DE1720663C3 - Verfahren zur Herstellung von Kunststoffen - Google Patents
Verfahren zur Herstellung von KunststoffenInfo
- Publication number
- DE1720663C3 DE1720663C3 DE1720663A DE1720663A DE1720663C3 DE 1720663 C3 DE1720663 C3 DE 1720663C3 DE 1720663 A DE1720663 A DE 1720663A DE 1720663 A DE1720663 A DE 1720663A DE 1720663 C3 DE1720663 C3 DE 1720663C3
- Authority
- DE
- Germany
- Prior art keywords
- aromatic
- epoxy
- weight
- compounds
- parts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920003023 plastic Polymers 0.000 title claims description 10
- 239000004033 plastic Substances 0.000 title claims description 9
- 238000004519 manufacturing process Methods 0.000 title claims description 4
- 238000000034 method Methods 0.000 title description 7
- 150000001875 compounds Chemical class 0.000 claims description 27
- 239000004593 Epoxy Substances 0.000 claims description 22
- -1 aromatic cyanic acid esters Chemical class 0.000 claims description 20
- 229920000647 polyepoxide Polymers 0.000 claims description 9
- 125000003118 aryl group Chemical group 0.000 claims description 7
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 claims description 7
- 125000003700 epoxy group Chemical group 0.000 claims description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 12
- 125000004432 carbon atom Chemical group C* 0.000 description 11
- XLJMAIOERFSOGZ-UHFFFAOYSA-N cyanic acid Chemical class OC#N XLJMAIOERFSOGZ-UHFFFAOYSA-N 0.000 description 10
- 150000002148 esters Chemical class 0.000 description 8
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 7
- 150000002989 phenols Chemical class 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 238000006735 epoxidation reaction Methods 0.000 description 6
- 239000004744 fabric Substances 0.000 description 6
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- 241000428199 Mustelinae Species 0.000 description 4
- 239000004305 biphenyl Substances 0.000 description 4
- 238000000576 coating method Methods 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- JMANVNJQNLATNU-UHFFFAOYSA-N glycolonitrile Natural products N#CC#N JMANVNJQNLATNU-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 238000000465 moulding Methods 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- HEJGXMCFSSDPOA-UHFFFAOYSA-N [4-(4-cyanatophenyl)phenyl] cyanate Chemical group C1=CC(OC#N)=CC=C1C1=CC=C(OC#N)C=C1 HEJGXMCFSSDPOA-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 235000010290 biphenyl Nutrition 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000004643 cyanate ester Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- 229920003986 novolac Polymers 0.000 description 3
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 3
- GUGZCSAPOLLKNG-UHFFFAOYSA-N (4-cyanatophenyl) cyanate Chemical compound N#COC1=CC=C(OC#N)C=C1 GUGZCSAPOLLKNG-UHFFFAOYSA-N 0.000 description 2
- XLLIQLLCWZCATF-UHFFFAOYSA-N 2-methoxyethyl acetate Chemical compound COCCOC(C)=O XLLIQLLCWZCATF-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- 229920002396 Polyurea Polymers 0.000 description 2
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 238000004026 adhesive bonding Methods 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 2
- 150000004982 aromatic amines Chemical class 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 150000001913 cyanates Chemical class 0.000 description 2
