DE1720009A1 - Verfahren zur Herstellung von 5-basisch substituierten 10,11-Dihydro-5H-dibenzo[b,e][1,4]diazepinen - Google Patents
Verfahren zur Herstellung von 5-basisch substituierten 10,11-Dihydro-5H-dibenzo[b,e][1,4]diazepinenInfo
- Publication number
- DE1720009A1 DE1720009A1 DE19601720009 DE1720009A DE1720009A1 DE 1720009 A1 DE1720009 A1 DE 1720009A1 DE 19601720009 DE19601720009 DE 19601720009 DE 1720009 A DE1720009 A DE 1720009A DE 1720009 A1 DE1720009 A1 DE 1720009A1
- Authority
- DE
- Germany
- Prior art keywords
- carbon atoms
- alkyl
- dibenzo
- quaternary ammonium
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 8
- 238000002360 preparation method Methods 0.000 title claims description 5
- OMGNOSZSCQGCGV-UHFFFAOYSA-N 6,11-dihydro-5h-benzo[b][1,4]benzodiazepine Chemical class C1NC2=CC=CC=C2NC2=CC=CC=C12 OMGNOSZSCQGCGV-UHFFFAOYSA-N 0.000 title 1
- 125000004432 carbon atom Chemical group C* 0.000 claims description 16
- 239000000047 product Substances 0.000 claims description 9
- -1 alkyl radical Chemical class 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- LRANPJDWHYRCER-UHFFFAOYSA-N 1,2-diazepine Chemical compound N1C=CC=CC=N1 LRANPJDWHYRCER-UHFFFAOYSA-N 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 125000001453 quaternary ammonium group Chemical group 0.000 claims description 6
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 4
- 239000012458 free base Substances 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000004414 alkyl thio group Chemical group 0.000 claims description 3
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000005842 heteroatom Chemical group 0.000 claims description 3
- 238000005984 hydrogenation reaction Methods 0.000 claims description 3
- 150000004908 diazepines Chemical class 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 claims 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 238000009835 boiling Methods 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 150000003254 radicals Chemical class 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 230000002152 alkylating effect Effects 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 125000003277 amino group Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- 229940050176 methyl chloride Drugs 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- QLAJNZSPVITUCQ-UHFFFAOYSA-N 1,3,2-dioxathietane 2,2-dioxide Chemical compound O=S1(=O)OCO1 QLAJNZSPVITUCQ-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- POXWDTQUDZUOGP-UHFFFAOYSA-N 1h-1,4-diazepine Chemical class N1C=CC=NC=C1 POXWDTQUDZUOGP-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical class Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 238000005574 benzylation reaction Methods 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000000812 cholinergic antagonist Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- JGDFBJMWFLXCLJ-UHFFFAOYSA-N copper chromite Chemical compound [Cu]=O.[Cu]=O.O=[Cr]O[Cr]=O JGDFBJMWFLXCLJ-UHFFFAOYSA-N 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- UZVGSSNIUNSOFA-UHFFFAOYSA-N dibenzofuran-1-carboxylic acid Chemical compound O1C2=CC=CC=C2C2=C1C=CC=C2C(=O)O UZVGSSNIUNSOFA-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910001853 inorganic hydroxide Inorganic materials 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000002445 parasympatholytic effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical class O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 239000013535 sea water Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21C—PRODUCTION OF CELLULOSE BY REMOVING NON-CELLULOSE SUBSTANCES FROM CELLULOSE-CONTAINING MATERIALS; REGENERATION OF PULPING LIQUORS; APPARATUS THEREFOR
- D21C3/00—Pulping cellulose-containing materials
- D21C3/04—Pulping cellulose-containing materials with acids, acid salts or acid anhydrides
- D21C3/06—Pulping cellulose-containing materials with acids, acid salts or acid anhydrides sulfur dioxide; sulfurous acid; bisulfites sulfites
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
- C07D243/10—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D243/38—[b, e]- or [b, f]-condensed with six-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Organic Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH7852059A CH380145A (de) | 1959-09-22 | 1959-09-22 | Verfahren zur Herstellung von Diazepinderivaten |
| CH7851859A CH392523A (de) | 1959-09-22 | 1959-09-22 | Verfahren zur Herstellung basisch substituierter Dibenzo(b,e)(1,4)diazepine |
| CH7852159A CH380146A (de) | 1959-09-22 | 1959-09-22 | Verfahren zur Herstellung von Diazepinderivaten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1720009A1 true DE1720009A1 (de) | 1971-05-19 |
Family
ID=27178587
Family Applications (4)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19601720009 Pending DE1720009A1 (de) | 1959-09-22 | 1960-09-13 | Verfahren zur Herstellung von 5-basisch substituierten 10,11-Dihydro-5H-dibenzo[b,e][1,4]diazepinen |
| DE19601445180 Pending DE1445180A1 (de) | 1959-09-22 | 1960-09-13 | Verfahren zur Herstellung 5-basisch substiuierter 10,11-Dihydro-5 H-dibenzo [auf b,e] zu [auf 1,4] zu diazepine |
| DE19601445179 Pending DE1445179A1 (de) | 1959-09-22 | 1960-09-13 | Verfahren zur Herstellung basisch substituierter 10,11,Dihydro-5 H-dibenzo [auf b,e]zu [auf 1,4] zu diazepine |
| DE19601445181 Pending DE1445181A1 (de) | 1959-09-22 | 1960-09-13 | Basisch substituierte 10,11-Dihyrro-5 H-dibenzo [auf b,e] zu [auf 1,4] zu diazepine |
Family Applications After (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19601445180 Pending DE1445180A1 (de) | 1959-09-22 | 1960-09-13 | Verfahren zur Herstellung 5-basisch substiuierter 10,11-Dihydro-5 H-dibenzo [auf b,e] zu [auf 1,4] zu diazepine |
| DE19601445179 Pending DE1445179A1 (de) | 1959-09-22 | 1960-09-13 | Verfahren zur Herstellung basisch substituierter 10,11,Dihydro-5 H-dibenzo [auf b,e]zu [auf 1,4] zu diazepine |
| DE19601445181 Pending DE1445181A1 (de) | 1959-09-22 | 1960-09-13 | Basisch substituierte 10,11-Dihyrro-5 H-dibenzo [auf b,e] zu [auf 1,4] zu diazepine |
Country Status (6)
| Country | Link |
|---|---|
| US (3) | US3419547A (enExample) |
| DE (4) | DE1720009A1 (enExample) |
| FR (2) | FR1385353A (enExample) |
| GB (3) | GB959994A (enExample) |
| NL (4) | NL256049A (enExample) |
| SE (2) | SE305445B (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL140242B (nl) * | 1963-03-01 | 1973-11-15 | Wander Ag Dr A | Werkwijze voor het bereiden van op de 11-plaats door een basische groep gesubstitueerde dibenz (b.f.)(1.4) oxazepinen. |
| US3351588A (en) * | 1965-09-14 | 1967-11-07 | American Home Prod | Dibenz [b, e] azepine derivative |
| US3852446A (en) * | 1967-03-13 | 1974-12-03 | Sandoz Ag | Organic compounds in treatment of psychotic disturbances |
| US3497499A (en) * | 1967-03-15 | 1970-02-24 | Sandoz Ag | Dibenzo(b,h)(1,5)diazecines |
| US3539573A (en) * | 1967-03-22 | 1970-11-10 | Jean Schmutz | 11-basic substituted dibenzodiazepines and dibenzothiazepines |
| GB1206332A (en) * | 1967-04-08 | 1970-09-23 | Yoshitomi Pharmaceutical | Cyclic hydroxamic acid derivatives |
| US3497496A (en) * | 1967-12-21 | 1970-02-24 | Eastman Kodak Co | Process for reducing the viscosity of cellulose ethers |
| FI50242C (fi) * | 1969-07-18 | 1976-01-12 | Thomae Gmbh Dr K | Menetelmä valmistaa farmakologisesti aktiivisia uusia diallyyliaminoal kanoyylidibenso- tai pyridobenso-diatsepiineja ja niiden happoadditios uoloja. |
| CH555856A (de) * | 1971-05-04 | 1974-11-15 | Hoffmann La Roche | Verfahren zur herstellung von tricyclischen verbindungen. |
| EP0026469B1 (en) * | 1979-10-01 | 1984-11-28 | Sandoz Ag | Dibenzazepine derivatives, their production and pharmaceutical compositions containing them |
| US4694003A (en) * | 1981-09-24 | 1987-09-15 | A. H. Robins Company, Incorporated | Method of treating depression with 5-(aminoalkyl)-11-phenyl-5H-dibenzo(b,e)(1,4) diazepines |
| SE448453B (sv) * | 1981-09-24 | 1987-02-23 | Robins Co Inc A H | Ftatimidoderivat |
| US5834463A (en) * | 1994-04-29 | 1998-11-10 | Takeda Chemical Industries, Ltd. | Condensed heterocyclic compounds, their production and use |
| US5716949A (en) * | 1995-04-07 | 1998-02-10 | Novo Nordisk A/S | Heterocyclic compounds |
| US6890919B2 (en) * | 2001-06-26 | 2005-05-10 | Shitij Kapur | Atypical antipsychotic agents having low affinity for the D2 receptor |
| US7388954B2 (en) * | 2002-06-24 | 2008-06-17 | Freescale Semiconductor, Inc. | Method and apparatus for tone indication |
| AU2006311577B2 (en) | 2005-11-09 | 2013-02-07 | Zalicus Inc. | Methods, compositions, and kits for the treatment of medical conditions |
| CN101878042B (zh) | 2007-11-28 | 2013-06-19 | 尼克塔治疗公司 | 低聚物-三环共轭物 |
| WO2011091050A1 (en) | 2010-01-19 | 2011-07-28 | Nektar Therapeutics | Oligomer-tricyclic conjugates |
| WO2012079017A1 (en) | 2010-12-10 | 2012-06-14 | Nektar Therapeutics | Hydroxylated tricyclic compounds |
| CN102746171A (zh) * | 2012-07-10 | 2012-10-24 | 南开大学 | 一种水油兼溶的新型苯氧羧酸酯类衍生物制备及应用研究 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH349986A (de) * | 1954-03-03 | 1960-11-15 | Ciba Geigy | Verfahren zur Herstellung neuer basisch substituierter Heterocyclen |
-
0
- NL NL256051D patent/NL256051A/xx unknown
- NL NL120551D patent/NL120551C/xx active
- NL NL256053D patent/NL256053A/xx unknown
- NL NL256049D patent/NL256049A/xx unknown
-
1960
- 1960-09-13 DE DE19601720009 patent/DE1720009A1/de active Pending
- 1960-09-13 DE DE19601445180 patent/DE1445180A1/de active Pending
- 1960-09-13 DE DE19601445179 patent/DE1445179A1/de active Pending
- 1960-09-13 DE DE19601445181 patent/DE1445181A1/de active Pending
- 1960-09-20 FR FR839026A patent/FR1385353A/fr not_active Expired
- 1960-09-20 FR FR839027A patent/FR1385354A/fr not_active Expired
- 1960-09-21 SE SE8985/60A patent/SE305445B/xx unknown
- 1960-09-21 SE SE8986/60A patent/SE305446B/xx unknown
- 1960-09-21 GB GB32460/60A patent/GB959994A/en not_active Expired
- 1960-09-22 GB GB32650/60A patent/GB961106A/en not_active Expired
- 1960-09-22 GB GB32649/60A patent/GB961105A/en not_active Expired
-
1962
