DE1670043C3 - Verfahren zur Herstellung von 3-(Aminophenyl)-pyridazon-(6)-derivaten - Google Patents
Verfahren zur Herstellung von 3-(Aminophenyl)-pyridazon-(6)-derivatenInfo
- Publication number
- DE1670043C3 DE1670043C3 DE1670043A DE1670043A DE1670043C3 DE 1670043 C3 DE1670043 C3 DE 1670043C3 DE 1670043 A DE1670043 A DE 1670043A DE 1670043 A DE1670043 A DE 1670043A DE 1670043 C3 DE1670043 C3 DE 1670043C3
- Authority
- DE
- Germany
- Prior art keywords
- aminophenyl
- pyridazone
- derivatives
- alkyl
- preparation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 11
- 238000002360 preparation method Methods 0.000 title claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 230000018044 dehydration Effects 0.000 claims description 3
- 238000006297 dehydration reaction Methods 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 239000000543 intermediate Substances 0.000 claims description 2
- 238000003786 synthesis reaction Methods 0.000 claims description 2
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 239000012024 dehydrating agents Substances 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 125000002252 acyl group Chemical group 0.000 description 4
- -1 alkyl radicals Chemical class 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical group NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- LJRGBERXYNQPJI-UHFFFAOYSA-M sodium;3-nitrobenzenesulfonate Chemical compound [Na+].[O-][N+](=O)C1=CC=CC(S([O-])(=O)=O)=C1 LJRGBERXYNQPJI-UHFFFAOYSA-M 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- WPFCHJIUEHHION-UHFFFAOYSA-N 2-nitronaphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=C([N+]([O-])=O)C=CC2=C1 WPFCHJIUEHHION-UHFFFAOYSA-N 0.000 description 1
- FTNWWQOFRQZWSC-UHFFFAOYSA-N 5-nitronaphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1[N+]([O-])=O FTNWWQOFRQZWSC-UHFFFAOYSA-N 0.000 description 1
- XJYBYQGLRAFVGT-UHFFFAOYSA-N 8-nitronaphthalene-1-sulfonic acid Chemical compound C1=CC([N+]([O-])=O)=C2C(S(=O)(=O)O)=CC=CC2=C1 XJYBYQGLRAFVGT-UHFFFAOYSA-N 0.000 description 1
- HWTDMFJYBAURQR-UHFFFAOYSA-N 80-82-0 Chemical class OS(=O)(=O)C1=CC=CC=C1[N+]([O-])=O HWTDMFJYBAURQR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- FIQIEWYXLLEXNR-UHFFFAOYSA-N [O-][N+](=O)S(=O)(=O)[N+]([O-])=O Chemical compound [O-][N+](=O)S(=O)(=O)[N+]([O-])=O FIQIEWYXLLEXNR-UHFFFAOYSA-N 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- IQZPDFORWZTSKT-UHFFFAOYSA-N nitrosulphonic acid Chemical class OS(=O)(=O)[N+]([O-])=O IQZPDFORWZTSKT-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000002250 progressing effect Effects 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/02—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings
- C07D237/06—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D237/10—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D237/14—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/02—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings
- C07D237/04—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having less than three double bonds between ring members or between ring members and non-ring members
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEB0085311 | 1966-01-07 | ||
| DEB0089433 | 1966-10-19 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1670043A1 DE1670043A1 (de) | 1970-10-29 |
| DE1670043B2 DE1670043B2 (de) | 1974-09-19 |
| DE1670043C3 true DE1670043C3 (de) | 1975-05-22 |
Family
ID=25967788
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1670043A Expired DE1670043C3 (de) | 1966-01-07 | 1966-01-07 | Verfahren zur Herstellung von 3-(Aminophenyl)-pyridazon-(6)-derivaten |
| DE19661670158 Pending DE1670158A1 (de) | 1966-01-07 | 1966-10-19 | Verfahren zur Herstellung von 6-Aminophenyl-und 6-Acylaminophenyl-4,5-dihydropyridazonen (3) |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19661670158 Pending DE1670158A1 (de) | 1966-01-07 | 1966-10-19 | Verfahren zur Herstellung von 6-Aminophenyl-und 6-Acylaminophenyl-4,5-dihydropyridazonen (3) |
Country Status (8)
| Country | Link |
|---|---|
| US (2) | US3475431A (https=) |
| BE (2) | BE692283A (https=) |
| CH (2) | CH481924A (https=) |
| DE (2) | DE1670043C3 (https=) |
| FR (2) | FR1507475A (https=) |
| GB (2) | GB1164139A (https=) |
| NL (2) | NL6700250A (https=) |
| SE (2) | SE321478B (https=) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3689652A (en) * | 1970-10-09 | 1972-09-05 | William Vincent Curran | Method of lowering blood pressure in mammals |
| GB1383906A (en) * | 1971-02-22 | 1974-02-12 | Bdh Pharmaceuticals Ltd | Pyridazinones |
| DE2123246C2 (de) * | 1971-05-11 | 1982-11-25 | Basf Ag, 6700 Ludwigshafen | 6-[p-(β-Phenyläthylaminoacetylamino)-phenyl]-4,5-dihydropyridazon-(3) |
| BE791539A (fr) * | 1971-11-19 | 1973-05-17 | Basf Ag | Dihydropyridazones, leur preparation et leurs utilisations therapeutiques |
| US3876786A (en) * | 1972-05-22 | 1975-04-08 | American Cyanamid Co | 6-(substituted phenyl)-4,5-dihydro-3(2h)-pyridazinones for lowering blood pressure in mammals |
| US3876787A (en) * | 1972-06-02 | 1975-04-08 | American Cyanamid Co | Method for lowering blood pressure in mammals |
| US4052395A (en) * | 1975-09-11 | 1977-10-04 | Sankyo Company Limited | Agricultural fungicidal compositions containing 6-(substituted phenyl)-pyridazinones and said pyridazinones |
| DE2727481A1 (de) * | 1977-06-18 | 1979-01-11 | Basf Ag | Dihydropyridazone und dihydropyridazone enthaltende therapeutische mittel |
| GR81309B (https=) * | 1980-06-13 | 1984-12-11 | Basf Ag | |
| EP0107735B1 (en) * | 1981-10-20 | 1988-10-19 | Mitsui Toatsu Kagaku Kabushiki Kaisha | Novel pyridazinone derivatives |
| DE3209159A1 (de) * | 1982-03-13 | 1983-09-15 | Basf Ag, 6700 Ludwigshafen | Neue 6-aryl-4,5-dihydro-3(2h)-pyridazinone, verfahren zu ihrer herstellung, diese verbindungen enthaltende therapeutische mittel und deren verwendung |
| DE3302021A1 (de) * | 1983-01-22 | 1984-07-26 | Basf Ag, 6700 Ludwigshafen | 6-aryl-4,5-dihydro-3(2h)-pyridazinone, ihre herstellung und verwendung |
| GB2164643B (en) * | 1984-07-27 | 1988-11-02 | Boehringer Biochemia Srl | Tricyclic dihydropyridazinones and pharmaceutical compositions containing them |
| CA1251448A (en) * | 1985-03-27 | 1989-03-21 | William J. Coates | Pyridazinone derivatives |
| GB8603780D0 (en) * | 1986-02-15 | 1986-03-19 | Smith Kline French Lab | Chemical compounds |
| DE10131133A1 (de) * | 2001-06-28 | 2003-01-16 | Bayer Ag | Pyridazinone |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL252908A (https=) * | 1959-06-23 | |||
| DE1213841B (de) * | 1962-03-29 | 1966-04-07 | Basf Ag | Verfahren zur Herstellung von 3-Aryl-4-halogen-pyridazonen-(6) |
-
1966
- 1966-01-07 DE DE1670043A patent/DE1670043C3/de not_active Expired
- 1966-10-19 DE DE19661670158 patent/DE1670158A1/de active Pending
- 1966-12-15 CH CH1799866A patent/CH481924A/de not_active IP Right Cessation
- 1966-12-16 CH CH1800666A patent/CH466299A/de unknown
- 1966-12-28 US US605213A patent/US3475431A/en not_active Expired - Lifetime
- 1966-12-29 GB GB58122/66A patent/GB1164139A/en not_active Expired
-
1967
- 1967-01-03 US US611526A patent/US3487081A/en not_active Expired - Lifetime
