DE1470984B2 - Stabilisatormischung für Misch- oder Pfropfpolymerisate von Acrylnitril, Butadien und Styrol - Google Patents
Stabilisatormischung für Misch- oder Pfropfpolymerisate von Acrylnitril, Butadien und StyrolInfo
- Publication number
- DE1470984B2 DE1470984B2 DE19631470984 DE1470984A DE1470984B2 DE 1470984 B2 DE1470984 B2 DE 1470984B2 DE 19631470984 DE19631470984 DE 19631470984 DE 1470984 A DE1470984 A DE 1470984A DE 1470984 B2 DE1470984 B2 DE 1470984B2
- Authority
- DE
- Germany
- Prior art keywords
- acrylonitrile
- styrene
- mixed
- butadiene
- graft
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 title claims description 39
- 239000003381 stabilizer Substances 0.000 title claims description 34
- 239000000203 mixture Substances 0.000 title claims description 32
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 title claims description 21
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 title claims description 19
- 229920000578 graft copolymer Polymers 0.000 title claims description 19
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 claims description 22
- 229920000642 polymer Polymers 0.000 claims description 16
- 229910052976 metal sulfide Inorganic materials 0.000 claims description 12
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 claims description 7
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 4
- WUPHOULIZUERAE-UHFFFAOYSA-N 3-(oxolan-2-yl)propanoic acid Chemical compound OC(=O)CCC1CCCO1 WUPHOULIZUERAE-UHFFFAOYSA-N 0.000 claims description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 2
- 229910052788 barium Inorganic materials 0.000 claims description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 2
- 229910052790 beryllium Inorganic materials 0.000 claims description 2
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 claims description 2
- 229910052980 cadmium sulfide Inorganic materials 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- 229910052749 magnesium Inorganic materials 0.000 claims description 2
- 239000011777 magnesium Substances 0.000 claims description 2
- 229910052712 strontium Inorganic materials 0.000 claims description 2
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims description 2
- 229910052725 zinc Inorganic materials 0.000 claims description 2
- 239000011701 zinc Substances 0.000 claims description 2
- 239000011347 resin Substances 0.000 description 22
- 229920005989 resin Polymers 0.000 description 22
- 238000002845 discoloration Methods 0.000 description 15
- 229920001971 elastomer Polymers 0.000 description 15
- 239000005060 rubber Substances 0.000 description 15
- 239000005083 Zinc sulfide Substances 0.000 description 13
- DRDVZXDWVBGGMH-UHFFFAOYSA-N zinc;sulfide Chemical compound [S-2].[Zn+2] DRDVZXDWVBGGMH-UHFFFAOYSA-N 0.000 description 13
- 229910052984 zinc sulfide Inorganic materials 0.000 description 12
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 10
- 229920000126 latex Polymers 0.000 description 8
- 229920002857 polybutadiene Polymers 0.000 description 7
- 239000003963 antioxidant agent Substances 0.000 description 6
- 239000004816 latex Substances 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 230000000704 physical effect Effects 0.000 description 6
- 229920003023 plastic Polymers 0.000 description 6
- 239000004033 plastic Substances 0.000 description 6
- -1 2,4 - methylene Chemical group 0.000 description 5
- 239000005062 Polybutadiene Substances 0.000 description 5
- 229920001577 copolymer Polymers 0.000 description 5
- 239000000314 lubricant Substances 0.000 description 5
- 238000006116 polymerization reaction Methods 0.000 description 5
- 239000011145 styrene acrylonitrile resin Substances 0.000 description 5
- 239000011787 zinc oxide Substances 0.000 description 5
- 229920000459 Nitrile rubber Polymers 0.000 description 4
