DE1482172A1 - Heuwerbungsmaschine - Google Patents
HeuwerbungsmaschineInfo
- Publication number
- DE1482172A1 DE1482172A1 DE19591482172 DE1482172A DE1482172A1 DE 1482172 A1 DE1482172 A1 DE 1482172A1 DE 19591482172 DE19591482172 DE 19591482172 DE 1482172 A DE1482172 A DE 1482172A DE 1482172 A1 DE1482172 A1 DE 1482172A1
- Authority
- DE
- Germany
- Prior art keywords
- rake
- frame
- machine
- daduroh
- rewarded
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims 4
- DSCFFEYYQKSRSV-FEPQRWDDSA-N (1s,2s,4s,5r)-6-methoxycyclohexane-1,2,3,4,5-pentol Chemical compound COC1[C@@H](O)[C@@H](O)C(O)[C@H](O)[C@H]1O DSCFFEYYQKSRSV-FEPQRWDDSA-N 0.000 claims 1
- 241000209202 Bromus secalinus Species 0.000 claims 1
- 238000001035 drying Methods 0.000 description 2
- 244000025254 Cannabis sativa Species 0.000 description 1
- 241000251730 Chondrichthyes Species 0.000 description 1
- 240000000731 Fagus sylvatica Species 0.000 description 1
- 235000010099 Fagus sylvatica Nutrition 0.000 description 1
- 240000000220 Panda oleosa Species 0.000 description 1
- 235000016496 Panda oleosa Nutrition 0.000 description 1
- 244000269722 Thea sinensis Species 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/73—Unsubstituted amino or imino radicals
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01C—PLANTING; SOWING; FERTILISING
- A01C3/00—Treating manure; Manuring
- A01C3/06—Manure distributors, e.g. dung distributors
- A01C3/08—Manure distributors, e.g. dung distributors for manure already laying on the soil
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01D—HARVESTING; MOWING
- A01D78/00—Haymakers with tines moving with respect to the machine
- A01D78/001—Side-delivery rakes
- A01D78/003—Drum-turner-tedders with throwing wheel
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01D—HARVESTING; MOWING
- A01D78/00—Haymakers with tines moving with respect to the machine
- A01D78/08—Haymakers with tines moving with respect to the machine with tine-carrying rotary heads or wheels
- A01D78/10—Haymakers with tines moving with respect to the machine with tine-carrying rotary heads or wheels the tines rotating about a substantially vertical axis
- A01D78/1078—Having only one row of rotors arranged on the same horizontal line perpendicular to the advance direction of the machine
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Organic Chemistry (AREA)
- Environmental Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Soil Sciences (AREA)
- Soil Working Implements (AREA)
- Agricultural Machines (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Tires In General (AREA)
- Studio Devices (AREA)
- Ultra Sonic Daignosis Equipment (AREA)
- Auxiliary Devices For Music (AREA)
- Optical Radar Systems And Details Thereof (AREA)
- Harvesting Machines For Root Crops (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL228135 | 1958-05-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1482172A1 true DE1482172A1 (de) | 1969-11-13 |
Family
ID=19751223
Family Applications (8)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19591482172 Pending DE1482172A1 (de) | 1958-05-27 | 1959-05-16 | Heuwerbungsmaschine |
| DEP22788A Pending DE1224082B (de) | 1958-05-27 | 1959-05-16 | Heuwerbungsmaschine |
| DE1507353A Expired DE1507353C3 (de) | 1958-05-27 | 1959-05-16 | Heuwerbungsmaschine |
| DEP22789A Pending DE1187056B (de) | 1958-05-27 | 1959-05-16 | Heumaschine |
| DEP34776A Pending DE1219723B (de) | 1958-05-27 | 1959-05-16 | Heuwerbungsmaschine |