- 1967-01-03 SE SE120/67A patent/SE321478B/xx unknown
- 1967-01-04 SE SE201/67A patent/SE321479B/xx unknown
- 1967-01-04 FR FR89952A patent/FR1507475A/fr not_active Expired
- 1967-01-05 FR FR90081A patent/FR1509274A/fr not_active Expired
- 1967-01-06 BE BE692283D patent/BE692283A/xx unknown
- 1967-01-06 NL NL6700250A patent/NL6700250A/xx unknown
- 1967-01-06 NL NL6700249A patent/NL6700249A/xx unknown
- 1967-01-06 GB GB925/67A patent/GB1168291A/en not_active Expired
- 1967-01-06 BE BE692292D patent/BE692292A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BE692292A (https=) | 1967-07-06 |
| NL6700249A (https=) | 1967-07-10 |
| CH466299A (de) | 1968-12-15 |
| NL6700250A (https=) | 1967-07-10 |
| FR1507475A (fr) | 1967-12-29 |
| FR1509274A (fr) | 1968-01-12 |
| SE321478B (https=) | 1970-03-09 |
| US3475431A (en) | 1969-10-28 |
| DE1670043B2 (de) | 1974-09-19 |
| SE321479B (https=) | 1970-03-09 |
| GB1168291A (en) | 1969-10-22 |
| CH481924A (de) | 1969-11-30 |
| DE1670158A1 (de) | 1970-12-03 |
| GB1164139A (en) | 1969-09-17 |
| DE1670043A1 (de) | 1970-10-29 |
| BE692283A (https=) | 1967-07-06 |
| US3487081A (en) | 1969-12-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1670043C3 (de) | Verfahren zur Herstellung von 3-(Aminophenyl)-pyridazon-(6)-derivaten | |
| DE2449492A1 (de) | Verfahren zur herstellung von optisch aktivem p-hydroxyphenylglycin | |
| DE2137339C2 (de) | Verfahren zur Herstellung von 2-Amino-4-hydroxypteridinen | |
| DE1569810A1 (de) | Nitrofarbstoffe und Verfahren zu deren Herstellung | |
| AT268297B (de) | Verfahren zur Herstellung von neuen 6-(Aminophenyl)-3-pyridazonen | |
| DE2357063C2 (de) | Verfahren zur Herstellung von N-Isopropyl-2,1,3-benzothiadiazin-4-on-2,2-dioxid | |
| DE1918253A1 (de) | Verbessertes Verfahren zur Herstellung von 3-Hydroxyisoxazolverbindungen | |
| DE1793693B2 (https=) | ||
| DE3314029C2 (https=) | ||
| DE2721265C2 (de) | Verfahren zur Herstellung von Di- n-propylacetonitril | |
| DE3302497A1 (de) | Verbessertes verfahren zur herstellung von riboflavin | |
| DE3044904A1 (de) | Fluorierte anthranilsaeure und anthranilsaeurenitril sowie verfahren zu ihrer herstellung | |
| DE2735052A1 (de) | Eckige klammer auf n-(2-diphenylmethoxyaethyl)-n-(1-methyl-2-phenoxyaethyl)- n-methyl eckige klammer zu amin, seine herstellung und verwendung in arzneimitteln | |
| DE1493705C2 (de) | 3-Phenylamino thiophen -4-carbonsäuren und Verfahren zu ihrer Herstellung | |
| DE2353580C2 (de) | Verfahren zur Herstellung von o-Acylamino-diarylverbindungen | |
| DE2112778A1 (de) | Verfahren zur Herstellung von 2-Cyan-3,4,5,6-tetrahalogenbenzoesaeurealkylestern | |
| AT246729B (de) | Verfahren zur Herstellung von neuen substituierten Benzoesäureamiden | |
| DE2413189C2 (de) | Verfahren zur Herstellung von Benzohydrochinonen | |
| AT227675B (de) | Verfahren zur Herstellung von am Sauerstoff basisch Hydroxylaminen | |
| DE1493619C (de) | Verfahren zur Herstellung von 3-(3,4-Dihydroxyphenyl)-2-methylalanin | |
| DE1793594C3 (de) | Verfahren zur Herstellung von substituierten Acrylnitrilen | |
| DE1543620C3 (de) | 2,6-Dicyan-4-nitranilin und ein Verfahren zu dessen Herstellung | |
| AT216511B (de) | Verfahren zur Herstellung von 1,2,4-Benzothiadiazin-1,1-dioxydverbindungen | |
| DE21150C (de) | Verfahren zur Herstellung der methylirten und aethylirten Abkömmlinge des OxychinolintetrahydrQrs, Methoxychinolintetrahydrürs und Aethoxychinolintetrahydrürs | |
| DE484905C (de) | Verfahren zur Herstellung von festen Aryldiazoniumsalzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |