugs 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 150000001780 cephalosporins Chemical class 0.000 claims description 2
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 claims description 2
- FVVXWRGARUACNW-UHFFFAOYSA-N 3-methylisoquinoline Chemical compound C1=CC=C2C=NC(C)=CC2=C1 FVVXWRGARUACNW-UHFFFAOYSA-N 0.000 claims 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 claims 2
- DCFKHNIGBAHNSS-UHFFFAOYSA-N chloro(triethyl)silane Chemical compound CC[Si](Cl)(CC)CC DCFKHNIGBAHNSS-UHFFFAOYSA-N 0.000 claims 2
- DTBDAFLSBDGPEA-UHFFFAOYSA-N 3-Methylquinoline Natural products C1=CC=CC2=CC(C)=CN=C21 DTBDAFLSBDGPEA-UHFFFAOYSA-N 0.000 claims 1
- PVEWMXHRWYGMGN-UHFFFAOYSA-N CC[SiH](Cl)CCC1=CC=CC=C1 Chemical compound CC[SiH](Cl)CCC1=CC=CC=C1 PVEWMXHRWYGMGN-UHFFFAOYSA-N 0.000 claims 1
- UCKORWKZRPKRQE-UHFFFAOYSA-N bromo(triethyl)silane Chemical compound CC[Si](Br)(CC)CC UCKORWKZRPKRQE-UHFFFAOYSA-N 0.000 claims 1
- CBOXQJGHYXSYFT-UHFFFAOYSA-N bromo-dimethyl-phenylsilane Chemical compound C[Si](C)(Br)C1=CC=CC=C1 CBOXQJGHYXSYFT-UHFFFAOYSA-N 0.000 claims 1
- CAURZYXCQQWBJO-UHFFFAOYSA-N bromomethyl-chloro-dimethylsilane Chemical compound C[Si](C)(Cl)CBr CAURZYXCQQWBJO-UHFFFAOYSA-N 0.000 claims 1
- MNKYQPOFRKPUAE-UHFFFAOYSA-N chloro(triphenyl)silane Chemical compound C=1C=CC=CC=1[Si](C=1C=CC=CC=1)(Cl)C1=CC=CC=C1 MNKYQPOFRKPUAE-UHFFFAOYSA-N 0.000 claims 1
- ACTAPAGNZPZLEF-UHFFFAOYSA-N chloro(tripropyl)silane Chemical compound CCC[Si](Cl)(CCC)CCC ACTAPAGNZPZLEF-UHFFFAOYSA-N 0.000 claims 1
- PDNUHAXBKKDGAM-UHFFFAOYSA-N chloro-diethyl-methylsilane Chemical compound CC[Si](C)(Cl)CC PDNUHAXBKKDGAM-UHFFFAOYSA-N 0.000 claims 1
- AVDUEHWPPXIAEB-UHFFFAOYSA-N chloro-ethyl-dimethylsilane Chemical compound CC[Si](C)(C)Cl AVDUEHWPPXIAEB-UHFFFAOYSA-N 0.000 claims 1
- UPSBFLYYMHIEJB-UHFFFAOYSA-N chloro-methyl-(2-phenylethyl)silane Chemical compound C[SiH](Cl)CCC1=CC=CC=C1 UPSBFLYYMHIEJB-UHFFFAOYSA-N 0.000 claims 1
- HPQGAYBKOJXAEZ-UHFFFAOYSA-N chloro-tris(2-methylphenyl)silane Chemical compound CC1=CC=CC=C1[Si](Cl)(C=1C(=CC=CC=1)C)C1=CC=CC=C1C HPQGAYBKOJXAEZ-UHFFFAOYSA-N 0.000 claims 1
- 230000032050 esterification Effects 0.000 claims 1
- 238000005886 esterification reaction Methods 0.000 claims 1
- 239000005055 methyl trichlorosilane Substances 0.000 claims 1
- JLUFWMXJHAVVNN-UHFFFAOYSA-N methyltrichlorosilane Chemical compound C[Si](Cl)(Cl)Cl JLUFWMXJHAVVNN-UHFFFAOYSA-N 0.000 claims 1
- RBKMMJSQKNKNEV-RITPCOANSA-N penicillanic acid Chemical compound OC(=O)[C@H]1C(C)(C)S[C@@H]2CC(=O)N21 RBKMMJSQKNKNEV-RITPCOANSA-N 0.000 claims 1
- JSQJUDVTRRCSRU-UHFFFAOYSA-N tributyl(chloro)silane Chemical compound CCCC[Si](Cl)(CCCC)CCCC JSQJUDVTRRCSRU-UHFFFAOYSA-N 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 60
- 239000000203 mixture Substances 0.000 description 24
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 22
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 20
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Natural products N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 19
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 19
- 239000010410 layer Substances 0.000 description 17
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- 239000000243 solution Substances 0.000 description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- 235000019371 penicillin G benzathine Nutrition 0.000 description 15
- 229940056360 penicillin g Drugs 0.000 description 15
- XRVPSMBZQKYMGA-WDOBJEIGSA-N (6r,7r)-3-(acetyloxymethyl)-7-[(2-acetyloxy-2-phenylacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C(O)=O)C(=O)C(OC(C)=O)C1=CC=CC=C1 XRVPSMBZQKYMGA-WDOBJEIGSA-N 0.000 description 14