| DEL30870U Expired DE1845628U (de) | 1958-05-27 | 1959-05-16 | Heuwerbungsmaschine. |
| DEP14902U Expired DE1845627U (de) | 1958-05-27 | 1959-05-16 | Heuwerbungsmaschine. |
| DEI30876U Expired DE1845629U (de) | 1958-05-27 | 1959-05-16 | Heuwerbungsmaschine. |
Family Applications After (7)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP22788A Pending DE1224082B (de) | 1958-05-27 | 1959-05-16 | Heuwerbungsmaschine |
| DE1507353A Expired DE1507353C3 (de) | 1958-05-27 | 1959-05-16 | Heuwerbungsmaschine |
| DEP22789A Pending DE1187056B (de) | 1958-05-27 | 1959-05-16 | Heumaschine |
| DEP34776A Pending DE1219723B (de) | 1958-05-27 | 1959-05-16 | Heuwerbungsmaschine |
| DEL30870U Expired DE1845628U (de) | 1958-05-27 | 1959-05-16 | Heuwerbungsmaschine. |
| DEP14902U Expired DE1845627U (de) | 1958-05-27 | 1959-05-16 | Heuwerbungsmaschine. |
| DEI30876U Expired DE1845629U (de) | 1958-05-27 | 1959-05-16 | Heuwerbungsmaschine. |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3120092A (enExample) |
| CH (2) | CH392972A (enExample) |
| DE (8) | DE1482172A1 (enExample) |
| FR (1) | FR1225342A (enExample) |
| GB (4) | GB924274A (enExample) |
| NL (3) | NL297621A (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL302966A (enExample) * | 1959-10-23 | |||
| DE1165329B (de) * | 1962-03-28 | 1964-03-12 | Fahr Ag Maschf | Heuwerbungsmaschine |
| BE630940A (enExample) * | 1962-04-13 | |||
| BE631139A (enExample) * | 1962-04-18 | |||
| DE1215990C2 (de) * | 1962-11-08 | 1975-09-25 | Fella-Werke Gmbh, 8501 Feucht | Heuwerbungsmaschine |
| US3771303A (en) * | 1966-08-31 | 1973-11-13 | Lely Nv C Van Der | Device for working crop lying on the ground |
| NL7209663A (enExample) * | 1972-07-13 | 1974-01-15 | ||
| US3962854A (en) * | 1973-10-12 | 1976-06-15 | Lely Cornelis V D | Rake machine |
| CA1039515A (en) * | 1973-10-12 | 1978-10-03 | C. Van Der Lely N.V. | Raking machines |
| US4023335A (en) * | 1973-10-12 | 1977-05-17 | Lely Cornelis V D | Rake machine |
| DE3028350A1 (de) * | 1980-07-25 | 1982-04-01 | Klöckner-Humboldt-Deutz AG Zweigniederlassung Fahr, 7702 Gottmadingen | Heuwerbungsmaschine |
| FR2564689B1 (fr) * | 1984-05-25 | 1987-05-07 | Kuhn Sa | Machine agricole munie de moyens d'entrainement perfectionnes |
| FR2719742B1 (fr) * | 1994-05-13 | 1996-08-02 | Kuhn Sa | Machine de fenaison, notamment une faneuse à rotors munis de bras porte-fourches avec des déflecteurs. |
| US6715275B1 (en) | 2000-06-22 | 2004-04-06 | Vermeer Manufacturing Company | Hay rake twin tooth with continuous camber and lost-motion activation and a rake wheel using the same |
| NL1024524C2 (nl) * | 2003-10-13 | 2005-04-27 | Gerardus Cornelius Maria Sande | Gewasharkinrichting. |
| US20070107409A1 (en) * | 2005-10-27 | 2007-05-17 | Cnh America Llc | Integrated rotary rake and inverter |
| ITRN20060046A1 (it) * | 2006-07-03 | 2008-01-04 | Ubaldi Denis | Elemento di raccolta di prodotti agricoli di forma esile e longilinea, come erba,paglia, leguminose e simili e dispositivo di raccolta utilizzante il medesimo |
| US8322124B2 (en) * | 2010-08-13 | 2012-12-04 | Forage Innovations B.V. | Center splitter rake wheel structure for rakes |
| US10470372B2 (en) * | 2014-07-15 | 2019-11-12 | Pequea Machine, Inc. | Frame suspension for rotary rakes and tedders |
| US10986783B2 (en) * | 2018-05-11 | 2021-04-27 | Lynn Bishop | Hay fluffer with removable tines |
| US20230371433A1 (en) * | 2022-05-17 | 2023-11-23 | Vermeer Manufacturing Company | Rake apparatus |
