DE2018525C3 - Verfahren zur Herstellung von Imidgruppen enthaltenden Prakondensaten - Google Patents
Verfahren zur Herstellung von Imidgruppen enthaltenden PrakondensatenInfo
- Publication number
- DE2018525C3 DE2018525C3 DE2018525A DE2018525A DE2018525C3 DE 2018525 C3 DE2018525 C3 DE 2018525C3 DE 2018525 A DE2018525 A DE 2018525A DE 2018525 A DE2018525 A DE 2018525A DE 2018525 C3 DE2018525 C3 DE 2018525C3
- Authority
- DE
- Germany
- Prior art keywords
- bis
- mixture
- aminophenyl
- radical
- weight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 10
- 125000005462 imide group Chemical group 0.000 title claims description 4
- 238000004519 manufacturing process Methods 0.000 title description 4
- 239000000203 mixture Substances 0.000 claims description 19
- 238000010438 heat treatment Methods 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 13
- 150000004985 diamines Chemical class 0.000 description 12
- 150000001491 aromatic compounds Chemical class 0.000 description 11
- 150000003254 radicals Chemical class 0.000 description 11
- -1 alkylene radical Chemical class 0.000 description 10
- 125000004432 carbon atom Chemical group C* 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 238000001816 cooling Methods 0.000 description 5
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 4
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 4
- SESFRYSPDFLNCH-UHFFFAOYSA-N benzyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OCC1=CC=CC=C1 SESFRYSPDFLNCH-UHFFFAOYSA-N 0.000 description 4
- 125000006267 biphenyl group Chemical group 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 4
- 150000008064 anhydrides Chemical class 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 2
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 2
- YBRVSVVVWCFQMG-UHFFFAOYSA-N 4,4'-diaminodiphenylmethane Chemical compound C1=CC(N)=CC=C1CC1=CC=C(N)C=C1 YBRVSVVVWCFQMG-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical group [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 description 2
- 125000002015 acyclic group Chemical group 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- DMLAVOWQYNRWNQ-UHFFFAOYSA-N azobenzene Chemical compound C1=CC=CC=C1N=NC1=CC=CC=C1 DMLAVOWQYNRWNQ-UHFFFAOYSA-N 0.000 description 2
- ZVSKZLHKADLHSD-UHFFFAOYSA-N benzanilide Chemical compound C=1C=CC=CC=1C(=O)NC1=CC=CC=C1 ZVSKZLHKADLHSD-UHFFFAOYSA-N 0.000 description 2
- HFACYLZERDEVSX-UHFFFAOYSA-N benzidine Chemical compound C1=CC(N)=CC=C1C1=CC=C(N)C=C1 HFACYLZERDEVSX-UHFFFAOYSA-N 0.000 description 2
- 229960002903 benzyl benzoate Drugs 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000007872 degassing Methods 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000011872 intimate mixture Substances 0.000 description 2
- 230000007774 longterm Effects 0.000 description 2
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 238000003825 pressing Methods 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- ODHXBMXNKOYIBV-UHFFFAOYSA-N triphenylamine Chemical compound C1=CC=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 ODHXBMXNKOYIBV-UHFFFAOYSA-N 0.000 description 2
- AAAQKTZKLRYKHR-UHFFFAOYSA-N triphenylmethane Chemical compound C1=CC=CC=C1C(C=1C=CC=CC=1)C1=CC=CC=C1 AAAQKTZKLRYKHR-UHFFFAOYSA-N 0.000 description 2
- 230000004580 weight loss Effects 0.000 description 2
- IACYWJSRXRRLQO-UHFFFAOYSA-N (2,5-dimethylphenyl)-(4-methylphenyl)methanone Chemical compound C1=CC(C)=CC=C1C(=O)C1=CC(C)=CC=C1C IACYWJSRXRRLQO-UHFFFAOYSA-N 0.000 description 1
- OGTSHGYHILFRHD-UHFFFAOYSA-N (4-fluorophenyl)-phenylmethanone Chemical compound C1=CC(F)=CC=C1C(=O)C1=CC=CC=C1 OGTSHGYHILFRHD-UHFFFAOYSA-N 0.000 description 1
- FKASFBLJDCHBNZ-UHFFFAOYSA-N 1,3,4-oxadiazole Chemical compound C1=NN=CO1 FKASFBLJDCHBNZ-UHFFFAOYSA-N 0.000 description 1
- UVGPELGZPWDPFP-UHFFFAOYSA-N 1,4-diphenoxybenzene Chemical compound C=1C=C(OC=2C=CC=CC=2)C=CC=1OC1=CC=CC=C1 UVGPELGZPWDPFP-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- XQUPVDVFXZDTLT-UHFFFAOYSA-N 1-[4-[[4-(2,5-dioxopyrrol-1-yl)phenyl]methyl]phenyl]pyrrole-2,5-dione Chemical compound O=C1C=CC(=O)N1C(C=C1)=CC=C1CC1=CC=C(N2C(C=CC2=O)=O)C=C1 XQUPVDVFXZDTLT-UHFFFAOYSA-N 0.000 description 1
- AGZRBJLATOQBCH-UHFFFAOYSA-N 1-methoxy-2-(2-methoxyphenoxy)benzene Chemical compound COC1=CC=CC=C1OC1=CC=CC=C1OC AGZRBJLATOQBCH-UHFFFAOYSA-N 0.000 description 1
- MFGALGYVFGDXIX-UHFFFAOYSA-N 2,3-Dimethylmaleic anhydride Chemical compound CC1=C(C)C(=O)OC1=O MFGALGYVFGDXIX-UHFFFAOYSA-N 0.000 description 1
- VEUMBMHMMCOFAG-UHFFFAOYSA-N 2,3-dihydrooxadiazole Chemical compound N1NC=CO1 VEUMBMHMMCOFAG-UHFFFAOYSA-N 0.000 description 1
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 description 1
- BNGIMWCROMYOKW-UHFFFAOYSA-N 3-(1,3,4-oxadiazol-2-yl)aniline Chemical compound NC1=CC=CC(C=2OC=NN=2)=C1 BNGIMWCROMYOKW-UHFFFAOYSA-N 0.000 description 1
- OFNISBHGPNMTMS-UHFFFAOYSA-N 3-methylideneoxolane-2,5-dione Chemical compound C=C1CC(=O)OC1=O OFNISBHGPNMTMS-UHFFFAOYSA-N 0.000 description 1
- ICNFHJVPAJKPHW-UHFFFAOYSA-N 4,4'-Thiodianiline Chemical compound C1=CC(N)=CC=C1SC1=CC=C(N)C=C1 ICNFHJVPAJKPHW-UHFFFAOYSA-N 0.000 description 1
- KQIKKETXZQDHGE-FOCLMDBBSA-N 4,4'-diaminoazobenzene Chemical compound C1=CC(N)=CC=C1\N=N\C1=CC=C(N)C=C1 KQIKKETXZQDHGE-FOCLMDBBSA-N 0.000 description 1
- LUQZCHUHDGHYOE-UHFFFAOYSA-N 4-(4-nitrophenoxy)carbonylbenzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C(=O)OC1=CC=C([N+]([O-])=O)C=C1 LUQZCHUHDGHYOE-UHFFFAOYSA-N 0.000 description 1
- HLBLWEWZXPIGSM-UHFFFAOYSA-N 4-Aminophenyl ether Chemical compound C1=CC(N)=CC=C1OC1=CC=C(N)C=C1 HLBLWEWZXPIGSM-UHFFFAOYSA-N 0.000 description 1
- DZIHTWJGPDVSGE-UHFFFAOYSA-N 4-[(4-aminocyclohexyl)methyl]cyclohexan-1-amine Chemical compound C1CC(N)CCC1CC1CCC(N)CC1 DZIHTWJGPDVSGE-UHFFFAOYSA-N 0.000 description 1
- XECVXFWNYNXCBN-UHFFFAOYSA-N 4-[(4-aminophenyl)-phenylmethyl]aniline Chemical compound C1=CC(N)=CC=C1C(C=1C=CC(N)=CC=1)C1=CC=CC=C1 XECVXFWNYNXCBN-UHFFFAOYSA-N 0.000 description 1
- KTZLSMUPEJXXBO-UHFFFAOYSA-N 4-[(4-aminophenyl)-phenylphosphoryl]aniline Chemical compound C1=CC(N)=CC=C1P(=O)(C=1C=CC(N)=CC=1)C1=CC=CC=C1 KTZLSMUPEJXXBO-UHFFFAOYSA-N 0.000 description 1
- CGEPGDQNCRDJHS-UHFFFAOYSA-N 4-[1-(4-amino-3-methylphenyl)cyclohexyl]-2-methylaniline Chemical compound C1=C(N)C(C)=CC(C2(CCCCC2)C=2C=C(C)C(N)=CC=2)=C1 CGEPGDQNCRDJHS-UHFFFAOYSA-N 0.000 description 1
- ZSQIQUAKDNTQOI-UHFFFAOYSA-N 4-[1-(4-aminophenyl)cyclohexyl]aniline Chemical compound C1=CC(N)=CC=C1C1(C=2C=CC(N)=CC=2)CCCCC1 ZSQIQUAKDNTQOI-UHFFFAOYSA-N 0.000 description 1
- XPAQFJJCWGSXGJ-UHFFFAOYSA-N 4-amino-n-(4-aminophenyl)benzamide Chemical compound C1=CC(N)=CC=C1NC(=O)C1=CC=C(N)C=C1 XPAQFJJCWGSXGJ-UHFFFAOYSA-N 0.000 description 1
- HRXZRAXKKNUKRF-UHFFFAOYSA-N 4-ethylaniline Chemical compound CCC1=CC=C(N)C=C1 HRXZRAXKKNUKRF-UHFFFAOYSA-N 0.000 description 1
- 238000005698 Diels-Alder reaction Methods 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 241001122767 Theaceae Species 0.000 description 1
- FDLQZKYLHJJBHD-UHFFFAOYSA-N [3-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=CC(CN)=C1 FDLQZKYLHJJBHD-UHFFFAOYSA-N 0.000 description 1
- ISKQADXMHQSTHK-UHFFFAOYSA-N [4-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=C(CN)C=C1 ISKQADXMHQSTHK-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 238000004026 adhesive bonding Methods 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- GAUZCKBSTZFWCT-UHFFFAOYSA-N azoxybenzene Chemical compound C=1C=CC=CC=1[N+]([O-])=NC1=CC=CC=C1 GAUZCKBSTZFWCT-UHFFFAOYSA-N 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- ZLSMCQSGRWNEGX-UHFFFAOYSA-N bis(4-aminophenyl)methanone Chemical compound C1=CC(N)=CC=C1C(=O)C1=CC=C(N)C=C1 ZLSMCQSGRWNEGX-UHFFFAOYSA-N 0.000 description 1
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 230000035606 childbirth Effects 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229930003836 cresol Natural products 0.000 description 1
- IGARGHRYKHJQSM-UHFFFAOYSA-N cyclohexylbenzene Chemical compound C1CCCCC1C1=CC=CC=C1 IGARGHRYKHJQSM-UHFFFAOYSA-N 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 229940113088 dimethylacetamide Drugs 0.000 description 1
- CZZYITDELCSZES-UHFFFAOYSA-N diphenylmethane Chemical compound C=1C=CC=CC=1CC1=CC=CC=C1 CZZYITDELCSZES-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- FCJSHPDYVMKCHI-UHFFFAOYSA-N phenyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OC1=CC=CC=C1 FCJSHPDYVMKCHI-UHFFFAOYSA-N 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920003192 poly(bis maleimide) Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- VHNQIURBCCNWDN-UHFFFAOYSA-N pyridine-2,6-diamine Chemical compound NC1=CC=CC(N)=N1 VHNQIURBCCNWDN-UHFFFAOYSA-N 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 230000008646 thermal stress Effects 0.000 description 1
- 238000007669 thermal treatment Methods 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L79/00—Compositions of macromolecular compounds obtained by reactions forming in the main chain of the macromolecule a linkage containing nitrogen with or without oxygen or carbon only, not provided for in groups C08L61/00 - C08L77/00
- C08L79/04—Polycondensates having nitrogen-containing heterocyclic rings in the main chain; Polyhydrazides; Polyamide acids or similar polyimide precursors
- C08L79/08—Polyimides; Polyester-imides; Polyamide-imides; Polyamide acids or similar polyimide precursors
- C08L79/085—Unsaturated polyimide precursors
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
- Photoreceptors In Electrophotography (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR6912222A FR2046025A5 (enExample) | 1969-04-18 | 1969-04-18 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2018525A1 DE2018525A1 (de) | 1970-10-22 |
| DE2018525B2 DE2018525B2 (de) | 1974-03-28 |
| DE2018525C3 true DE2018525C3 (de) | 1974-11-21 |
Family
ID=9032693
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2018525A Expired DE2018525C3 (de) | 1969-04-18 | 1970-04-17 | Verfahren zur Herstellung von Imidgruppen enthaltenden Prakondensaten |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3679639A (enExample) |