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 4
- NTXGQCSETZTARF-UHFFFAOYSA-N buta-1,3-diene;prop-2-enenitrile Chemical compound C=CC=C.C=CC#N NTXGQCSETZTARF-UHFFFAOYSA-N 0.000 description 4
- 239000000178 monomer Substances 0.000 description 4
- 239000000049 pigment Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 230000006866 deterioration Effects 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 230000000737 periodic effect Effects 0.000 description 3
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 230000000087 stabilizing effect Effects 0.000 description 3
- 150000004763 sulfides Chemical class 0.000 description 3
- XOOUIPVCVHRTMJ-UHFFFAOYSA-L zinc stearate Chemical compound [Zn+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O XOOUIPVCVHRTMJ-UHFFFAOYSA-L 0.000 description 3
- OILMLWAZYNVPMG-UHFFFAOYSA-N 4-methyl-2-nonylphenol Chemical compound CCCCCCCCCC1=CC(C)=CC=C1O OILMLWAZYNVPMG-UHFFFAOYSA-N 0.000 description 2
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 230000003078 antioxidant effect Effects 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 239000006069 physical mixture Substances 0.000 description 2
- SCUZVMOVTVSBLE-UHFFFAOYSA-N prop-2-enenitrile;styrene Chemical group C=CC#N.C=CC1=CC=CC=C1 SCUZVMOVTVSBLE-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 230000006641 stabilisation Effects 0.000 description 2
- 238000011105 stabilization Methods 0.000 description 2
- 239000004408 titanium dioxide Substances 0.000 description 2
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 description 2
- OSVKHTYJGSWIBJ-UHFFFAOYSA-N 1,6-ditert-butyl-4-methylcyclohexa-2,4-dien-1-ol Chemical compound CC1=CC(C(C)(C)C)C(O)(C(C)(C)C)C=C1 OSVKHTYJGSWIBJ-UHFFFAOYSA-N 0.000 description 1
- KGRVJHAUYBGFFP-UHFFFAOYSA-N 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) Chemical compound CC(C)(C)C1=CC(C)=CC(CC=2C(=C(C=C(C)C=2)C(C)(C)C)O)=C1O KGRVJHAUYBGFFP-UHFFFAOYSA-N 0.000 description 1
- QVXGKJYMVLJYCL-UHFFFAOYSA-N 2,3-di(nonyl)-N-phenylaniline Chemical compound C(CCCCCCCC)C=1C(=C(C=CC1)NC1=CC=CC=C1)CCCCCCCCC QVXGKJYMVLJYCL-UHFFFAOYSA-N 0.000 description 1
- QZLAEIZEPJAELS-UHFFFAOYSA-N 2,4,4-trimethylpentane-2-thiol Chemical compound CC(C)(C)CC(C)(C)S QZLAEIZEPJAELS-UHFFFAOYSA-N 0.000 description 1
- QFCGHEBLSUPGPF-UHFFFAOYSA-N 4-methyl-2,6-bis(1-phenylethyl)phenol Chemical compound C=1C(C)=CC(C(C)C=2C=CC=CC=2)=C(O)C=1C(C)C1=CC=CC=C1 QFCGHEBLSUPGPF-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- LKDKCTLTRLXBKU-UHFFFAOYSA-N C(CCCCCC)C=1C(=C(C=CC1)NC1=CC=CC=C1)CCCCCCC Chemical compound C(CCCCCC)C=1C(=C(C=CC1)NC1=CC=CC=C1)CCCCCCC LKDKCTLTRLXBKU-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical group S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- OUBMGJOQLXMSNT-UHFFFAOYSA-N N-isopropyl-N'-phenyl-p-phenylenediamine Chemical compound C1=CC(NC(C)C)=CC=C1NC1=CC=CC=C1 OUBMGJOQLXMSNT-UHFFFAOYSA-N 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 229910010413 TiO 2 Inorganic materials 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- HBVZVLFUCBFLJQ-UHFFFAOYSA-N [O-2].[O-2].[Ti+4].[S-2].[Zn+2] Chemical compound [O-2].[O-2].[Ti+4].[S-2].[Zn+2] HBVZVLFUCBFLJQ-UHFFFAOYSA-N 0.000 description 1
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 229920001893 acrylonitrile styrene Polymers 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- CJDPJFRMHVXWPT-UHFFFAOYSA-N barium sulfide Chemical compound [S-2].[Ba+2] CJDPJFRMHVXWPT-UHFFFAOYSA-N 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 238000012662 bulk polymerization Methods 0.000 description 1
- 235000010354 butylated hydroxytoluene Nutrition 0.000 description 1
- JGIATAMCQXIDNZ-UHFFFAOYSA-N calcium sulfide Chemical compound [Ca]=S JGIATAMCQXIDNZ-UHFFFAOYSA-N 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 238000010528 free radical solution polymerization reaction Methods 0.000 description 1