Family Cites Families (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE94924C (enExample) * | ||||
| DE1070436B (enExample) * | ||||
| DE135213C (enExample) * | ||||
| BE514811A (enExample) * | ||||
| GB190017636A (en) * | 1900-10-04 | 1901-10-04 | James Edward Ransome | Improvements in Machines for Turning the Swath of Grass and other Crops. |
| AT44753B (de) * | 1908-12-03 | 1910-11-10 | Thomas Phipps | Schwadenwender. |
| GB191116403A (en) * | 1911-07-17 | 1912-05-23 | Joseph Viccars Collyer | Improvements in or relating to Swath turning Machines. |
| CH71998A (de) * | 1915-11-18 | 1916-03-16 | Ernst Held | Grasstreumaschine |
| GB109094A (en) * | 1916-08-30 | 1917-08-30 | Edward Christopher Blackstone | An Improved Combined Swath Turner and Side-delivery Rake. |
| GB171169A (en) * | 1920-08-10 | 1921-11-10 | Frederic Parkinson | Improvements in swath turners and side delivery rakes |
| GB216394A (en) * | 1923-07-31 | 1924-05-29 | William Edward Martin | Improvements in swath turners and hay collectors |
| US2532652A (en) * | 1948-07-06 | 1950-12-05 | Sr Alexander J Wray | Rotary side-delivery rake |
| GB652538A (en) * | 1948-08-05 | 1951-04-25 | Cyril Joseph Bamford | Improvements in swath turners and windrowers |
| GB652539A (en) * | 1948-08-05 | 1951-04-25 | Cyril Joseph Bamford | Improvements in swath turners and windrowers |
| US2680343A (en) * | 1949-05-05 | 1954-06-08 | Melvin A Morrill | Side delivery rake |
| DE937677C (de) * | 1949-05-11 | 1956-01-12 | Hugo Dipl-Landw Schillert | Einrichtung zum Verteilen von Stallmist, Gras, Heu u. dgl. |
| US2722799A (en) * | 1951-07-16 | 1955-11-08 | Melvin A Morrill | Combined raking tooth and mounting structure therefor |
| US2710519A (en) * | 1952-07-24 | 1955-06-14 | Daniel F Winter | Adjustable rotary rake and stubble cleaner |
| US2689446A (en) * | 1952-12-09 | 1954-09-21 | Herman P Sorrels | Side delivery rake |
| US2852905A (en) * | 1953-01-16 | 1958-09-23 | Lely Nv C Van Der | Rotary raking wheel |
| GB790916A (en) * | 1953-05-28 | 1958-02-19 | Lely Nv C Van Der | Improvements in or relating to side-delivery rakes |
| FR1108945A (fr) * | 1953-10-15 | 1956-01-19 | Lely Nv C Van Der | Machine à râteler comportant au moins un organe de râtelage monté sur un essieu fixé rigidement au châssis |
| DE945197C (de) * | 1953-12-09 | 1956-07-05 | Siegfried Freiherr Von Welser | Einrichtung zum Zerstreuen von Gras- oder Heuschwaden u. dgl. |
| FR1124097A (fr) * | 1954-03-05 | 1956-10-03 | Lely Nv C Van Der | Râteau avec organe de râtelage s'adaptant de lui-même aux dénivellations du sol |
| DE1022040B (de) * | 1954-04-24 | 1958-01-02 | Bayerische Pflugfabrik Gmbh | Rechenrad |
| FR1109215A (fr) * | 1954-07-19 | 1956-01-24 | Faucheux Ets | Appareil agricole à organes de travail rotatifs tiré par tracteur |
| AT187731B (de) * | 1954-12-02 | 1956-11-26 | Heinrich Dipl Ing Wuester | Gerät zum Zusammenrechen von auf dem Boden liegendem Gut, insbesondere Heu |
| FR1147900A (fr) * | 1955-04-27 | 1957-12-02 | Lely Nv C Van Der | Roue de râteau ou de cultivateur munie de dents ou rayons |
| FR1154909A (fr) * | 1955-07-05 | 1958-04-18 | Lely Nv C Van Der | Dispositif déplaçant latéralement une récolte à terre, à l'aide de roues râteleuses actionnées par un dispositif d'entraînement |
| DE1745843U (de) * | 1955-12-16 | 1957-05-29 | Alfred Lang | Landwirtschaftliches arbeitsgeraet. |
