DE1693032B1 - Verfahren zur Herstellung von 1,2-disubstituierten Adamantanverbindungen - Google Patents
Verfahren zur Herstellung von 1,2-disubstituierten AdamantanverbindungenInfo
- Publication number
- DE1693032B1 DE1693032B1 DE19671693032 DE1693032A DE1693032B1 DE 1693032 B1 DE1693032 B1 DE 1693032B1 DE 19671693032 DE19671693032 DE 19671693032 DE 1693032 A DE1693032 A DE 1693032A DE 1693032 B1 DE1693032 B1 DE 1693032B1
- Authority
- DE
- Germany
- Prior art keywords
- parts
- ether
- preparation
- solution
- disubstituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000002360 preparation method Methods 0.000 title claims description 6
- -1 1,2-disubstituted adamantane compounds Chemical class 0.000 title claims description 5
- 238000000034 method Methods 0.000 title claims description 5
- ORILYTVJVMAKLC-UHFFFAOYSA-N Adamantane Natural products C1C(C2)CC3CC1CC2C3 ORILYTVJVMAKLC-UHFFFAOYSA-N 0.000 claims description 9
- 229940052761 dopaminergic adamantane derivative Drugs 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 27
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- 125000000217 alkyl group Chemical group 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- HLQSEJBREPQBRW-UHFFFAOYSA-N 2-(1-adamantyl)acetyl chloride Chemical compound C1C(C2)CC3CC2CC1(CC(=O)Cl)C3 HLQSEJBREPQBRW-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 239000001294 propane Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- UMSVPCYSAUKCAZ-UHFFFAOYSA-N propane;hydrochloride Chemical compound Cl.CCC UMSVPCYSAUKCAZ-UHFFFAOYSA-N 0.000 description 3
- AIDPAFBRBBMNEH-UHFFFAOYSA-N 1-(1-adamantyl)propan-2-one Chemical compound C1C(C2)CC3CC2CC1(CC(=O)C)C3 AIDPAFBRBBMNEH-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- QDHHCQZDFGDHMP-UHFFFAOYSA-N Chloramine Chemical compound ClN QDHHCQZDFGDHMP-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- JMHAVFHEJJAIDZ-UHFFFAOYSA-K [OH-].[Na+].[Mg++].[O-]S([O-])(=O)=O Chemical compound [OH-].[Na+].[Mg++].[O-]S([O-])(=O)=O JMHAVFHEJJAIDZ-UHFFFAOYSA-K 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB47666/66A GB1207954A (en) | 1966-10-24 | 1966-10-24 | Novel adamantane derivatives, the preparation thereof and compositions containing the same |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1693032B1 true DE1693032B1 (de) | 1972-04-27 |
Family
ID=10445838
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19671693032 Pending DE1693032B1 (de) | 1966-10-24 | 1967-10-23 | Verfahren zur Herstellung von 1,2-disubstituierten Adamantanverbindungen |
| DE19671793693 Granted DE1793693A1 (de) | 1966-10-24 | 1967-10-23 | Verfahren zur Herstellung von Adamantanverbindungen |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19671793693 Granted DE1793693A1 (de) | 1966-10-24 | 1967-10-23 | Verfahren zur Herstellung von Adamantanverbindungen |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3591642A (OSRAM) |
| BE (1) | BE705492A (OSRAM) |
| CH (1) | CH493444A (OSRAM) |
| DE (2) | DE1693032B1 (OSRAM) |
| GB (1) | GB1207954A (OSRAM) |
| NL (2) | NL6714362A (OSRAM) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4911228B1 (OSRAM) * | 1970-07-31 | 1974-03-15 | ||
| JPS5212705B2 (OSRAM) * | 1973-06-29 | 1977-04-08 | ||
| US3907895A (en) * | 1973-09-24 | 1975-09-23 | Colgate Palmolive Co | Keto-quaternary compounds |
| US4284484A (en) * | 1980-07-10 | 1981-08-18 | The United States Of America As Represented By The Secretary Of The Army | Preparation of 1,3,5,7 tetraacetamido- and 1,3,5,7-tetraaminoadamantanes |
| DE3838243A1 (de) * | 1988-05-07 | 1989-11-16 | Bayer Ag | Verfahren zur herstellung von 2,3-dichlor-5-acetylpyridin |
