DE2021983C3 - Spannungsabhängiger Widerstand - Google Patents
Spannungsabhängiger WiderstandInfo
- Publication number
- DE2021983C3 DE2021983C3 DE2021983A DE2021983A DE2021983C3 DE 2021983 C3 DE2021983 C3 DE 2021983C3 DE 2021983 A DE2021983 A DE 2021983A DE 2021983 A DE2021983 A DE 2021983A DE 2021983 C3 DE2021983 C3 DE 2021983C3
- Authority
- DE
- Germany
- Prior art keywords
- fluoride
- mol
- voltage
- sintered body
- dependent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000001419 dependent effect Effects 0.000 title claims description 32
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 claims description 32
- 239000000654 additive Substances 0.000 claims description 31
- PQXKHYXIUOZZFA-UHFFFAOYSA-M lithium fluoride Chemical compound [Li+].[F-] PQXKHYXIUOZZFA-UHFFFAOYSA-M 0.000 claims description 18
- 229910021569 Manganese fluoride Inorganic materials 0.000 claims description 17
- CTNMMTCXUUFYAP-UHFFFAOYSA-L difluoromanganese Chemical compound F[Mn]F CTNMMTCXUUFYAP-UHFFFAOYSA-L 0.000 claims description 16
- 239000011787 zinc oxide Substances 0.000 claims description 16
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 claims description 12
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 10
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 claims description 10
- YCYBZKSMUPTWEE-UHFFFAOYSA-L cobalt(ii) fluoride Chemical compound F[Co]F YCYBZKSMUPTWEE-UHFFFAOYSA-L 0.000 claims description 9
- 229910021583 Cobalt(III) fluoride Inorganic materials 0.000 claims description 8
- 229910021594 Copper(II) fluoride Inorganic materials 0.000 claims description 7
- WUKWITHWXAAZEY-UHFFFAOYSA-L calcium difluoride Chemical compound [F-].[F-].[Ca+2] WUKWITHWXAAZEY-UHFFFAOYSA-L 0.000 claims description 7
- 229910001634 calcium fluoride Inorganic materials 0.000 claims description 7
- 150000002222 fluorine compounds Chemical class 0.000 claims description 7
- BYMUNNMMXKDFEZ-UHFFFAOYSA-K trifluorolanthanum Chemical compound F[La](F)F BYMUNNMMXKDFEZ-UHFFFAOYSA-K 0.000 claims description 7
- LVEULQCPJDDSLD-UHFFFAOYSA-L cadmium fluoride Chemical compound F[Cd]F LVEULQCPJDDSLD-UHFFFAOYSA-L 0.000 claims description 6
- 229910021563 chromium fluoride Inorganic materials 0.000 claims description 6
- ORUIBWPALBXDOA-UHFFFAOYSA-L magnesium fluoride Chemical compound [F-].[F-].[Mg+2] ORUIBWPALBXDOA-UHFFFAOYSA-L 0.000 claims description 6
- 229910001635 magnesium fluoride Inorganic materials 0.000 claims description 6
- 239000011698 potassium fluoride Substances 0.000 claims description 6
- 235000003270 potassium fluoride Nutrition 0.000 claims description 6
- FTBATIJJKIIOTP-UHFFFAOYSA-K trifluorochromium Chemical compound F[Cr](F)F FTBATIJJKIIOTP-UHFFFAOYSA-K 0.000 claims description 6
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 claims description 5
- GWFAVIIMQDUCRA-UHFFFAOYSA-L copper(ii) fluoride Chemical compound [F-].[F-].[Cu+2] GWFAVIIMQDUCRA-UHFFFAOYSA-L 0.000 claims description 5
- 229910052742 iron Inorganic materials 0.000 claims description 5
- 239000011775 sodium fluoride Substances 0.000 claims description 5
- 235000013024 sodium fluoride Nutrition 0.000 claims description 5
- 229910052804 chromium Inorganic materials 0.000 claims description 4
- 239000011651 chromium Substances 0.000 claims description 4
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 3
- 229910017052 cobalt Inorganic materials 0.000 claims description 3
- 239000010941 cobalt Substances 0.000 claims description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 150000001768 cations Chemical class 0.000 claims description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 2
- 230000000996 additive effect Effects 0.000 description 14
- 239000000203 mixture Substances 0.000 description 11
- 238000000034 method Methods 0.000 description 9
- 239000000395 magnesium oxide Substances 0.000 description 7
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 7
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 7
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 5
- 230000000737 periodic effect Effects 0.000 description 5
- 229910000428 cobalt oxide Inorganic materials 0.000 description 4
- IVMYJDGYRUAWML-UHFFFAOYSA-N cobalt(ii) oxide Chemical compound [Co]=O IVMYJDGYRUAWML-UHFFFAOYSA-N 0.000 description 4
- 229910052709 silver Inorganic materials 0.000 description 4
- 239000004332 silver Substances 0.000 description 4
- 239000000919 ceramic Substances 0.000 description 3
- 238000005245 sintering Methods 0.000 description 3
- VTLYFUHAOXGGBS-UHFFFAOYSA-N Fe3+ Chemical compound [Fe+3] VTLYFUHAOXGGBS-UHFFFAOYSA-N 0.000 description 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 2
- 230000037237 body shape Effects 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- SHXXPRJOPFJRHA-UHFFFAOYSA-K iron(iii) fluoride Chemical compound F[Fe](F)F SHXXPRJOPFJRHA-UHFFFAOYSA-K 0.000 description 2
- 229910052746 lanthanum Inorganic materials 0.000 description 2
- MRELNEQAGSRDBK-UHFFFAOYSA-N lanthanum(3+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[La+3].[La+3] MRELNEQAGSRDBK-UHFFFAOYSA-N 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 229910000679 solder Inorganic materials 0.000 description 2
- 238000010792 warming Methods 0.000 description 2
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- -1 Manganese fluoride Copper fluoride Chemical compound 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- SKDPGMZPNVYUBP-UHFFFAOYSA-J [Mg+2].[F-].[Mn+2].[F-].[F-].[F-] Chemical compound [Mg+2].[F-].[Mn+2].[F-].[F-].[F-] SKDPGMZPNVYUBP-UHFFFAOYSA-J 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 229910000416 bismuth oxide Inorganic materials 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 229910000423 chromium oxide Inorganic materials 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- TYIXMATWDRGMPF-UHFFFAOYSA-N dibismuth;oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Bi+3].[Bi+3] TYIXMATWDRGMPF-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000009713 electroplating Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 239000005007 epoxy-phenolic resin Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000010436 fluorite Substances 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- LIKBJVNGSGBSGK-UHFFFAOYSA-N iron(3+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Fe+3].[Fe+3] LIKBJVNGSGBSGK-UHFFFAOYSA-N 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- 229910000480 nickel oxide Inorganic materials 0.000 description 1
- 229910000484 niobium oxide Inorganic materials 0.000 description 1
- URLJKFSTXLNXLG-UHFFFAOYSA-N niobium(5+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[O-2].[O-2].[Nb+5].[Nb+5] URLJKFSTXLNXLG-UHFFFAOYSA-N 0.000 description 1
- QGLKJKCYBOYXKC-UHFFFAOYSA-N nonaoxidotritungsten Chemical compound O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1 QGLKJKCYBOYXKC-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- GNRSAWUEBMWBQH-UHFFFAOYSA-N oxonickel Chemical compound [Ni]=O GNRSAWUEBMWBQH-UHFFFAOYSA-N 0.000 description 1
- BPUBBGLMJRNUCC-UHFFFAOYSA-N oxygen(2-);tantalum(5+) Chemical compound [O-2].[O-2].[O-2].[O-2].[O-2].[Ta+5].[Ta+5] BPUBBGLMJRNUCC-UHFFFAOYSA-N 0.000 description 1
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000004065 semiconductor Substances 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229910001936 tantalum oxide Inorganic materials 0.000 description 1
- 229910001930 tungsten oxide Inorganic materials 0.000 description 1
- 238000005019 vapor deposition process Methods 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 229910001928 zirconium oxide Inorganic materials 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01C—RESISTORS
- H01C7/00—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material
- H01C7/10—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material voltage responsive, i.e. varistors
- H01C7/105—Varistor cores
- H01C7/108—Metal oxide
- H01C7/112—ZnO type
Landscapes
- Engineering & Computer Science (AREA)
- Microelectronics & Electronic Packaging (AREA)
- Physics & Mathematics (AREA)
- Electromagnetism (AREA)
- Thermistors And Varistors (AREA)
- Compositions Of Oxide Ceramics (AREA)
- Inorganic Compounds Of Heavy Metals (AREA)
- Catalysts (AREA)
- Silicates, Zeolites, And Molecular Sieves (AREA)
- Glass Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP44034928A JPS4840790B1 (OSRAM) | 1969-05-02 | 1969-05-02 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2021983A1 DE2021983A1 (de) | 1971-01-07 |
| DE2021983B2 DE2021983B2 (de) | 1978-01-19 |
| DE2021983C3 true DE2021983C3 (de) | 1978-10-12 |
Family
ID=12427844
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2021983A Expired DE2021983C3 (de) | 1969-05-02 | 1970-04-29 | Spannungsabhängiger Widerstand |
| DE2022219*A Expired DE2022219C3 (de) | 1969-05-02 | 1970-04-30 | Spannungsabhängiger Widerstand |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2022219*A Expired DE2022219C3 (de) | 1969-05-02 | 1970-04-30 | Spannungsabhängiger Widerstand |
Country Status (6)
| Country | Link |
|---|---|
| US (2) | US3642664A (OSRAM) |
| JP (1) | JPS4840790B1 (OSRAM) |
| DE (2) | DE2021983C3 (OSRAM) |
| FR (2) | FR2047124A5 (OSRAM) |
| GB (2) | GB1307597A (OSRAM) |
| NL (2) | NL151540B (OSRAM) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3805114A (en) * | 1972-03-01 | 1974-04-16 | Matsushita Electric Industrial Co Ltd | Voltage-nonlinear resistors |
| US3806765A (en) * | 1972-03-01 | 1974-04-23 | Matsushita Electric Industrial Co Ltd | Voltage-nonlinear resistors |
| DE2342172C3 (de) * | 1972-09-20 | 1979-09-27 | Matsushita Electric Industrial Co., Ltd., Kadoma, Osaka (Japan) | Spannungsabhängiger Widerstand mit Zinkoxid als Hauptbestandteil |
| JPS539397B2 (OSRAM) * | 1973-07-09 | 1978-04-05 | ||
| GB1461116A (en) * | 1973-07-18 | 1977-01-13 | Conradty Fa C | Voltage dependant resistors of sintered ceramic material |
| CA1029133A (en) * | 1974-02-20 | 1978-04-04 | Mikio Matsuura | Voltage-dependent resistor |
| US4042535A (en) * | 1975-09-25 | 1977-08-16 | General Electric Company | Metal oxide varistor with improved electrical properties |
| US4103274A (en) * | 1976-09-13 | 1978-07-25 | General Electric Company | Reconstituted metal oxide varistor |
| US4338223A (en) * | 1979-05-30 | 1982-07-06 | Marcon Electronics Co., Ltd. | Method of manufacturing a voltage-nonlinear resistor |
| US4327349A (en) * | 1980-03-19 | 1982-04-27 | General Electric Company | Transformer core having charge dissipation facility |
| US4436650A (en) * | 1982-07-14 | 1984-03-13 | Gte Laboratories Incorporated | Low voltage ceramic varistor |
| US5294374A (en) * | 1992-03-20 | 1994-03-15 | Leviton Manufacturing Co., Inc. | Electrical overstress materials and method of manufacture |
| CN1048109C (zh) * | 1994-07-13 | 2000-01-05 | 松下电器产业株式会社 | 高分子感温体和用其制造的感温元件 |
| US5854586A (en) * | 1997-09-17 | 1998-12-29 | Lockheed Martin Energy Research Corporation | Rare earth doped zinc oxide varistors |
| JP5865711B2 (ja) * | 2012-01-13 | 2016-02-17 | Jx日鉱日石金属株式会社 | 低屈折率膜形成用イオンプレーティング用材料及び低屈折率膜 |
| JP5837183B2 (ja) * | 2012-03-28 | 2015-12-24 | Jx日鉱日石金属株式会社 | 低屈折率膜形成用焼結体及びその製造方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3089856A (en) * | 1960-11-10 | 1963-05-14 | New Jersey Zinc Co | Production of conductive zinc oxide |
| FR1510286A (OSRAM) * | 1966-01-13 | 1968-04-03 |
-
1969
- 1969-05-02 JP JP44034928A patent/JPS4840790B1/ja active Pending
-
1970
- 1970-04-17 US US29415A patent/US3642664A/en not_active Expired - Lifetime
- 1970-04-17 US US05/029,416 patent/US3936396A/en not_active Expired - Lifetime
- 1970-04-29 FR FR7015723A patent/FR2047124A5/fr not_active Expired
- 1970-04-29 DE DE2021983A patent/DE2021983C3/de not_active Expired
- 1970-04-29 FR FR7015721A patent/FR2047123A5/fr not_active Expired
- 1970-04-30 DE DE2022219*A patent/DE2022219C3/de not_active Expired
- 1970-05-01 NL NL707006480A patent/NL151540B/xx not_active IP Right Cessation
- 1970-05-01 NL NL707006479A patent/NL151830B/xx not_active IP Right Cessation
- 1970-05-04 GB GB2124170A patent/GB1307597A/en not_active Expired
- 1970-05-04 GB GB2124270A patent/GB1307598A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL7006480A (OSRAM) | 1970-11-04 |
| DE2022219B2 (de) | 1973-07-19 |
| DE2021983A1 (de) | 1971-01-07 |
| DE2022219A1 (de) | 1970-12-17 |
| NL151540B (nl) | 1976-11-15 |
| DE2021983B2 (de) | 1978-01-19 |
| FR2047124A5 (OSRAM) | 1971-03-12 |
| JPS4840790B1 (OSRAM) | 1973-12-03 |
| GB1307598A (en) | 1973-02-21 |
| US3642664A (en) | 1972-02-15 |
| GB1307597A (en) | 1973-02-21 |
| DE2022219C3 (de) | 1974-06-06 |
| NL7006479A (OSRAM) | 1970-11-04 |
| FR2047123A5 (OSRAM) | 1971-03-12 |
| NL151830B (nl) | 1976-12-15 |
| US3936396A (en) | 1976-02-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2021983C3 (de) | Spannungsabhängiger Widerstand | |
| DE3785506T2 (de) | Halbleitende keramische zusammensetzung, sowie kondensator aus halbleitender keramik. | |
| DE2365232B2 (de) | Verfahren zur herstellung eines aufgrund der zusammensetzung seiner masse selbst spannungsabhaengigen gesinterten widerstandes | |
| DE2552127B2 (de) | Keramikhalbleiter | |
| DE1961679C3 (de) | Spannungsabhängiger Widerstand auf der Basis von Zinkoxid (ZnO) | |
| DE1956817B2 (de) | Mangan-modifizierte spannungsabhaengige zinkoxid-widerstandskeramikmasse | |
| EP0066333B1 (de) | Nichtlinearer Widerstand und Verfahren zu seiner Herstellung | |
| EP0065806B1 (de) | Spannungsabhängiger Widerstand und Verfahren zu seiner Herstellung | |
| DE2641996C3 (de) | Spannungsabhängiges Widerstandselement | |
| DE2215933B2 (de) | Spannungsabhängige Massewiderstände | |
| DE19832843A1 (de) | Thermistor | |
| DE1952840C3 (de) | Keramikkörper als spannungsabhangiger Widerstand | |
| DE2225431C2 (de) | Metalloxid-Varistor mit einem Gehalt an ZnO | |
| DE1954056C3 (de) | Verfahren zur Herstellung eines spannungsabhängigen Widerstandes | |
| DE2932212C2 (de) | Varistor, dessen Herstellverfahren und dessen Verwendung | |
| DE2026011C3 (de) | Spannungsabhängiger Widerstand | |
| DE1961680C3 (de) | Spannungsabhängiger Widerstand auf der Basis von Zinkoxid | |
| DE2441450C3 (de) | Keramikkondensator und Verfahren seiner Herstellung | |
| DE2135916A1 (de) | Thermistor für hohe Temperaturen | |
| DE1765244C3 (de) | Spannungsabhängiger ZnO-Widerstand | |
| DE2009319C (de) | Spannungsabhängiger Widerstand | |
| DE1961680A1 (de) | Widerstaende mit variabler Spannung | |
| DE2033850C3 (de) | Spannungsabhängiger Widerstand | |
| DE1952838B2 (de) | Keramikkoerper als spannungsabhaengiger widerstand | |
| DE2026003C3 (de) | Spannungsabhängiger Widerstand |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |