DE1814576C2 - Elektrode zur Verwendung in elektrolytischen Prozessen und Verfahren zu deren Herstellung - Google Patents
Elektrode zur Verwendung in elektrolytischen Prozessen und Verfahren zu deren HerstellungInfo
- Publication number
- DE1814576C2 DE1814576C2 DE1814576A DE1814576A DE1814576C2 DE 1814576 C2 DE1814576 C2 DE 1814576C2 DE 1814576 A DE1814576 A DE 1814576A DE 1814576 A DE1814576 A DE 1814576A DE 1814576 C2 DE1814576 C2 DE 1814576C2
- Authority
- DE
- Germany
- Prior art keywords
- coating
- oxides
- titanium
- oxide
- tantalum
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 14
- 230000008569 process Effects 0.000 title claims description 9
- 238000004519 manufacturing process Methods 0.000 title claims description 3
- 238000000576 coating method Methods 0.000 claims description 49
- 239000011248 coating agent Substances 0.000 claims description 39
- 229910052751 metal Inorganic materials 0.000 claims description 32
- 239000002184 metal Substances 0.000 claims description 32
- 239000010936 titanium Substances 0.000 claims description 26
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 25
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 24
- 229910052719 titanium Inorganic materials 0.000 claims description 24
- 229910044991 metal oxide Inorganic materials 0.000 claims description 21
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 20
- 150000004706 metal oxides Chemical class 0.000 claims description 13
- 150000002739 metals Chemical class 0.000 claims description 12
- 239000000203 mixture Substances 0.000 claims description 12
- 238000005868 electrolysis reaction Methods 0.000 claims description 10
- 229910052715 tantalum Inorganic materials 0.000 claims description 9
- 229910001936 tantalum oxide Inorganic materials 0.000 claims description 9
- 239000003792 electrolyte Substances 0.000 claims description 8
- BPUBBGLMJRNUCC-UHFFFAOYSA-N oxygen(2-);tantalum(5+) Chemical compound [O-2].[O-2].[O-2].[O-2].[O-2].[Ta+5].[Ta+5] BPUBBGLMJRNUCC-UHFFFAOYSA-N 0.000 claims description 8
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 claims description 7
- 239000002585 base Substances 0.000 claims description 6
- 239000007788 liquid Substances 0.000 claims description 5
- 229910006404 SnO 2 Inorganic materials 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 4
- 238000010438 heat treatment Methods 0.000 claims description 4
- KKCBUQHMOMHUOY-UHFFFAOYSA-N Na2O Inorganic materials [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- 229910018072 Al 2 O 3 Inorganic materials 0.000 claims description 2
- 229910021193 La 2 O 3 Inorganic materials 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims description 2
- LJCFOYOSGPHIOO-UHFFFAOYSA-N antimony pentoxide Inorganic materials O=[Sb](=O)O[Sb](=O)=O LJCFOYOSGPHIOO-UHFFFAOYSA-N 0.000 claims 1
- 239000000470 constituent Substances 0.000 claims 1
- 150000003482 tantalum compounds Chemical class 0.000 claims 1
- 229910010413 TiO 2 Inorganic materials 0.000 description 15
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 13
- 239000000243 solution Substances 0.000 description 13
- 239000000460 chlorine Substances 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- 229910052801 chlorine Inorganic materials 0.000 description 10
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 9
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 7
- 239000011135 tin Substances 0.000 description 7
- 239000004408 titanium dioxide Substances 0.000 description 7
- 229910052707 ruthenium Inorganic materials 0.000 description 6
- 229910052718 tin Inorganic materials 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 5
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 5
- 239000004065 semiconductor Substances 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M sodium chloride Inorganic materials [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 4
- 230000008859 change Effects 0.000 description 4
- 229910000510 noble metal Inorganic materials 0.000 description 4
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 4
- 239000006104 solid solution Substances 0.000 description 4
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 239000010953 base metal Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 3
- 229910052753 mercury Inorganic materials 0.000 description 3
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 229910003446 platinum oxide Inorganic materials 0.000 description 3
- 150000003303 ruthenium Chemical class 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 229910008433 SnCU Inorganic materials 0.000 description 2
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 229910001902 chlorine oxide Inorganic materials 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000005530 etching Methods 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000010955 niobium Substances 0.000 description 2
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 235000010344 sodium nitrate Nutrition 0.000 description 2
- 239000004317 sodium nitrate Substances 0.000 description 2
- 229910001948 sodium oxide Inorganic materials 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 230000004580 weight loss Effects 0.000 description 2
- 229910052726 zirconium Inorganic materials 0.000 description 2
- 229910000497 Amalgam Inorganic materials 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 229910019020 PtO2 Inorganic materials 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 1
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 239000010405 anode material Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- FPCJKVGGYOAWIZ-UHFFFAOYSA-N butan-1-ol;titanium Chemical compound [Ti].CCCCO.CCCCO.CCCCO.CCCCO FPCJKVGGYOAWIZ-UHFFFAOYSA-N 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 238000005234 chemical deposition Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 230000001427 coherent effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- RKTYLMNFRDHKIL-UHFFFAOYSA-N copper;5,10,15,20-tetraphenylporphyrin-22,24-diide Chemical compound [Cu+2].C1=CC(C(=C2C=CC([N-]2)=C(C=2C=CC=CC=2)C=2C=CC(N=2)=C(C=2C=CC=CC=2)C2=CC=C3[N-]2)C=2C=CC=CC=2)=NC1=C3C1=CC=CC=C1 RKTYLMNFRDHKIL-UHFFFAOYSA-N 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 238000003411 electrode reaction Methods 0.000 description 1
- 238000004070 electrodeposition Methods 0.000 description 1
- 238000001652 electrophoretic deposition Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000010304 firing Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N iron oxide Inorganic materials [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 1
- 235000013980 iron oxide Nutrition 0.000 description 1
- VBMVTYDPPZVILR-UHFFFAOYSA-N iron(2+);oxygen(2-) Chemical class [O-2].[Fe+2] VBMVTYDPPZVILR-UHFFFAOYSA-N 0.000 description 1
- 229910052746 lanthanum Inorganic materials 0.000 description 1
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 description 1
- 239000011133 lead Substances 0.000 description 1
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Inorganic materials [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910000480 nickel oxide Inorganic materials 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 229910000484 niobium oxide Inorganic materials 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 238000005554 pickling Methods 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 238000011946 reduction process Methods 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 239000011833 salt mixture Substances 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 238000005488 sandblasting Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000004763 sulfides Chemical class 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 229910001887 tin oxide Inorganic materials 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
- 229910001935 vanadium oxide Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B1/00—Electrolytic production of inorganic compounds or non-metals
- C25B1/01—Products
- C25B1/34—Simultaneous production of alkali metal hydroxides and chlorine, oxyacids or salts of chlorine, e.g. by chlor-alkali electrolysis
- C25B1/46—Simultaneous production of alkali metal hydroxides and chlorine, oxyacids or salts of chlorine, e.g. by chlor-alkali electrolysis in diaphragm cells
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B11/00—Electrodes; Manufacture thereof not otherwise provided for
- C25B11/04—Electrodes; Manufacture thereof not otherwise provided for characterised by the material
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B11/00—Electrodes; Manufacture thereof not otherwise provided for
- C25B11/04—Electrodes; Manufacture thereof not otherwise provided for characterised by the material
- C25B11/051—Electrodes formed of electrocatalysts on a substrate or carrier
- C25B11/073—Electrodes formed of electrocatalysts on a substrate or carrier characterised by the electrocatalyst material
- C25B11/091—Electrodes formed of electrocatalysts on a substrate or carrier characterised by the electrocatalyst material consisting of at least one catalytic element and at least one catalytic compound; consisting of two or more catalytic elements or catalytic compounds
- C25B11/093—Electrodes formed of electrocatalysts on a substrate or carrier characterised by the electrocatalyst material consisting of at least one catalytic element and at least one catalytic compound; consisting of two or more catalytic elements or catalytic compounds at least one noble metal or noble metal oxide and at least one non-noble metal oxide
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B11/00—Electrodes; Manufacture thereof not otherwise provided for
- C25B11/04—Electrodes; Manufacture thereof not otherwise provided for characterised by the material
- C25B11/051—Electrodes formed of electrocatalysts on a substrate or carrier
- C25B11/055—Electrodes formed of electrocatalysts on a substrate or carrier characterised by the substrate or carrier material
- C25B11/057—Electrodes formed of electrocatalysts on a substrate or carrier characterised by the substrate or carrier material consisting of a single element or compound
- C25B11/061—Metal or alloy
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Electrodes For Compound Or Non-Metal Manufacture (AREA)
- Water Treatment By Electricity Or Magnetism (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US69040767A | 1967-12-14 | 1967-12-14 | |
| US04/771,665 US3948751A (en) | 1967-12-14 | 1968-10-29 | Valve metal electrode with valve metal oxide semi-conductive face |
| US77873668A | 1968-11-25 | 1968-11-25 | |
| US00141946A US3846273A (en) | 1967-12-14 | 1971-05-10 | Method of producing valve metal electrode with valve metal oxide semiconductive coating having a chlorine discharge catalyst in said coating |
| US00155644A US3810770A (en) | 1967-12-14 | 1971-06-22 | Titanium or tantalum base electrodes with applied titanium or tantalum oxide face activated with noble metals or noble metal oxides |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1814576A1 DE1814576A1 (de) | 1970-11-26 |
| DE1814576C2 true DE1814576C2 (de) | 1987-10-01 |
Family
ID=27538157
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1814576A Expired DE1814576C2 (de) | 1967-12-14 | 1968-12-13 | Elektrode zur Verwendung in elektrolytischen Prozessen und Verfahren zu deren Herstellung |
| DE19681814567 Withdrawn DE1814567A1 (de) | 1967-12-14 | 1968-12-13 | Elektrode mit elektrokatalytischen,keramischen und halbleitenden Flaechen |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681814567 Withdrawn DE1814567A1 (de) | 1967-12-14 | 1968-12-13 | Elektrode mit elektrokatalytischen,keramischen und halbleitenden Flaechen |
Country Status (7)
| Country | Link |
|---|---|
| US (4) | US3616445A (enExample) |
| BE (2) | BE725491A (enExample) |
| CA (1) | CA962228A (enExample) |
| DE (2) | DE1814576C2 (enExample) |
| FR (2) | FR1595024A (enExample) |
| GB (2) | GB1231280A (enExample) |
| NL (2) | NL165225C (enExample) |
Families Citing this family (125)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3751296A (en) * | 1967-02-10 | 1973-08-07 | Chemnor Ag | Electrode and coating therefor |
| US4003817A (en) * | 1967-12-14 | 1977-01-18 | Diamond Shamrock Technologies, S.A. | Valve metal electrode with valve metal oxide semi-conductive coating having a chlorine discharge in said coating |
| US4318795A (en) * | 1967-12-14 | 1982-03-09 | Diamond Shamrock Technologies S.A. | Valve metal electrode with valve metal oxide semi-conductor face and methods of carrying out electrolysis reactions |
| US3562008A (en) * | 1968-10-14 | 1971-02-09 | Ppg Industries Inc | Method for producing a ruthenium coated titanium electrode |
| US4070504A (en) * | 1968-10-29 | 1978-01-24 | Diamond Shamrock Technologies, S.A. | Method of producing a valve metal electrode with valve metal oxide semi-conductor face and methods of manufacture and use |
| US3711382A (en) * | 1970-06-04 | 1973-01-16 | Ppg Industries Inc | Bimetal spinel surfaced electrodes |
| LU61433A1 (enExample) * | 1970-07-29 | 1972-04-04 | ||
| GB1352872A (en) * | 1971-03-18 | 1974-05-15 | Ici Ltd | Electrodes for electrochemical processes |
| DE2113676C2 (de) * | 1971-03-20 | 1985-09-12 | Conradty GmbH & Co Metallelektroden KG, 8505 Röthenbach | Elektrode für elektrochemische Prozesse |
| JPS4735736A (enExample) * | 1971-03-22 | 1972-11-25 | ||
| US4049532A (en) * | 1971-06-02 | 1977-09-20 | Solvay & Cie. | Electrodes for electrochemical processes |
| US4234405A (en) * | 1971-09-16 | 1980-11-18 | Imperial Chemical Industries Limited | Electrode for electrochemical processes |
| US3924025A (en) * | 1972-02-02 | 1975-12-02 | Electronor Corp | Method of making an electrode having a coating of cobalt metatitanate thereon |
| IT955661B (it) * | 1972-05-19 | 1973-09-29 | Oronzio De Nora Impianti | Elettrodi perfezionati ricoperti di leghe contenenti metalli nobili |
| US3855092A (en) * | 1972-05-30 | 1974-12-17 | Electronor Corp | Novel electrolysis method |
| US3853739A (en) * | 1972-06-23 | 1974-12-10 | Electronor Corp | Platinum group metal oxide coated electrodes |
| US4042484A (en) * | 1972-10-19 | 1977-08-16 | Gerhard Thiele | Metal anode for electro-chemical processes |
| US3873437A (en) * | 1972-11-09 | 1975-03-25 | Diamond Shamrock Corp | Electrode assembly for multipolar electrolytic cells |
| DE2300422C3 (de) * | 1973-01-05 | 1981-10-15 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung einer Elektrode |
| US4134806A (en) * | 1973-01-29 | 1979-01-16 | Diamond Shamrock Technologies, S.A. | Metal anodes with reduced anodic surface and high current density and their use in electrowinning processes with low cathodic current density |
| US3875043A (en) * | 1973-04-19 | 1975-04-01 | Electronor Corp | Electrodes with multicomponent coatings |
| US4000048A (en) * | 1973-06-25 | 1976-12-28 | Diamond Shamrock Technologies S.A. | Novel cathode |
| DE2354477A1 (de) * | 1973-10-31 | 1975-05-15 | Conradty Fa C | Metallelektrode mit deckschicht fuer elektrochemische zwecke |
| US4078988A (en) * | 1974-02-02 | 1978-03-14 | Sigri Elektrographit Gmbh | Electrode for electrochemical processes and method of producing the same |
| DE2405010C3 (de) * | 1974-02-02 | 1982-08-05 | Sigri Elektrographit Gmbh, 8901 Meitingen | Sinter-Elektrode für elektrochemische Prozesse und Verfahren zum Herstellen der Elektrode |
| US3956083A (en) * | 1974-08-02 | 1976-05-11 | Hooker Chemicals & Plastics Corporation | Electrochemical anode and process using the anode |
| US3951766A (en) * | 1974-08-02 | 1976-04-20 | Hooker Chemicals & Plastics Corporation | Electrolytic cell and method of using same |
| US3882002A (en) * | 1974-08-02 | 1975-05-06 | Hooker Chemicals Plastics Corp | Anode for electrolytic processes |
| US4072585A (en) * | 1974-09-23 | 1978-02-07 | Diamond Shamrock Technologies S.A. | Valve metal electrode with valve metal oxide semi-conductive coating having a chlorine discharge catalyst in said coating |
| US4173518A (en) * | 1974-10-23 | 1979-11-06 | Sumitomo Aluminum Smelting Company, Limited | Electrodes for aluminum reduction cells |
| IT1058755B (it) * | 1975-03-24 | 1982-05-10 | Lignes Telegraph Telephon | Procedimento per la fabbricazione di anodi sinterizzati per condensatori elettrolitici |
| US3950240A (en) * | 1975-05-05 | 1976-04-13 | Hooker Chemicals & Plastics Corporation | Anode for electrolytic processes |
| DE2630398C3 (de) * | 1975-07-08 | 1981-04-23 | Rhone-Poulenc Industries, 75360 Paris | Kathode für die Elektrolyse in alkalischem Medium |
| US4012296A (en) * | 1975-10-30 | 1977-03-15 | Hooker Chemicals & Plastics Corporation | Electrode for electrolytic processes |
| US4098669A (en) * | 1976-03-31 | 1978-07-04 | Diamond Shamrock Technologies S.A. | Novel yttrium oxide electrodes and their uses |
| US4076611A (en) * | 1976-04-19 | 1978-02-28 | Olin Corporation | Electrode with lanthanum-containing perovskite surface |
| US4037032A (en) * | 1976-05-05 | 1977-07-19 | Diamond Shamrock Technologies S.A. | Electric storage battery with valve metal electrodes |
| IL50217A (en) * | 1976-08-06 | 1980-01-31 | Israel State | Electrocatalytically acitve spinel type mixed oxides |
| US4067783A (en) * | 1977-03-21 | 1978-01-10 | Bell Telephone Laboratories, Incorporated | Gold electroplating process |
| US4100049A (en) * | 1977-07-11 | 1978-07-11 | Diamond Shamrock Corporation | Coated cathode for electrolysis cells |
| US4297421A (en) * | 1977-11-10 | 1981-10-27 | The International Nickel Co., Inc. | Battery and electrolytic cell electrodes |
| JPS54125197A (en) * | 1978-03-24 | 1979-09-28 | Berumeretsuku Denkiyoku Kk | Electrolytic electrode and its manufacture |
| FI66919C (fi) * | 1978-03-28 | 1984-12-10 | Diamond Shamrock Techn | Elektroder foer elektrolytiska processer speciellt foer perkloratproduktion |
| US4181593A (en) * | 1978-06-22 | 1980-01-01 | Gte Laboratories Incorporated | Modified titanium dioxide photoactive electrodes |
| US4181754A (en) * | 1978-06-22 | 1980-01-01 | Gte Laboratories Incorporated | In situ method of preparing modified titanium dioxide photoactive electrodes |
| US4215155A (en) * | 1978-06-22 | 1980-07-29 | Gte Laboratories Incorporated | Method of preparing modified titanium dioxide photoactive electrodes |
| US4157943A (en) * | 1978-07-14 | 1979-06-12 | The International Nickel Company, Inc. | Composite electrode for electrolytic processes |
| US4189358A (en) * | 1978-07-14 | 1980-02-19 | The International Nickel Company, Inc. | Electrodeposition of ruthenium-iridium alloy |
| US4457823A (en) * | 1978-08-08 | 1984-07-03 | General Electric Company | Thermally stabilized reduced platinum oxide electrocatalyst |
| US4214971A (en) * | 1978-08-14 | 1980-07-29 | The Dow Chemical Company | Electrode coating process |
| US4256556A (en) * | 1978-11-24 | 1981-03-17 | Diamond Shamrock Corporation | Anodically polarized surface for biofouling and scale control |
| DE2914414A1 (de) | 1979-04-10 | 1980-10-23 | Bayer Ag | Anode fuer die alkalichlorid-elektrolyse und verfahren zur herstellung von chlor |
| US4384937A (en) * | 1979-05-29 | 1983-05-24 | Diamond Shamrock Corporation | Production of chromic acid in a three-compartment cell |
| US4273628A (en) * | 1979-05-29 | 1981-06-16 | Diamond Shamrock Corp. | Production of chromic acid using two-compartment and three-compartment cells |
| DE2928911A1 (de) * | 1979-06-29 | 1981-01-29 | Bbc Brown Boveri & Cie | Elektrode fuer die wasserelektrolyse |
| DE2928910A1 (de) * | 1979-06-29 | 1981-01-29 | Bbc Brown Boveri & Cie | Elektrode fuer die wasserelektrolyse |
| DE2928909A1 (de) * | 1979-06-29 | 1981-01-29 | Bbc Brown Boveri & Cie | Elektrode fuer die wasserelektrolyse |
| GB2060701B (en) | 1979-10-12 | 1983-06-08 | Diamond Shamrock Corp | Electrode coating with platinum- group metal catalyst and semiconducting polymer |
| DE2944814A1 (de) * | 1979-11-06 | 1981-05-14 | Vladimir Borisovič Busse-Mačukas | Elektrode fuer elektrochemische prozesse |
| US4310391A (en) * | 1979-12-21 | 1982-01-12 | Bell Telephone Laboratories, Incorporated | Electrolytic gold plating |
| DE3000365A1 (de) * | 1980-01-07 | 1981-07-09 | Degussa Ag, 6000 Frankfurt | Verfahren zur herstellung von ((monotrichlor)-tetra(monikalium-dichlor))-penta-isocyanurat |
| US4269670A (en) * | 1980-03-03 | 1981-05-26 | Bell Telephone Laboratories, Incorporated | Electrode for electrochemical processes |
| US4378385A (en) | 1980-03-28 | 1983-03-29 | United Kingdom Atomic Energy Authority | Method of making oxygen ion conducting solid electrolyte device |
| CA1190186A (en) * | 1980-08-18 | 1985-07-09 | Henri B. Beer | Electrode with mixed oxide interface on valve metal base and stable outer coating |
| CA1225066A (en) * | 1980-08-18 | 1987-08-04 | Jean M. Hinden | Electrode with surface film of oxide of valve metal incorporating platinum group metal or oxide |
| US4422917A (en) * | 1980-09-10 | 1983-12-27 | Imi Marston Limited | Electrode material, electrode and electrochemical cell |
| EP0052986B1 (en) * | 1980-11-26 | 1983-12-28 | Imi Kynoch Limited | Electrode, method of manufacturing an electrode and electrolytic cell using such an electrode |
| JPS5861286A (ja) * | 1981-10-08 | 1983-04-12 | Tdk Corp | 電解用電極およびその製造方法 |
| US4437948A (en) | 1981-10-16 | 1984-03-20 | Bell Telephone Laboratories, Incorporated | Copper plating procedure |
| WO1983002288A1 (en) * | 1981-12-28 | 1983-07-07 | Hinden, Jean, Marcel | Electrocatalytic electrode |
| JPS6022074B2 (ja) * | 1982-08-26 | 1985-05-30 | ペルメレツク電極株式会社 | 耐久性を有する電解用電極及びその製造方法 |
| US4483752A (en) * | 1982-09-28 | 1984-11-20 | Eltech Systems Corporation | Valve metal electrodeposition onto graphite |
| DE3460087D1 (en) * | 1983-03-11 | 1986-05-22 | Bbc Brown Boveri & Cie | Catalyst for the coating of anodes, and its manufacturing process |
| US4584085A (en) * | 1983-05-31 | 1986-04-22 | The Dow Chemical Company | Preparation and use of electrodes |
| US4871703A (en) * | 1983-05-31 | 1989-10-03 | The Dow Chemical Company | Process for preparation of an electrocatalyst |
| DE3345530A1 (de) * | 1983-07-13 | 1985-06-27 | Basf Ag, 6700 Ludwigshafen | Gasentwickelnde metallelektrode fuer elektrolysezellen |
| IL73536A (en) * | 1984-09-13 | 1987-12-20 | Eltech Systems Corp | Composite catalytic material particularly for electrolysis electrodes,its manufacture and its use in electrolysis |
| US4564434A (en) * | 1984-09-28 | 1986-01-14 | Busse Machukas Vladimir B | Electrode for electrolysis of solutions of electrolytes |
| US4589969A (en) * | 1984-10-12 | 1986-05-20 | Yurkov Leonid I | Electrode for electrolysis of solutions of electrolytes and process for producing same |
| US4931213A (en) * | 1987-01-23 | 1990-06-05 | Cass Richard B | Electrically-conductive titanium suboxides |
| DE3881359T2 (de) * | 1987-12-16 | 1994-01-20 | Tansitor Electronics Inc | Kondensatortantaloberfläche zur Verwendung als Gegenelektrodenanordnung und Verfahren. |
| US4946570A (en) * | 1989-02-28 | 1990-08-07 | The United States Of America As Represented By The Secretary Of The Army | Ceramic coated strip anode for cathodic protection |
| US5176807A (en) * | 1989-02-28 | 1993-01-05 | The United States Of America As Represented By The Secretary Of The Army | Expandable coil cathodic protection anode |
| US5055169A (en) * | 1989-03-17 | 1991-10-08 | The United States Of America As Represented By The Secretary Of The Army | Method of making mixed metal oxide coated substrates |
| US5028568A (en) * | 1989-07-05 | 1991-07-02 | Wisconsin Alumni Research Foundation | Niobium-doped titanium membranes |
| US5215943A (en) * | 1989-07-05 | 1993-06-01 | Wisconsin Alumi Research Foundation | Ceramic membranes with enhanced thermal stability |
| US5230780A (en) * | 1989-12-08 | 1993-07-27 | Eltech Systems Corporation | Electrolyzing halogen-containing solution in a membrane cell |
| JP2713788B2 (ja) * | 1989-12-22 | 1998-02-16 | ティーディーケイ株式会社 | 酸素発生用電極及びその製造方法 |
| US5043849A (en) * | 1990-04-17 | 1991-08-27 | Tansistor Electronics, Inc. | Electrolytic capacitor with codeposited noble metal/base metal cathode element and method for making |
| US5419824A (en) * | 1992-11-12 | 1995-05-30 | Weres; Oleh | Electrode, electrode manufacturing process and electrochemical cell |
| US5503663A (en) * | 1994-11-30 | 1996-04-02 | The Dow Chemical Company | Sable coating solutions for coating valve metal anodes |
| US5654030A (en) * | 1995-02-07 | 1997-08-05 | Intermedics, Inc. | Method of making implantable stimulation electrodes |
| US5587058A (en) * | 1995-09-21 | 1996-12-24 | Karpov Institute Of Physical Chemicstry | Electrode and method of preparation thereof |
| GB9600210D0 (en) | 1996-01-05 | 1996-03-06 | Vanderstraeten E Bvba | Improved sputtering targets and method for the preparation thereof |
| US6572758B2 (en) * | 2001-02-06 | 2003-06-03 | United States Filter Corporation | Electrode coating and method of use and preparation thereof |
| TW508681B (en) * | 2001-05-11 | 2002-11-01 | Macronix Int Co Ltd | Cleaning method of semiconductor manufacture process for preventing metal corrosion |
| US7001494B2 (en) * | 2001-08-14 | 2006-02-21 | 3-One-2, Llc | Electrolytic cell and electrodes for use in electrochemical processes |
| KR100407710B1 (ko) * | 2001-11-08 | 2003-12-01 | (주) 테크윈 | 고온 소결에 의한 촉매성 산화물 전극의 제조방법 |
| WO2005063646A1 (en) | 2003-12-22 | 2005-07-14 | Cardinal Cg Company | Graded photocatalytic coatings |
| EP1765740B1 (en) | 2004-07-12 | 2007-11-07 | Cardinal CG Company | Low-maintenance coatings |
| US8092660B2 (en) | 2004-12-03 | 2012-01-10 | Cardinal Cg Company | Methods and equipment for depositing hydrophilic coatings, and deposition technologies for thin films |
| US7923114B2 (en) | 2004-12-03 | 2011-04-12 | Cardinal Cg Company | Hydrophilic coatings, methods for depositing hydrophilic coatings, and improved deposition technology for thin films |
| JP4032068B2 (ja) * | 2005-07-28 | 2008-01-16 | 株式会社神戸製鋼所 | 燃料電池用のセパレータに用いるチタン材 |
| US20070119652A1 (en) * | 2005-10-04 | 2007-05-31 | Broyles Sean C | Emergency evacuation rappel line anchor mount apparatus |
| BRPI0618007A2 (pt) * | 2005-10-28 | 2011-08-16 | Akuatech S R L | solução aquosa altamente estável, eletrodo com nanorevestimento para preparação de solução e método de fabricação deste eletrodo |
| ITMI20052297A1 (it) * | 2005-11-30 | 2007-06-01 | De Nora Elettrodi Spa | Trattamento elettrochimico di soluzioni contenenti cromo esavalente |
| US7989094B2 (en) | 2006-04-19 | 2011-08-02 | Cardinal Cg Company | Opposed functional coatings having comparable single surface reflectances |
| US20080011599A1 (en) | 2006-07-12 | 2008-01-17 | Brabender Dennis M | Sputtering apparatus including novel target mounting and/or control |
| CN101490301B (zh) * | 2006-07-14 | 2012-05-30 | 丹佛斯公司 | 利用混合的钽和钛的氧化物的表面层处理钛物体的方法 |
| US8801961B2 (en) * | 2006-10-18 | 2014-08-12 | University Of South Carolina | Electrocatalyst support and catalyst supported thereon |
| AU2008236636B2 (en) * | 2007-04-05 | 2013-05-16 | Evoqua Water Technologies Llc | Method and system of electrolytic treatment |
| CA2664368A1 (en) | 2007-09-14 | 2009-03-19 | Cardinal Cg Company | Low-maintenance coating technology |
| US8022004B2 (en) * | 2008-05-24 | 2011-09-20 | Freeport-Mcmoran Corporation | Multi-coated electrode and method of making |
| TWI490371B (zh) * | 2009-07-28 | 2015-07-01 | Industrie De Nora Spa | 電解應用上的電極及其製法以及在電極表面上陽極釋氧之電解法和電冶法 |
| ITMI20101100A1 (it) * | 2010-06-17 | 2011-12-18 | Industrie De Nora Spa | Sistema per la generazione elettrochimica di ipoclorito |
| DE102010043085A1 (de) | 2010-10-28 | 2012-05-03 | Bayer Materialscience Aktiengesellschaft | Elektrode für die elektrolytische Chlorherstellung |
| DE102013202143A1 (de) * | 2013-02-08 | 2014-08-14 | Bayer Materialscience Ag | Katalysatorbeschichtung und Verfahren zu ihrer Herstellung |
| CN105297073A (zh) * | 2015-10-30 | 2016-02-03 | 昆明理工大学 | 一种铜基亚氧化钛电极板的制备方法 |
| WO2018093985A1 (en) | 2016-11-17 | 2018-05-24 | Cardinal Cg Company | Static-dissipative coating technology |
| IT201800003533A1 (it) * | 2018-03-14 | 2019-09-14 | Industrie De Nora Spa | Elettrodo per processi di elettroclorazione |
| US11668017B2 (en) | 2018-07-30 | 2023-06-06 | Water Star, Inc. | Current reversal tolerant multilayer material, method of making the same, use as an electrode, and use in electrochemical processes |
| US11484865B2 (en) * | 2019-05-06 | 2022-11-01 | Yale University | Hydrogen peroxide selective catalysts, methods of using thereof, and methods of making thereof |
| CN111807573B (zh) * | 2020-07-16 | 2022-06-14 | 湖南中湘春天环保科技有限公司 | 一种含铊废水的处理装置及方法 |
| DE102021206711A1 (de) * | 2021-06-29 | 2022-12-29 | Aktiebolaget Skf | Bauteil |
| EP4480924A1 (en) * | 2023-06-20 | 2024-12-25 | Infineum International Limited | Catalytic anodes and processes for use in electro-chlorination |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DD66414A (enExample) * | ||||
| DD55323A (enExample) * | ||||
| US2940845A (en) * | 1958-02-24 | 1960-06-14 | Kennecott Copper Corp | Columbium-titanium base oxidationresistant alloys |
| US3037858A (en) * | 1958-12-22 | 1962-06-05 | Union Carbide Corp | Columbium base alloy |
| NL126075C (enExample) * | 1959-04-27 | |||
| GB1195871A (en) * | 1967-02-10 | 1970-06-24 | Chemnor Ag | Improvements in or relating to the Manufacture of Electrodes. |
-
1967
- 1967-12-14 US US690407A patent/US3616445A/en not_active Expired - Lifetime
-
1968
- 1968-10-29 US US04/771,665 patent/US3948751A/en not_active Expired - Lifetime
- 1968-12-11 FR FR1595024D patent/FR1595024A/fr not_active Expired
- 1968-12-12 GB GB1231280D patent/GB1231280A/en not_active Expired
- 1968-12-12 GB GB59185/68A patent/GB1235570A/en not_active Expired
- 1968-12-12 FR FR1597806D patent/FR1597806A/fr not_active Expired
- 1968-12-13 NL NLAANVRAGE6817957,A patent/NL165225C/xx not_active IP Right Cessation
- 1968-12-13 CA CA037,759A patent/CA962228A/en not_active Expired
- 1968-12-13 NL NL6817966A patent/NL6817966A/xx not_active Application Discontinuation
- 1968-12-13 DE DE1814576A patent/DE1814576C2/de not_active Expired
- 1968-12-13 BE BE725491D patent/BE725491A/xx not_active IP Right Cessation
- 1968-12-13 BE BE725492D patent/BE725492A/xx not_active IP Right Cessation
- 1968-12-13 DE DE19681814567 patent/DE1814567A1/de not_active Withdrawn
-
1971
- 1971-05-10 US US00141946A patent/US3846273A/en not_active Expired - Lifetime
- 1971-06-22 US US00155644A patent/US3810770A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| BE725492A (enExample) | 1969-06-13 |
| FR1597806A (enExample) | 1970-06-29 |
| GB1235570A (en) | 1971-06-16 |
| CA962228A (en) | 1975-02-04 |
| DE1814567A1 (de) | 1969-08-14 |
| US3948751A (en) | 1976-04-06 |
| NL165225C (nl) | 1983-09-16 |
| GB1231280A (enExample) | 1971-05-12 |
| DE1814576A1 (de) | 1970-11-26 |
| US3810770A (en) | 1974-05-14 |
| US3846273A (en) | 1974-11-05 |
| FR1595024A (enExample) | 1970-06-08 |
| BE725491A (fr) | 1969-06-13 |
| US3616445A (en) | 1971-10-26 |
| NL6817966A (enExample) | 1969-06-17 |
| NL165225B (nl) | 1980-10-15 |
| NL6817957A (enExample) | 1969-06-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1814576C2 (de) | Elektrode zur Verwendung in elektrolytischen Prozessen und Verfahren zu deren Herstellung | |
| DE3219003C2 (enExample) | ||
| DE2403573C2 (de) | Verfahren zur Herstellung von Anoden | |
| DE2331949C3 (de) | Verfahren zur Herstellung einer Elektrode | |
| DE1571721C3 (de) | Elektrode zur Verwendung in elektrolytischen Prozessen | |
| DE2636447C2 (de) | Mangandioxidelektroden | |
| DE1952484C3 (de) | Ventilmetall-Elektrode | |
| DE69218075T2 (de) | Elektrode für Elektrolyse | |
| DE60019256T2 (de) | Kathode für die elektrolyse von wässrigen lösungen | |
| DE60306772T2 (de) | Elektrode für gasentwicklung und deren herstellungsverfahren | |
| DE2620589C3 (de) | Aktivierte Kathode zur Verwendung bei der Elektrolyse wäßriger Lösungen | |
| DE2936033C2 (enExample) | ||
| DE2719051A1 (de) | Elektroden mit hoher durchbruchspannung fuer bromidhaltige elektrolyte | |
| DE3588054T2 (de) | Verfahren zur Herstellung einer Elektrode und deren Verwendung in elektrochemischen Verfahren. | |
| DE3330388C2 (enExample) | ||
| DE2300422B2 (de) | Langzeitelektrode für elektrolytische Prozesse | |
| DE2113795A1 (de) | Elektrode,Verfahren zu ihrer Herstellung und ihre Verwendung als Sauerstoffanode | |
| DE3507071C2 (de) | Elektrode für die Elektrolyse und Verfahren zu ihrer Herstellung | |
| DE2419021B2 (de) | Elektrode | |
| DE2213083A1 (de) | Elektroden für elektrochemische Verfahren | |
| DE2543033C2 (de) | Verfahren zur Herstellung einer beschichteten Elektrode und ihre Verwendung | |
| DE2342663B2 (de) | Elektrode | |
| DE2113676C2 (de) | Elektrode für elektrochemische Prozesse | |
| DE3507072C2 (de) | Elektrode für die elektrolytische Erzeugung von Sauerstoff und Verfahren zu ihrer Herstellung | |
| DE69521588T2 (de) | Stabile Beschichtungslösungen zur Bildung von elektrokatalytischen Beschichtungen aus gemischten Oxyden auf Metall oder metallisierten Trägern und Verfahren zur Herstellung von dimensionstabilen Anoden unter Verwendung dieser Lösungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OGA | New person/name/address of the applicant | ||
| OI | Miscellaneous see part 1 | ||
| OI | Miscellaneous see part 1 | ||
| AF | Is addition to no. |
Ref country code: DE Ref document number: 1814567 Format of ref document f/p: P |
|
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: DIAMOND SHAMROCK TECHNOLOGIES S.A., 6301 ZUG, CH |
|
| AH | Division in |
Ref country code: DE Ref document number: 1818051 Format of ref document f/p: P |
|
| 8366 | Restricted maintained after opposition proceedings | ||
| 8305 | Restricted maintenance of patent after opposition | ||
| AH | Division in |
Ref country code: DE Ref document number: 1818051 Format of ref document f/p: P |
|
| D4 | Patent maintained restricted |