DE2020299A1 - Perinonfarbstoffe - Google Patents
PerinonfarbstoffeInfo
- Publication number
- DE2020299A1 DE2020299A1 DE19702020299 DE2020299A DE2020299A1 DE 2020299 A1 DE2020299 A1 DE 2020299A1 DE 19702020299 DE19702020299 DE 19702020299 DE 2020299 A DE2020299 A DE 2020299A DE 2020299 A1 DE2020299 A1 DE 2020299A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- perinone
- dyes
- parts
- dye
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000975 dye Substances 0.000 title claims description 29
- -1 cyclic amine Chemical class 0.000 claims description 21
- 239000002253 acid Substances 0.000 claims description 12
- 238000004043 dyeing Methods 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- DGBWPZSGHAXYGK-UHFFFAOYSA-N perinone Chemical compound C12=NC3=CC=CC=C3N2C(=O)C2=CC=C3C4=C2C1=CC=C4C(=O)N1C2=CC=CC=C2N=C13 DGBWPZSGHAXYGK-UHFFFAOYSA-N 0.000 claims description 9
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical class C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical group 0.000 claims description 5
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical class C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 150000004820 halides Chemical class 0.000 claims description 4
- 230000002209 hydrophobic effect Effects 0.000 claims description 4
- 239000012442 inert solvent Substances 0.000 claims description 4
- 150000002780 morpholines Chemical class 0.000 claims description 4
- 150000003053 piperidines Chemical class 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 150000003235 pyrrolidines Chemical class 0.000 claims description 4
- 150000004886 thiomorpholines Chemical class 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- 239000011230 binding agent Substances 0.000 claims description 3
- 239000002657 fibrous material Substances 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical group OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 claims 4
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims 1
- 230000002378 acidificating effect Effects 0.000 claims 1
- 239000000835 fiber Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 6
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- 229920000728 polyester Polymers 0.000 description 5
- YFOOEYJGMMJJLS-UHFFFAOYSA-N 1,8-diaminonaphthalene Chemical compound C1=CC(N)=C2C(N)=CC=CC2=C1 YFOOEYJGMMJJLS-UHFFFAOYSA-N 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 4
- 238000000859 sublimation Methods 0.000 description 4
- 230000008022 sublimation Effects 0.000 description 4
- RNXBULGSPPJUKF-UHFFFAOYSA-N 2,5-dimethylthiomorpholine Chemical compound CC1CSC(C)CN1 RNXBULGSPPJUKF-UHFFFAOYSA-N 0.000 description 3
- MHHCLPHGZOISFK-UHFFFAOYSA-N 2-methylthiomorpholine Chemical compound CC1CNCCS1 MHHCLPHGZOISFK-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 238000009826 distribution Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 2
- NDOVLWQBFFJETK-UHFFFAOYSA-N 1,4-thiazinane 1,1-dioxide Chemical compound O=S1(=O)CCNCC1 NDOVLWQBFFJETK-UHFFFAOYSA-N 0.000 description 2
- OSKSVESWLSCULX-UHFFFAOYSA-N 2,3-dimethylthiomorpholine Chemical compound CC1NCCSC1C OSKSVESWLSCULX-UHFFFAOYSA-N 0.000 description 2
- QOZOFODNIBQPGN-UHFFFAOYSA-N 2,4-dimethylpiperidine Chemical compound CC1CCNC(C)C1 QOZOFODNIBQPGN-UHFFFAOYSA-N 0.000 description 2
- RPSYMAMREDJAES-UHFFFAOYSA-N 2,5-dimethylmorpholine Chemical compound CC1COC(C)CN1 RPSYMAMREDJAES-UHFFFAOYSA-N 0.000 description 2
- ICBFNPPCXPMCBP-UHFFFAOYSA-N 2,5-dimethylpiperidine Chemical compound CC1CCC(C)NC1 ICBFNPPCXPMCBP-UHFFFAOYSA-N 0.000 description 2
- SDGKUVSVPIIUCF-UHFFFAOYSA-N 2,6-dimethylpiperidine Chemical compound CC1CCCC(C)N1 SDGKUVSVPIIUCF-UHFFFAOYSA-N 0.000 description 2
- HEFKKYCXFOTNTB-UHFFFAOYSA-N 2,6-dimethylthiomorpholine Chemical compound CC1CNCC(C)S1 HEFKKYCXFOTNTB-UHFFFAOYSA-N 0.000 description 2
- NNWUEBIEOFQMSS-UHFFFAOYSA-N 2-Methylpiperidine Chemical compound CC1CCCCN1 NNWUEBIEOFQMSS-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- ABUQTRRRWPNEQK-UHFFFAOYSA-N 2-bromopiperidine Chemical compound BrC1CCCCN1 ABUQTRRRWPNEQK-UHFFFAOYSA-N 0.000 description 2
- RGHPCLZJAFCTIK-UHFFFAOYSA-N 2-methylpyrrolidine Chemical compound CC1CCCN1 RGHPCLZJAFCTIK-UHFFFAOYSA-N 0.000 description 2
- YQUBWBSLSNIUBN-UHFFFAOYSA-N 3-chloropiperidine Chemical compound ClC1CCCNC1 YQUBWBSLSNIUBN-UHFFFAOYSA-N 0.000 description 2
- KZZPRWYOUNLBQK-UHFFFAOYSA-N 3-methylthiomorpholine Chemical compound CC1CSCCN1 KZZPRWYOUNLBQK-UHFFFAOYSA-N 0.000 description 2
- ZEYSHALLPAKUHG-UHFFFAOYSA-N 4-methoxypiperidine Chemical compound COC1CCNCC1 ZEYSHALLPAKUHG-UHFFFAOYSA-N 0.000 description 2
- UZOFELREXGAFOI-UHFFFAOYSA-N 4-methylpiperidine Chemical compound CC1CCNCC1 UZOFELREXGAFOI-UHFFFAOYSA-N 0.000 description 2
- XOFNHZHCGBPVGJ-UHFFFAOYSA-N 5-ethyl-2-methylpiperidine Chemical compound CCC1CCC(C)NC1 XOFNHZHCGBPVGJ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- 239000000370 acceptor Substances 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- LLEMOWNGBBNAJR-UHFFFAOYSA-N biphenyl-2-ol Chemical compound OC1=CC=CC=C1C1=CC=CC=C1 LLEMOWNGBBNAJR-UHFFFAOYSA-N 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000004040 coloring Methods 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 239000001044 red dye Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- ARCGXLSVLAOJQL-UHFFFAOYSA-N trimellitic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C(C(O)=O)=C1 ARCGXLSVLAOJQL-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ZKCLHJUZGZWTNA-UHFFFAOYSA-N 2,3-dimethylpyrrolidine Chemical compound CC1CCNC1C ZKCLHJUZGZWTNA-UHFFFAOYSA-N 0.000 description 1
- ZEBFPAXSQXIPNF-UHFFFAOYSA-N 2,5-dimethylpyrrolidine Chemical compound CC1CCC(C)N1 ZEBFPAXSQXIPNF-UHFFFAOYSA-N 0.000 description 1
- HNVIQLPOGUDBSU-UHFFFAOYSA-N 2,6-dimethylmorpholine Chemical compound CC1CNCC(C)O1 HNVIQLPOGUDBSU-UHFFFAOYSA-N 0.000 description 1
- ISQWYHZNUJHVKJ-UHFFFAOYSA-N 2-chloropiperidine Chemical compound ClC1CCCCN1 ISQWYHZNUJHVKJ-UHFFFAOYSA-N 0.000 description 1
- FJOWUOPTYZSMSG-UHFFFAOYSA-N 2-ethoxypiperidine Chemical compound CCOC1CCCCN1 FJOWUOPTYZSMSG-UHFFFAOYSA-N 0.000 description 1
- QBBKKFZGCDJDQK-UHFFFAOYSA-N 2-ethylpiperidine Chemical compound CCC1CCCCN1 QBBKKFZGCDJDQK-UHFFFAOYSA-N 0.000 description 1
- DNYWGUIJLFDIPD-UHFFFAOYSA-N 2-methoxypiperidine Chemical compound COC1CCCCN1 DNYWGUIJLFDIPD-UHFFFAOYSA-N 0.000 description 1
- LQMMFVPUIVBYII-UHFFFAOYSA-N 2-methylmorpholine Chemical compound CC1CNCCO1 LQMMFVPUIVBYII-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical class CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- CWXVJIRMENQIMZ-UHFFFAOYSA-N 3,3-dichloropyrrolidine Chemical compound ClC1(Cl)CCNC1 CWXVJIRMENQIMZ-UHFFFAOYSA-N 0.000 description 1
