DE2010579C3 - Verfahren zur Herstellung kationischer Farbstoffe - Google Patents
Verfahren zur Herstellung kationischer FarbstoffeInfo
- Publication number
- DE2010579C3 DE2010579C3 DE2010579A DE2010579A DE2010579C3 DE 2010579 C3 DE2010579 C3 DE 2010579C3 DE 2010579 A DE2010579 A DE 2010579A DE 2010579 A DE2010579 A DE 2010579A DE 2010579 C3 DE2010579 C3 DE 2010579C3
- Authority
- DE
- Germany
- Prior art keywords
- naphtholactam
- ethyl
- aniline
- methyl
- iso
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000975 dye Substances 0.000 title claims description 14
- 238000000034 method Methods 0.000 title claims description 14
- 125000002091 cationic group Chemical group 0.000 title claims description 3
- 238000002360 preparation method Methods 0.000 title claims description 3
- -1 inorganic acid halide Chemical class 0.000 claims description 28
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical group ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 claims description 18
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 claims description 10
- 150000001412 amines Chemical class 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 7
- 125000001424 substituent group Chemical group 0.000 claims description 7
- 125000001624 naphthyl group Chemical group 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 238000009833 condensation Methods 0.000 claims description 5
- 230000005494 condensation Effects 0.000 claims description 5
- 229910052757 nitrogen Inorganic materials 0.000 claims description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 4
- 150000004820 halides Chemical class 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 7
- 125000000217 alkyl group Chemical group 0.000 description 6
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 5
- 125000003710 aryl alkyl group Chemical group 0.000 description 5
- 150000005840 aryl radicals Chemical class 0.000 description 5
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- GPYLCFQEKPUWLD-UHFFFAOYSA-N 1h-benzo[cd]indol-2-one Chemical class C1=CC(C(=O)N2)=C3C2=CC=CC3=C1 GPYLCFQEKPUWLD-UHFFFAOYSA-N 0.000 description 3
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 244000172533 Viola sororia Species 0.000 description 3
- 150000001450 anions Chemical class 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 3
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 150000003951 lactams Chemical class 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 2
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000005036 alkoxyphenyl group Chemical group 0.000 description 2
- 125000005037 alkyl phenyl group Chemical group 0.000 description 2
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229920002239 polyacrylonitrile Polymers 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- QYKOLWLKTJIVEX-UHFFFAOYSA-N 1-ethyl-3,4-dihydro-2h-quinoline Chemical compound C1=CC=C2N(CC)CCCC2=C1 QYKOLWLKTJIVEX-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- MOYHVSKDHLMMPS-UHFFFAOYSA-N 3-methoxy-n,n-dimethylaniline Chemical compound COC1=CC=CC(N(C)C)=C1 MOYHVSKDHLMMPS-UHFFFAOYSA-N 0.000 description 1
- 101000623895 Bos taurus Mucin-15 Proteins 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 235000005811 Viola adunca Nutrition 0.000 description 1
- 240000009038 Viola odorata Species 0.000 description 1
- 235000013487 Viola odorata Nutrition 0.000 description 1
- 235000002254 Viola papilionacea Nutrition 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 150000003974 aralkylamines Chemical class 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000008034 disappearance Effects 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000005059 halophenyl group Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- FZPXKEPZZOEPGX-UHFFFAOYSA-N n,n-dibutylaniline Chemical compound CCCCN(CCCC)C1=CC=CC=C1 FZPXKEPZZOEPGX-UHFFFAOYSA-N 0.000 description 1
- XLEMRIJDZGESRG-UHFFFAOYSA-N n,n-diethylnaphthalen-1-amine Chemical compound C1=CC=C2C(N(CC)CC)=CC=CC2=C1 XLEMRIJDZGESRG-UHFFFAOYSA-N 0.000 description 1
- AJUXDFHPVZQOGF-UHFFFAOYSA-N n,n-dimethyl-1-naphthylamine Chemical compound C1=CC=C2C(N(C)C)=CC=CC2=C1 AJUXDFHPVZQOGF-UHFFFAOYSA-N 0.000 description 1
- MMFBQHXDINNBMW-UHFFFAOYSA-N n,n-dipropylaniline Chemical compound CCCN(CCC)C1=CC=CC=C1 MMFBQHXDINNBMW-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- UXCDUFKZSUBXGM-UHFFFAOYSA-N phosphoric tribromide Chemical compound BrP(Br)(Br)=O UXCDUFKZSUBXGM-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B57/00—Other synthetic dyes of known constitution
- C09B57/06—Naphtholactam dyes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/56—Ring systems containing three or more rings
- C07D209/80—[b, c]- or [b, d]-condensed
- C07D209/90—Benzo [c, d] indoles; Hydrogenated benzo [c, d] indoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Coloring (AREA)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2010579A DE2010579C3 (de) | 1970-03-06 | 1970-03-06 | Verfahren zur Herstellung kationischer Farbstoffe |
| AT147971A AT297885B (de) | 1970-03-06 | 1971-02-22 | Verfahren zur Herstellung kationischer Farbstoffe |
| CA106,035A CA945162A (en) | 1970-03-06 | 1971-02-23 | Process for the manufacture of cationic dyestuffs |
| US05/119,393 US4003898A (en) | 1970-03-06 | 1971-02-26 | Process for the manufacture of cationic dyestuffs |
| NL7102906A NL7102906A (enExample) | 1970-03-06 | 1971-03-04 | |
| BE763854A BE763854A (fr) | 1970-03-06 | 1971-03-05 | Procede de production de colorants cationiques |
| CH328171A CH560243A5 (enExample) | 1970-03-06 | 1971-03-05 | |
| FR7107826A FR2084286A5 (enExample) | 1970-03-06 | 1971-03-05 | |
| JP46011614A JPS523419B1 (enExample) | 1970-03-06 | 1971-03-06 | |
| GB23241/71A GB1280790A (en) | 1970-03-06 | 1971-04-19 | Process for the manufacture of cationic dyestuffs |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2010579A DE2010579C3 (de) | 1970-03-06 | 1970-03-06 | Verfahren zur Herstellung kationischer Farbstoffe |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2010579A1 DE2010579A1 (de) | 1971-09-16 |
| DE2010579B2 DE2010579B2 (de) | 1974-02-14 |
| DE2010579C3 true DE2010579C3 (de) | 1974-09-12 |
Family
ID=5764272
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2010579A Expired DE2010579C3 (de) | 1970-03-06 | 1970-03-06 | Verfahren zur Herstellung kationischer Farbstoffe |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4003898A (enExample) |
| JP (1) | JPS523419B1 (enExample) |
| AT (1) | AT297885B (enExample) |
| BE (1) | BE763854A (enExample) |
| CA (1) | CA945162A (enExample) |
| CH (1) | CH560243A5 (enExample) |
| DE (1) | DE2010579C3 (enExample) |
| FR (1) | FR2084286A5 (enExample) |
| GB (1) | GB1280790A (enExample) |
| NL (1) | NL7102906A (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2349980C3 (de) * | 1973-10-04 | 1979-09-06 | Bayer Ag, 5090 Leverkusen | Transferdruckverfahren |
| US4147865A (en) * | 1976-01-30 | 1979-04-03 | Bayer Aktiengesellschaft | Benz-(C,D)-indolyl compounds |
| DE2603592B2 (de) * | 1976-01-30 | 1978-03-16 | Bayer Ag, 5090 Leverkusen | Benz- [c,d] -indolyl-Verbindungen, deren Herstellung und deren Verwendung |
| DE2640760A1 (de) * | 1976-09-10 | 1978-03-16 | Hoechst Ag | Benzimidazo-eckige klammer auf 1,2-a eckige klammer zu -chinoline und verfahren zu ihrer herstellung |
| DE2823169A1 (de) * | 1978-05-26 | 1979-11-29 | Hoechst Ag | Verfahren zum nuancieren von mittels russ schwarzgefaerbten polymeren und mischpolymeren des acrylnitrils, insbesondere beim verspinnen aus der spinnmasse |
| JPS63171087U (enExample) * | 1987-04-27 | 1988-11-08 | ||
| DE3740421A1 (de) * | 1987-11-28 | 1989-06-08 | Basf Ag | Mehrschichtiges, elektrophotographisches aufzeichnungsmaterial |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3347865A (en) * | 1967-10-17 | Hybrocarbon-z-tertiary amino carbo- cvclic aryl benz-[c,d]-indoles | ||
| DD100731A5 (enExample) * | 1971-06-08 | 1973-10-05 | ||
| BE794154A (fr) * | 1972-01-19 | 1973-07-17 | Bayer Ag | Colorants cationiques, leur obtention et leurs applications |
-
1970
- 1970-03-06 DE DE2010579A patent/DE2010579C3/de not_active Expired
-
1971
- 1971-02-22 AT AT147971A patent/AT297885B/de active
- 1971-02-23 CA CA106,035A patent/CA945162A/en not_active Expired
- 1971-02-26 US US05/119,393 patent/US4003898A/en not_active Expired - Lifetime
- 1971-03-04 NL NL7102906A patent/NL7102906A/xx unknown
- 1971-03-05 FR FR7107826A patent/FR2084286A5/fr not_active Expired
- 1971-03-05 BE BE763854A patent/BE763854A/xx not_active IP Right Cessation
- 1971-03-05 CH CH328171A patent/CH560243A5/xx not_active IP Right Cessation
- 1971-03-06 JP JP46011614A patent/JPS523419B1/ja active Pending
- 1971-04-19 GB GB23241/71A patent/GB1280790A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2010579B2 (de) | 1974-02-14 |
| BE763854A (fr) | 1971-08-02 |
| NL7102906A (enExample) | 1971-09-08 |
| GB1280790A (en) | 1972-07-05 |
| FR2084286A5 (enExample) | 1971-12-17 |
| AT297885B (de) | 1972-04-10 |
| DE2010579A1 (de) | 1971-09-16 |
| JPS523419B1 (enExample) | 1977-01-27 |
| US4003898A (en) | 1977-01-18 |
| CH560243A5 (enExample) | 1975-03-27 |
| CA945162A (en) | 1974-04-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2010579C3 (de) | Verfahren zur Herstellung kationischer Farbstoffe | |
| DE1150652B (de) | Faerben von Polyacrylnitrilfasern | |
| DE2850996C3 (de) | Anthrachinonverbindungen, deren Herstellung und Verwendung | |
| DE2010578C3 (de) | Verfahren zur Herstellung kationischer Farbstoffe | |
| DE2328163A1 (de) | Basische arylmercaptonaphtholactamfarbstoffe | |
| DE2036505C3 (de) | Kationische Farbstoffe, Verfahren zu deren Herstellung und deren Verwendung | |
| DE1544469B1 (de) | Verfahren zur Herstellung von Pyridazinazofarbstoffen,neue Pyridazinazofarbstoffe und deren Verwendung | |
| DE2929848A1 (de) | Farbstoffmischungen | |
| DE2239445C3 (de) | Kationische Pyrazolfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE848979C (de) | Verfahren zur Herstellung chromhaltiger Monoazofarbstoffe | |
| DE2013791A1 (en) | Yellow basic hydrazone dyes for polyacry-lonitrile etc | |
| DE1619441A1 (de) | Verwendung von aus 5,12-Dialkylfluorindinen bestehenden Farbstoffen zum Faerben von Faeden und Fasern aus Polyacrylnitril oder modifiziertem Polyacrylnitril | |
| DE2851373A1 (de) | Wasserloesliche kationische monoazo- farbstoffe | |
| DE2202854C3 (de) | Kationische Farbstoffe, ihre Herstellung und ihre Verwendung | |
| DE693061C (de) | Verfahren zur Herstellung von Kuepenfarbstoffen | |
| DE929569C (de) | Verfahren zur Herstellung von neuen Disazofarbstoffen | |
| DE278660C (enExample) | ||
| DE1569737C (de) | Benzothioxanthenfarbstoffe und Verfahren zu deren Herstellung | |
| DE2314875C3 (de) | Verfahren zur Herstellung von 4-Amino-1,8- naphthalsäureimid-3-sulfonsäuren, 4-Amino-1,8-naphthalsäureimid-3-sulfonsäuren und ihre Verwendung zum Färben von natürlichen und synthetischen Polyamidfasern | |
| DE737436C (de) | Verfahren zur Herstellung von sauren Wollfarbstoffen | |
| DE2753072A1 (de) | Verfahren zur herstellung von blauen triphenylmethanfarbstoffen | |
| DE1030302B (de) | Verfahren zum Faerben oder Bedrucken von Polymerisaten bzw. Mischpolymerisaten des Acrylnitrils bzw. Dicyanaethylens | |
| DE919003C (de) | Verfahren zur Herstellung neuer metallisierbarer Monoazofarbstoffe und deren Metallverbindungen | |
| DE184445C (enExample) | ||
| DE109261C (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 |