DE1249280B - Verfahren zur Herstellung von Hydroxybenzyl y amino-pemciUmen - Google Patents
Verfahren zur Herstellung von Hydroxybenzyl y amino-pemciUmenInfo
- Publication number
- DE1249280B DE1249280B DENDAT1249280D DE1249280DA DE1249280B DE 1249280 B DE1249280 B DE 1249280B DE NDAT1249280 D DENDAT1249280 D DE NDAT1249280D DE 1249280D A DE1249280D A DE 1249280DA DE 1249280 B DE1249280 B DE 1249280B
- Authority
- DE
- Germany
- Prior art keywords
- group
- reacted
- bromine atom
- general formula
- anhydride
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 6
- 238000002360 preparation method Methods 0.000 title claims description 5
- 125000006289 hydroxybenzyl group Chemical group 0.000 title 1
- 150000003839 salts Chemical class 0.000 claims description 9
- -1 phenyloxycarbonyl Chemical group 0.000 claims description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- 150000008064 anhydrides Chemical class 0.000 claims description 6
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 claims description 6
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 claims description 6
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical compound [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 claims description 5
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 claims description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 3
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 150000001718 carbodiimides Chemical class 0.000 claims description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 3
- 150000004820 halides Chemical class 0.000 claims description 3
- 235000010299 hexamethylene tetramine Nutrition 0.000 claims description 3
- 239000004312 hexamethylene tetramine Substances 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 239000011800 void material Substances 0.000 claims 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 239000000047 product Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 230000003115 biocidal effect Effects 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 229940049954 penicillin Drugs 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- YSRHMZBYTFKOCX-UHFFFAOYSA-N 2-(3-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)acetic acid Chemical compound C=1C=CC(O)=CC=1C(C(=O)O)NC(=O)OCC1=CC=CC=C1 YSRHMZBYTFKOCX-UHFFFAOYSA-N 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 208000035473 Communicable disease Diseases 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 229930182555 Penicillin Natural products 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000293869 Salmonella enterica subsp. enterica serovar Typhimurium Species 0.000 description 1
- JVVXZOOGOGPDRZ-SLFFLAALSA-N [(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanamine Chemical compound NC[C@]1(C)CCC[C@]2(C)C3=CC=C(C(C)C)C=C3CC[C@H]21 JVVXZOOGOGPDRZ-SLFFLAALSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 244000144972 livestock Species 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 208000004396 mastitis Diseases 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 238000004816 paper chromatography Methods 0.000 description 1
- 235000019371 penicillin G benzathine Nutrition 0.000 description 1
- 229940056360 penicillin g Drugs 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 244000144977 poultry Species 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D499/21—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring with a nitrogen atom directly attached in position 6 and a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2
- C07D499/44—Compounds with an amino radical acylated by carboxylic acids, attached in position 6
- C07D499/48—Compounds with an amino radical acylated by carboxylic acids, attached in position 6 with a carbon chain, substituted by hetero atoms or by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, attached to the carboxamido radical
- C07D499/58—Compounds with an amino radical acylated by carboxylic acids, attached in position 6 with a carbon chain, substituted by hetero atoms or by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, attached to the carboxamido radical substituted in alpha-position to the carboxamido radical