| GB809841A (en) * | 1956-05-28 | 1959-03-04 | Charles Goodall | Rotary agricultural or horticultural machines |
| AT198559B (de) * | 1956-09-01 | 1958-07-10 | Steininger Maschinenfabrik & E | Als Schlepperanbaugerät ausgebildeter Graszetter |
-
0
- NL NL272457D patent/NL272457A/xx unknown
- NL NL100758D patent/NL100758C/xx active
- NL NL297621D patent/NL297621A/xx unknown
-
1959
- 1959-05-01 CH CH234064A patent/CH392972A/de unknown
- 1959-05-01 CH CH234264A patent/CH392135A/de unknown
- 1959-05-04 GB GB36972/62A patent/GB924274A/en not_active Expired
- 1959-05-04 GB GB15257/59A patent/GB924271A/en not_active Expired
- 1959-05-04 GB GB36973/62A patent/GB924275A/en not_active Expired
- 1959-05-04 GB GB36971/62A patent/GB924273A/en not_active Expired
- 1959-05-06 US US811445A patent/US3120092A/en not_active Expired - Lifetime
- 1959-05-16 DE DE19591482172 patent/DE1482172A1/de active Pending
- 1959-05-16 DE DEP22788A patent/DE1224082B/de active Pending
- 1959-05-16 DE DE1507353A patent/DE1507353C3/de not_active Expired
- 1959-05-16 DE DEP22789A patent/DE1187056B/de active Pending
- 1959-05-16 DE DEP34776A patent/DE1219723B/de active Pending
- 1959-05-16 DE DEL30870U patent/DE1845628U/de not_active Expired
- 1959-05-16 DE DEP14902U patent/DE1845627U/de not_active Expired
- 1959-05-16 DE DEI30876U patent/DE1845629U/de not_active Expired
- 1959-05-25 FR FR795488A patent/FR1225342A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE1219723B (de) | 1966-06-23 |
| DE1845627U (de) | 1962-01-25 |
| CH392972A (de) | 1965-05-31 |
| DE1187056B (de) | 1965-02-11 |
| NL297621A (enExample) | |
| DE1507353C3 (de) | 1978-11-02 |
| DE1224082B (de) | 1966-09-01 |
| GB924273A (en) | 1963-04-24 |
| DE1845628U (de) | 1962-01-25 |
| DE1507353A1 (de) | 1972-04-06 |
| NL272457A (enExample) | |
| DE1845629U (de) | 1962-01-25 |
| DE1507353B2 (de) | 1977-05-12 |
| GB924271A (en) | 1963-04-24 |
| GB924274A (en) | 1963-04-24 |
| NL100758C (enExample) | |
| US3120092A (en) | 1964-02-04 |
| CH392135A (de) | 1965-05-15 |
| GB924275A (en) | 1963-04-24 |
| FR1225342A (fr) | 1960-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1482172A1 (de) | Heuwerbungsmaschine | |
| DE602004009338T2 (de) | Landmaschine zum schwaden von auf dem boden liegenden produkten | |
| DE2814440A1 (de) | Erntemaschine | |
| DE102006043314B4 (de) | Erntemaschine | |
| DE60210242T2 (de) | Heuwerbungsmaschine mit Schwadgruppierungsvorrichtung | |
| DE2808354A1 (de) | Heuerntemaschine zum seitlichen schwadenlegen mit gesteuerten werkzeugtragarmen | |
| DE60112351T2 (de) | Heuwerbungsmaschine | |
| DE2843782A1 (de) | Heuerntemaschine ohne metallzinken | |
| DE1507341B2 (de) | Schleppergezogene heuwerbungsmaschine | |
| DE2844235A1 (de) | Heuwerbungsmaschine | |
| DE602005005143T2 (de) | Heuwerbungsmaschine | |
| DE1857283U (de) | Zinkenkorbheuer. | |
| DE2001374A1 (de) | Maehwerk | |
| DE19951183A1 (de) | Fahrzeug | |
| DE6606533U (de) | Heuwerbungsmaschine | |
| DE1482049C (de) | Heuwerbungsmaschine | |
| AT286796B (de) | Ladewagen für Halmgut od.dgl. | |
| DE2047801C3 (de) | Rübenerntemaschine | |
| DE1165923B (de) | Heuwerbungsmaschine | |
| DE911190C (de) | Maehdrescher | |
| DE2617970A1 (de) | Heuwerbungsmaschine | |
| AT115663B (de) | In einen Heu- und Schwadenwender umwandelbarer, seitlich ablegender Trommelheurechen. | |
| AT413313B (de) | Trägerfahrzeug für zwei schwadtrommeln | |
| DE502516C (de) | Fahrbarer Heulader | |
| AT413779B (de) | Schwadvorrichtung mit zwei schwadtrommeln |