DE1644328C3 - Verfahren zur Herstellung von Monoazofarbstoffen - Google Patents
Verfahren zur Herstellung von MonoazofarbstoffenInfo
- Publication number
- DE1644328C3 DE1644328C3 DE1644328A DES0095743A DE1644328C3 DE 1644328 C3 DE1644328 C3 DE 1644328C3 DE 1644328 A DE1644328 A DE 1644328A DE S0095743 A DES0095743 A DE S0095743A DE 1644328 C3 DE1644328 C3 DE 1644328C3
- Authority
- DE
- Germany
- Prior art keywords
- parts
- dyes
- amino
- dye
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000975 dye Substances 0.000 title claims description 38
- 238000000034 method Methods 0.000 title claims description 8
- 238000002360 preparation method Methods 0.000 title claims description 5
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 title claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 7
- 150000002367 halogens Chemical class 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 description 18
- 239000000203 mixture Substances 0.000 description 13
- 239000000835 fiber Substances 0.000 description 10
- 229920000728 polyester Polymers 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 7
- 239000002270 dispersing agent Substances 0.000 description 7
- 238000004043 dyeing Methods 0.000 description 7
- 206010039587 Scarlet Fever Diseases 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 238000005859 coupling reaction Methods 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 239000004952 Polyamide Substances 0.000 description 5
- 125000003545 alkoxy group Chemical group 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- 229920002647 polyamide Polymers 0.000 description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- 239000012954 diazonium Substances 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- -1 methoxy, ethoxy Chemical group 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 229920002994 synthetic fiber Polymers 0.000 description 4
- 239000012209 synthetic fiber Substances 0.000 description 4
- 229920002284 Cellulose triacetate Polymers 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 description 3
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- POJOORKDYOPQLS-UHFFFAOYSA-L barium(2+) 5-chloro-2-[(2-hydroxynaphthalen-1-yl)diazenyl]-4-methylbenzenesulfonate Chemical compound [Ba+2].C1=C(Cl)C(C)=CC(N=NC=2C3=CC=CC=C3C=CC=2O)=C1S([O-])(=O)=O.C1=C(Cl)C(C)=CC(N=NC=2C3=CC=CC=C3C=CC=2O)=C1S([O-])(=O)=O POJOORKDYOPQLS-UHFFFAOYSA-L 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 150000001447 alkali salts Chemical class 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 150000001989 diazonium salts Chemical class 0.000 description 2
- 150000002191 fatty alcohols Chemical class 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 229920000591 gum Polymers 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- 238000005470 impregnation Methods 0.000 description 2
- 238000006068 polycondensation reaction Methods 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 239000010979 ruby Substances 0.000 description 2
- 229910001750 ruby Inorganic materials 0.000 description 2
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- RYPVUNGPPCYIDC-UHFFFAOYSA-N 1,4-dioxane;propan-2-one Chemical compound CC(C)=O.C1COCCO1 RYPVUNGPPCYIDC-UHFFFAOYSA-N 0.000 description 1
- LOCWBQIWHWIRGN-UHFFFAOYSA-N 2-chloro-4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1Cl LOCWBQIWHWIRGN-UHFFFAOYSA-N 0.000 description 1
- SNZQGOFQINOHGO-UHFFFAOYSA-N 3-chloro-2-methylsulfonylaniline Chemical compound CS(=O)(=O)C1=C(N)C=CC=C1Cl SNZQGOFQINOHGO-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- DKKVIKAIZCKPOQ-UHFFFAOYSA-N CCN(CC)N(C1=CC=CC=C1)S(C)(=O)=O Chemical compound CCN(CC)N(C1=CC=CC=C1)S(C)(=O)=O DKKVIKAIZCKPOQ-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 229920000161 Locust bean gum Polymers 0.000 description 1
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- VJMAITQRABEEKP-UHFFFAOYSA-N [6-(phenylmethoxymethyl)-1,4-dioxan-2-yl]methyl acetate Chemical compound O1C(COC(=O)C)COCC1COCC1=CC=CC=C1 VJMAITQRABEEKP-UHFFFAOYSA-N 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 238000000889 atomisation Methods 0.000 description 1
- TXHIDIHEXDFONW-UHFFFAOYSA-N benzene;propan-2-one Chemical compound CC(C)=O.C1=CC=CC=C1 TXHIDIHEXDFONW-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical class O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- GTRGJJDVSJFNTE-UHFFFAOYSA-N chembl2009633 Chemical compound OC1=CC=C2C=C(S(O)(=O)=O)C=CC2=C1N=NC1=CC=CC=C1 GTRGJJDVSJFNTE-UHFFFAOYSA-N 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000005108 dry cleaning Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000002657 fibrous material Substances 0.000 description 1
- 239000010408 film Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 235000010420 locust bean gum Nutrition 0.000 description 1
- 239000000711 locust bean gum Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 description 1
- 235000019960 monoglycerides of fatty acid Nutrition 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 229930014626 natural product Natural products 0.000 description 1
- 239000000025 natural resin Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 239000013535 sea water Substances 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 229940080236 sodium cetyl sulfate Drugs 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- GGHPAKFFUZUEKL-UHFFFAOYSA-M sodium;hexadecyl sulfate Chemical compound [Na+].CCCCCCCCCCCCCCCCOS([O-])(=O)=O GGHPAKFFUZUEKL-UHFFFAOYSA-M 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 210000004243 sweat Anatomy 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/0008—Organic ingredients according to more than one of the "one dot" groups of C08K5/01 - C08K5/59
- C08K5/0041—Optical brightening agents, organic pigments
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH326364 | 1964-03-13 | ||
| CH465364A CH465735A (de) | 1964-03-13 | 1964-03-13 | Verfahren zur Herstellung von Monoazofarbstoffen |
| CH469364A CH465089A (de) | 1964-03-13 | 1964-03-13 | Verfahren zur Herstellung von Monoazofarbstoffen |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1644328A1 DE1644328A1 (de) | 1971-04-15 |
| DE1644328B2 DE1644328B2 (de) | 1973-08-16 |
| DE1644328C3 true DE1644328C3 (de) | 1974-03-14 |
Family
ID=27174234
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1644328A Expired DE1644328C3 (de) | 1964-03-13 | 1965-03-02 | Verfahren zur Herstellung von Monoazofarbstoffen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3359256A (en:Method) |
| BE (2) | BE659270A (en:Method) |
| CH (2) | CH465735A (en:Method) |
| DE (1) | DE1644328C3 (en:Method) |
| FR (2) | FR1428382A (en:Method) |
| GB (2) | GB1090844A (en:Method) |
| NL (1) | NL128605C (en:Method) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH524668A (de) * | 1967-02-21 | 1972-06-30 | Ciba Geigy Ag | Verfahren zur Herstellung wasserunlöslicher Azofarbstoffe |
| DE1932824A1 (de) * | 1969-06-28 | 1971-02-04 | Bayer Ag | Monoazofarbstoffe |
| US3692769A (en) * | 1970-02-18 | 1972-09-19 | Max A Weaver | Azo compounds containing an arylsulfonyl phenyl diazo component |
| GB1352059A (en) * | 1970-05-06 | 1974-05-15 | Sandoz Ltd | Monoazo compounds of low solubility in water their production and use as dyes |
| US4042580A (en) * | 1970-05-06 | 1977-08-16 | Sandoz Ltd. | Phenylazophenyl dyes having an alkoxyacylamino group on the coupling component radical |
| US4038269A (en) * | 1970-05-06 | 1977-07-26 | Sandoz Ltd. | 2'-alkoxyacylamino-4'-alkylamino-4-nitro-1,1'-azobenzene disperse dyes |
| US3869442A (en) * | 1971-10-29 | 1975-03-04 | Eastman Kodak Co | Phenyl-azo-n-acylamidoethylaniline compounds |
| US3884901A (en) * | 1972-04-06 | 1975-05-20 | American Aniline Prod | O-(benzyl or benzoyl)-benzoic acid-azo-phenyl compounds |
| US3926945A (en) * | 1972-05-16 | 1975-12-16 | Gaf Corp | 2,4-Dicyano butylamino-substituted monoazo dyestuffs |
| US4119624A (en) * | 1972-06-08 | 1978-10-10 | Imperial Chemical Industries Limited | Disperse monoazo dyestuffs |
| US4087420A (en) * | 1972-11-04 | 1978-05-02 | Cassella Farbwerke Mainkur Aktiengesellschaft | Azo dyestuffs containing an α-phenylamino isobutyric acid alkyl ester coupling component |
| US4667023A (en) * | 1973-07-16 | 1987-05-19 | Sandoz Ltd. | 4-(2'-halo-4'-nitrophenylazo)-2-2[2'-(C1-2 alkoxy or 2"-methoxyethoxy)ethoxycarbonylamino --N,N-di-C2-3 alkylanilines |
| DE2500071A1 (de) * | 1975-01-02 | 1976-07-08 | Basf Ag | Azofarbstoffe fuer den transferdruck |
| JPS51102565A (en:Method) * | 1975-03-07 | 1976-09-10 | Hitachi Ltd | |
| CH645232GA3 (en:Method) * | 1977-03-15 | 1984-09-28 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2151857A (en) * | 1935-04-04 | 1939-03-28 | Gen Aniline Works Inc | Water insoluble azo dyestuff |
| US2083308A (en) * | 1935-08-27 | 1937-06-08 | Firm Of J R Geigy A G | Monoazo-dyestuffs and their manufacture |
| US2231021A (en) * | 1938-11-02 | 1941-02-11 | Eastman Kodak Co | Azo compounds and material colored therewith |
| US2289349A (en) * | 1940-08-30 | 1942-07-14 | Eastman Kodak Co | Azo compounds and material colored therewith |
| US3139422A (en) * | 1961-10-11 | 1964-06-30 | Ici Ltd | Azo dyestuffs |
-
1964
- 1964-03-13 CH CH465364A patent/CH465735A/de unknown
- 1964-03-13 CH CH469364A patent/CH465089A/de unknown
-
1965
- 1965-02-04 BE BE659270D patent/BE659270A/xx unknown
- 1965-02-17 GB GB6831/65A patent/GB1090844A/en not_active Expired
- 1965-03-01 NL NL6502564A patent/NL128605C/xx active
- 1965-03-01 BE BE660461D patent/BE660461A/xx unknown
- 1965-03-02 DE DE1644328A patent/DE1644328C3/de not_active Expired
- 1965-03-08 US US438057A patent/US3359256A/en not_active Expired - Lifetime
- 1965-03-09 GB GB9929/65A patent/GB1092057A/en not_active Expired
- 1965-03-11 FR FR8868A patent/FR1428382A/fr not_active Expired
- 1965-03-11 FR FR8869A patent/FR1428383A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE1644328A1 (de) | 1971-04-15 |
| FR1428383A (fr) | 1966-02-11 |
| GB1092057A (en) | 1967-11-22 |
| GB1090844A (en) | 1967-11-15 |
| BE660461A (en:Method) | 1965-07-01 |
| DE1644328B2 (de) | 1973-08-16 |
| BE659270A (en:Method) | 1965-05-28 |
| NL6502564A (en:Method) | 1965-09-14 |
| CH465735A (de) | 1968-11-30 |
| FR1428382A (fr) | 1966-02-11 |
| US3359256A (en) | 1967-12-19 |
| NL128605C (en:Method) | 1970-04-15 |
| CH465089A (de) | 1968-11-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1295115B (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE1644328C3 (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| CH498907A (de) | Verfahren zur Herstellung von Dispersionsfarbstoffen der Monoazoreihe | |
| DE2433260C3 (de) | In Wasser schwer lösliche Monoazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken | |
| DE2120877B2 (de) | In Wasser schwer lösliche Monoazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1644373A1 (de) | Monoazofarbstoffe,ihre Herstellung und Verwendung | |
| DE1644352C3 (de) | Monoazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2116315C3 (de) | Monoazofarbstoffe, Verfahren zu ihrer Herstellung und Verwendung | |
| CH638551A5 (de) | Monoazofarbstoffe und verfahren zu deren herstellung. | |
| DE2013791A1 (en) | Yellow basic hydrazone dyes for polyacry-lonitrile etc | |
| DE2001821A1 (de) | Wasserunloesliche Monoazofarbstoffe | |
| DE2460668C2 (de) | Monoazofarbstoffe, ihre Herstellung und Verwendung | |
| DE1644327B2 (de) | Azofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| CH438526A (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE1801328B2 (de) | Mono- und Disazoverbindungen, Verfahren zu ihrer Herstellung und sie enthaltende Farbstoffpräparate | |
| DE4238231A1 (en:Method) | ||
| DE2139449A1 (de) | Verfahren zur Herstellung von Azoverbindungen und deren Verwendung | |
| DE1644373C (de) | Monoazofarbstoffe, ihre Herstellung und Verwendung | |
| DE1644333C (de) | Verfahren zur Herstellung von Dispersionsfarbstoffen der Monoazoreihe | |
| AT249212B (de) | Verfahren zur Herstellung von neuen wasserunlöslichen 4-Nitro-4'-dialkylamino-1,1'-azobenzolen | |
| DE2234465C3 (de) | Farbstoffmischungen und Verfahren zum Färben und Bedrucken von Polyesterfasermaterialien | |
| CH496770A (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| CH475309A (de) | Verfahren zur Herstellung in Wasser schwer löslicher Azofarbstoffe | |
| CH496771A (de) | Verfahren zur Herstellung in Wasser schwer löslicher Azofarbstoffe | |
| DE1794398A1 (de) | Monoazoverbindungen, ihre herstellung und verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 | ||
| 8339 | Ceased/non-payment of the annual fee |