- C07D499/64—Compounds with an amino radical acylated by carboxylic acids, attached in position 6 with a carbon chain, substituted by hetero atoms or by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, attached to the carboxamido radical substituted in alpha-position to the carboxamido radical by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Vertical, Hearth, Or Arc Furnaces (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB4154162A GB978178A (en) | 1958-10-06 | 1962-11-02 | Penicillins |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1249280B true DE1249280B (de) | 1967-09-07 |
Family
ID=10420176
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT1249280D Pending DE1249280B (de) | 1962-11-02 | Verfahren zur Herstellung von Hydroxybenzyl y amino-pemciUmen |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3192198A (enExample) |
| AT (1) | AT261803B (enExample) |
| BE (1) | BE639104A (enExample) |
| BR (1) | BR6354032D0 (enExample) |
| CH (1) | CH444164A (enExample) |
| DE (1) | DE1249280B (enExample) |
| DK (1) | DK123871B (enExample) |
| FI (1) | FI41745C (enExample) |
| FR (1) | FR3034M (enExample) |
| NL (1) | NL299897A (enExample) |
| NO (1) | NO125391B (enExample) |
| SE (1) | SE349305B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1929997A1 (de) * | 1968-06-13 | 1969-12-18 | Bristol Myers Co | Verfahren zur Herstellung von antibakteriellen Mitteln |
| DE1942693A1 (de) * | 1968-08-23 | 1970-02-26 | Beecham Group Ltd | Verfahren zur Herstellung von 6-[(-)-alpha-Amino-p-hydroxy-phenylacetamido] penicillansaeure |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1745619B1 (de) * | 1963-09-14 | 1969-09-11 | Bayer Ag | Verfahren zur Herstellung von halbsynthetischen 6-Acylaminopenicillansaeuren |
| US3301811A (en) * | 1963-10-28 | 1967-01-31 | Bristol Myers Co | Nu-hydroxypenicillin amides |
| USRE28744E (en) * | 1968-08-23 | 1976-03-23 | Beecham Group Limited | Crystalline p-hydroxyampicillin and salts thereof |
| IE34011B1 (en) * | 1969-03-13 | 1975-01-08 | Leo Pharm Prod Ltd | New penicillin esters |
| US4003887A (en) * | 1972-12-15 | 1977-01-18 | Sumitomo Chemical Company, Limited | Novel penicillins and their preparation |
| US4197240A (en) * | 1977-12-23 | 1980-04-08 | Yeda Research And Development Co. Ltd. | Penicillin derivatives |
| US4278600A (en) * | 1979-03-19 | 1981-07-14 | Bristol-Myers Company | Production of penicillins |
| US4240960A (en) * | 1979-03-19 | 1980-12-23 | Bristol-Myers Company | Trimethylsilyl substituted penicillins |
| US4310458A (en) * | 1979-03-19 | 1982-01-12 | Bristol-Myers Company | Production of penicillins |
| US4351766A (en) * | 1979-07-12 | 1982-09-28 | Bristol-Myers Company | Production of penicillins |
| US4946838A (en) * | 1981-07-13 | 1990-08-07 | E. R. Squibb & Sons, Inc. | Crystalline anhydrous aztreonam |
| US4457924A (en) * | 1981-12-22 | 1984-07-03 | Pfizer, Inc. | 1,1-Alkanediol dicarboxylate linked antibacterial agents |
| US4359472A (en) * | 1981-12-22 | 1982-11-16 | Pfizer Inc. | Bis-hydroxymethyl carbonate bridged antibacterial agents |
| US4462934A (en) | 1983-03-31 | 1984-07-31 | Pfizer Inc. | Bis-esters of dicarboxylic acids with amoxicillin and certain hydroxymethylpenicillanate 1,1-dioxides |
| IT1255716B (it) * | 1992-10-05 | 1995-11-10 | Procedimento per la preparazione di antibiotici beta-lattamici sterili | |
| ES2114476B1 (es) * | 1996-03-07 | 1999-07-01 | Dsm Deretil S A | Nuevas penicilinas. |
| US6169102B1 (en) | 1996-06-25 | 2001-01-02 | Takeda Chemical Industries, Ltd. | Oxazolone derivatives and their use as anti-Helicobacter pylori agent |
| US6225304B1 (en) | 1999-02-17 | 2001-05-01 | Pharmaceutical Solutions, Inc. | Soluble forms of amoxicillin and treatment of animals |
| US6475522B1 (en) * | 2000-08-30 | 2002-11-05 | Hammond Group, Inc. | Synthetic polymer compositions containing antibiotics as antidegradants |
| US20090075965A1 (en) * | 2007-09-13 | 2009-03-19 | Protia, Llc | Deuterium-enriched amoxicilin |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2985648A (en) * | 1958-10-06 | 1961-05-23 | Doyle Frank Peter | Alpha-aminobenzylpenicillins |
| US3040032A (en) * | 1959-07-02 | 1962-06-19 | Doyle Frank Peter | Synthetic penicillins and salts thereof |
| US3071575A (en) * | 1959-07-15 | 1963-01-01 | Beecham Res Lab | Synthetic penicillins and salts thereof |
