DE1240738B - Lichtempfindliche Schicht fuer die Trockenentwicklung - Google Patents
Lichtempfindliche Schicht fuer die TrockenentwicklungInfo
- Publication number
- DE1240738B DE1240738B DEK50826A DEK0050826A DE1240738B DE 1240738 B DE1240738 B DE 1240738B DE K50826 A DEK50826 A DE K50826A DE K0050826 A DEK0050826 A DE K0050826A DE 1240738 B DE1240738 B DE 1240738B
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- solution
- acid
- hydroxynaphthalene
- ecm
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 31
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 21
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 15
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 claims description 15
- -1 aromatic Diazo compound Chemical class 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 12
- 229940124530 sulfonamide Drugs 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 11
- 230000008018 melting Effects 0.000 claims description 11
- 238000002844 melting Methods 0.000 claims description 11
- 238000010168 coupling process Methods 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 230000008878 coupling Effects 0.000 claims description 9
- 238000005859 coupling reaction Methods 0.000 claims description 9
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 8
- 229910052757 nitrogen Inorganic materials 0.000 claims description 8
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 8
- 150000003456 sulfonamides Chemical class 0.000 claims description 8
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 claims description 8
- 238000000746 purification Methods 0.000 claims description 7
- 238000006243 chemical reaction Methods 0.000 claims description 6
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- 239000011593 sulfur Substances 0.000 claims description 5
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 239000000203 mixture Substances 0.000 claims description 4
- 239000011592 zinc chloride Substances 0.000 claims description 4
- 235000005074 zinc chloride Nutrition 0.000 claims description 4
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims description 3
- 239000004327 boric acid Substances 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 claims description 2
- IEIADDVJUYQKAZ-UHFFFAOYSA-N 1,8-naphthosultone Chemical compound C1=CC(S(=O)(=O)O2)=C3C2=CC=CC3=C1 IEIADDVJUYQKAZ-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- DIZPMCHEQGEION-UHFFFAOYSA-H aluminium sulfate (anhydrous) Chemical compound [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O DIZPMCHEQGEION-UHFFFAOYSA-H 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 claims description 2
- 238000004383 yellowing Methods 0.000 claims description 2
- 239000011541 reaction mixture Substances 0.000 claims 3
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 claims 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims 1
- 229960000583 acetic acid Drugs 0.000 claims 1
- 239000003610 charcoal Substances 0.000 claims 1
- 238000002425 crystallisation Methods 0.000 claims 1
- 230000008025 crystallization Effects 0.000 claims 1
- 238000004090 dissolution Methods 0.000 claims 1
- 239000005457 ice water Substances 0.000 claims 1
- 238000004898 kneading Methods 0.000 claims 1
- 238000006386 neutralization reaction Methods 0.000 claims 1
- 230000003472 neutralizing effect Effects 0.000 claims 1
- 229920002689 polyvinyl acetate Polymers 0.000 claims 1
- 239000011118 polyvinyl acetate Substances 0.000 claims 1