- FVIZARNDLVOMSU-UHFFFAOYSA-N ginsenoside K Natural products C1CC(C2(CCC3C(C)(C)C(O)CCC3(C)C2CC2O)C)(C)C2C1C(C)(CCC=C(C)C)OC1OC(CO)C(O)C(O)C1O FVIZARNDLVOMSU-UHFFFAOYSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- GOJKBIHROGSVIJ-UHFFFAOYSA-N octyl bis(2-octylphenyl) phosphite Chemical compound C=1C=CC=C(CCCCCCCC)C=1OP(OCCCCCCCC)OC1=CC=CC=C1CCCCCCCC GOJKBIHROGSVIJ-UHFFFAOYSA-N 0.000 description 1
- 230000019612 pigmentation Effects 0.000 description 1
- 239000002861 polymer material Substances 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- QOQNJVLFFRMJTQ-UHFFFAOYSA-N trioctyl phosphite Chemical compound CCCCCCCCOP(OCCCCCCCC)OCCCCCCCC QOQNJVLFFRMJTQ-UHFFFAOYSA-N 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000004246 zinc acetate Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/30—Sulfur-, selenium- or tellurium-containing compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US234561A US3352820A (en) | 1962-10-31 | 1962-10-31 | Abs polymers stabilized with a metal sulfide and one or more phenolic, amine or phosphite antioxidants |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1470984A1 DE1470984A1 (de) | 1969-02-13 |
| DE1470984B2 true DE1470984B2 (de) | 1970-07-16 |
Family
ID=22881888
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19631470984 Pending DE1470984B2 (de) | 1962-10-31 | 1963-08-01 | Stabilisatormischung für Misch- oder Pfropfpolymerisate von Acrylnitril, Butadien und Styrol |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3352820A (enExample) |
| BE (1) | BE636312A (enExample) |
| DE (1) | DE1470984B2 (enExample) |
| FR (1) | FR1373728A (enExample) |
| GB (1) | GB986247A (enExample) |
| LU (1) | LU44306A1 (enExample) |
| NL (2) | NL122726C (enExample) |
| SE (1) | SE315125B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3031806A1 (de) * | 1979-08-22 | 1981-04-02 | Nautamix B.V., Overveen | Fluessiges stabilisierungsmittel und damit stabilisierte chlorhaltige thermoplaste |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS456944B1 (enExample) * | 1965-12-22 | 1970-03-10 | ||
| US3472813A (en) * | 1967-01-18 | 1969-10-14 | Argus Chem | Resistance of acrylonitrile butadiene styrene polymers to discoloration |
| US3639216A (en) * | 1967-11-11 | 1972-02-01 | Sumitomo Naugatuck | Improving adhesion of electroplated metal on graft copolymers |
| US4255321A (en) * | 1970-01-02 | 1981-03-10 | General Electric Company | Stabilized polyphenylene ether |
| US3856728A (en) * | 1971-04-26 | 1974-12-24 | Argus Chem | Acrylonitrile-butadiene-styrene polymers having improved resistance to discoloration |
| US3761541A (en) * | 1971-10-12 | 1973-09-25 | Gen Electric | Stabilized polyphenylene ethers |
| US4111905A (en) * | 1977-01-28 | 1978-09-05 | M&T Chemicals Inc. | Flame retarding agents and polymer compositions containing same |
| US4243577A (en) * | 1978-09-13 | 1981-01-06 | The Dow Chemical Company | Modified thermoplastic resins |
| CN106366553B (zh) * | 2016-08-29 | 2018-09-11 | 会通新材料股份有限公司 | 一种准渐变色离子增强次光源高透光、抗光腐蚀隐藏显示复合材料及其制备方法 |
| CN113897022B (zh) * | 2020-07-06 | 2024-03-01 | 合肥杰事杰新材料股份有限公司 | 一种耐候性能优异的纤维填充abs树脂及其制备方法 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2599544A (en) * | 1951-01-31 | 1952-06-10 | Phillips Petroleum Co | Stabilization of unsaturated organic material-sulfur dioxide resins with elemental sulfur or inorganic sulfides |
| US2985620A (en) * | 1956-08-16 | 1961-05-23 | Minnesota Mining & Mfg | Stabilization of perfluorochlorocarbon plastics |
| DE1068007B (enExample) * | 1957-08-08 | 1959-10-29 | ||
| US3058141A (en) * | 1958-08-25 | 1962-10-16 | Gen Motors Corp | Windshield cleaning system and wiper blades therefor |
| US3153098A (en) * | 1959-05-28 | 1964-10-13 | Ethyl Corp | Bis phenols |