- YMBRIWSAYYALKH-UHFFFAOYSA-N 3,4-dibromopyrrolidine Chemical compound BrC1CNCC1Br YMBRIWSAYYALKH-UHFFFAOYSA-N 0.000 description 1
- RDEHRKLSYJBKDV-UHFFFAOYSA-N 3,4-dimethylpyrrolidine Chemical compound CC1CNCC1C RDEHRKLSYJBKDV-UHFFFAOYSA-N 0.000 description 1
- KXKQNQADWLIDLS-UHFFFAOYSA-N 3-bromopiperidine Chemical compound BrC1CCCNC1 KXKQNQADWLIDLS-UHFFFAOYSA-N 0.000 description 1
- RYNGVDXHFTWXDH-UHFFFAOYSA-N 3-ethoxypiperidine Chemical compound CCOC1CCCNC1 RYNGVDXHFTWXDH-UHFFFAOYSA-N 0.000 description 1
- YLUDSYGJHAQGOD-UHFFFAOYSA-N 3-ethylpiperidine Chemical compound CCC1CCCNC1 YLUDSYGJHAQGOD-UHFFFAOYSA-N 0.000 description 1
- SFWWGMKXCYLZEG-UHFFFAOYSA-N 3-methylmorpholine Chemical compound CC1COCCN1 SFWWGMKXCYLZEG-UHFFFAOYSA-N 0.000 description 1
- JEGMWWXJUXDNJN-UHFFFAOYSA-N 3-methylpiperidine Chemical compound CC1CCCNC1 JEGMWWXJUXDNJN-UHFFFAOYSA-N 0.000 description 1
- KYINPWAJIVTFBW-UHFFFAOYSA-N 3-methylpyrrolidine Chemical compound CC1CCNC1 KYINPWAJIVTFBW-UHFFFAOYSA-N 0.000 description 1
- FIHYVUSUEHIGOM-UHFFFAOYSA-N 4-bromopiperidine Chemical compound BrC1CCNCC1 FIHYVUSUEHIGOM-UHFFFAOYSA-N 0.000 description 1
- GBPBXBUHZSOKTH-UHFFFAOYSA-N 4-chloropiperidine Chemical compound ClC1CCNCC1 GBPBXBUHZSOKTH-UHFFFAOYSA-N 0.000 description 1
- OYHQAXYDSYSGEI-UHFFFAOYSA-N 4-ethoxypiperidine Chemical compound CCOC1CCNCC1 OYHQAXYDSYSGEI-UHFFFAOYSA-N 0.000 description 1
- KWHPWBXOLZTZMJ-UHFFFAOYSA-N 4-ethylpiperidine Chemical compound CCC1CCNCC1 KWHPWBXOLZTZMJ-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical group OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 229920002284 Cellulose triacetate Polymers 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000003673 groundwater Substances 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-N naphthalene-2-sulfonic acid Chemical compound C1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 239000001048 orange dye Substances 0.000 description 1
- 235000010292 orthophenyl phenol Nutrition 0.000 description 1
- 229920006149 polyester-amide block copolymer Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- SRPWOOOHEPICQU-UHFFFAOYSA-N trimellitic anhydride Chemical compound OC(=O)C1=CC=C2C(=O)OC(=O)C2=C1 SRPWOOOHEPICQU-UHFFFAOYSA-N 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/06—Peri-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702020299 DE2020299A1 (de) | 1970-04-25 | 1970-04-25 | Perinonfarbstoffe |
| CH1205872A CH532644A (de) | 1970-04-25 | 1971-04-08 | Verfahren zur Herstellung von Perinonfarbstoffen |
| GB2714471*A GB1319734A (en) | 1970-04-25 | 1971-04-19 | Perinone dyestuffs |
| US00136234A US3833583A (en) | 1970-04-25 | 1971-04-21 | Perinone dyestuffs |
| NL7105403A NL7105403A (OSRAM) | 1970-04-25 | 1971-04-21 | |
| FR7114548A FR2090639A5 (OSRAM) | 1970-04-25 | 1971-04-23 | |
| BE766197A BE766197A (fr) | 1970-04-25 | 1971-04-23 | Colorants de la serie des perinones |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702020299 DE2020299A1 (de) | 1970-04-25 | 1970-04-25 | Perinonfarbstoffe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2020299A1 true DE2020299A1 (de) | 1971-11-11 |
Family
ID=5769376
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702020299 Pending DE2020299A1 (de) | 1970-04-25 | 1970-04-25 | Perinonfarbstoffe |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3833583A (OSRAM) |
| BE (1) | BE766197A (OSRAM) |
| DE (1) | DE2020299A1 (OSRAM) |
| FR (1) | FR2090639A5 (OSRAM) |
| GB (1) | GB1319734A (OSRAM) |
| NL (1) | NL7105403A (OSRAM) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2930736A1 (de) * | 1979-07-28 | 1981-02-12 | Cassella Ag | Pharmakologisch wirksame, substituierte 3-amino-sydnonimine, verfahren zu ihrer herstellung und ihre verwendung |
| JP2685229B2 (ja) * | 1988-06-25 | 1997-12-03 | シャープ株式会社 | 感光体 |
| DE19548453A1 (de) * | 1995-12-22 | 1997-06-26 | Bayer Ag | Verfahren zur Herstellung polycyclischer Verbindungen |
| US20060163650A1 (en) * | 2005-01-27 | 2006-07-27 | Ling Ma | Power semiconductor device with endless gate trenches |
-
1970
- 1970-04-25 DE DE19702020299 patent/DE2020299A1/de active Pending
-
1971
- 1971-04-19 GB GB2714471*A patent/GB1319734A/en not_active Expired
- 1971-04-21 NL NL7105403A patent/NL7105403A/xx unknown
- 1971-04-21 US US00136234A patent/US3833583A/en not_active Expired - Lifetime
- 1971-04-23 BE BE766197A patent/BE766197A/xx unknown
- 1971-04-23 FR FR7114548A patent/FR2090639A5/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1319734A (en) | 1973-06-06 |
| US3833583A (en) | 1974-09-03 |
| FR2090639A5 (OSRAM) | 1972-01-14 |
| NL7105403A (OSRAM) | 1971-10-27 |
| BE766197A (fr) | 1971-09-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2117251C3 (de) | Kationische Anthrachinonfarbstoffe und deren Herstellung und Verwendung | |
| DE68920393T2 (de) | Polycyclische Farbstoffe. | |
| CH636116A5 (de) | Heterocyclische dispersionsfarbstoffe. | |
| DE1492065B2 (de) | Haarfaerbemittel | |
| DE2020299A1 (de) | Perinonfarbstoffe | |
| DE2237372C3 (de) | Heterocyclische Farbstoffe, ihre Herstellung und ihre Verwendung | |
| DE1919511A1 (de) | Basische Oxazinfarbstoffe und Verfahren zu ihrer Herstellung | |
| DE2714653A1 (de) | Kationische styrylfarbstoffe | |
| DE2017764C3 (de) | Benzoxanthen- und Benzothioxanthenfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung. Anmi Farbwerke Hoechst AG, vormals Meister Lucius & Brüning, 6000 Frankfurt | |
| DE1950679A1 (de) | Verfahren zum kontinuierlichen Faerben synthetischer Fasermaterialien | |
| DE1963356A1 (de) | Chinophthalon-Farbstoffe | |
| CH532644A (de) | Verfahren zur Herstellung von Perinonfarbstoffen | |
| DE2334168A1 (de) | Verfahren zur herstellung in wasser schwer loeslicher heterocyclischer verbindungen | |
| DE1644606C3 (de) | Anthrachinonfarbstoffe | |
| DE2447878C3 (de) | Cumarinverbindungen, ihre Herstellung und ihre Verwendung | |
| DE2023632C3 (de) | Basische Anthrachinonfarbstoffe, ihre Herstellung und Verwendung | |
| DE1769789C3 (de) | Gemische aus Chinophthalonfarbstoffen, deren Herstellung und Verwendung | |
| DE2064735C3 (de) | Basische ^azinfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1267360B (de) | Verfahren zur Herstellung von Anthrachinonfarbstoffen | |
| DE1644551C2 (de) | Verfahren zur Herstellung von sauren Anthrachinonfarbstoffen | |
| DE2342815A1 (de) | Neue dioxazinfarbstoffe | |
| DE1569606A1 (de) | Basische Farbstoffe | |
| DE2047431A1 (en) | Basic methine dyes - for use on anionic-modified fibres, giving brilliant fluorescent yellow shades | |
| DE2644145A1 (de) | Organische verbindungen | |
| DE2309612A1 (de) | Naphtholactam-farbstoffe |