DE1543353C3 - - Google Patents
Info
- Publication number
- DE1543353C3 DE1543353C3 DE19511543353 DE1543353A DE1543353C3 DE 1543353 C3 DE1543353 C3 DE 1543353C3 DE 19511543353 DE19511543353 DE 19511543353 DE 1543353 A DE1543353 A DE 1543353A DE 1543353 C3 DE1543353 C3 DE 1543353C3
- Authority
- DE
- Germany
- Prior art keywords
- parts
- carbon atoms
- tertiary
- general formula
- organic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 150000002432 hydroperoxides Chemical class 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 4
- 239000000370 acceptor Substances 0.000 claims description 3
- 239000012433 hydrogen halide Substances 0.000 claims description 3
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- 150000001451 organic peroxides Chemical class 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 150000007529 inorganic bases Chemical class 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 150000003512 tertiary amines Chemical class 0.000 claims description 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- JOOXCMJARBKPKM-UHFFFAOYSA-N 4-oxopentanoic acid Chemical compound CC(=O)CCC(O)=O JOOXCMJARBKPKM-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 6
- 229910052760 oxygen Inorganic materials 0.000 description 6
- 239000001301 oxygen Substances 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 4
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 3
- 238000002329 infrared spectrum Methods 0.000 description 3
- 229940040102 levulinic acid Drugs 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- YWAZQHICADRCRA-UHFFFAOYSA-N 5-chlorooxan-2-one Chemical compound ClC1CCC(=O)OC1 YWAZQHICADRCRA-UHFFFAOYSA-N 0.000 description 2
- SDLPXQYHKKEOQH-UHFFFAOYSA-N CCC(C)(C)OOC(CC1)COC1=O Chemical compound CCC(C)(C)OOC(CC1)COC1=O SDLPXQYHKKEOQH-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 150000002596 lactones Chemical class 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- -1 organic acid halides Chemical class 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- JGBAASVQPMTVHO-UHFFFAOYSA-N 2,5-dihydroperoxy-2,5-dimethylhexane Chemical compound OOC(C)(C)CCC(C)(C)OO JGBAASVQPMTVHO-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- XRXANEMIFVRKLN-UHFFFAOYSA-N 2-hydroperoxy-2-methylbutane Chemical compound CCC(C)(C)OO XRXANEMIFVRKLN-UHFFFAOYSA-N 0.000 description 1
- XWKFPIODWVPXLX-UHFFFAOYSA-N 2-methyl-5-methylpyridine Natural products CC1=CC=C(C)N=C1 XWKFPIODWVPXLX-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- OFPMPNUYTCQEQO-UHFFFAOYSA-N CC(C)(CCC(C)(C)OOC1(C)CCC(=O)O1)OOC1(C)CCC(=O)O1 Chemical compound CC(C)(CCC(C)(C)OOC1(C)CCC(=O)O1)OOC1(C)CCC(=O)O1 OFPMPNUYTCQEQO-UHFFFAOYSA-N 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 150000002976 peresters Chemical class 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/26—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D307/30—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/32—Oxygen atoms
- C07D307/33—Oxygen atoms in position 2, the oxygen atom being in its keto or unsubstituted enol form
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19511543353 DE1543353A1 (de) | 1951-01-28 | 1951-01-28 | Verfahren zur Herstellung von organischen Peroxyden |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19511543353 DE1543353A1 (de) | 1951-01-28 | 1951-01-28 | Verfahren zur Herstellung von organischen Peroxyden |
| DEB0087586 | 1966-06-16 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1543353A1 DE1543353A1 (de) | 1969-08-28 |
| DE1543353B2 DE1543353B2 (enExample) | 1974-05-09 |
| DE1543353C3 true DE1543353C3 (enExample) | 1974-12-12 |
Family
ID=25752841
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19511543353 Granted DE1543353A1 (de) | 1951-01-28 | 1951-01-28 | Verfahren zur Herstellung von organischen Peroxyden |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE1543353A1 (enExample) |
-
1951
- 1951-01-28 DE DE19511543353 patent/DE1543353A1/de active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE1543353B2 (enExample) | 1974-05-09 |
| DE1543353A1 (de) | 1969-08-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE851496C (de) | Verfahren zur Herstellung symmetrischer oder unsymmetrischer aliphatischer, ditertiaerer Peroxyde | |
| DE1058993B (de) | Verfahren zur Herstellung von als Katalysatoren fuer die Polymerisation von Perhalogenolefinen geeigneten aliphatischen Perhalogen-diacylperoxyden | |
| DE1543353C3 (enExample) | ||
| EP0001089A1 (de) | Verfahren zur Herstellung von halogenvinylsubstituierten Tetrahydrofuran-2-onen, bestimmte halogenvinylsubstituierte Tetrahydrofuran-2-one | |
| DE2920562A1 (de) | Verfahren zur herstellung von 5-halogen-6,9 alpha -oxydo-prostaglandin- derivaten | |
| DE1593075B1 (de) | Verfahren zur Herstellung von Vinyl- und Propenylestern aliphatischer Monocarbonsaeuren | |
| DE1079635B (de) | Verfahren zur Herstellung halogenhaltiger organischer Peroxyde | |
| DE1085159B (de) | Verfahren zur Herstellung von N, N-Diisopropylbenzthiazolyl-2-sulfenamid | |
| DD233845A1 (de) | Verfahren zur herstellung von neuen 1,3,2-dioxaborinanen | |
| DE844442C (de) | Verfahren zur Herstellung von 1, 1-Dihalogen-1, 3-alkadienen | |
| EP0011208A1 (de) | Verfahren zur Herstellung von 3-Phenoxy-benzaldehyden | |
| DE3603100C2 (de) | Verfahren zur Herstellung von Nitromethylen-Derivaten | |
| DE2734243A1 (de) | Verfahren zur herstellung von halogensubstituierten vinyloxiranen | |
| DE1909494C3 (de) | Verfahren zur Herstellung von Triorganobleiverbindu nge n | |
| DE1064514B (de) | Verfahren zur Herstellung von organischen Hydroperoxyden | |
| DE1048569B (de) | Verfahren zur Herstellung von Xanthendenvaten | |
| DE1147570B (de) | Verfahren zur Herstellung von Alkylaralkylphthalaten | |
| DE857964C (de) | Verfahren zur Herstellung von Peroxydverbindungen | |
| DE2827323A1 (de) | Verfahren zur herstellung von halogenbutenylacrylaten | |
| DE1161881B (de) | Verfahren zur Herstellung von 1, 2-Epoxycyclododecadien-(5, 9) | |
| AT238192B (de) | Verfahren zur Herstellung von neuen Sulfensäurederivaten | |
| DE1518128C (de) | Peroxyphthahde | |
| DE1927529C3 (de) | Verfahren zur Herstellung von Mono- und Biscarbodiimiden | |
| DE3932552A1 (de) | Verfahren zur herstellung von 1-hydroxyimidazol | |
| DE837700C (de) | Verfahren zur Herstellung von Furanderivaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 | ||
| 8330 | Complete disclaimer |