- 239000011541 reaction mixture Substances 0.000 description 14
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 14
- 125000002252 acyl group Chemical group 0.000 description 13
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 8
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 8
- 229950005499 carbon tetrachloride Drugs 0.000 description 8
- 238000001228 spectrum Methods 0.000 description 8
- 239000007858 starting material Substances 0.000 description 8
- DNPOVSLJNLLGMA-SJUANORRSA-N (2s,5r,6r)-3,3-dimethyl-4,7-dioxo-6-[(2-phenoxyacetyl)amino]-4$l^{4}-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound N([C@H]1[C@@H]2N(C1=O)[C@H](C(S2=O)(C)C)C(O)=O)C(=O)COC1=CC=CC=C1 DNPOVSLJNLLGMA-SJUANORRSA-N 0.000 description 7
- 241000588724 Escherichia coli Species 0.000 description 7
- 244000005700 microbiome Species 0.000 description 7
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical compound N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 239000008055 phosphate buffer solution Substances 0.000 description 5
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical group CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 238000011065 in-situ storage Methods 0.000 description 4
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- 150000003377 silicon compounds Chemical class 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 238000010533 azeotropic distillation Methods 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 230000020176 deacylation Effects 0.000 description 3
- 238000005947 deacylation reaction Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- CFXQEHVMCRXUSD-UHFFFAOYSA-N 1,2,3-Trichloropropane Chemical compound ClCC(Cl)CCl CFXQEHVMCRXUSD-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- XWKFPIODWVPXLX-UHFFFAOYSA-N 2,5-dimethylpyridine Chemical compound CC1=CC=C(C)N=C1 XWKFPIODWVPXLX-UHFFFAOYSA-N 0.000 description 2
- NVIAYEIXYQCDAN-CLZZGJSISA-N 7beta-aminodeacetoxycephalosporanic acid Chemical compound S1CC(C)=C(C(O)=O)N2C(=O)[C@@H](N)[C@@H]12 NVIAYEIXYQCDAN-CLZZGJSISA-N 0.000 description 2
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 239000006286 aqueous extract Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 2
- 230000002906 microbiologic effect Effects 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- QITDACOZCQXYQY-BAFYGKSASA-N (6r)-7-amino-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one Chemical class S1CC=CN2C(=O)C(N)[C@H]21 QITDACOZCQXYQY-BAFYGKSASA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- JLHMJWHSBYZWJJ-UHFFFAOYSA-N 1,2-thiazole 1-oxide Chemical class O=S1C=CC=N1 JLHMJWHSBYZWJJ-UHFFFAOYSA-N 0.000 description 1
- HYBDSXBLGCQKRE-UHFFFAOYSA-N 1-(2,6-dichlorophenyl)ethanone Chemical compound CC(=O)C1=C(Cl)C=CC=C1Cl HYBDSXBLGCQKRE-UHFFFAOYSA-N 0.000 description 1
- QMSVNDSDEZTYAS-UHFFFAOYSA-N 1-bromo-1-chloroethane Chemical compound CC(Cl)Br QMSVNDSDEZTYAS-UHFFFAOYSA-N 0.000 description 1
- SODQFLRLAOALCF-UHFFFAOYSA-N 1lambda3-bromacyclohexa-1,3,5-triene Chemical compound Br1=CC=CC=C1 SODQFLRLAOALCF-UHFFFAOYSA-N 0.000 description 1
- OBETXYAYXDNJHR-UHFFFAOYSA-M 2-ethylhexanoate Chemical compound CCCCC(CC)C([O-])=O OBETXYAYXDNJHR-UHFFFAOYSA-M 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- AGIJRRREJXSQJR-UHFFFAOYSA-N 2h-thiazine Chemical group N1SC=CC=C1 AGIJRRREJXSQJR-UHFFFAOYSA-N 0.000 description 1
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical class [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 description 1