- 125000005442 diisocyanate group Chemical group 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N dimethylmethane Natural products CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 239000003365 glass fiber Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 239000004922 lacquer Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 238000010137 moulding (plastic) Methods 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 229920000768 polyamine Polymers 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- 229920002635 polyurethane Polymers 0.000 description 2
- 239000004814 polyurethane Substances 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 239000012779 reinforcing material Substances 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- UFKLQICEQCIWNE-UHFFFAOYSA-N (3,5-dicyanatophenyl) cyanate Chemical compound N#COC1=CC(OC#N)=CC(OC#N)=C1 UFKLQICEQCIWNE-UHFFFAOYSA-N 0.000 description 1
- ONMCVKJYUPVOFY-UHFFFAOYSA-N (3-cyanato-2-nitrophenyl) cyanate Chemical compound [O-][N+](=O)C1=C(OC#N)C=CC=C1OC#N ONMCVKJYUPVOFY-UHFFFAOYSA-N 0.000 description 1
- QQZZMAPJAKOSNG-UHFFFAOYSA-N (3-cyanatophenyl) cyanate Chemical compound N#COC1=CC=CC(OC#N)=C1 QQZZMAPJAKOSNG-UHFFFAOYSA-N 0.000 description 1
- MUTGBJKUEZFXGO-OLQVQODUSA-N (3as,7ar)-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione Chemical compound C1CCC[C@@H]2C(=O)OC(=O)[C@@H]21 MUTGBJKUEZFXGO-OLQVQODUSA-N 0.000 description 1
- AXEXEKJAOHFFFE-UHFFFAOYSA-N (4-cyanato-2,3-dicyanophenyl) cyanate Chemical compound N#COC1=CC=C(OC#N)C(C#N)=C1C#N AXEXEKJAOHFFFE-UHFFFAOYSA-N 0.000 description 1
- CRAHKSAIGXIDHY-UHFFFAOYSA-N (4-cyanato-2-methylphenyl) cyanate Chemical compound CC1=CC(OC#N)=CC=C1OC#N CRAHKSAIGXIDHY-UHFFFAOYSA-N 0.000 description 1
- OFIWROJVVHYHLQ-UHFFFAOYSA-N (7-cyanatonaphthalen-2-yl) cyanate Chemical compound C1=CC(OC#N)=CC2=CC(OC#N)=CC=C21 OFIWROJVVHYHLQ-UHFFFAOYSA-N 0.000 description 1
- HECLRDQVFMWTQS-RGOKHQFPSA-N 1755-01-7 Chemical compound C1[C@H]2[C@@H]3CC=C[C@@H]3[C@@H]1C=C2 HECLRDQVFMWTQS-RGOKHQFPSA-N 0.000 description 1
- UIFVCPMLQXKEEU-UHFFFAOYSA-N 2,3-dimethylbenzaldehyde Chemical class CC1=CC=CC(C=O)=C1C UIFVCPMLQXKEEU-UHFFFAOYSA-N 0.000 description 1
- SVONRAPFKPVNKG-UHFFFAOYSA-N 2-ethoxyethyl acetate Chemical compound CCOCCOC(C)=O SVONRAPFKPVNKG-UHFFFAOYSA-N 0.000 description 1
- TZLVUWBGUNVFES-UHFFFAOYSA-N 2-ethyl-5-methylpyrazol-3-amine Chemical compound CCN1N=C(C)C=C1N TZLVUWBGUNVFES-UHFFFAOYSA-N 0.000 description 1
- WDGCBNTXZHJTHJ-UHFFFAOYSA-N 2h-1,3-oxazol-2-id-4-one Chemical group O=C1CO[C-]=N1 WDGCBNTXZHJTHJ-UHFFFAOYSA-N 0.000 description 1
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical compound C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 1
- WFCQTAXSWSWIHS-UHFFFAOYSA-N 4-[bis(4-hydroxyphenyl)methyl]phenol Chemical compound C1=CC(O)=CC=C1C(C=1C=CC(O)=CC=1)C1=CC=C(O)C=C1 WFCQTAXSWSWIHS-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OSEITQKKGSKHRV-UHFFFAOYSA-N C(C1CO1)(=O)O.C(C1CO1)(=O)O.C(C1C(C(=O)O)CCCC1)(=O)O Chemical compound C(C1CO1)(=O)O.C(C1CO1)(=O)O.C(C1C(C(=O)O)CCCC1)(=O)O OSEITQKKGSKHRV-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 238000005698 Diels-Alder reaction Methods 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- KZTYYGOKRVBIMI-UHFFFAOYSA-N S-phenyl benzenesulfonothioate Natural products C=1C=CC=CC=1S(=O)(=O)C1=CC=CC=C1 KZTYYGOKRVBIMI-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- YKONYNBAMHVIMF-UHFFFAOYSA-N [2,6-dichloro-4-[2-(3,5-dichloro-4-cyanatophenyl)propan-2-yl]phenyl] cyanate Chemical compound C=1C(Cl)=C(OC#N)C(Cl)=CC=1C(C)(C)C1=CC(Cl)=C(OC#N)C(Cl)=C1 YKONYNBAMHVIMF-UHFFFAOYSA-N 0.000 description 1
- SPPHTMLVUBCBKQ-UHFFFAOYSA-N [4-(4-cyanatobenzoyl)phenyl] cyanate Chemical compound C=1C=C(OC#N)C=CC=1C(=O)C1=CC=C(OC#N)C=C1 SPPHTMLVUBCBKQ-UHFFFAOYSA-N 0.000 description 1
- RZBUVWIMPWGGRK-UHFFFAOYSA-N [4-[1-(4-cyanatophenyl)cyclohexyl]phenyl] cyanate Chemical compound C1=CC(OC#N)=CC=C1C1(C=2C=CC(OC#N)=CC=2)CCCCC1 RZBUVWIMPWGGRK-UHFFFAOYSA-N 0.000 description 1
- AHZMUXQJTGRNHT-UHFFFAOYSA-N [4-[2-(4-cyanatophenyl)propan-2-yl]phenyl] cyanate Chemical compound C=1C=C(OC#N)C=CC=1C(C)(C)C1=CC=C(OC#N)C=C1 AHZMUXQJTGRNHT-UHFFFAOYSA-N 0.000 description 1
- KMRYAEVKCGXOTA-UHFFFAOYSA-N [4-[4-(4-cyanatophenyl)-2-methylpentan-2-yl]phenyl] cyanate Chemical compound C=1C=C(OC#N)C=CC=1C(C)CC(C)(C)C1=CC=C(OC#N)C=C1 KMRYAEVKCGXOTA-UHFFFAOYSA-N 0.000 description 1
- HYAOCWBXRFEHDV-UHFFFAOYSA-N [4-bis(4-cyanatophenoxy)phosphoryloxyphenyl] cyanate Chemical compound C=1C=C(OC#N)C=CC=1OP(OC=1C=CC(OC#N)=CC=1)(=O)OC1=CC=C(OC#N)C=C1 HYAOCWBXRFEHDV-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- XFUOBHWPTSIEOV-UHFFFAOYSA-N bis(oxiran-2-ylmethyl) cyclohexane-1,2-dicarboxylate Chemical compound C1CCCC(C(=O)OCC2OC2)C1C(=O)OCC1CO1 XFUOBHWPTSIEOV-UHFFFAOYSA-N 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000012084 conversion product Substances 0.000 description 1
- QPJDMGCKMHUXFD-UHFFFAOYSA-N cyanogen chloride Chemical compound ClC#N QPJDMGCKMHUXFD-UHFFFAOYSA-N 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- QSAWQNUELGIYBC-UHFFFAOYSA-N cyclohexane-1,2-dicarboxylic acid Chemical compound OC(=O)C1CCCCC1C(O)=O QSAWQNUELGIYBC-UHFFFAOYSA-N 0.000 description 1
- 150000001983 dialkylethers Chemical class 0.000 description 1
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzylether Substances C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical class C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000010292 electrical insulation Methods 0.000 description 1
- 239000012772 electrical insulation material Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 150000002118 epoxides Chemical class 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- LDLDYFCCDKENPD-UHFFFAOYSA-N ethenylcyclohexane Chemical compound C=CC1CCCCC1 LDLDYFCCDKENPD-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 1
- 238000010030 laminating Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 239000012169 petroleum derived wax Substances 0.000 description 1
- 235000019381 petroleum wax Nutrition 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920001195 polyisoprene Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- FZHAPNGMFPVSLP-UHFFFAOYSA-N silanamine Chemical compound [SiH3]N FZHAPNGMFPVSLP-UHFFFAOYSA-N 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 229920006305 unsaturated polyester Polymers 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J20/00—Solid sorbent compositions or filter aid compositions; Sorbents for chromatography; Processes for preparing, regenerating or reactivating thereof
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/18—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing
- C08G59/40—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing characterised by the curing agents used
- C08G59/4007—Curing agents not provided for by the groups C08G59/42 - C08G59/66
- C08G59/4014—Nitrogen containing compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Analytical Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Epoxy Resins (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
- Reinforced Plastic Materials (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
- Laminated Bodies (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF0052573 | 1967-06-01 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1720663A1 DE1720663A1 (de) | 1971-06-24 |
| DE1720663B2 DE1720663B2 (de) | 1975-02-06 |
| DE1720663C3 true DE1720663C3 (de) | 1975-09-18 |
Family
ID=7105553
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1720663A Expired DE1720663C3 (de) | 1967-06-01 | 1967-06-01 | Verfahren zur Herstellung von Kunststoffen |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3562214A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS4641112B1 (cg-RX-API-DMAC10.html) |
| AT (1) | AT281424B (cg-RX-API-DMAC10.html) |
| BE (1) | BE716010A (cg-RX-API-DMAC10.html) |
| CH (1) | CH501691A (cg-RX-API-DMAC10.html) |
| DE (1) | DE1720663C3 (cg-RX-API-DMAC10.html) |
| ES (1) | ES354506A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR1573148A (cg-RX-API-DMAC10.html) |
| GB (1) | GB1218446A (cg-RX-API-DMAC10.html) |
| NL (1) | NL153233B (cg-RX-API-DMAC10.html) |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3876607A (en) * | 1972-09-13 | 1975-04-08 | John B Snell | Epoxy compositions |
| US4118535A (en) * | 1975-11-03 | 1978-10-03 | General Electric Company | Novel polyetheramide-imide epoxy resin blends |
| US4142034A (en) * | 1978-04-10 | 1979-02-27 | Cincinnati Milacron Inc. | Epoxy resin compositions containing an amine-cyanic acid ester combination curing agent |
| JPS5610529A (en) * | 1979-07-09 | 1981-02-03 | Mitsubishi Gas Chem Co Inc | Curable resin composition |
| JPS5611924A (en) * | 1979-07-12 | 1981-02-05 | Mitsubishi Gas Chem Co Inc | Curable resin composition |
| JPS5626950A (en) * | 1979-08-08 | 1981-03-16 | Mitsubishi Gas Chem Co Inc | Curable resin composition |
| JPS5626951A (en) * | 1979-08-08 | 1981-03-16 | Mitsubishi Gas Chem Co Inc | Curable resin composition |
| JPS5626911A (en) * | 1979-08-08 | 1981-03-16 | Mitsubishi Gas Chem Co Inc | Curable resin composition |
| JPS5690824A (en) * | 1979-12-24 | 1981-07-23 | Mitsubishi Gas Chem Co Inc | Curable resin composition |
| JPS5690823A (en) * | 1979-12-24 | 1981-07-23 | Mitsubishi Gas Chem Co Inc | Curable resin composition |
| JPS5698221A (en) * | 1980-01-07 | 1981-08-07 | Mitsubishi Gas Chem Co Inc | Curable resin composition |
| JPS56125449A (en) * | 1980-01-29 | 1981-10-01 | Mitsubishi Gas Chem Co Inc | Curable resin composition |
| JPS56110760A (en) * | 1980-02-06 | 1981-09-02 | Mitsubishi Gas Chem Co Inc | Curable resin composition |
| JPS56141321A (en) * | 1980-04-08 | 1981-11-05 | Mitsubishi Gas Chem Co Inc | Photosetting resin composition |
| US4404330A (en) * | 1980-05-06 | 1983-09-13 | Mitsubishi Gas Chemical Company, Inc. | Curable resin composition |
| DE3117903C2 (de) * | 1980-05-06 | 1983-09-29 | Mitsubishi Gas Chemical Co., Inc., Tokyo | Härtbare Harzmasse |
| US4396745A (en) * | 1980-05-08 | 1983-08-02 | Mitsubishi Gas Chemical Company, Inc. | Curable resin composition |
| JPS5939307B2 (ja) * | 1980-06-18 | 1984-09-21 | 三菱瓦斯化学株式会社 | プラスチツク物品 |
| US4533727A (en) * | 1983-04-06 | 1985-08-06 | Mitsubishi Gas Chemical Company, Inc. | Process for producing a curable resin from cyanate ester compound and unsaturated 1,2-epoxy compound |
| JPS6026030A (ja) * | 1983-07-22 | 1985-02-08 | Mitsubishi Gas Chem Co Inc | 硬化性樹脂の製造法 |
| US4713442A (en) * | 1983-11-16 | 1987-12-15 | The Dow Chemical Company | Polyaromatic cyanate |
| US4751323A (en) * | 1983-11-16 | 1988-06-14 | The Dow Chemical Company | Novel polyaromatic cyanates |
| US4774282A (en) * | 1986-11-20 | 1988-09-27 | Amoco Corporation | Thermoset composition comprising aromatic cyanate ester, allyl ethers of bisphenol and bismaleimide |
| US4904760A (en) * | 1987-04-27 | 1990-02-27 | Mitsubishi Gas Chemical Co., Inc. | Thermosetting resin composition from cyanate ester and non-branched aromatic compound |
| US5045609A (en) * | 1989-07-07 | 1991-09-03 | Hexcel Corporation | Toughened, high temperature resin matrix system |
| US5385989A (en) * | 1991-04-15 | 1995-01-31 | Mitsubishi Gas Chemical Company, Inc. | Thermal resistance resin dust for friction material |
| JP3231814B2 (ja) * | 1991-07-12 | 2001-11-26 | ミネソタ マイニング アンド マニュファクチャリング カンパニー | 異方性導電膜 |
| US5932762A (en) * | 1994-05-27 | 1999-08-03 | Lonza, Ltd. | Process for the production of aryl cyanates |
| US5912308A (en) * | 1994-11-30 | 1999-06-15 | Alliedsignal Inc. | Multifunctional cyanate ester and epoxy blends |
| US5855821A (en) * | 1995-12-22 | 1999-01-05 | Johnson Matthey, Inc. | Materials for semiconductor device assemblies |
| EP0941216B1 (de) * | 1996-11-29 | 2001-10-24 | Lonza Ag | Verfahren zur herstellung von arylcyanaten |
| TW541323B (en) | 1998-05-13 | 2003-07-11 | Sumitomo Chemical Co | Cyanate ester composition and cured product thereof |
| JP4715979B2 (ja) * | 2000-07-04 | 2011-07-06 | 三菱瓦斯化学株式会社 | プリプレグの製造方法及びそれを用いたプリント配線板 |
| WO2003048251A1 (en) * | 2001-12-05 | 2003-06-12 | Isola Laminate Systems Corp. | Prepreg and composition of epoxy resin(s), sma copolymers(s) and bis-maleimide triazine resin(s) |
| US7892651B2 (en) | 2004-09-14 | 2011-02-22 | Mitsubishi Gas Chemical Company, Inc. | Resin composite metal foil, laminate and process for the production of printed wiring board using the laminate |
| JP2010180147A (ja) * | 2009-02-04 | 2010-08-19 | Mitsubishi Gas Chemical Co Inc | シアン酸エステル化合物、およびその硬化物 |
| TWI501865B (zh) | 2009-07-24 | 2015-10-01 | Mitsubishi Gas Chemical Co | 樹脂複合電解銅箔、銅箔積層板以及印刷配線板 |
| EP2743283B1 (en) | 2011-08-09 | 2016-05-25 | Mitsubishi Gas Chemical Company, Inc. | Novel cyanic acid ester compound, method for producing same, curable resin composition containing novel cyanic acid ester compound, and cured product of curable resin composition |
| EP2770005B1 (en) | 2011-10-18 | 2019-05-08 | Guangdong Shengyi Sci. Tech Co., Ltd | Epoxy resin composition and high frequency electronic-circuit substrate manufactured by using the same |
| US9706651B2 (en) | 2011-12-07 | 2017-07-11 | Mitsubishi Gas Chemical Company, Inc. | Resin composition, prepreg, and laminate |
-
1967
- 1967-06-01 DE DE1720663A patent/DE1720663C3/de not_active Expired
-
1968
- 1968-05-08 US US727695A patent/US3562214A/en not_active Expired - Lifetime
- 1968-05-13 AT AT457268A patent/AT281424B/de not_active IP Right Cessation
- 1968-05-28 NL NL686807523A patent/NL153233B/xx unknown
- 1968-05-28 GB GB25389/68A patent/GB1218446A/en not_active Expired
- 1968-05-30 ES ES354506A patent/ES354506A1/es not_active Expired
- 1968-05-30 FR FR1573148D patent/FR1573148A/fr not_active Expired
- 1968-05-31 CH CH807168A patent/CH501691A/de not_active IP Right Cessation
- 1968-05-31 BE BE716010D patent/BE716010A/xx unknown
- 1968-06-01 JP JP3731668A patent/JPS4641112B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| GB1218446A (en) | 1971-01-06 |
| ES354506A1 (es) | 1969-11-01 |
| DE1720663B2 (de) | 1975-02-06 |
| CH501691A (de) | 1971-01-15 |
| DE1720663A1 (de) | 1971-06-24 |
| US3562214A (en) | 1971-02-09 |
| NL153233B (nl) | 1977-05-16 |
| NL6807523A (cg-RX-API-DMAC10.html) | 1968-12-02 |
| BE716010A (cg-RX-API-DMAC10.html) | 1968-10-16 |
| JPS4641112B1 (cg-RX-API-DMAC10.html) | 1971-12-04 |
| AT281424B (de) | 1970-05-25 |
| FR1573148A (cg-RX-API-DMAC10.html) | 1969-07-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1720663C3 (de) | Verfahren zur Herstellung von Kunststoffen | |
| EP3178863B1 (de) | Epoxidharz-zusammensetzungen zur herstellung von lagerstabilen composites | |
| DE3105056C2 (de) | Verfahren zur Herstellung von hitzehärtbaren Vorpolymerisaten vom Maleinimidtyp | |
| EP2678369B1 (de) | Hochlatente härter für epoxidharze | |
| DE3433851A1 (de) | Chemisch haertbare harze aus 1-oxa-3-aza-tetralin-gruppen enthaltenden verbindungen und cycloaliphatischen epoxid-harzen, verfahren zu deren herstellung und haertung sowie die verwendung solcher harze | |
| EP0146498B1 (de) | Härtbare Gemische, enthaltend ein Epoxidharz, ein Imid und einen Härtungskatalysator | |
| EP0379107A2 (de) | Verwendung von polyamidoaminen als Härter für Epoxidharze und diese enthaltende härtbare Mischungen | |
| DE2504625C2 (de) | Imidgruppen enthaltende Prepolymere, Verfahren zu deren Herstellung und deren Weiterverarbeitung | |
| EP3596147B1 (de) | Verfahren zur herstellung von oxazolidinongruppen aufweisenden verbindungen | |
| DE2346404A1 (de) | Verfahren, um oberflaechen miteinander zu verbinden | |
| DE69434098T2 (de) | Kinetisch überprüfte -i(in-situ) erzeugung von katalytischen spezien zur härtung von epoxy/amin-zusammensetzungen | |
| CH504491A (de) | Verfahren zur Herstellung von Formköpern, Überzügen und Verklebungen | |
| CH634588A5 (de) | Verfahren zur herstellung von blasenfreien, waermebestaendigen isocyanuratgruppen aufweisenden vernetzten kunststoffen. | |
| DE69300465T2 (de) | Wärmebeständige Klebstoffzusammensetzung. | |
| DE3882123T2 (de) | Epoxyharze, die einen aromatischen diaminhaerter enthalten. | |
| DE2547094A1 (de) | Waermehaertbare zusammensetzungen auf bis-imid- und polyurethanbasis | |
| DE102011012079A1 (de) | Neue Härter für Epoxidharze | |
| EP0356392A2 (de) | Härtbares Epoxidharzgemisch | |
| DE69024807T2 (de) | Schlagfestes hochtemperaturharz enthaltendes matrixsystem | |
| DE2533422A1 (de) | Verfahren zur herstellung von schaumstoffen aus epoxidharzen | |
| DE1942653B2 (de) | Verfahren zur Herstellung von epoxidgruppenhaltigen Addukten aus Polyglycidylverbindungen und sauren Polyestern alphatisch-cycloaliphatischer Dicarbonsäuren und ihre Anwendung | |
| CH632001A5 (en) | Process and compositions for the production of mouldings and coatings | |
| DE2164099C3 (de) | Verfahren zur Herstellung von Polyaddukten | |
| EP0487452A2 (de) | Härtbares Epoxidharzgemisch | |
| EP0435060A2 (de) | Verfahren zur Herstellung von Kunststoff-Formteilen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 |