| JP (1) | JPS4819211B1 (enExample) |
| AT (1) | AT305624B (enExample) |
| BE (1) | BE749145A (enExample) |
| CH (1) | CH511265A (enExample) |
| DE (1) | DE2018525C3 (enExample) |
| ES (1) | ES378786A1 (enExample) |
| FR (1) | FR2046025A5 (enExample) |
| GB (1) | GB1260819A (enExample) |
| IL (1) | IL34332A (enExample) |
| LU (1) | LU60750A1 (enExample) |
| NL (1) | NL139763B (enExample) |
| SE (1) | SE355371B (enExample) |
| ZA (1) | ZA702559B (enExample) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3930070A (en) * | 1969-11-24 | 1975-12-30 | Rhone Poulenc Sa | Coating process using a fluidisable powder comprising a heat-stable bisimide resin and particles of glass or mica |
| NL7114237A (enExample) * | 1970-10-23 | 1972-04-25 | ||
| FR2126087B1 (enExample) * | 1971-02-24 | 1973-11-23 | Rhone Poulenc Sa | |
| US3972960A (en) * | 1971-02-24 | 1976-08-03 | Rhone-Poulenc S.A. | Heat-stable polyimide resin modified by unsaturated polyester |
| US3970714A (en) * | 1971-02-24 | 1976-07-20 | Rhone-Poulenc S.A. | Heat-stable polyimide resin modified by unsaturated polyester |
| US3910859A (en) * | 1971-02-24 | 1975-10-07 | Rhone Poulenc Sa | Heat-stable polyimide resin from bis-imide, polyamine and alazine |
| US4039628A (en) * | 1971-02-24 | 1977-08-02 | Rhone-Poulenc S.A. | Heat-stable polyimide resins |
| US4064192A (en) * | 1971-02-24 | 1977-12-20 | Rhone-Poulenc S.A. | Heat-stable polyimide resins |
| FR2126088B1 (enExample) * | 1971-02-24 | 1973-11-23 | Rhone Poulenc Sa | |
| GB1408933A (en) * | 1971-09-21 | 1975-10-08 | Union Carbide Corp | Thermosetting arylimides |
| BE790207A (fr) * | 1971-10-18 | 1973-04-17 | Rhone Poulenc Sa | Polyamines a groupements imide |
| JPS48103568A (enExample) * | 1972-04-07 | 1973-12-25 | ||
| US3925314A (en) * | 1972-10-10 | 1975-12-09 | Ciba Geigy Corp | Storage-stable compositions of polyimides and azomethines |
| US3897393A (en) * | 1973-11-29 | 1975-07-29 | Ici America Inc | Polyimides from bismaleimides and heterocyclic disecondary diamines |
| FR2427345A1 (fr) * | 1978-05-30 | 1979-12-28 | Rhone Poulenc Ind | Polymeres a groupements imide |
| FR2427344A1 (fr) * | 1978-05-30 | 1979-12-28 | Rhone Poulenc Ind | Polymeres a groupements imide |
| US4533206A (en) * | 1982-04-30 | 1985-08-06 | Rockwell International Corp. | Flexible printed circuit connector |
| US4711933A (en) * | 1986-11-10 | 1987-12-08 | General Electric Company | Polyetherimide esters |
| EP0418406A1 (en) * | 1989-09-19 | 1991-03-27 | The Boeing Company | Coreactive oligomer blends |
| CN101870693B (zh) * | 2010-06-29 | 2012-03-21 | 沈阳航空航天大学 | 含1,3,4-噁二唑结构双马来酰亚胺及其制备方法 |
-
1969
- 1969-04-18 FR FR6912222A patent/FR2046025A5/fr not_active Expired
-
1970
- 1970-04-10 NL NL707005204A patent/NL139763B/xx not_active IP Right Cessation
- 1970-04-16 US US29286A patent/US3679639A/en not_active Expired - Lifetime
- 1970-04-16 JP JP45031982A patent/JPS4819211B1/ja active Pending
- 1970-04-16 IL IL34332A patent/IL34332A/xx unknown
- 1970-04-16 ZA ZA702559A patent/ZA702559B/xx unknown
- 1970-04-17 AT AT349870A patent/AT305624B/de not_active IP Right Cessation
- 1970-04-17 LU LU60750D patent/LU60750A1/xx unknown
- 1970-04-17 BE BE749145D patent/BE749145A/xx unknown
- 1970-04-17 DE DE2018525A patent/DE2018525C3/de not_active Expired
- 1970-04-17 GB GB18603/70A patent/GB1260819A/en not_active Expired
- 1970-04-17 SE SE05341/70A patent/SE355371B/xx unknown
- 1970-04-17 CH CH575670A patent/CH511265A/fr not_active IP Right Cessation
- 1970-04-18 ES ES378786A patent/ES378786A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2018525B2 (de) | 1974-03-28 |
| ZA702559B (en) | 1971-01-27 |
| IL34332A0 (en) | 1970-06-17 |
| SE355371B (enExample) | 1973-04-16 |
| US3679639A (en) | 1972-07-25 |
| IL34332A (en) | 1974-07-31 |
| BE749145A (fr) | 1970-10-19 |
| GB1260819A (en) | 1972-01-19 |
| AT305624B (de) | 1973-03-12 |
| DE2018525A1 (de) | 1970-10-22 |
| LU60750A1 (enExample) | 1970-11-17 |
| NL7005204A (enExample) | 1970-10-20 |
| ES378786A1 (es) | 1972-07-16 |
| JPS4819211B1 (enExample) | 1973-06-12 |
| NL139763B (nl) | 1973-09-17 |
| FR2046025A5 (enExample) | 1971-03-05 |
| CH511265A (fr) | 1971-08-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2018525C3 (de) | Verfahren zur Herstellung von Imidgruppen enthaltenden Prakondensaten | |
| DE2131735C3 (de) | Härtbare Zusammensetzungen auf der Basis von Bis-imiden | |
| DE1770867B1 (de) | Verfahren zur herstellung von formkoerpern auf der basis von imidgruppen enthaltenden polykondensaten | |
| DE1770866C3 (de) | Verfahren zur Herstellung von Polyimiden und deren Verwendung | |
| DE1954878B2 (de) | Verfahren zur herstellung von formkoerpern auf der basis von imidgruppen enthaltenden polykondensaten | |
| DE2754632A1 (de) | Heisshaertbare imidharze | |
| DE2754631A1 (de) | Heisshaertbare imidharze | |
| DE2230887C3 (de) | Verfahren zur Herstellung von härtbaren Vorpolymeren aus Maleinsäureimiden und Polyaminen | |
| DE2921513C2 (de) | Imidgruppenhaltige Polymerisate | |
| DE2517303A1 (de) | Neue thermostabile polymere | |
| DE2355858C3 (de) | Formbare Zusammensetzung auf der Basis von wärmehärtbarem Harz | |
| DE3880184T2 (de) | Bismaleimid-siloxane und verfahren zu deren herstellung. | |
| DE2152973C3 (de) | Wärmebeständige Polymere auf der Basis von dreidimensionalen Polyimiden, die sich von Bis-imiden und oUgomeren Aminen ableiten | |
| DE69002711T2 (de) | Lineare aromatische Poly(amide-imide), die am Kettenende funktionalisiert sind durch latente Maleimidgruppen, Verfahren zu ihrer Herstellung und ihre Verwendung zur Herstellung vernetzter Polymere. | |
| DE2208832C3 (de) | Wärmebeständige Harze auf der Basis von Polymiden, Aldazinen und Polyaminen | |
| DE2141913A1 (de) | Polysulfon-Zusammensetzungen | |
| DE2005587B2 (de) | Aromatische Polyimide mit Karbüiolkettenverknüpfung sowie deren Anwendung | |
| DE2159935A1 (de) | Verfahren zur herstellung loeslicher polyimide | |
| DE2558182C3 (de) | Hitzebeständige Kunstharzformmasse | |
| DE2358084A1 (de) | Neue polyamid-imide | |
| DE1963823B2 (de) | Verfahrenmzur herstellung von formkoerpern aufd er basis von imidgruppen enthaltenden polykondensaten | |
| DE2350471A1 (de) | Neue, lagerstabile und heisshaertbare mischungen | |
| DE2921575C2 (de) | Imidgruppenhaltige Polymerisate | |
| DE2208788C3 (de) | Wärmebeständige Harze auf der Basis von dreidimensionalen Polyimiden | |
| DE2843035C2 (de) | Heißhärtbare Imidharze |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 | ||
| 8339 | Ceased/non-payment of the annual fee |