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229930182555 Penicillin Natural products 0.000 description 1
- 229930195708 Penicillin V Natural products 0.000 description 1
- IKFIAYNBJNQVLS-UHFFFAOYSA-N [S].C1CSCN1 Chemical group [S].C1CSCN1 IKFIAYNBJNQVLS-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- CSGFFYNMTALICU-ZWNOBZJWSA-N adipyl-7-aminodesacetoxycephalosporanic acid Natural products CC1=C(N2[C@H](SC1)[C@H](NC(=O)CCCCC(O)=O)C2=O)C(O)=O CSGFFYNMTALICU-ZWNOBZJWSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- CREXVNNSNOKDHW-UHFFFAOYSA-N azaniumylideneazanide Chemical group N[N] CREXVNNSNOKDHW-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 125000002618 bicyclic heterocycle group Chemical group 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- GNEPOXWQWFSSOU-UHFFFAOYSA-N dichloro-methyl-phenylsilane Chemical compound C[Si](Cl)(Cl)C1=CC=CC=C1 GNEPOXWQWFSSOU-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- MVEAAGBEUOMFRX-UHFFFAOYSA-N ethyl acetate;hydrochloride Chemical compound Cl.CCOC(C)=O MVEAAGBEUOMFRX-UHFFFAOYSA-N 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000000855 fermentation Methods 0.000 description 1
- 230000004151 fermentation Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- JYJVVHFRSFVEJM-UHFFFAOYSA-N iodosobenzene Chemical compound O=IC1=CC=CC=C1 JYJVVHFRSFVEJM-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 238000013048 microbiological method Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 125000001038 naphthoyl group Chemical group C1(=CC=CC2=CC=CC=C12)C(=O)* 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229940049954 penicillin Drugs 0.000 description 1
- 229940056367 penicillin v Drugs 0.000 description 1
- KHIWWQKSHDUIBK-UHFFFAOYSA-N periodic acid Chemical compound OI(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-N 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- BPLBGHOLXOTWMN-MBNYWOFBSA-N phenoxymethylpenicillin Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)COC1=CC=CC=C1 BPLBGHOLXOTWMN-MBNYWOFBSA-N 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000005544 phthalimido group Chemical group 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 238000006049 ring expansion reaction Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 150000003860 tertiary carboxamides Chemical class 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 238000002211 ultraviolet spectrum Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB789270A GB1355791A (en) | 1970-02-18 | 1970-02-18 | Process for the preparation of cephalosporanic acid derivatives application |
| GB3579670 | 1970-07-23 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2107650A1 DE2107650A1 (ref) | 1971-09-02 |
| DE2107650B2 true DE2107650B2 (de) | 1979-07-19 |
| DE2107650C3 DE2107650C3 (ref) | 1980-03-20 |
Family
ID=26241736
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2107650A Granted DE2107650B2 (de) | 1970-02-18 | 1971-02-17 | Verfahren zur Herstellung von 7-Acylamido-S-methyl-ceph-S-em^-Carbonsäurederivaten |
| DE19712166561 Pending DE2166561A1 (de) | 1970-02-18 | 1971-02-17 | 6-aminopenicillansulfoxidsilylester |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712166561 Pending DE2166561A1 (de) | 1970-02-18 | 1971-02-17 | 6-aminopenicillansulfoxidsilylester |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US3852281A (ref) |
| JP (2) | JPS5139234B1 (ref) |
| AT (1) | AT317420B (ref) |
| CA (1) | CA976546A (ref) |
| CH (1) | CH570408A5 (ref) |
| CS (1) | CS191866B2 (ref) |
| DE (2) | DE2107650B2 (ref) |
| DK (1) | DK140639B (ref) |
| ES (1) | ES388373A1 (ref) |
| FI (1) | FI55205C (ref) |
| FR (1) | FR2078715A5 (ref) |
| HU (1) | HU166587B (ref) |
| IE (1) | IE35010B1 (ref) |
| IL (1) | IL36217A (ref) |
| LU (1) | LU62618A1 (ref) |
| NL (1) | NL170148C (ref) |
| NO (2) | NO144170C (ref) |
| PH (1) | PH9353A (ref) |
| PL (1) | PL82809B1 (ref) |
| RO (1) | RO58059A (ref) |
| SE (2) | SE395897B (ref) |
| YU (1) | YU35448B (ref) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS536158B2 (ref) * | 1972-03-23 | 1978-03-04 | ||
| JPS4970989A (ref) * | 1972-11-15 | 1974-07-09 | ||
| GB1442785A (en) * | 1972-12-09 | 1976-07-14 | Nikken Chemicals Co Ltd | Desacetoxy ceaphalosporanic acids |
| DE2309599A1 (de) * | 1973-02-26 | 1974-09-05 | Bayer Ag | Verfahren zur herstellung von 7-acylamino-desacetoxy-cephalosporansaeurederivaten |
| JPS5084591A (ref) * | 1973-11-29 | 1975-07-08 | ||
| US4022773A (en) * | 1974-08-29 | 1977-05-10 | Toshiyasu Ishimaru | Cephalosporin esters |
| CA1069126A (en) * | 1974-12-24 | 1980-01-01 | Eli Lilly And Company | Sulfinyl halides and their preparation from penicillin sulfoxides |
| CN102617602A (zh) * | 2012-03-15 | 2012-08-01 | 江苏九九久科技股份有限公司 | 合成7-苯乙酰氨基去乙酰氧基头孢g酸的方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3275626A (en) * | 1962-07-31 | 1966-09-27 | Lilly Co Eli | Penicillin conversion via sulfoxide |
| US3591585A (en) * | 1969-02-14 | 1971-07-06 | Lilly Co Eli | Process for making desacetoxycephalosporins |
| ES377330A1 (es) * | 1969-03-11 | 1972-06-16 | Glaxo Lab Ltd | Procedimiento para preparar esteres de acido 7 beta-acila- mido-3-metilcef3-em-4-carboxilico. |
| US3632850A (en) * | 1969-03-18 | 1972-01-04 | Lilly Co Eli | Cephalexin synthesis |
| GB1312233A (en) * | 1969-12-05 | 1973-04-04 | Glaxo Lab Ltd | Cephalosporin compounds |
-
1971
- 1971-02-16 YU YU382/71A patent/YU35448B/xx unknown
- 1971-02-16 US US00115883A patent/US3852281A/en not_active Expired - Lifetime
- 1971-02-17 SE SE7102038A patent/SE395897B/xx unknown
- 1971-02-17 DK DK72671AA patent/DK140639B/da not_active IP Right Cessation
- 1971-02-17 JP JP46007332A patent/JPS5139234B1/ja active Pending
- 1971-02-17 FR FR7105387A patent/FR2078715A5/fr not_active Expired
- 1971-02-17 NL NLAANVRAGE7102131,A patent/NL170148C/xx not_active IP Right Cessation
- 1971-02-17 PH PH12203*UA patent/PH9353A/en unknown
- 1971-02-17 DE DE2107650A patent/DE2107650B2/de active Granted
- 1971-02-17 IL IL36217A patent/IL36217A/xx unknown
- 1971-02-17 AT AT134671A patent/AT317420B/de not_active IP Right Cessation
- 1971-02-17 CA CA105,608A patent/CA976546A/en not_active Expired
- 1971-02-17 HU HUKO2402A patent/HU166587B/hu unknown
- 1971-02-17 IE IE191/71A patent/IE35010B1/xx unknown
- 1971-02-17 CS CS711203A patent/CS191866B2/cs unknown
- 1971-02-17 PL PL1971146306A patent/PL82809B1/pl unknown
- 1971-02-17 FI FI450/71A patent/FI55205C/fi active
- 1971-02-17 DE DE19712166561 patent/DE2166561A1/de active Pending
- 1971-02-17 CH CH228371A patent/CH570408A5/xx not_active IP Right Cessation
- 1971-02-17 NO NO580/71A patent/NO144170C/no unknown
- 1971-02-17 LU LU62618D patent/LU62618A1/xx unknown
- 1971-02-17 ES ES388373A patent/ES388373A1/es not_active Expired
- 1971-02-18 RO RO65983A patent/RO58059A/ro unknown
- 1971-08-20 NO NO3114/71A patent/NO144168C/no unknown
-
1974
- 1974-02-15 SE SE7402023A patent/SE411549B/sv not_active IP Right Cessation
-
1976
- 1976-04-19 JP JP51046075A patent/JPS5217490A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE2107650A1 (ref) | 1971-09-02 |
