DE1782040A1 - Trockenhaube - Google Patents
TrockenhaubeInfo
- Publication number
- DE1782040A1 DE1782040A1 DE19681782040 DE1782040A DE1782040A1 DE 1782040 A1 DE1782040 A1 DE 1782040A1 DE 19681782040 DE19681782040 DE 19681782040 DE 1782040 A DE1782040 A DE 1782040A DE 1782040 A1 DE1782040 A1 DE 1782040A1
- Authority
- DE
- Germany
- Prior art keywords
- hood
- support arm
- hood according
- dryer
- drying
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000010438 heat treatment Methods 0.000 claims description 2
- 239000000463 material Substances 0.000 claims description 2
- 238000001035 drying Methods 0.000 claims 4
- TWVKGYNQQAUNRN-ACZMJKKPSA-N Ile-Ser Chemical compound CC[C@H](C)[C@H]([NH3+])C(=O)N[C@@H](CO)C([O-])=O TWVKGYNQQAUNRN-ACZMJKKPSA-N 0.000 description 1
- 239000011449 brick Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 244000144980 herd Species 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000009423 ventilation Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A45—HAND OR TRAVELLING ARTICLES
- A45D—HAIRDRESSING OR SHAVING EQUIPMENT; EQUIPMENT FOR COSMETICS OR COSMETIC TREATMENTS, e.g. FOR MANICURING OR PEDICURING
- A45D20/00—Hair drying devices; Accessories therefor
- A45D20/22—Helmets with hot air supply or ventilating means, e.g. electrically heated air current
Landscapes
- Cleaning And Drying Hair (AREA)
- Drying Of Solid Materials (AREA)
Priority Applications (14)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19681782040 DE1782040A1 (de) | 1968-07-11 | 1968-07-11 | Trockenhaube |
| AT622769A AT308310B (de) | 1968-07-11 | 1969-06-30 | Zusammenlegbare Heißluft-Haartrockenhaube |
| NO2772/69A NO121171B (enExample) | 1968-07-11 | 1969-07-02 | |
| DK366369AA DK128876B (da) | 1968-07-11 | 1969-07-07 | Sammenfoldelig tørrehjælm. |
| US839932A US3650041A (en) | 1968-07-11 | 1969-07-08 | Hair dryer |
| SE9759/69A SE343201B (enExample) | 1968-07-11 | 1969-07-09 | |
| BE735888D BE735888A (enExample) | 1968-07-11 | 1969-07-09 | |
| NL6910567A NL6910567A (enExample) | 1968-07-11 | 1969-07-09 | |
| GB34499/69A GB1280228A (en) | 1968-07-11 | 1969-07-09 | Hair dryer |
| CH1057069A CH494554A (de) | 1968-07-11 | 1969-07-10 | Elektrische Haartrockenhaube |
| YU1781/69A YU32265B (en) | 1968-07-11 | 1969-07-10 | Elektricna sklopiva kapa za susenje kose |
| FR6923564A FR2012760A1 (enExample) | 1968-07-11 | 1969-07-10 | |
| JP44054582A JPS493791B1 (enExample) | 1968-07-11 | 1969-07-11 | |
| ES369423A ES369423A1 (es) | 1968-07-11 | 1969-07-11 | Casco secador con cuerpo de casco replegable. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19681782040 DE1782040A1 (de) | 1968-07-11 | 1968-07-11 | Trockenhaube |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1782040A1 true DE1782040A1 (de) | 1971-07-01 |
Family
ID=5704839
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681782040 Pending DE1782040A1 (de) | 1968-07-11 | 1968-07-11 | Trockenhaube |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3650041A (enExample) |
| JP (1) | JPS493791B1 (enExample) |
| AT (1) | AT308310B (enExample) |
| BE (1) | BE735888A (enExample) |
| CH (1) | CH494554A (enExample) |
| DE (1) | DE1782040A1 (enExample) |
| DK (1) | DK128876B (enExample) |
| ES (1) | ES369423A1 (enExample) |
| FR (1) | FR2012760A1 (enExample) |
| GB (1) | GB1280228A (enExample) |
| NL (1) | NL6910567A (enExample) |
| NO (1) | NO121171B (enExample) |
| SE (1) | SE343201B (enExample) |
| YU (1) | YU32265B (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5426142Y2 (enExample) * | 1974-06-20 | 1979-08-30 | ||
| JPS55173Y2 (enExample) * | 1975-02-20 | 1980-01-07 | ||
| US4361966A (en) * | 1980-12-29 | 1982-12-07 | Downey John H | Portable hair dryer |
| USD314065S (en) | 1988-09-17 | 1991-01-22 | Takara Belmont Kabushiki Kaisha | Hair dryer |
| USD527490S1 (en) * | 2003-04-11 | 2006-08-29 | Wella Aktiengesellschaft | Hair dryer |