- 230000001376 precipitating effect Effects 0.000 claims 1
- 230000002035 prolonged effect Effects 0.000 claims 1
- 239000000377 silicon dioxide Substances 0.000 claims 1
- 238000005245 sintering Methods 0.000 claims 1
- 239000007787 solid Substances 0.000 claims 1
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- 150000001408 amides Chemical class 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 238000000354 decomposition reaction Methods 0.000 description 5
- 150000008049 diazo compounds Chemical class 0.000 description 5
- 239000000987 azo dye Substances 0.000 description 4
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 4
- 150000003460 sulfonic acids Chemical class 0.000 description 4
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- USWINTIHFQKJTR-UHFFFAOYSA-N 3-hydroxynaphthalene-2,7-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C=C(S(O)(=O)=O)C(O)=CC2=C1 USWINTIHFQKJTR-UHFFFAOYSA-N 0.000 description 2
- QEJUOCBDRDCLOP-UHFFFAOYSA-N 4-diazo-3-ethoxy-n,n-diethylcyclohexa-1,5-dien-1-amine Chemical compound CCOC1C=C(N(CC)CC)C=CC1=[N+]=[N-] QEJUOCBDRDCLOP-UHFFFAOYSA-N 0.000 description 2
- CQXXYOLFJXSRMT-UHFFFAOYSA-N 5-diazocyclohexa-1,3-diene Chemical compound [N-]=[N+]=C1CC=CC=C1 CQXXYOLFJXSRMT-UHFFFAOYSA-N 0.000 description 2
- DKJVSIITPZVTRO-UHFFFAOYSA-N 6,7-dihydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C=C(O)C(O)=CC2=C1 DKJVSIITPZVTRO-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000009435 amidation Effects 0.000 description 2
- 238000007112 amidation reaction Methods 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- YKYOUMDCQGMQQO-UHFFFAOYSA-L cadmium dichloride Chemical compound Cl[Cd]Cl YKYOUMDCQGMQQO-UHFFFAOYSA-L 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- WHQSYGRFZMUQGQ-UHFFFAOYSA-N n,n-dimethylformamide;hydrate Chemical compound O.CN(C)C=O WHQSYGRFZMUQGQ-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- AKYPSKXBHUGOHU-UHFFFAOYSA-N 3,6-dihydroxynaphthalene-2,7-disulfonic acid Chemical compound OC1=C(S(O)(=O)=O)C=C2C=C(S(O)(=O)=O)C(O)=CC2=C1 AKYPSKXBHUGOHU-UHFFFAOYSA-N 0.000 description 1
- ALKYHXVLJMQRLQ-UHFFFAOYSA-N 3-Hydroxy-2-naphthoate Chemical compound C1=CC=C2C=C(O)C(C(=O)O)=CC2=C1 ALKYHXVLJMQRLQ-UHFFFAOYSA-N 0.000 description 1
- YZYFPMLAGIGAJJ-UHFFFAOYSA-N 4-diazo-n,n-diethylcyclohexa-1,5-dien-1-amine Chemical compound CCN(CC)C1=CCC(=[N+]=[N-])C=C1 YZYFPMLAGIGAJJ-UHFFFAOYSA-N 0.000 description 1
- ZSUDUDXOEGHEJR-UHFFFAOYSA-N 4-methylnaphthalen-1-ol Chemical compound C1=CC=C2C(C)=CC=C(O)C2=C1 ZSUDUDXOEGHEJR-UHFFFAOYSA-N 0.000 description 1
- MHMYMQABTKLGDP-UHFFFAOYSA-N 5-diazo-2-ethoxycyclohexa-1,3-diene Chemical compound CCOC1=CCC(=[N+]=[N-])C=C1 MHMYMQABTKLGDP-UHFFFAOYSA-N 0.000 description 1
- SQQBGGWCRGUBTP-UHFFFAOYSA-N 8-hydroxy-5-methylnaphthalene-1-sulfonamide Chemical compound CC1=CC=C(C2=C(C=CC=C12)S(=O)(=O)N)O SQQBGGWCRGUBTP-UHFFFAOYSA-N 0.000 description 1
- MJYRKFPGDGQEBJ-UHFFFAOYSA-N 8-hydroxy-5-methylnaphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(C)=CC=C(O)C2=C1S(O)(=O)=O MJYRKFPGDGQEBJ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- 235000005811 Viola adunca Nutrition 0.000 description 1
- 240000009038 Viola odorata Species 0.000 description 1
- 235000013487 Viola odorata Nutrition 0.000 description 1
- 235000002254 Viola papilionacea Nutrition 0.000 description 1
- 244000172533 Viola sororia Species 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 1
