DE1793559C3 - Verfahren zur Herstellung von Furan 3 carbonsaureestern Ausscheidung aus 1543804 - Google Patents
Verfahren zur Herstellung von Furan 3 carbonsaureestern Ausscheidung aus 1543804Info
- Publication number
- DE1793559C3 DE1793559C3 DE1793559A DE1793559A DE1793559C3 DE 1793559 C3 DE1793559 C3 DE 1793559C3 DE 1793559 A DE1793559 A DE 1793559A DE 1793559 A DE1793559 A DE 1793559A DE 1793559 C3 DE1793559 C3 DE 1793559C3
- Authority
- DE
- Germany
- Prior art keywords
- acid
- furan
- room temperature
- carboxylic acid
- sodium salt
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims 7
- IHCCAYCGZOLTEU-UHFFFAOYSA-N 3-furoic acid Chemical class OC(=O)C=1C=COC=1 IHCCAYCGZOLTEU-UHFFFAOYSA-N 0.000 title claims 5
- 238000004519 manufacturing process Methods 0.000 title claims 3
- 230000029142 excretion Effects 0.000 title 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims 8
- 239000002253 acid Substances 0.000 claims 8
- 159000000000 sodium salts Chemical class 0.000 claims 5
- 239000000243 solution Substances 0.000 claims 5
- JOOXCMJARBKPKM-UHFFFAOYSA-N 4-oxopentanoic acid Chemical compound CC(=O)CCC(O)=O JOOXCMJARBKPKM-UHFFFAOYSA-N 0.000 claims 4
- 150000007513 acids Chemical class 0.000 claims 4
- 125000000217 alkyl group Chemical group 0.000 claims 4
- -1 enol compound Chemical class 0.000 claims 4
- 125000004494 ethyl ester group Chemical group 0.000 claims 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims 3
- 239000002904 solvent Substances 0.000 claims 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims 2
- 229910052783 alkali metal Inorganic materials 0.000 claims 2
- 150000001340 alkali metals Chemical group 0.000 claims 2
- 239000011260 aqueous acid Substances 0.000 claims 2
- 238000009835 boiling Methods 0.000 claims 2
- HYBBIBNJHNGZAN-UHFFFAOYSA-N furfural Chemical compound O=CC1=CC=CO1 HYBBIBNJHNGZAN-UHFFFAOYSA-N 0.000 claims 2
- 229910052500 inorganic mineral Inorganic materials 0.000 claims 2
- 229940040102 levulinic acid Drugs 0.000 claims 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims 2
- 239000011707 mineral Substances 0.000 claims 2
- 235000010755 mineral Nutrition 0.000 claims 2
- 239000007858 starting material Substances 0.000 claims 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims 1
- 238000003512 Claisen condensation reaction Methods 0.000 claims 1
- DKMROQRQHGEIOW-UHFFFAOYSA-N Diethyl succinate Chemical compound CCOC(=O)CCC(=O)OCC DKMROQRQHGEIOW-UHFFFAOYSA-N 0.000 claims 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 claims 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 claims 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical class [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims 1
- 230000002378 acidificating effect Effects 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 claims 1
- 239000006185 dispersion Substances 0.000 claims 1
- 238000004821 distillation Methods 0.000 claims 1
- 150000002085 enols Chemical class 0.000 claims 1
- 239000012259 ether extract Substances 0.000 claims 1
- XEMLEMIOCGLVMR-UHFFFAOYSA-N ethyl 5-benzylfuran-3-carboxylate Chemical compound CCOC(=O)C1=COC(CC=2C=CC=CC=2)=C1 XEMLEMIOCGLVMR-UHFFFAOYSA-N 0.000 claims 1
- 235000019253 formic acid Nutrition 0.000 claims 1
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 claims 1
- 150000002240 furans Chemical class 0.000 claims 1
- 150000002402 hexoses Chemical class 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 claims 1
- 239000002917 insecticide Substances 0.000 claims 1
- 125000000468 ketone group Chemical group 0.000 claims 1
- 239000000203 mixture Substances 0.000 claims 1
- 229910052760 oxygen Inorganic materials 0.000 claims 1
- 239000001301 oxygen Substances 0.000 claims 1
