DE1934889A1 - Neuartige Pyridin-bis-(hydroxyarylaether) und Verfahren zu ihrer Herstellung - Google Patents
Neuartige Pyridin-bis-(hydroxyarylaether) und Verfahren zu ihrer HerstellungInfo
- Publication number
- DE1934889A1 DE1934889A1 DE19691934889 DE1934889A DE1934889A1 DE 1934889 A1 DE1934889 A1 DE 1934889A1 DE 19691934889 DE19691934889 DE 19691934889 DE 1934889 A DE1934889 A DE 1934889A DE 1934889 A1 DE1934889 A1 DE 1934889A1
- Authority
- DE
- Germany
- Prior art keywords
- pyridine
- formula
- mol
- bis
- dichloropyridine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 title claims description 14
- 238000000034 method Methods 0.000 title claims description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 title claims description 5
- FILKGCRCWDMBKA-UHFFFAOYSA-N 2,6-dichloropyridine Chemical compound ClC1=CC=CC(Cl)=N1 FILKGCRCWDMBKA-UHFFFAOYSA-N 0.000 claims description 9
- 239000011541 reaction mixture Substances 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 6
- -1 hydroxyaryl ether Chemical compound 0.000 claims description 6
- 239000003495 polar organic solvent Substances 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 claims description 3
- 229940031826 phenolate Drugs 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- IFVTZJHWGZSXFD-UHFFFAOYSA-N biphenylene Chemical group C1=CC=C2C3=CC=CC=C3C2=C1 IFVTZJHWGZSXFD-UHFFFAOYSA-N 0.000 claims description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 10
- 238000010438 heat treatment Methods 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000002798 polar solvent Substances 0.000 description 5
- XKZQKPRCPNGNFR-UHFFFAOYSA-N 2-(3-hydroxyphenyl)phenol Chemical compound OC1=CC=CC(C=2C(=CC=CC=2)O)=C1 XKZQKPRCPNGNFR-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 4
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical compound C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 238000006482 condensation reaction Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000011261 inert gas Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- 229930185605 Bisphenol Natural products 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 150000004707 phenolate Chemical class 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- HHVIBTZHLRERCL-UHFFFAOYSA-N sulfonyldimethane Chemical compound CS(C)(=O)=O HHVIBTZHLRERCL-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- RNHDAKUGFHSZEV-UHFFFAOYSA-N 1,4-dioxane;hydrate Chemical compound O.C1COCCO1 RNHDAKUGFHSZEV-UHFFFAOYSA-N 0.000 description 1
- MBDUIEKYVPVZJH-UHFFFAOYSA-N 1-ethylsulfonylethane Chemical compound CCS(=O)(=O)CC MBDUIEKYVPVZJH-UHFFFAOYSA-N 0.000 description 1
- BCMLMVXTJIMQTK-UHFFFAOYSA-N 2-[(4-phenoxyphenyl)sulfinylmethyl]thiirane Chemical compound C=1C=C(OC=2C=CC=CC=2)C=CC=1S(=O)CC1CS1 BCMLMVXTJIMQTK-UHFFFAOYSA-N 0.000 description 1
- ZDULHUHNYHJYKA-UHFFFAOYSA-N 2-propan-2-ylsulfonylpropane Chemical compound CC(C)S(=O)(=O)C(C)C ZDULHUHNYHJYKA-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- KNIUHBNRWZGIQQ-UHFFFAOYSA-N 7-diethoxyphosphinothioyloxy-4-methylchromen-2-one Chemical compound CC1=CC(=O)OC2=CC(OP(=S)(OCC)OCC)=CC=C21 KNIUHBNRWZGIQQ-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- VCCBEIPGXKNHFW-UHFFFAOYSA-N biphenyl-4,4'-diol Chemical group C1=CC(O)=CC=C1C1=CC=C(O)C=C1 VCCBEIPGXKNHFW-UHFFFAOYSA-N 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- CCAFPWNGIUBUSD-UHFFFAOYSA-N diethyl sulfoxide Chemical compound CCS(=O)CC CCAFPWNGIUBUSD-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- WHQSYGRFZMUQGQ-UHFFFAOYSA-N n,n-dimethylformamide;hydrate Chemical compound O.CN(C)C=O WHQSYGRFZMUQGQ-UHFFFAOYSA-N 0.000 description 1
- NXPPAOGUKPJVDI-UHFFFAOYSA-N naphthalene-1,2-diol Chemical class C1=CC=CC2=C(O)C(O)=CC=C21 NXPPAOGUKPJVDI-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229920006337 unsaturated polyester resin Polymers 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/69—Two or more oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691934889 DE1934889A1 (de) | 1969-07-10 | 1969-07-10 | Neuartige Pyridin-bis-(hydroxyarylaether) und Verfahren zu ihrer Herstellung |
| US00051018A US3716549A (en) | 1969-07-10 | 1970-06-29 | Pyridine-bis-(hydroxyaryl ethers) and derivatives thereof |
| NL7009975A NL7009975A (https=) | 1969-07-10 | 1970-07-06 | |
| GB3338270A GB1301740A (https=) | 1969-07-10 | 1970-07-09 | |
| FR7025701A FR2055009A5 (https=) | 1969-07-10 | 1970-07-10 | |
| BE753314D BE753314A (fr) | 1969-07-10 | 1970-07-10 | Nouveaux pyridine-bis-(hydroxyaryl-ethers) et leur procede de preparation |
| JP45059961A JPS4820556B1 (https=) | 1969-07-10 | 1970-07-10 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691934889 DE1934889A1 (de) | 1969-07-10 | 1969-07-10 | Neuartige Pyridin-bis-(hydroxyarylaether) und Verfahren zu ihrer Herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1934889A1 true DE1934889A1 (de) | 1971-01-14 |
Family
ID=5739342
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691934889 Pending DE1934889A1 (de) | 1969-07-10 | 1969-07-10 | Neuartige Pyridin-bis-(hydroxyarylaether) und Verfahren zu ihrer Herstellung |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3716549A (https=) |
| JP (1) | JPS4820556B1 (https=) |
| BE (1) | BE753314A (https=) |
| DE (1) | DE1934889A1 (https=) |
| FR (1) | FR2055009A5 (https=) |
| GB (1) | GB1301740A (https=) |
| NL (1) | NL7009975A (https=) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0255778A1 (en) * | 1986-08-01 | 1988-02-10 | MITSUI TOATSU CHEMICALS, Inc. | Thermoplastic aromatic polyether-pyridines and process for preparing same |
| EP0354500A3 (de) * | 1988-08-10 | 1991-06-05 | BASF Aktiengesellschaft | Hitzehärtbare Bismaleinimid-Formmassen |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4275212A (en) * | 1977-08-15 | 1981-06-23 | The Dow Chemical Company | Method of preparing pyridinyloxyphenols and derivatives |
| US5278276A (en) * | 1985-08-27 | 1994-01-11 | Mitsui Toatsu Chemicals, Incorporated | Polyimide and high-temperature adhesive of polyimide |
| EP0235294B1 (en) * | 1985-08-27 | 1997-11-12 | MITSUI TOATSU CHEMICALS, Inc. | Polyimides and heat-resistant adhesives comprising the same |
| JPS6253388A (ja) * | 1985-09-03 | 1987-03-09 | Mitsui Toatsu Chem Inc | 耐熱性接着剤 |
| FR2587348B1 (fr) * | 1985-09-16 | 1988-02-05 | Mat Organ Technolog Centre | Compositions d'oligomeres de polyaryloxypyridine a terminaisons phtalonitriles, leur preparation, leur utilisation dans la fabrication de reseaux de polyaryloxypyridine co-polyphtalocyanines, et les reseaux obtenus |
| EP0234882B1 (en) * | 1986-02-25 | 1993-01-13 | MITSUI TOATSU CHEMICALS, Inc. | High-temperature adhesive of polyimide |
| US4883844A (en) * | 1987-09-05 | 1989-11-28 | The Dow Chemical Company | Substituted styrylaza epoxy resins |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1527714A (fr) * | 1966-07-01 | 1968-06-07 | Inst Francais Du Petrole | Polyéthers dérivés de la pyridine |
-
1969
- 1969-07-10 DE DE19691934889 patent/DE1934889A1/de active Pending
-
1970
- 1970-06-29 US US00051018A patent/US3716549A/en not_active Expired - Lifetime
- 1970-07-06 NL NL7009975A patent/NL7009975A/xx unknown
- 1970-07-09 GB GB3338270A patent/GB1301740A/en not_active Expired
- 1970-07-10 FR FR7025701A patent/FR2055009A5/fr not_active Expired
- 1970-07-10 BE BE753314D patent/BE753314A/xx unknown
- 1970-07-10 JP JP45059961A patent/JPS4820556B1/ja active Pending
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0255778A1 (en) * | 1986-08-01 | 1988-02-10 | MITSUI TOATSU CHEMICALS, Inc. | Thermoplastic aromatic polyether-pyridines and process for preparing same |
| EP0354500A3 (de) * | 1988-08-10 | 1991-06-05 | BASF Aktiengesellschaft | Hitzehärtbare Bismaleinimid-Formmassen |
Also Published As
| Publication number | Publication date |
|---|---|
| US3716549A (en) | 1973-02-13 |
| JPS4820556B1 (https=) | 1973-06-21 |
| NL7009975A (https=) | 1971-01-12 |
| BE753314A (fr) | 1971-01-11 |
| GB1301740A (https=) | 1973-01-04 |
| FR2055009A5 (https=) | 1971-05-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1932067A1 (de) | Neue Polyarylaethersulfone und Verfahren zu ihrer Herstellung | |
| DE2438327C2 (de) | Polyätherchinoxaline und Verfahren zu deren Herstellung | |
| DE2305413C2 (de) | Verzweigte aromatische Polyaryläthersulfone | |
| DE1595781C3 (de) | Verfahren zur Herstellung hochmolekularer, thermoplastischer Polyester. Ausscheidung aus: 1445384 | |
| DE1934889A1 (de) | Neuartige Pyridin-bis-(hydroxyarylaether) und Verfahren zu ihrer Herstellung | |
| DE3303473A1 (de) | Neues epoxyharz und verfahren zur herstellung desselben | |
| DE1795120C3 (de) | Thermoplastische Polyaryläthersulfone und Verfahren zu ihrer Herstellung | |
| DE1495841A1 (de) | Verfahren zur Herstellung hochmolekularer Polycarbonate | |
| DE2433400C3 (de) | Verfahren zur Herstellung eines aromatischen Polymeren | |
| EP0376005A2 (de) | Verfahren zur Herstellung von bifunktionellen Polyphenylenoxiden mit endständigen OH-Gruppen | |
| DE3020403A1 (de) | Polyphenole | |
| DE1770593C3 (de) | Halogenhaltige, hochmolekulare, lösliche, thermoplastische Polyarylpolyäther | |
| US3532759A (en) | Aryl ethers and process of producing the same | |
| DE1768595C3 (de) | Dihalogenphenyl- bis-(hydroxyaryläther) und Verfahren zu ihrer Herstellung | |
| DE1645580A1 (de) | Verfahren zur Herstellung von Polyarylenpolyaethern | |
| DE1543577C3 (de) | Verfahren zur Herstellung neuartiger Aryläther | |
| EP0356660B1 (de) | Neue aromatische Polyethersulfone, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1911799A1 (de) | Verfahren zur Herstellung halogenhaltiger Arylmono- und -diaether | |
| DE2052378C3 (de) | Halogenhaltige hochmolekulare aromatische Polyestercarbonate, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1930256A1 (de) | Verfahren zur Herstellung halogenhaltiger Hydroxyarylaether | |
| DE1930255A1 (de) | Neuartige Aminoarylaether und Verfahren zu ihrer Herstellung | |
| DE1930259A1 (de) | Chlorhaltige aromatische Dioxinverbindungen und Verfahren zu ihrer Herstellung | |
| DE1806271A1 (de) | Verfahren zur Herstellung von Polyketonen | |
| DE1768595A1 (de) | Dihalogenphenyl- bis-(hydroxyarylaether) | |
| DE1670683A1 (de) | Verfahren zur Herstellung neuartiger Arylaether |