| US3852281A (en) | 1974-12-03 |
| DE2107650C3 (ref) | 1980-03-20 |
| LU62618A1 (ref) | 1971-12-29 |
| FR2078715A5 (ref) | 1971-11-05 |
| DE2166561A1 (de) | 1974-08-22 |
| DK140639B (da) | 1979-10-15 |
| FI55205C (fi) | 1979-06-11 |
| CA976546A (en) | 1975-10-21 |
| NO144170B (no) | 1981-03-30 |
| YU35448B (en) | 1981-02-28 |
| ES388373A1 (es) | 1974-03-16 |
| CS191866B2 (en) | 1979-07-31 |
| NO144168B (no) | 1981-03-30 |
| JPS5217490A (en) | 1977-02-09 |
| NL170148C (nl) | 1982-10-01 |
| JPS5139234B1 (ref) | 1976-10-26 |
| NL7102131A (ref) | 1971-08-20 |
| HU166587B (ref) | 1975-04-28 |
| IL36217A0 (en) | 1971-04-28 |
| AT317420B (de) | 1974-08-26 |
| IL36217A (en) | 1974-09-10 |
| CH570408A5 (ref) | 1975-12-15 |
| YU38271A (en) | 1980-09-25 |
| DK140639C (ref) | 1980-03-10 |
| NO144168C (no) | 1981-07-08 |
| IE35010B1 (en) | 1975-10-15 |
| SE411549B (sv) | 1980-01-14 |
| JPS5420516B2 (ref) | 1979-07-23 |
| IE35010L (en) | 1971-08-18 |
| RO58059A (ref) | 1975-06-15 |
| NO144170C (no) | 1981-07-08 |
| SE395897B (sv) | 1977-08-29 |
| FI55205B (fi) | 1979-02-28 |
| PL82809B1 (en) | 1975-10-31 |
| PH9353A (en) | 1975-10-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2258221C2 (de) | Verfahren zur Herstellung von Penicillinen und Cepholosporinen mit einem weiteren Substituenten in 6- bzw. 7-Stellung | |
| DE2240224C3 (de) | Verfahren zur Herstellung von A3 methyl-cephem- 4-carbonsäuren | |
| DE2462383A1 (de) | Verfahren zur herstellung von antibiotischen mitteln | |
| DE2107650C3 (ref) | ||
| DE2324272A1 (de) | 3-methylencephalosporine | |
| DE2265641C2 (de) | 7-Iminocephalosporine | |
| DE2318852C3 (de) | Verfahren zur Herstellung von 7-Acylamido-3-halogen-3-methyl--cepham-4-carbonsäureestern | |
| DE2501219A1 (de) | Verfahren zur herstellung von 7-aminocephalosporansaeuren | |
| DE2754743A1 (de) | Thiooximcephalosporin- und -penicillin- derivate, verfahren zu ihrer herstellung und ihre verwendung als arzneistoffe | |
| CH615675A5 (ref) | ||
| DE2534926C2 (de) | Verfahren zur Herstellung von Estern der 7-Oxo- und 7β-Hydroxy-cephalosporansäure und deren 3-substituierten Derivaten | |
| AT328085B (de) | Verfahren zur herstellung neuer penicilline | |
| DE2505280A1 (de) | Azetidinderivate, verfahren zu ihrer herstellung und ihre verwendung zur herstellung von cephalosporansaeurederivaten | |
| AT403048B (de) | Verfahren zur herstellung von cephem-derivaten | |
| DE2151036C2 (de) | 6-Azido- und 6-Amino-penicillansäureester und Verfahren zu deren Herstellung | |
| DE2215039A1 (de) | Neue Acyloxyalkylesterderivate von Penicillin und Cephalosporin | |
| DE2822876A1 (de) | Verfahren zur herstellung von hydroxy- alpha-aminobenzylpenicillin | |
| DE2221035C2 (de) | Verfahren zur Herstellung von substituierten 6-Iminopenicillinen und 7-Iminocephalosporinen | |
| DE2412598A1 (de) | Verfahren zur herstellung von 7-alkoxycephalosporinen bzw. 6-alkoxypenicillinen | |
| DE2334343C2 (de) | Verfahren zur Herstellung von Pivaloyloxymethyl-6-[ α-(carboxy)phenylacetamido]-penicillanat | |
| AT323323B (de) | Verfahren zur herstellung neuer 6-aminopenicillansulfoxydsilylester | |
| DE2408171C3 (de) | Silyl-oxazolidinon-Verbindungen und Verfahren zu ihrer Herstellung | |
| AT309684B (de) | Verfahren zur Herstellung von neuen Penicillinen und Cephalosporinen | |
| DE1906194C3 (de) | 3-Brommethyl-A2 -cephalosporine und Verfahren zu ihrer Herstellung | |
| DE2264753C3 (de) | Penicillansäureverbindungen und Verfahren zu deren Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |