DE1808684A1 - Verwendung von Verbindungen mit Vinylsulfonylalkylgruppen als Haertungsmittel zum Haerten kolloidaler Bindemittel photographischer Emulsionen - Google Patents
Verwendung von Verbindungen mit Vinylsulfonylalkylgruppen als Haertungsmittel zum Haerten kolloidaler Bindemittel photographischer EmulsionenInfo
- Publication number
- DE1808684A1 DE1808684A1 DE19681808684 DE1808684A DE1808684A1 DE 1808684 A1 DE1808684 A1 DE 1808684A1 DE 19681808684 DE19681808684 DE 19681808684 DE 1808684 A DE1808684 A DE 1808684A DE 1808684 A1 DE1808684 A1 DE 1808684A1
- Authority
- DE
- Germany
- Prior art keywords
- hardening
- compounds
- emulsions
- groups
- carbon atoms
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000839 emulsion Substances 0.000 title claims description 40
- 239000003795 chemical substances by application Substances 0.000 title claims description 22
- 150000001875 compounds Chemical class 0.000 title claims description 22
- 239000011230 binding agent Substances 0.000 title claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 150000001450 anions Chemical class 0.000 claims description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 125000000524 functional group Chemical group 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 125000000732 arylene group Chemical group 0.000 claims 2
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 claims 1
- -1 alkyl methacrylates Chemical class 0.000 description 24
- 229910052709 silver Inorganic materials 0.000 description 20
- 239000004332 silver Substances 0.000 description 20
- 229920000159 gelatin Polymers 0.000 description 13
- 235000019322 gelatine Nutrition 0.000 description 13
- 108010010803 Gelatin Proteins 0.000 description 12
- 239000008273 gelatin Substances 0.000 description 12
- 235000011852 gelatine desserts Nutrition 0.000 description 12
- 238000000034 method Methods 0.000 description 10
- 239000000463 material Substances 0.000 description 9
- 239000004848 polyfunctional curative Substances 0.000 description 7
- 238000009792 diffusion process Methods 0.000 description 5
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 4
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 4
- SJOOOZPMQAWAOP-UHFFFAOYSA-N [Ag].BrCl Chemical compound [Ag].BrCl SJOOOZPMQAWAOP-UHFFFAOYSA-N 0.000 description 4
- 239000000975 dye Substances 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 229920002301 cellulose acetate Polymers 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 238000002845 discoloration Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 239000000123 paper Substances 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- QGKMIGUHVLGJBR-UHFFFAOYSA-M (4z)-1-(3-methylbutyl)-4-[[1-(3-methylbutyl)quinolin-1-ium-4-yl]methylidene]quinoline;iodide Chemical compound [I-].C12=CC=CC=C2N(CCC(C)C)C=CC1=CC1=CC=[N+](CCC(C)C)C2=CC=CC=C12 QGKMIGUHVLGJBR-UHFFFAOYSA-M 0.000 description 1
- LUMLZKVIXLWTCI-NSCUHMNNSA-N (e)-2,3-dichloro-4-oxobut-2-enoic acid Chemical compound OC(=O)C(\Cl)=C(/Cl)C=O LUMLZKVIXLWTCI-NSCUHMNNSA-N 0.000 description 1
- IDFLGSYEBJNWMK-UHFFFAOYSA-N 1,2-Bis(chloromethoxy)ethane Chemical compound ClCOCCOCCl IDFLGSYEBJNWMK-UHFFFAOYSA-N 0.000 description 1
- WJYMWGGAVJHRTJ-UHFFFAOYSA-N 1,2-bis(2-chloroethylsulfonylmethoxy)ethane Chemical compound ClCCS(=O)(=O)COCCOCS(=O)(=O)CCCl WJYMWGGAVJHRTJ-UHFFFAOYSA-N 0.000 description 1
- AHCZTKJEGILDRU-UHFFFAOYSA-N 1,2-bis(ethenylsulfonylmethoxy)ethane Chemical compound C=CS(=O)(=O)COCCOCS(=O)(=O)C=C AHCZTKJEGILDRU-UHFFFAOYSA-N 0.000 description 1
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 1
- JKFYKCYQEWQPTM-UHFFFAOYSA-N 2-azaniumyl-2-(4-fluorophenyl)acetate Chemical compound OC(=O)C(N)C1=CC=C(F)C=C1 JKFYKCYQEWQPTM-UHFFFAOYSA-N 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 206010067482 No adverse event Diseases 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- GBFOMDSBOSHFDS-UHFFFAOYSA-M S(=O)([O-])O.[Na+].S(=O)(=O)(O)OC1=CC=C(C=C1)NC Chemical compound S(=O)([O-])O.[Na+].S(=O)(=O)(O)OC1=CC=C(C=C1)NC GBFOMDSBOSHFDS-UHFFFAOYSA-M 0.000 description 1
- 229910021607 Silver chloride Inorganic materials 0.000 description 1
- 229910021612 Silver iodide Inorganic materials 0.000 description 1
- FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 description 1
- HOLVRJRSWZOAJU-UHFFFAOYSA-N [Ag].ICl Chemical compound [Ag].ICl HOLVRJRSWZOAJU-UHFFFAOYSA-N 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000005250 alkyl acrylate group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 235000019646 color tone Nutrition 0.000 description 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000002344 gold compounds Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- ZAKLKBFCSHJIRI-UHFFFAOYSA-N mucochloric acid Natural products OC1OC(=O)C(Cl)=C1Cl ZAKLKBFCSHJIRI-UHFFFAOYSA-N 0.000 description 1
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 1
- 229920005615 natural polymer Polymers 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 229920006267 polyester film Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 1
- NDGRWYRVNANFNB-UHFFFAOYSA-N pyrazolidin-3-one Chemical compound O=C1CCNN1 NDGRWYRVNANFNB-UHFFFAOYSA-N 0.000 description 1
- 230000001235 sensitizing effect Effects 0.000 description 1
- 150000003378 silver Chemical class 0.000 description 1
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 1
- ZUNKMNLKJXRCDM-UHFFFAOYSA-N silver bromoiodide Chemical compound [Ag].IBr ZUNKMNLKJXRCDM-UHFFFAOYSA-N 0.000 description 1
- 229940045105 silver iodide Drugs 0.000 description 1
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000001043 yellow dye Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/005—Silver halide emulsions; Preparation thereof; Physical treatment thereof; Incorporation of additives therein
- G03C1/06—Silver halide emulsions; Preparation thereof; Physical treatment thereof; Incorporation of additives therein with non-macromolecular additives
- G03C1/30—Hardeners
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C315/00—Preparation of sulfones; Preparation of sulfoxides
- C07C315/04—Preparation of sulfones; Preparation of sulfoxides by reactions not involving the formation of sulfone or sulfoxide groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/16—Sulfones; Sulfoxides having sulfone or sulfoxide groups and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C317/18—Sulfones; Sulfoxides having sulfone or sulfoxide groups and singly-bound oxygen atoms bound to the same carbon skeleton with sulfone or sulfoxide groups bound to acyclic carbon atoms of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/10—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C323/11—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and singly-bound oxygen atoms bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton
- C07C323/12—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and singly-bound oxygen atoms bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being acyclic and saturated
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L101/00—Compositions of unspecified macromolecular compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Physics & Mathematics (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Health & Medical Sciences (AREA)
- Spectroscopy & Molecular Physics (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US48879765A | 1965-09-20 | 1965-09-20 | |
| US68264167A | 1967-11-13 | 1967-11-13 | |
| US86214469A | 1969-08-22 | 1969-08-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1808684A1 true DE1808684A1 (de) | 1969-07-24 |
Family
ID=27413826
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681808684 Pending DE1808684A1 (de) | 1965-09-20 | 1968-11-13 | Verwendung von Verbindungen mit Vinylsulfonylalkylgruppen als Haertungsmittel zum Haerten kolloidaler Bindemittel photographischer Emulsionen |
Country Status (6)
| Country | Link |
|---|---|
| US (2) | US3490911A (cg-RX-API-DMAC10.html) |
| BE (2) | BE686440A (cg-RX-API-DMAC10.html) |
| BR (1) | BR6803921D0 (cg-RX-API-DMAC10.html) |
| DE (1) | DE1808684A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR1591428A (cg-RX-API-DMAC10.html) |
| GB (2) | GB1158263A (cg-RX-API-DMAC10.html) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1220787B (de) * | 1962-12-06 | 1966-07-07 | Ford Motor Co | Seitlich am Schlepper anzubringende Schaufel-Ladeeinrichtung |
| DE2447587A1 (de) * | 1973-10-08 | 1975-04-17 | Konishiroku Photo Ind | Verfahren zum haerten von gelatine |
| JPS519609B1 (cg-RX-API-DMAC10.html) * | 1971-05-18 | 1976-03-29 |
Families Citing this family (52)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3642486A (en) * | 1970-03-19 | 1972-02-15 | Eastman Kodak Co | Vinylsulfonyl-containing compounds as hardening agents |
| JPS5035807B2 (cg-RX-API-DMAC10.html) * | 1971-12-30 | 1975-11-19 | ||
| US3841872A (en) * | 1972-09-29 | 1974-10-15 | Eastman Kodak Co | Hydrophilic-colloid silver halide emulsion hardened with a bisvinylsulfonyl compound |
| USRE29305E (en) * | 1972-09-29 | 1977-07-12 | Eastman Kodak Company | Hydrophilic-colloid silver halide emulsion hardened with a bisvinylsulfonyl compound |
| CH592700A5 (cg-RX-API-DMAC10.html) * | 1974-01-31 | 1977-11-15 | Ciba Geigy Ag | |
| JPS532459B2 (cg-RX-API-DMAC10.html) * | 1974-04-01 | 1978-01-28 | ||
| US4088495A (en) * | 1974-10-14 | 1978-05-09 | Konishiroku Photo Industry Co., Ltd. | Silver halide photographic element containing a gelatinous layer hardened with an aliphatic hydrocarbon having at least three vinylsulfonyl groups |
| JPS51126124A (en) * | 1975-04-25 | 1976-11-04 | Fuji Photo Film Co Ltd | Gelatin setting method |
| JPS5221059A (en) * | 1975-08-09 | 1977-02-17 | Konishiroku Photo Ind Co Ltd | Method for hardening gelatin |
| US4134765A (en) * | 1975-10-31 | 1979-01-16 | Ciba-Geigy Ag | Vinylsulphone hardener |
| GB1542462A (en) * | 1976-02-04 | 1979-03-21 | Ciba Geigy Ag | N-vinyl sulphonyl-or sulphinylalkyl amides ureas and sulphoxylureas and their use as cross-linking agents for hydrophilic colloids |
| US4134770A (en) * | 1976-09-22 | 1979-01-16 | Mitsubishi Paper Mills, Ltd. | Gelatin-containing photographic layer incorporated with hardener |
| JPS5357257A (en) * | 1976-11-04 | 1978-05-24 | Fuji Photo Film Co Ltd | Setting of gelatin |
| JPS5376025A (en) * | 1976-12-17 | 1978-07-06 | Fuji Photo Film Co Ltd | Prevention method for uneven transfer of color diffusion transfer image |
| DE2730042A1 (de) * | 1977-07-02 | 1979-01-11 | Cassella Farbwerke Mainkur Ag | Avivage- und hydrophobiermittel fuer zellulose-textilien und leder |
| US4161407A (en) * | 1977-10-06 | 1979-07-17 | Eastman Kodak Company | Crosslinkable polymers having vinylsulfonyl groups or styrylsulfonyl groups and their use as hardeners for gelatin |
| US4190447A (en) * | 1978-01-09 | 1980-02-26 | Eastman Kodak Company | Cover sheets for integral imaging receiver elements |
| JPS59137946A (ja) | 1983-01-28 | 1984-08-08 | Fuji Photo Film Co Ltd | ハロゲン化銀感光材料 |
| SE470099B (sv) * | 1984-05-17 | 1993-11-08 | Jerker Porath | Sulfonaktiverade tioeteradsorbenter för separation av t ex protein |
| JPS61123834A (ja) * | 1984-10-23 | 1986-06-11 | Konishiroku Photo Ind Co Ltd | ハロゲン化銀写真感光材料 |
| CA1303412C (en) | 1985-05-31 | 1992-06-16 | Shigeharu Koboshi | Method for forming direct positive color image |
| DE3523360A1 (de) * | 1985-06-29 | 1987-01-08 | Agfa Gevaert Ag | Lichtempfindliches fotografisches aufzeichnungsmaterial |
| JPS63128338A (ja) * | 1986-11-18 | 1988-05-31 | Fuji Photo Film Co Ltd | 画像形成方法 |
| US5219992A (en) * | 1990-06-18 | 1993-06-15 | Eastman Kodak Company | Modification of gelatin |
| US5187259A (en) * | 1990-11-14 | 1993-02-16 | Eastman Kodak Company | Chain extended gelatin |
| EP0521632A1 (en) * | 1991-06-26 | 1993-01-07 | Konica Corporation | Silver halide photographic materials |
| JP2929511B2 (ja) * | 1991-09-25 | 1999-08-03 | コニカ株式会社 | ハロゲン化銀カラー写真感光材料 |
| JPH0588324A (ja) * | 1991-09-25 | 1993-04-09 | Konica Corp | ハロゲン化銀カラー写真感光材料 |
| JP3095847B2 (ja) * | 1991-12-27 | 2000-10-10 | コニカ株式会社 | カラー写真用処理液及び該処理液を用いたハロゲン化銀カラー写真感光材料の処理方法 |
| EP0553569B1 (en) * | 1991-12-27 | 1996-12-04 | Konica Corporation | Method for processing silver halide color photographic light-sensitive materials |
| JPH0649434A (ja) * | 1992-06-01 | 1994-02-22 | Eastman Kodak Co | ゼラチン溶液用迅速作用性増粘剤 |
| US5286450A (en) * | 1992-06-01 | 1994-02-15 | Eastman Kodak Company | Bilirubin assay using crosslinkable polymers |
| US5378598A (en) * | 1992-12-21 | 1995-01-03 | Eastman Kodak Company | Use of acid processed ossein gelatin and chain-extened acid processed ossein gelatin as peptizers in the preparation of photographic emulsions |
| US5318889A (en) * | 1992-12-21 | 1994-06-07 | Eastman Kodak Company | Use of chain-extended acid processed ossein gelatin in the preparation of photographic elements |
| US5514535A (en) * | 1995-05-10 | 1996-05-07 | Eastman Kodak Company | Stabilized vinyl sulfone hardening compositions useful in photographic manufacturing |
| US5658721A (en) * | 1995-12-21 | 1997-08-19 | Eastman Kodak Company | Stabilized vinyl sulfone hardening compositions useful in photographic manufacturing |
| US5800977A (en) * | 1996-07-24 | 1998-09-01 | Eastman Kodak Company | Hardening a hydrophilic colloid composition |
| US6435678B1 (en) | 1998-05-22 | 2002-08-20 | Eastman Kodak Company | Waterfast ink jet images treated with hardeners |
| US6020398A (en) * | 1998-05-22 | 2000-02-01 | Eastman Kodak Company | Pigmented ink jet inks for poly (vinylalcohol) receivers |
| US6176574B1 (en) | 1998-05-22 | 2001-01-23 | Eastman Kodak Company | Printing apparatus with spray bar for improved durability |
| US6082853A (en) * | 1998-05-22 | 2000-07-04 | Eastman Kodak Company | Printing apparatus with processing tank |
| US6161929A (en) * | 1998-05-22 | 2000-12-19 | Eastman Kodak Company | Inkjet images on PVA overcoated with hardener solution |
| US6045219A (en) * | 1998-05-22 | 2000-04-04 | Eastman Kodak Company | Pigmented ink jet prints on gelatin overcoated with hardeners |
| US6254230B1 (en) | 1998-05-22 | 2001-07-03 | Eastman Kodak Company | Ink jet printing apparatus with print head for improved image durability |
| US6074057A (en) * | 1998-05-22 | 2000-06-13 | Eastman Kodak Company | Pigmented ink jet inks and recording elements containing hardening agents |
| US7148937B2 (en) * | 2004-05-21 | 2006-12-12 | Eastman Kodak Company | Display comprising blended mixture of different uniform domain sizes with the ratio of smallest to largest domain size no more than 1:2 |
| US20060062898A1 (en) * | 2004-09-17 | 2006-03-23 | Eastman Kodak Company | Method of making a display sheet comprising discontinuous stripe coating |
| US7630029B2 (en) * | 2005-02-16 | 2009-12-08 | Industrial Technology Research Institute | Conductive absorption layer for flexible displays |
| US7557875B2 (en) * | 2005-03-22 | 2009-07-07 | Industrial Technology Research Institute | High performance flexible display with improved mechanical properties having electrically modulated material mixed with binder material in a ratio between 6:1 and 0.5:1 |
| US7507449B2 (en) | 2006-05-30 | 2009-03-24 | Industrial Technology Research Institute | Displays with low driving voltage and anisotropic particles |
| US7754295B2 (en) | 2006-06-29 | 2010-07-13 | Industrial Technology Research Institute | Single substrate guest-host polymer dispersed liquid crystal displays |
| JP2010256908A (ja) | 2010-05-07 | 2010-11-11 | Fujifilm Corp | 映画用ハロゲン化銀写真感光材料 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE576882A (cg-RX-API-DMAC10.html) * | 1958-03-19 | |||
| DE1105272B (de) * | 1958-12-06 | 1961-04-20 | Agfa Ag | Verfahren zur Herstellung photographischer Schichten mit Hilfe von Proteinderivaten |
| US3132945A (en) * | 1960-07-13 | 1964-05-12 | Polaroid Corp | Silver halide emulsions containing vinyl sulfone-gelatin derivatives |
-
1966
- 1966-09-05 BE BE686440D patent/BE686440A/xx unknown
- 1966-09-20 GB GB41851/66A patent/GB1158263A/en not_active Expired
-
1967
- 1967-11-13 US US682641A patent/US3490911A/en not_active Expired - Lifetime
-
1968
- 1968-11-08 GB GB1256709D patent/GB1256709A/en not_active Expired
- 1968-11-12 BR BR203921/68A patent/BR6803921D0/pt unknown
- 1968-11-13 DE DE19681808684 patent/DE1808684A1/de active Pending
- 1968-11-13 FR FR1591428D patent/FR1591428A/fr not_active Expired
- 1968-11-13 BE BE723807D patent/BE723807A/xx unknown
-
1969
- 1969-08-22 US US862144A patent/US3642908A/en not_active Expired - Lifetime
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1220787B (de) * | 1962-12-06 | 1966-07-07 | Ford Motor Co | Seitlich am Schlepper anzubringende Schaufel-Ladeeinrichtung |
| JPS519609B1 (cg-RX-API-DMAC10.html) * | 1971-05-18 | 1976-03-29 | ||
| DE2447587A1 (de) * | 1973-10-08 | 1975-04-17 | Konishiroku Photo Ind | Verfahren zum haerten von gelatine |
Also Published As
| Publication number | Publication date |
|---|---|
| DE1547733B2 (de) | 1973-01-25 |
| BE686440A (cg-RX-API-DMAC10.html) | 1967-02-15 |
| GB1158263A (en) | 1969-07-16 |
| US3490911A (en) | 1970-01-20 |
| GB1256709A (cg-RX-API-DMAC10.html) | 1971-12-15 |
| BR6803921D0 (pt) | 1973-01-18 |
| FR1591428A (cg-RX-API-DMAC10.html) | 1970-04-27 |
| DE1547733A1 (de) | 1970-01-02 |
| BE723807A (cg-RX-API-DMAC10.html) | 1969-04-16 |
| US3642908A (en) | 1972-02-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1808684A1 (de) | Verwendung von Verbindungen mit Vinylsulfonylalkylgruppen als Haertungsmittel zum Haerten kolloidaler Bindemittel photographischer Emulsionen | |
| DE1447632C3 (de) | Photographisches Aufzeichnungsmaterial | |
| DE1547675A1 (de) | Farbphotographisches Material fuer das Silberfarbbleichverfahren | |
| DE1472818A1 (de) | Photographisches Material | |
| DE1808685A1 (de) | Verwendung von Vinylsulfonylalkylverbindungen als Haertungsmittel zum Haerten kolloidaler Bindemittel photographischer Emulsionen | |
| DE2042359A1 (de) | Lichtempfindliche, photographi sehe Halogensilberemulsion | |
| DE2431225A1 (de) | Verfahren zur herstellung von photographischen silberhalogenidemulsionen | |
| DE1170778B (de) | Silberhalogenid-Auskopieremulsion mit einem Gehalt an einem Schwermetallsalz | |
| DE2344563A1 (de) | Photographische silberhalogenidemulsion, photographisches silberhalogenidmaterial und verfahren zur chemischen reifung einer photographischen silberhalogenidemulsion | |
| DE2360878A1 (de) | Entwicklung von photographischen silberhalogenidmaterialien | |
| DE3125743A1 (de) | "photographische silberhalogenidemulsionen" | |
| DE2804719A1 (de) | Lichtempfindliches silberhalogenidfarbphotographisches material | |
| DE2429557C2 (de) | Verfahren zur Reproduktion von Halbtonbildern | |
| DE2515771A1 (de) | Verfahren zur erzeugung eines farbphotographischen bildes | |
| DE2335279A1 (de) | Farbphotographische materialien | |
| DE2315758A1 (de) | Lichtempfindliches photographisches silberhalogenidmaterial | |
| DE1945408A1 (de) | Verfahren zur Herstellung photographischer Bilder | |
| DE1285872B (de) | Chemisch sensibilisiertes photographisches Aufzeichnungsmaterial | |
| DE1811542A1 (de) | Photographisches Aufzeichnungsmaterial | |
| DE2112728C3 (de) | Farbphotographisches Aufzeichnungsmaterial | |
| DE1547811C3 (de) | Photographisches Aufzeichnungsmaterial | |
| DE1912332A1 (de) | Photographisches Aufzeichnungsmaterial | |
| DE3545925A1 (de) | Lichtempfindliches photographisches silberhalogenidaufzeichnungsmaterial | |
| DE2164249A1 (de) | Farbent wicklungsverfahren | |
| DE2224367C2 (de) | Spektral sensibilisiertes photographisches Aufzeichnungsmaterial |