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical compound N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 claims 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical class [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 claims 1
- 230000001376 precipitating effect Effects 0.000 claims 1
- 238000002360 preparation method Methods 0.000 claims 1
- 238000003385 ring cleavage reaction Methods 0.000 claims 1
- 238000007142 ring opening reaction Methods 0.000 claims 1
- 229920006395 saturated elastomer Polymers 0.000 claims 1
- 239000012312 sodium hydride Substances 0.000 claims 1
- 229910000104 sodium hydride Inorganic materials 0.000 claims 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 claims 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/40—Radicals substituted by oxygen atoms
- C07D307/42—Singly bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/76—Unsaturated compounds containing keto groups
- C07C59/84—Unsaturated compounds containing keto groups containing six membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/14—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D317/30—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Furan Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Catching Or Destruction (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB52406/65A GB1168797A (en) | 1965-12-09 | 1965-12-09 | Cyclopropane Carboxylic Acid Derivatives and their use as Insecticides |
| GB3778866A GB1168798A (en) | 1965-12-09 | 1965-12-09 | Furan Derivatives and a Process for Their Preparation. |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1793559A1 DE1793559A1 (de) | 1972-03-09 |
| DE1793559B2 DE1793559B2 (de) | 1973-04-12 |
| DE1793559C3 true DE1793559C3 (de) | 1973-11-15 |
Family
ID=26263575
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1793559A Expired DE1793559C3 (de) | 1965-12-09 | 1966-12-08 | Verfahren zur Herstellung von Furan 3 carbonsaureestern Ausscheidung aus 1543804 |
| DE19661543804 Pending DE1543804A1 (de) | 1965-12-09 | 1966-12-08 | 3-Furylmethylalkohole |
| DE19661543805 Granted DE1543805B1 (de) | 1965-12-09 | 1966-12-08 | Substituierte 3-Furylmethylester und Verfahren zu deren Herstellung sowie deren Verwendung als Insekticide |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19661543804 Pending DE1543804A1 (de) | 1965-12-09 | 1966-12-08 | 3-Furylmethylalkohole |
| DE19661543805 Granted DE1543805B1 (de) | 1965-12-09 | 1966-12-08 | Substituierte 3-Furylmethylester und Verfahren zu deren Herstellung sowie deren Verwendung als Insekticide |
Country Status (15)
| Country | Link |
|---|---|
| US (3) | US3465007A (show.php) |
| AT (3) | AT285590B (show.php) |
| BE (1) | BE690984A (show.php) |
| CA (1) | CA1030152A (show.php) |
| CH (3) | CH524593A (show.php) |
| DE (3) | DE1793559C3 (show.php) |
| DK (3) | DK128607B (show.php) |
| ES (1) | ES334365A1 (show.php) |
| FR (1) | FR1503260A (show.php) |
| GB (1) | GB1168797A (show.php) |
| IL (2) | IL30842A (show.php) |
| NL (3) | NL6617119A (show.php) |
| NO (1) | NO118155B (show.php) |
| OA (1) | OA02187A (show.php) |
| SE (3) | SE353719B (show.php) |
Families Citing this family (43)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3968238A (en) * | 1966-06-28 | 1976-07-06 | Dainippon Jochugiku Kabushiki Kaisha | 5-Acetyl furfurylester of chrysanthemumic acid |
| US3932470A (en) * | 1966-06-28 | 1976-01-13 | Dainippon Jochugiku Kabushiki Kaisha | Substituted furfurylesters of chrysantheumumic acid |
| US3982013A (en) * | 1966-06-28 | 1976-09-21 | Dainippon Jochugiku Kabushiki Kaisha | 5-Phenylvinylfurfurylester of chrysanthemumic acid |
| US3992526A (en) * | 1966-06-28 | 1976-11-16 | Dainippon Jochugiku Kabushiki Kaisha | 5-Ethoxymethyl furfuryl ester of chrysanthemumic acid and its use as an insecticide |
| US3832467A (en) * | 1967-08-11 | 1974-08-27 | Sumitomo Chemical Co | Insecticidal chrysanthemate compositions and their method of use |
| US3669989A (en) * | 1968-06-13 | 1972-06-13 | Sumitomo Chemical Co | Cyclopropanecarboxylic acid esters |
| DE2005489C3 (de) * | 1969-02-07 | 1982-04-15 | Roussel-Uclaf, 75007 Paris | cis-3,3-Dimethyl-2S-(2'-R↓1↓-2'-R↓2↓-vinyl)-cyclopropan-1R-carbonsäure-5"-benzyl-3"-furylmethylester, Verfahren zu deren Herstellung und diese Verbindungen enthaltende insektizide Mittel |
| US3857858A (en) * | 1969-04-08 | 1974-12-31 | Sumitomo Chemical Co | Cyclopropane carboxylic acid esters |
| FR2045177A5 (show.php) * | 1969-06-13 | 1971-02-26 | Roussel Uclaf | |
| FR2077677B1 (show.php) * | 1970-02-04 | 1973-05-25 | Roussel Uclaf | |
| US3835220A (en) * | 1970-03-19 | 1974-09-10 | Sumitomo Chemical Co | Insecticidal composition comprising vinylcyclopropanecarboxylates |
| US3716560A (en) * | 1970-03-26 | 1973-02-13 | Sumitomo Chemical Co | 4,5-tetramethylene furfuryl and 4,5-tetramethylene-3-furylmethyl chrysanthemates |
| JPS4821487B1 (show.php) * | 1970-08-04 | 1973-06-29 | ||
| US3873716A (en) * | 1971-03-01 | 1975-03-25 | Procter & Gamble | Insecticidal esters of chrysanthemic acid and alcohols related to 3-hydroxymethylbenzofuran |
| US3755368A (en) * | 1971-03-01 | 1973-08-28 | Penick S & Co | Formylation of carboxylic compounds with carbon monoxide |
| US4622337A (en) * | 1972-05-25 | 1986-11-11 | National Research Development Corporation | 2,2-dimethyl-3-(2-halovinyl)cyclopropane carboxlic acid ester pesticides |
| GB1410080A (en) * | 1972-12-21 | 1975-10-15 | Nat Res Dev | Oxime derivatives of 2,2-dimethyl-3-formyl cyclopropane carboxylic acid and their use as insecticides |
| US3994882A (en) * | 1974-07-22 | 1976-11-30 | Kabushiki Kaisha Ueno Seiyaku Oyo Kenkyujo | Nitrofuran derivatives, process for the preparation thereof and compositions containing same as active ingredient |
| FI53971C (fi) * | 1974-08-15 | 1978-09-11 | Kemira Oy | Foerfarande foer framstaellning av estrar av furfuryalkohol eller dess derivat med laegre alifatiska karbonsyror |
| US4220591A (en) * | 1975-11-26 | 1980-09-02 | Commonwealth Scientific And Industrial Research Organization | Insecticidal esters |
| FR2341307A1 (fr) * | 1976-02-19 | 1977-09-16 | Roussel Uclaf | Pyrethrinoides a titre de medicaments et compositions pharmaceutiques les renfermant |
| LU75478A1 (show.php) | 1976-07-28 | 1978-02-08 | ||
| SE446527B (sv) * | 1976-09-21 | 1986-09-22 | Roussel Uclaf | Nya cyklopropankarboxylsyraestrar med en polyhalogenerad substituent, sett for framstellning derav samt anvendning derav i pesticidkompositioner |
| FR2364884A1 (fr) * | 1976-09-21 | 1978-04-14 | Roussel Uclaf | Nouveaux esters d'acides cyclopropane, carboxyliques comportant un substituant polyhalogene, procedes de preparation et compositions insecticides les renfermant |
| US4234582A (en) * | 1978-05-10 | 1980-11-18 | Chugai Seiyaku Kabushiki Kaisha | Trialkyl isocyanates used as pesticides |
| FR2426673A1 (fr) * | 1978-05-25 | 1979-12-21 | Nat Res Dev | Pesticides du type pyrethrine |
| US4356023A (en) * | 1980-06-30 | 1982-10-26 | Shell Oil Company | Certain herbicidal tetrahydrofurans |
| US4677117A (en) * | 1982-06-28 | 1987-06-30 | Roussel Uclaf | Stabilized pesticidal compositions |
| US4676977A (en) * | 1982-06-28 | 1987-06-30 | Roussel Uclaf | Stabilized pesticidal emulsions |
| US4477679A (en) * | 1983-03-01 | 1984-10-16 | Cpc International Inc. | Production of alkyl-5-substituted-3-furoate compounds |
| DE3546371A1 (de) * | 1985-12-31 | 1987-07-02 | Basf Ag | Pyrethroide, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung von schaedlingen sowie vorprodukte fuer die herstellung der pyrethroide |
| DE10007411A1 (de) * | 2000-02-18 | 2001-08-23 | Bayer Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| AR029677A1 (es) | 2000-06-29 | 2003-07-10 | Bayer Ag | Combinaciones de compuestos activos con propiedades insecticidas y acaricidas |
| DE102004001271A1 (de) | 2004-01-08 | 2005-08-04 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden Eigenschaften |
| EP1938691A3 (en) * | 2004-12-17 | 2009-07-22 | Devgen NV | Nematicidal compositions |
| JP5066843B2 (ja) * | 2006-06-15 | 2012-11-07 | 住友化学株式会社 | エステル化合物及びその有害生物防除用途 |
| DE102006046688B3 (de) * | 2006-09-29 | 2008-01-24 | Siemens Ag | Kälteanlage mit einem warmen und einem kalten Verbindungselement und einem mit den Verbindungselementen verbundenen Wärmerohr |
| DE102007045953B4 (de) | 2007-09-26 | 2018-07-05 | Bayer Intellectual Property Gmbh | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| EP2127522A1 (de) | 2008-05-29 | 2009-12-02 | Bayer CropScience AG | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| JP2012521371A (ja) | 2009-03-25 | 2012-09-13 | バイエル・クロップサイエンス・アーゲー | 殺虫特性および殺ダニ特性を有する活性化合物の組合せ |
| EP2382865A1 (de) | 2010-04-28 | 2011-11-02 | Bayer CropScience AG | Synergistische Wirkstoffkombinationen |
| CN103058897A (zh) * | 2012-12-27 | 2013-04-24 | 苏州大学 | 一种手性β-羟基磺酰胺的制备方法 |
| DE102014107739B4 (de) | 2014-06-02 | 2023-12-07 | Jacques Tchouangueu | Moskitonetz mit Insektenfalle |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2470349A (en) * | 1945-05-29 | 1949-05-17 | California Spray Chemical Corp | Cyclopropyl furyl propenone |
| US2891889A (en) * | 1953-11-20 | 1959-06-23 | Union Carbide Corp | Insecticidal compositions containing cyclethrin |
| US3101296A (en) * | 1959-11-09 | 1963-08-20 | Harvel Res Corp | Synergistic insecticidal composition |
| NL296103A (show.php) * | 1962-08-06 | |||
| BE660565A (show.php) * | 1963-03-18 |
-
1965
- 1965-12-09 GB GB52406/65A patent/GB1168797A/en not_active Expired
-
1966
- 1966-11-21 IL IL30842A patent/IL30842A/xx unknown
- 1966-11-21 IL IL26910A patent/IL26910A/en unknown
- 1966-11-23 DK DK604566AA patent/DK128607B/da not_active IP Right Cessation
- 1966-11-28 SE SE16271/68A patent/SE353719B/xx unknown
- 1966-11-28 SE SE16259/66A patent/SE325582B/xx unknown
- 1966-11-28 SE SE16272/68A patent/SE353906B/xx unknown
- 1966-12-02 CA CA976,970A patent/CA1030152A/en not_active Expired
- 1966-12-05 FR FR86170A patent/FR1503260A/fr not_active Expired
- 1966-12-05 US US598923A patent/US3465007A/en not_active Expired - Lifetime
- 1966-12-05 US US598901A patent/US3466304A/en not_active Expired - Lifetime
- 1966-12-06 NL NL6617119A patent/NL6617119A/xx unknown
- 1966-12-06 NO NO165885A patent/NO118155B/no unknown
- 1966-12-08 DE DE1793559A patent/DE1793559C3/de not_active Expired
- 1966-12-08 CH CH1120171A patent/CH524593A/fr not_active IP Right Cessation
- 1966-12-08 CH CH1748866A patent/CH513587A/fr not_active IP Right Cessation
- 1966-12-08 DE DE19661543804 patent/DE1543804A1/de active Pending
- 1966-12-08 CH CH1654768A patent/CH507931A/fr not_active IP Right Cessation
- 1966-12-08 DE DE19661543805 patent/DE1543805B1/de active Granted
- 1966-12-09 BE BE690984D patent/BE690984A/xx not_active IP Right Cessation
- 1966-12-09 ES ES334365A patent/ES334365A1/es not_active Expired
- 1966-12-09 AT AT10130/68A patent/AT285590B/de not_active IP Right Cessation
- 1966-12-09 OA OA52688A patent/OA02187A/xx unknown
- 1966-12-09 AT AT1138366A patent/AT275238B/de active
- 1966-12-09 AT AT05936/68A patent/AT279599B/de not_active IP Right Cessation
-
1968
- 1968-10-16 DK DK497368AA patent/DK136035B/da not_active IP Right Cessation
- 1968-10-16 DK DK497468A patent/DK136036C/da not_active IP Right Cessation
-
1969
- 1969-03-14 US US807406A patent/US3542928A/en not_active Expired - Lifetime
- 1969-11-20 NL NL6917481A patent/NL6917481A/xx unknown
- 1969-11-20 NL NL6917482A patent/NL6917482A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL26910A (en) | 1971-06-23 |
| DK136035C (show.php) | 1978-01-09 |
| SE353719B (show.php) | 1973-02-12 |
| OA02187A (fr) | 1970-05-05 |
| DE1543805C2 (show.php) | 1973-01-04 |
| ES334365A1 (es) | 1967-10-16 |
| DK128607B (da) | 1974-06-04 |
| AT285590B (de) | 1970-11-10 |
| NL6917482A (show.php) | 1970-01-26 |
| SE353906B (show.php) | 1973-02-19 |
| DK136036C (da) | 1977-12-27 |
| CA1030152A (en) | 1978-04-25 |
| IL30842A (en) | 1971-11-29 |
| FR1503260A (fr) | 1967-11-24 |
| AT275238B (de) | 1969-10-10 |
| SE325582B (show.php) | 1970-07-06 |
| US3465007A (en) | 1969-09-02 |
| AT279599B (de) | 1970-03-10 |
| CH524593A (fr) | 1972-06-30 |
| DK136036B (da) | 1977-08-01 |
| GB1168797A (en) | 1969-10-29 |
| DE1793559A1 (de) | 1972-03-09 |
| DE1543804A1 (de) | 1970-01-02 |
| DE1543805B1 (de) | 1972-05-31 |
| NO118155B (show.php) | 1969-11-17 |
| NL6917481A (show.php) | 1970-01-26 |
| BE690984A (show.php) | 1967-05-16 |
| NL6617119A (show.php) | 1967-06-12 |
| CH507931A (fr) | 1971-05-31 |
| DE1793559B2 (de) | 1973-04-12 |
| DK136035B (da) | 1977-08-01 |
| CH513587A (fr) | 1971-10-15 |
| US3542928A (en) | 1970-11-24 |
| US3466304A (en) | 1969-09-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1793559C3 (de) | Verfahren zur Herstellung von Furan 3 carbonsaureestern Ausscheidung aus 1543804 | |
| DE2008878C3 (show.php) | ||
| DE2248337A1 (de) | Verfahren zur herstellung von 3,4,5trimethoxybenzaldehyd | |
| DE1149353B (de) | Verfahren zur Herstellung von 6-[2', 6', 6'-Trimethylcyclohexen-(1')-yl]-4-methylhexadien-(3, 5)-in-(1) (íÀC-KohlenwasserstoffíÂ) | |
| DE1227914B (de) | Verfahren zur Herstellung von 3-(1, 2-Dithia-cyclopentyl)-5-pentansaeure | |
| DE2108649C3 (de) | 2-Methyl-2-hepten-6-on-l-al und seine Acetale | |
| DE1055007B (de) | Verfahren zur Herstellung von 3-Aminothiophen-2-carbonsaeureestern und den entsprechenden freien Carbonsaeuren | |
| DE2356702A1 (de) | Verfahren zur herstellung von transchrysanthemummonocarbonsaeure | |
| DE2150146C3 (de) | Verfahren zur Herstellung von Flavon-7-oxyessigsäureäthylester | |
| DE907171C (de) | Verfahren zur Abtrennung sauerstoffhaltiger Verbindungen aus Produkten der katalytrischen Kohlenoxydhydrierung | |
| DE1249263B (de) | Verfah ren zur Herstellung vor substituierten 1,3 Dioxocyclopentanderivaten | |
| DE2558399C3 (de) | Verfahren zur Herstellung von 3,6-Dichlorpicolinsäure | |
| DE2918900A1 (de) | Verfahren zur herstellung von 1,5- dimethyl-bicyclo- eckige klammer auf 3,2,1 eckige klammer zu octanol-8 und dessen ester | |
| EP0119546B1 (de) | Neues Verfahren zur Herstellung von Verbindungen der 4-Oxodamascon-Reihe sowie neue Riechstoffe aus dieser Verbindungsklasse | |
| EP0573999A1 (de) | Verfahren zur Herstellung von Tetronsäurealkylestern | |
| DE2108926C3 (de) | Verfahren zur Herstellung von 3-Acyl-4-hydroxy-buten-(2)-saurelactonen | |
| DE809806C (de) | Verfahren zur Herstellung von ungesaettigten Dicarbonylverbindungen | |
| DE854503C (de) | Verfahren zur Herstellung von hoehermolekularen Umwandlungs-produkten von Allylverbindungen | |
| DE1127888B (de) | Verfahren zur Herstellung von Vinylestern hoeherer Carbonsaeuren | |
| DE806458C (de) | Verfahren zur Herstellung von Cumarinen | |
| DE870698C (de) | Verfahren zur Herstellung von Hydrochinonen | |
| AT211817B (de) | Verfahren zur Herstellung von β-Lactonen | |
| DE2233489C3 (de) | Verfahren zur Herstellung von Octachlordipropyläther | |
| DE1134985B (de) | Verfahren zur Herstellung von Vorprodukten des OEstrons | |
| DE867851C (de) | Verfahren zur Herstellung von Trinitroalkoholen und deren Derivaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 |