- 1962-02-05 US US171245A patent/US3419547A/en not_active Expired - Lifetime
-
1964
- 1964-01-02 US US335344A patent/US3312689A/en not_active Expired - Lifetime
- 1964-01-02 US US335403A patent/US3347849A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| NL256051A (enExample) | |
| SE305445B (enExample) | 1968-10-28 |
| GB961105A (en) | 1964-06-17 |
| US3347849A (en) | 1967-10-17 |
| NL256049A (enExample) | |
| NL256053A (enExample) | |
| DE1445181A1 (de) | 1968-10-24 |
| FR1385353A (fr) | 1965-01-15 |
| SE305446B (enExample) | 1968-10-28 |
| DE1445179A1 (de) | 1968-10-24 |
| DE1445180A1 (de) | 1968-10-24 |
| FR1385354A (fr) | 1965-01-15 |
| US3419547A (en) | 1968-12-31 |
| NL120551C (enExample) | |
| GB961106A (en) | 1964-06-17 |
| US3312689A (en) | 1967-04-04 |
| GB959994A (en) | 1964-06-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1720009A1 (de) | Verfahren zur Herstellung von 5-basisch substituierten 10,11-Dihydro-5H-dibenzo[b,e][1,4]diazepinen | |
| DE2143587A1 (de) | 3 alpha- und 3beta-Phenyl (und monosubstituierte Phenyl) -nortropane und Verfahren zu deren Herstellung | |
| DE1137733B (de) | Verfahren zur Herstellung von Aryl- und Thienylmethylphenylalkylaminen | |
| DE1172671B (de) | Verfahren zur Herstellung von 17ª-Hydroxy-androstan-(3, 2-c)-pyrazol oder eines 17ª-Hydroxy-17ª-niederes-Alkyl-androstan-(3, 2-c)-pyrazols | |
| DE1493451A1 (de) | Verfahren zur Herstellung basischer Dibenzooxepin-bzw. Dibenzothiepin-Derivate und ihrer Salze | |
| DE2531678C3 (de) | Thieno [2,3e] triazole [3,4c] 5,6-dihydro-l,4diazepine und Verfahren zu ihrer Herstellung | |
| DE1197887B (de) | Verfahren zur Herstellung von 3-Trifluormethylphenoxazinderivaten | |
| AT220619B (de) | Verfahren zur Herstellung von Aminoalkylbenzhydryläthern | |
| DE936571C (de) | Verfahren zur Herstellung von 4-Aminochromanen | |
| DE1445648C (de) | Homopiperazindenvate | |
| DE1044102B (de) | Verfahren zur Herstellung von Estern der Xanthen-9-carbonsaeure | |
| DE945509C (de) | Verfahren zur Herstellung von Thiobarbitursaeurederivaten | |
| DE2356999A1 (de) | 1,2-dihydroinden-2-spiro-2'-piperazinderivate und verfahren zu ihrer herstellung | |
| AT218518B (de) | Verfahren zur Herstellung von neuen alkylsubstituierten, basischen Tetralonderivaten | |
| DE2015731C3 (de) | Azamorphinanverbindungen, Verfahren zu ihrer Herstellung und pharmazeutische Zubereitungen | |
| DE1929138C3 (de) | Verfahren zur Herstellung von N hoch 1 -Benzoylphenyläthylendiaminen und ihren Salzen | |
| AT254875B (de) | Verfahren zur Herstellung von neuen Derivaten des 1,2,3,6-Tetrahydro-pyridins | |
| DE1811831C3 (de) | Verfahren zur Herstellung von 5-Phenyl-13-dihydro-2H-l,4-benzodiazepin-2-on-derivaten | |
| DE1620675C (de) | S-Benzoyloxymethylthiamine und Verfahren zu deren Herstellung | |
| DE1720010A1 (de) | Verfahren zur Herstellung von in 5-Stellung basisch substituierten Dibenzo [b,e][1,4]diazepinen | |
| DE1120451B (de) | Verfahren zur Herstellung von in 3-Stellung acylierten Phenthiazinderivaten | |
| DE1470431A1 (de) | Verfahren zur Herstellung von Lactamverbindungen | |
| DE1445178A1 (de) | Verfahren zur Herstellung basisch substitutierter Heterocyclen | |
| DE3213881A1 (de) | Verfahren zur herstellung von isochinuclidin | |
| DE1169920B (de) | Verfahren zur Herstellung von als Enzymhemmstoff besonders geeigneten p-Allyloxybenzylaminen |