| US3014954A (en) * | 1959-06-16 | 1961-12-26 | Monsanto Chemicals | Polyphosphorus esters and method of preparing same |
| US3014956A (en) * | 1959-07-21 | 1961-12-26 | Monsanto Chemicals | Pentavalent phosphorus esters |
| US3116305A (en) * | 1960-02-18 | 1963-12-31 | Shell Oil Co | Hydroxybenzyl esters |
| US3155704A (en) * | 1960-09-01 | 1964-11-03 | Ethyl Corp | O, o-dialkyl 3, 5-dialkyl 4-hydroxyphenylalkyl phosphonates and process for preparing same |
| NL279734A (enExample) * | 1961-06-26 | |||
| US3179701A (en) * | 1962-05-14 | 1965-04-20 | Shell Oil Co | (3, 5-dialkyl-4-hydroxyphenyl) (3, 5-dialkyl-4-hydroxybenzyl) sulfides |
-
0
- BE BE636312D patent/BE636312A/xx unknown
- NL NL299655D patent/NL299655A/xx unknown
- NL NL122726D patent/NL122726C/xx active
-
1962
- 1962-10-31 US US234561A patent/US3352820A/en not_active Expired - Lifetime
-
1963
- 1963-06-26 GB GB25348/63A patent/GB986247A/en not_active Expired
- 1963-07-30 FR FR943231A patent/FR1373728A/fr not_active Expired
- 1963-08-01 DE DE19631470984 patent/DE1470984B2/de active Pending
- 1963-08-21 LU LU44306D patent/LU44306A1/xx unknown
- 1963-10-10 SE SE11124/63A patent/SE315125B/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3031806A1 (de) * | 1979-08-22 | 1981-04-02 | Nautamix B.V., Overveen | Fluessiges stabilisierungsmittel und damit stabilisierte chlorhaltige thermoplaste |
Also Published As
| Publication number | Publication date |
|---|---|
| LU44306A1 (enExample) | 1963-10-21 |
| SE315125B (enExample) | 1969-09-22 |
| NL299655A (enExample) | |
| US3352820A (en) | 1967-11-14 |
| NL122726C (enExample) | |
| FR1373728A (fr) | 1964-10-02 |
| GB986247A (en) | 1965-03-17 |
| BE636312A (enExample) | |
| DE1470984A1 (de) | 1969-02-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2629202A1 (de) | Hitzestabilisierungszusammensetzung | |
| DE1669677A1 (de) | Stabilisierte halogenhaltige organische Polymermassen | |
| DE1520179C3 (de) | Verfahren zur Herstellung eines Acrylnitril-Butadien-Vinylaromat-Polymerisats | |
| DE1470984B2 (de) | Stabilisatormischung für Misch- oder Pfropfpolymerisate von Acrylnitril, Butadien und Styrol | |
| DE1268833B (de) | Thermoplastische Masse zur Herstellung von schlagfesten Formkoerpern | |
| DE2416988B2 (de) | Thermoplastische formmassen | |
| DE1218726B (de) | Stabilisierung von ABS-Polymerisaten und Styrol-Acrylnitril-Mischpolymerisaten gegenVerfaerbung und thermischen Abbau | |
| DE964542C (de) | Vulkanisiermittel | |
| DE1669989A1 (de) | Verwendung von Stabilisatormischungen zur Stabilisierung von halogenhaltigen Polymerisatkunststoffmischungen | |
| DE2161136A1 (de) | Polymerisatmassen | |
| DE2219708C3 (de) | Pfropfpolymerisat und Verwendung desselben zur Herstellung von Formmassen | |
| DE2307270C3 (de) | Polyvinylchlorid enthaltende thermoplastische Massen | |
| DE1544865C3 (enExample) | ||
| DE1269360B (de) | Verfahren zur Herstellung von thermoplastisch-elastischen Formmassen | |
| DE2308225A1 (de) | Pvc-mischung | |
| DE1468091A1 (de) | Stabilisierungsmittel | |
| DE1161008B (de) | Haertbare Formmassen aus AEthylenpolymeren | |
| CH524648A (de) | Elastisch-thermoplastische Formmassen mit guter Hitze- und Lichtstabilität | |
| DE1694101C3 (de) | Elastisch-thermoplastische Formmassen mit guter Hitze- und Lichtstabilität | |
| DE904466C (de) | Stabilisierte Massen aus halogenhaltigen Vinylharzen | |
| DE2613050C2 (de) | Verfahren zur Herstellung eines synthetischen Kautschuks mit verbesserter Grünfestigkeit | |
| DE69732604T2 (de) | Methode zur Kontrolle des Anstiegs der Viskosität von Naturkautschuk | |
| DE702210C (de) | Kautschuk | |
| DE2835937A1 (de) | Gegenueber oxidativer zersetzung stabilisierte polypropylen-polymer-masse | |
| DE1769958A1 (de) | Transparente Zusammensetzungen von Vinylhalogenidpolymerisaten und tert.-Alkylstyrol-acrylnitril-butadienkautschukpolymerisaten sowie Verfahren zu ihrer Herstellung |