DE1934607A1 - Verfahren zur Herstellung neuer 5-Aryl-1H-1,5-benzodiazepin-2,4-dione - Google Patents
Verfahren zur Herstellung neuer 5-Aryl-1H-1,5-benzodiazepin-2,4-dioneInfo
- Publication number
- DE1934607A1 DE1934607A1 DE19691934607 DE1934607A DE1934607A1 DE 1934607 A1 DE1934607 A1 DE 1934607A1 DE 19691934607 DE19691934607 DE 19691934607 DE 1934607 A DE1934607 A DE 1934607A DE 1934607 A1 DE1934607 A1 DE 1934607A1
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- dione
- benzodiazepine
- radical
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 10
- 238000002360 preparation method Methods 0.000 title claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 54
- -1 alkyl radical Chemical class 0.000 claims description 35
- 125000005843 halogen group Chemical group 0.000 claims description 13
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 125000002252 acyl group Chemical group 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 7
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 150000003254 radicals Chemical class 0.000 claims description 5
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 claims description 4
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 239000007858 starting material Substances 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 claims description 2
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical compound [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 claims description 2
- 125000004423 acyloxy group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 2
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 claims description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 2
- 239000002904 solvent Substances 0.000 claims description 2
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims 1
- RMRFFCXPLWYOOY-UHFFFAOYSA-N allyl radical Chemical compound [CH2]C=C RMRFFCXPLWYOOY-UHFFFAOYSA-N 0.000 claims 1
- 125000004663 dialkyl amino group Chemical group 0.000 claims 1
- 150000003839 salts Chemical class 0.000 claims 1
- 125000001544 thienyl group Chemical group 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 20
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000000460 chlorine Substances 0.000 description 9
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 238000006254 arylation reaction Methods 0.000 description 4
- 235000011056 potassium acetate Nutrition 0.000 description 4
- UNFHOAZOCIELCW-UHFFFAOYSA-N 1,5-dihydro-1,5-benzodiazepine-2,4-dione Chemical compound N1C(=O)CC(=O)NC2=CC=CC=C21 UNFHOAZOCIELCW-UHFFFAOYSA-N 0.000 description 3
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 229940049706 benzodiazepine Drugs 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000013256 coordination polymer Substances 0.000 description 3
- 239000012467 final product Substances 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 2
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 2
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- 229910000365 copper sulfate Inorganic materials 0.000 description 2
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- LPEPHAJSOWLSAF-UHFFFAOYSA-N 1,5-benzodiazepine-2,4-dione Chemical class O=C1CC(=O)N=C2C=CC=CC2=N1 LPEPHAJSOWLSAF-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- SVUOLADPCWQTTE-UHFFFAOYSA-N 1h-1,2-benzodiazepine Chemical compound N1N=CC=CC2=CC=CC=C12 SVUOLADPCWQTTE-UHFFFAOYSA-N 0.000 description 1
- ZVAPWJGRRUHKGP-UHFFFAOYSA-N 1h-1,5-benzodiazepine Chemical compound N1C=CC=NC2=CC=CC=C12 ZVAPWJGRRUHKGP-UHFFFAOYSA-N 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- DPJCXCZTLWNFOH-UHFFFAOYSA-N 2-nitroaniline Chemical class NC1=CC=CC=C1[N+]([O-])=O DPJCXCZTLWNFOH-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- PQOCJONTQYLEFC-UHFFFAOYSA-N 3-methoxy-3-oxopropanoic acid;hydrochloride Chemical compound Cl.COC(=O)CC(O)=O PQOCJONTQYLEFC-UHFFFAOYSA-N 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical class [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WZELXJBMMZFDDU-UHFFFAOYSA-N Imidazol-2-one Chemical class O=C1N=CC=N1 WZELXJBMMZFDDU-UHFFFAOYSA-N 0.000 description 1
- MKYBYDHXWVHEJW-UHFFFAOYSA-N N-[1-oxo-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propan-2-yl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(C(C)NC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 MKYBYDHXWVHEJW-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- RYGMFSIKBFXOCR-AHCXROLUSA-N copper-60 Chemical compound [60Cu] RYGMFSIKBFXOCR-AHCXROLUSA-N 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000002206 pyridazin-3-yl group Chemical group [H]C1=C([H])C([H])=C(*)N=N1 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000003385 ring cleavage reaction Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
- C07D243/10—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D243/12—1,5-Benzodiazepines; Hydrogenated 1,5-benzodiazepines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT677768A AT286302B (de) | 1968-07-12 | 1968-07-12 | Verfahren zur Herstellung neuer 5-Aryl-1H-1,5-benzodiazepin-2,4-3H,5H-dione |
| AT677868 | 1968-07-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1934607A1 true DE1934607A1 (de) | 1970-01-22 |
Family
ID=25603322
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1934606A Expired DE1934606C3 (de) | 1968-07-12 | 1969-07-08 | 1 Substituierte 5 (2 Pyridyl) IH 2,3,4,5 tetrahydro 1,5 benzodiazepin 2,4 dione |
| DE19691934607 Pending DE1934607A1 (de) | 1968-07-12 | 1969-07-08 | Verfahren zur Herstellung neuer 5-Aryl-1H-1,5-benzodiazepin-2,4-dione |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1934606A Expired DE1934606C3 (de) | 1968-07-12 | 1969-07-08 | 1 Substituierte 5 (2 Pyridyl) IH 2,3,4,5 tetrahydro 1,5 benzodiazepin 2,4 dione |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3660381A (cg-RX-API-DMAC10.html) |
| BE (1) | BE735944A (cg-RX-API-DMAC10.html) |
| CA (1) | CA959055A (cg-RX-API-DMAC10.html) |
| CH (1) | CH517103A (cg-RX-API-DMAC10.html) |
| DE (2) | DE1934606C3 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2012867A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1274029A (cg-RX-API-DMAC10.html) |
| IE (1) | IE33218B1 (cg-RX-API-DMAC10.html) |
| IL (1) | IL32604A (cg-RX-API-DMAC10.html) |
| NL (1) | NL153536B (cg-RX-API-DMAC10.html) |
| SE (1) | SE366749B (cg-RX-API-DMAC10.html) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2052840C2 (de) * | 1970-10-28 | 1983-09-08 | Knoll Ag, 6700 Ludwigshafen | 8-Chlor-1-phenyl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepin-2-on-Derivate |
| DE2103744A1 (de) * | 1971-01-27 | 1972-08-10 | CH. Boehringer Sohn, 6507 Ingelheim | Neue 5-Aryl-3,3-dihydroxy-lH-l,5benzodiazepin-2,4-(3H,5H>dionebzw. deren wasserfreie Form und Verfahren zu ihrer Herstellung |
| US10150745B2 (en) | 2015-03-24 | 2018-12-11 | Piramal Enterprises Limited | Process for the preparation of clobazam and its intermediate |
| CN106243050B (zh) * | 2016-08-10 | 2019-09-06 | 安徽恒星制药有限公司 | 一种适合工业化生产氯巴占的方法 |
| CN112812070B (zh) * | 2021-01-30 | 2022-10-21 | 陕西师范大学 | 一种吡啶钯高效催化制备苯二氮卓类化合物的方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE707667A (cg-RX-API-DMAC10.html) * | 1966-12-14 | 1968-06-07 | ||
| DE1670190A1 (de) * | 1967-02-07 | 1970-12-03 | Boehringer Sohn Ingelheim | Verfahren zur Herstellung von 1,5-Dihydro-5-phenyl-3H-1,5-benzodiazepin-2,4-dionen |
| BE719134A (cg-RX-API-DMAC10.html) * | 1968-08-06 | 1969-02-06 |
-
1969
- 1969-07-08 DE DE1934606A patent/DE1934606C3/de not_active Expired
- 1969-07-08 DE DE19691934607 patent/DE1934607A1/de active Pending
- 1969-07-09 CH CH1048369A patent/CH517103A/de not_active IP Right Cessation
- 1969-07-10 US US840839A patent/US3660381A/en not_active Expired - Lifetime
- 1969-07-10 BE BE735944D patent/BE735944A/xx not_active IP Right Cessation
- 1969-07-11 CA CA056,763A patent/CA959055A/en not_active Expired
- 1969-07-11 IL IL32604A patent/IL32604A/en unknown
- 1969-07-11 IE IE950/69A patent/IE33218B1/xx unknown
- 1969-07-11 FR FR6923721A patent/FR2012867A1/fr not_active Withdrawn
- 1969-07-11 SE SE09884/69A patent/SE366749B/xx unknown
- 1969-07-11 NL NL696910679A patent/NL153536B/xx not_active IP Right Cessation
- 1969-07-14 GB GB35374/69A patent/GB1274029A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL6910679A (cg-RX-API-DMAC10.html) | 1970-01-14 |
| NL153536B (nl) | 1977-06-15 |
| DE1934606B2 (de) | 1973-05-17 |
| SE366749B (cg-RX-API-DMAC10.html) | 1974-05-06 |
| IE33218L (en) | 1970-01-12 |
| CA959055A (en) | 1974-12-10 |
| IL32604A (en) | 1972-10-29 |
| BE735944A (cg-RX-API-DMAC10.html) | 1970-01-12 |
| IE33218B1 (en) | 1974-04-17 |
| IL32604A0 (en) | 1969-09-25 |
| DE1934606C3 (de) | 1973-12-13 |
| GB1274029A (en) | 1972-05-10 |
| DE1934606A1 (de) | 1970-01-29 |
| US3660381A (en) | 1972-05-02 |
| FR2012867A1 (cg-RX-API-DMAC10.html) | 1970-03-27 |
| CH517103A (de) | 1971-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH516574A (de) | Verfahren zur Herstellung von 1H-Imidazo(3,5-b)pyrazin-2-onen | |
| DE2940483A1 (de) | 5h-2,3-benzodiazepinderivate, verfahren zur herstellung derselben und diese enthaltende arzneimittel | |
| DE2836255A1 (de) | 7-phenyl-5h eckige klammer auf 1,2,4 eckige klammer zu triazolo- eckige klammer auf 5,1-a eckige klammer zu eckige klammer auf 2,4 eckige klammer zu -benzodiazepine, verfahren zu ihrer herstellung und ihre verwendung als antiphlogistika, tranquillizer und muskelrelaxantien | |
| CH630381A5 (de) | Verfahren zur herstellung von diazepinderivaten. | |
| DE2323149A1 (de) | Thienopyrimidine, verfahren zu deren herstellung und diese verbindungen enthaltende arzneipraeparate | |
| EP0288431B1 (de) | 3H-1,2,3-Triazolo[4,5-d]pyrimidine | |
| DE1934607A1 (de) | Verfahren zur Herstellung neuer 5-Aryl-1H-1,5-benzodiazepin-2,4-dione | |
| DE2508333A1 (de) | Triazolo eckige klammer auf 4,3-a eckige klammer zu chinazoline | |
| DE2413610A1 (de) | Neue heterocyclische verbindungen und verfahren zu deren herstellung | |
| DE2215943A1 (de) | Neue 6-Phenyl-4H-s-triazolo eckige Klammer auf 1,5-a eckige Klammer zu eckige Klammer auf 1,4 eckige Klammer zu benzodiazepin-2-carbonsäuren und ihre Ester, sowie Verfahren zu deren Herstellung | |
| DE2410699A1 (de) | Verfahren zur herstellung von indolderivaten | |
| DE1935671C3 (de) | 2-Aminomethylindole und ihre Salze | |
| DE1445908A1 (de) | Verfahren zur Herstellung von 1,4-Benzodiazepin-Derivaten | |
| DE2010884A1 (de) | Neue Benzodiazepinderivate und Verfahren zu ihrer Herstellung | |
| DE1445913A1 (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| AT395155B (de) | Verfahren zur herstellung von neuen imidazo(1,5-a)(1,4)diazepinverbindungen | |
| DE1811831C3 (de) | Verfahren zur Herstellung von 5-Phenyl-13-dihydro-2H-l,4-benzodiazepin-2-on-derivaten | |
| CH612186A5 (en) | Process for the preparation of 2(1H)-quinazolinone derivatives | |
| DE2141443C3 (de) | U-Dihydro-S-phenyl^H-M-benzodiazepin-2-one, ihre Salze, Verfahren zu ihrer Herstellung und Arzneimittel | |
| DE2017060C3 (de) | Verfahren zur Herstellung von 1,3-Dihydro-2H-1,4-benzodiazepinon-(2)derivaten | |
| AT276402B (de) | Verfahren zur Herstellung von Chinazolinderivaten bzw. von 3-Desoxyderivaten und Säureadditionssalzen dieser Verbindungen | |
| AT330786B (de) | Verfahren zur herstellung von neuen diazepinderivaten | |
| CH615435A5 (cg-RX-API-DMAC10.html) | ||
| DE2541464A1 (de) | 1,2,4-triazolderivate, verfahren zur herstellung derselben und diese enthaltende pharmazeutische mittel | |
| DE2435041A1 (de) | Neue 8-substituierte 6-aryl-4h-striazolo- eckige klammer auf 3,4c eckige klammer zu-thieno- eckige klammer auf 2,3e eckige klammer zu -1,4-diazepine, verfahren zu ihrer herstellung, ihre verwendung in arzneimitteln sowie zwischenprodukte und verfahren zur herstellung dieser zwischenprodukte |