| US3071576A (en) * | 1959-11-13 | 1963-01-01 | Beecham Res Lab | Synthetic penicillins |
-
0
- NL NL299897D patent/NL299897A/xx unknown
- BE BE639104D patent/BE639104A/xx unknown
- DE DENDAT1249280D patent/DE1249280B/de active Pending
-
1963
- 1963-10-24 SE SE11730/63A patent/SE349305B/xx unknown
- 1963-10-25 BR BR154032/63A patent/BR6354032D0/pt unknown
- 1963-10-29 AT AT863363A patent/AT261803B/de active
- 1963-10-29 FI FI632107A patent/FI41745C/fi active
- 1963-10-30 NO NO150636A patent/NO125391B/no unknown
- 1963-10-31 FR FR952405A patent/FR3034M/fr active Active
- 1963-10-31 US US320538A patent/US3192198A/en not_active Expired - Lifetime
- 1963-11-02 DK DK515563AA patent/DK123871B/da unknown
- 1963-11-04 CH CH1351063A patent/CH444164A/de unknown
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1929997A1 (de) * | 1968-06-13 | 1969-12-18 | Bristol Myers Co | Verfahren zur Herstellung von antibakteriellen Mitteln |
| DE1942693A1 (de) * | 1968-08-23 | 1970-02-26 | Beecham Group Ltd | Verfahren zur Herstellung von 6-[(-)-alpha-Amino-p-hydroxy-phenylacetamido] penicillansaeure |
| DE1967313C2 (de) * | 1968-08-23 | 1986-05-28 | Beecham Group Ltd., Brentford, Middlesex | Verwendung von (-)-α-Amino-p-hydroxybenzylpenicillin-trihydrat zur Herstellung eines Arzneimittels in oraler Applikationsform zur Bekämpfung bakterieller Infektionen des Menschen |
Also Published As
| Publication number | Publication date |
|---|---|
| FI41745C (fi) | 1970-02-10 |
| SE349305B (enExample) | 1972-09-25 |
| DK123871B (da) | 1972-08-14 |
| AT261803B (de) | 1968-05-10 |
| NL299897A (enExample) | |
| FI41745B (enExample) | 1969-10-31 |
| FR3034M (fr) | |
| BR6354032D0 (pt) | 1973-07-12 |
| BE639104A (enExample) | |
| NO125391B (enExample) | 1972-09-04 |
| US3192198A (en) | 1965-06-29 |
| CH444164A (de) | 1967-09-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1249280B (de) | Verfahren zur Herstellung von Hydroxybenzyl y amino-pemciUmen | |
| DE1295558B (de) | ª-Carboxybenzyl- und ª-Carboxythienylmethylpenicilline und Verfahren zu ihrer Herstellung | |
| DE2039214A1 (de) | Neue Tris-trijodisophthalsaeuremonoamide,Verfahren zu ihrer Herstellung und ihre Verwendung als Roentgenkontrastmittel | |
| DE1545609C3 (de) | 6 eckige Klammer auf alpha-Ureidophenylacetamido eckige Klammer zu penicillansäure und deren nichttoxische Salze | |
| DE1795861B1 (de) | alpha-(Alkoxycarbonyl)-thienylmethyl-penicilline und deren Salze,Verfahren zu deren Herstellung und diese Verbindungen enthaltende antibakterielle Mittel | |
| DE1670163B2 (de) | Cephaloglycinderivat und verfahren zu seiner herstellung | |
| DE1289053B (de) | ª‡-Hydroxy-2-thienylmethyl-penicilline und Verfahren zur ihrer Herstellung | |
| DE1911581B2 (de) | Cephalosporinderivate | |
| AT226364B (de) | Verfahren zur Herstellung von neuen Penicillinderivaten | |
| DE1670114A1 (de) | Penicilline und Verfahren zu ihrer Herstellung | |
| DE1941026C3 (de) | 6- eckige Klammer auf 2,2-Dimethyl-4-(p-hydroxyphenyl)-5-oxo-1-imidazolinyl eckige Klammer zu -penicHlansäure und Verfahren zu ihrer Herstellung | |
| AT270863B (de) | Verfahren zur Herstellung eines neuen Cephaloglycinderivates und seiner Salze | |
| DE2258930A1 (de) | Antibakterielle mittel und verfahren zu deren herstellung | |
| DE2550151A1 (de) | Neue cephalosporine, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE1795129B2 (de) | Verfahren zur Herstellung von Alkalimetallsalzen des a-Aminobenzylpenicillins und seiner Epimeren | |
| DE2147852A1 (de) | Neue Penicilline und Verfahren zu deren Herstellung | |
| AT234276B (de) | Verfahren zur Herstellung der neuen Verbindung α-Azidobenzylpenicillin | |
| AT270860B (de) | Verfahren zur Herstellung von neuen Penicillinen | |
| DE2251290C3 (de) | α-Sulfo-p-aminobenzylpenicillin | |
| AT228397B (de) | Verfahren zur Herstellung von Verbindungen mit antibakterieller Wirkung | |
| AT220288B (de) | Verfahren zur Herstellung von neuen therapeutisch wirksamen Estern des Erythromycins | |
| DE2150516B2 (enExample) | ||
| DE2759395B1 (de) | 4-Pyridylformimidoylglycyl-D-phenylglycin | |
| DE1745612C (de) | 7 (N Chloralkyl ureido) cephalospo ransauren und deren Salze sowie ein Ver fahren zu deren Herstellung | |
| AT268296B (de) | Verfahren zur Herstellung von neuen 6-Aminophenyl- und 6-Acylaminophenyl-4, 5-dihydropyridazonen (3) |