| RU2330013C1 (ru) * | 2006-12-20 | 2008-07-27 | Государственное образовательное учреждение высшего профессионального образования Волгоградский государственный технический университет (ВолгГТУ) | Способ получения адамантилсодержащих производных симметричных 1,4-дикетонов |
-
1966
- 1966-10-24 GB GB47666/66A patent/GB1207954A/en not_active Expired
-
1967
- 1967-10-13 US US675037A patent/US3591642A/en not_active Expired - Lifetime
- 1967-10-23 NL NL6714362A patent/NL6714362A/xx unknown
- 1967-10-23 BE BE705492D patent/BE705492A/xx unknown
- 1967-10-23 DE DE19671693032 patent/DE1693032B1/de active Pending
- 1967-10-23 DE DE19671793693 patent/DE1793693A1/de active Granted
- 1967-10-23 CH CH1475467A patent/CH493444A/fr not_active IP Right Cessation
-
1971
- 1971-10-05 NL NL7113680A patent/NL7113680A/xx unknown
Non-Patent Citations (1)
| Title |
|---|
| None * |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1207954A (en) | 1970-10-07 |
| DE1793693C3 (OSRAM) | 1974-10-17 |
| DE1793693B2 (OSRAM) | 1974-03-21 |
| NL6714362A (OSRAM) | 1968-04-25 |
| NL7113680A (OSRAM) | 1972-01-25 |
| BE705492A (OSRAM) | 1968-03-01 |
| US3591642A (en) | 1971-07-06 |
| DE1793693A1 (de) | 1972-06-08 |
| CH493444A (fr) | 1970-07-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2335943B2 (de) | Tricyclisch substituierte Aminoalkohole und ihre nichttoxischen Salze, Verfahren zu deren Herstellung und deren Verwendung bei der Bekämpfung von Herz- und Kreislauf erkrankungen | |
| DE1693032B1 (de) | Verfahren zur Herstellung von 1,2-disubstituierten Adamantanverbindungen | |
| DE1125428B (de) | Verfahren zur Herstellung von 1-substituierten 3-Oxymethylpyrrolidinen | |
| DE1693032C (de) | Verfahren zur Herstellung von 1,2disubstituierten Adamantanverbindungen | |
| DE2602846C2 (de) | Verfahren zur Herstellung von 2-(2-Thienyl)äthylaminen | |
| DE2538095A1 (de) | Neue organische verbindungen, ihre herstellung und verwendung | |
| DE1293751B (de) | Zimtsaeureanilide und Verfahren zu ihrer Herstellung | |
| DE2741387C3 (de) | Kreislaufverfahren zum Anreichern des trans, trans-Isomerengehalts eines Gemischs aus Stereoisomeren des Di-(p-aminocyclohexyl)-methans | |
| DE1046063B (de) | Verfahren zur Herstellung neuer, amoebicid wirkender Acetanilide | |
| DE942149C (de) | Verfahren zur Herstellung substituierter Glycinamide | |
| AT238186B (de) | Verfahren zur Herstellung neuer Pyrrolidinverbindungen | |
| DE908138C (de) | Verfahren zur Herstellung von 1-Benzyl-2-alkyl-1,2,3,4,5,6,7,8,-octa-hydroisochinolinen und ihren Salzen | |
| CH411847A (de) | Verfahren zur Herstellung von Kampferderivaten | |
| DE866647C (de) | Verfahren zur Herstellung von sekundaeren 1, 3-Alkendiaminen | |
| AT218509B (de) | Verfahren zur Herstellung von basisch substituierten Carbinolen, sowie von ihren sterisch einheitlichen Razematen und deren optisch aktiven Komponenten und/oder ihren Säureadditionssalzen | |
| CH653322A5 (de) | Verfahren zur herstellung von phenylethanolaminen. | |
| AT254166B (de) | Verfahren zur Herstellung von neuen 5-(3'-sek.Aminopropyl)-5H-dibenzo[a,d]cycloheptenen bzw. den 10,11-Dihydroderivaten derselben | |
| DE1186069B (de) | Verfahren zur Herstellung von N, N'-disubstituierten Piperazinen | |
| DE2551141A1 (de) | Cyclododecylamin-derivate | |
| AT231439B (de) | Verfahren zur Herstellung von neuen o-Alkoxybenzoesäureaminoalkylamiden | |
| DE859892C (de) | Verfahren zur Herstellung von substituierten Piperidinoessigsaeureestern | |
| DE1570034A1 (de) | Verfahren zur Herstellung von Nikotinsaeureamiden | |
| DE677127C (de) | Verfahren zur Darstellung von Abkoemmlingen des 3, 4-Dioxyphenylaminopropanols | |
| DE4133145A1 (de) | Verfahren zur herstellung angereicherter diastereomeren von propranololanaloga mit zwei chiralen zentren | |
| DE1179940B (de) | Verfahren zur Herstellung von 2-Phenyl-3-methyl-4-(1-methyl-2-phenylaethylamino)-morpholin |