| USD622445S1 (en) | 2006-12-05 | 2010-08-24 | Wella Aktiengesellschaft | Hair drying hood |
| USD601750S1 (en) | 2007-10-19 | 2009-10-06 | Wella Aktiengesellschaft | Hair dryer |
| USD628343S1 (en) | 2008-04-17 | 2010-11-30 | Wella Aktiengesellschaft | Infrared radiation dryer |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR587244A (fr) * | 1924-08-13 | 1925-04-14 | Appareil séchoir de tête | |
| US2425056A (en) * | 1944-08-15 | 1947-08-05 | Younger Alexander Reginald | Electric hair dryer |
| US2662303A (en) * | 1952-02-11 | 1953-12-15 | Myers Carmel | Hair drier |
| CH369553A (de) * | 1958-07-04 | 1963-05-31 | Electrolux Ab | Haar-Trockenhaube |
| US3418726A (en) * | 1966-12-19 | 1968-12-31 | Westinghouse Electric Corp | Hair dryer |
-
1968
- 1968-07-11 DE DE19681782040 patent/DE1782040A1/de active Pending
-
1969
- 1969-06-30 AT AT622769A patent/AT308310B/de not_active IP Right Cessation
- 1969-07-02 NO NO2772/69A patent/NO121171B/no unknown
- 1969-07-07 DK DK366369AA patent/DK128876B/da unknown
- 1969-07-08 US US839932A patent/US3650041A/en not_active Expired - Lifetime
- 1969-07-09 GB GB34499/69A patent/GB1280228A/en not_active Expired
- 1969-07-09 SE SE9759/69A patent/SE343201B/xx unknown
- 1969-07-09 NL NL6910567A patent/NL6910567A/xx unknown
- 1969-07-09 BE BE735888D patent/BE735888A/xx unknown
- 1969-07-10 FR FR6923564A patent/FR2012760A1/fr not_active Withdrawn
- 1969-07-10 CH CH1057069A patent/CH494554A/de not_active IP Right Cessation
- 1969-07-10 YU YU1781/69A patent/YU32265B/xx unknown
- 1969-07-11 ES ES369423A patent/ES369423A1/es not_active Expired
- 1969-07-11 JP JP44054582A patent/JPS493791B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| SE343201B (enExample) | 1972-03-06 |
| ES369423A1 (es) | 1971-05-16 |
| CH494554A (de) | 1970-08-15 |
| NL6910567A (enExample) | 1970-01-13 |
| US3650041A (en) | 1972-03-21 |
| GB1280228A (en) | 1972-07-05 |
| AT308310B (de) | 1973-06-25 |
| BE735888A (enExample) | 1969-12-16 |
| YU178169A (en) | 1973-12-31 |
| FR2012760A1 (enExample) | 1970-03-20 |
| DK128876B (da) | 1974-07-22 |
| NO121171B (enExample) | 1971-01-25 |
| JPS493791B1 (enExample) | 1974-01-28 |
| YU32265B (en) | 1974-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE4100858C2 (enExample) | ||
| DE1901436A1 (de) | Tragbares Haartrockengeraet | |
| DE1454546A1 (de) | Anordnung einer elektrischen Deckenleuchte und der Fassung einer Belueftungsoeffnung | |
| DE2028546B2 (de) | Wirbelbrenner | |
| DE2203196A1 (de) | Tischstativ | |
| DE2722626C2 (de) | Abzugssystem für Verbrennungsabgase aus gasdichten Apparaten | |
| DE2707779C3 (de) | Belüftungsrohr sowie Anordnung desselben in einem Wohnwagen | |
| DE2903401C2 (de) | Aufrührorgan in einem mit Farbe oder Lack gefüllten zylindrischen Behälter | |
| AT261854B (de) | Brennertopf für mit Öl beheizte Geräte | |
| DE1557340C3 (de) | Haartrockner | |
| DE4323080C1 (de) | Belüftungsvorrichtung | |
| DE862051C (de) | Raumheizvorrichtung | |
| DE926877C (de) | Geraet zum Erzeugen von Warmluft oder Dampf fuer Warmluft- bzw. Dampfbaeder | |
| DE451990C (de) | Lufterhitzer mit umlaufendem, von aussen beheiztem Waermeaustauschmantel | |
| CH535548A (de) | Automatischer Aschenbecher | |
| DE10035382C1 (de) | Vorrichtung zur Höhenverstellung von Präsentierständern | |
| CH526070A (de) | Zusammenklappbarer Ständer | |
| DE572383C (de) | An einen Heizkoerper angeschlossene Vorrichtung zur Lufterneuerung fuer Raeume | |
| DE2015908C3 (de) | Strahlungsbrenner | |
| DE2302362C3 (de) | Zusammenklappbarer Ständer | |
| AT228977B (de) | Verdampfungsbrenner für flüssigen Brennstoff | |
| AT215937B (de) | Trockenzentrifuge, insbesondere für Wäsche | |
| DE1604169B1 (de) | Luftauslass fuer eine Lueftungsanlage | |
| DE3516829A1 (de) | Luftbefeuchter nach dem verdunstungsprinzip | |
| DE7140980U (de) | Haartrockenhaube |