- 229910001864 baryta Inorganic materials 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- ZPBSAMLXSQCSOX-UHFFFAOYSA-N naphthalene-1,3,6-trisulfonic acid Chemical compound OS(=O)(=O)C1=CC(S(O)(=O)=O)=CC2=CC(S(=O)(=O)O)=CC=C21 ZPBSAMLXSQCSOX-UHFFFAOYSA-N 0.000 description 1
- JRNGUTKWMSBIBF-UHFFFAOYSA-N naphthalene-2,3-diol Chemical compound C1=CC=C2C=C(O)C(O)=CC2=C1 JRNGUTKWMSBIBF-UHFFFAOYSA-N 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000004989 p-phenylenediamines Chemical class 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000001302 tertiary amino group Chemical group 0.000 description 1
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/52—Compositions containing diazo compounds as photosensitive substances
- G03C1/58—Coupling substances therefor
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB1052977D GB1052977A (https=) | 1963-09-14 | ||
| DEK50826A DE1240738B (de) | 1963-09-14 | 1963-09-14 | Lichtempfindliche Schicht fuer die Trockenentwicklung |
| NL646410312A NL139826B (nl) | 1963-09-14 | 1964-09-04 | Diazotypiemateriaal. |
| CH1182064A CH438934A (de) | 1963-09-14 | 1964-09-10 | Lichtempfindliche Schicht für die Trockenentwicklung |
| SE10968/64A SE305806B (https=) | 1963-09-14 | 1964-09-11 | |
| US395901A US3406071A (en) | 1963-09-14 | 1964-09-11 | Naphthol sulfonamides as coupling components for light-sensitive diazotype materials |
| BE653020A BE653020A (https=) | 1963-09-14 | 1964-09-11 | |
| AT784864A AT255892B (de) | 1963-09-14 | 1964-09-11 | Diazotypiematerial, insbesondere für die Trockenentwicklung |
| FR988037A FR1407598A (fr) | 1963-09-14 | 1964-09-14 | Couches photosensibles pour la diazotypie et destinées plus particulièrement à être développées par le procédé à sec |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEK50826A DE1240738B (de) | 1963-09-14 | 1963-09-14 | Lichtempfindliche Schicht fuer die Trockenentwicklung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1240738B true DE1240738B (de) | 1967-05-18 |
Family
ID=7225766
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEK50826A Pending DE1240738B (de) | 1963-09-14 | 1963-09-14 | Lichtempfindliche Schicht fuer die Trockenentwicklung |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3406071A (https=) |
| AT (1) | AT255892B (https=) |
| BE (1) | BE653020A (https=) |
| CH (1) | CH438934A (https=) |
| DE (1) | DE1240738B (https=) |
| GB (1) | GB1052977A (https=) |
| NL (1) | NL139826B (https=) |
| SE (1) | SE305806B (https=) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ZA6706734B (https=) * | 1966-11-10 | |||
| GB1278640A (en) * | 1969-01-09 | 1972-06-21 | Ricoh Kk | Improvements in and relating to photosensitive materials |
| DE2811981A1 (de) * | 1978-03-18 | 1979-09-27 | Hoechst Ag | 2-hydroxy-3-naphthoesaeureamide |
| DE2907446A1 (de) * | 1979-02-26 | 1980-09-04 | Hoechst Ag | Zweikomponenten-diazotypiematerial |
| NZ193654A (en) * | 1979-05-16 | 1984-08-24 | Wuelfing Johann A | Naphthalene sulphonamido-alkyl-piperidines,pyrrolidines or piperazines and pharmaceutical compositions |
| WO2024215900A2 (en) * | 2023-04-12 | 2024-10-17 | The Board Of Trustees Of The University Of Illinois | Agonists of small heterodimer partner for cancer therapy |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE367501A (https=) * | 1929-02-09 | |||
| US2356475A (en) * | 1936-07-07 | 1944-08-22 | Eastman Kodak Co | Phenolic and naphtholic couplers containing sulphonamide groups |
| NL52177C (https=) * | 1938-11-17 | |||
| US2537098A (en) * | 1946-04-12 | 1951-01-09 | Gen Aniline & Film Corp | Sulfonamide azo coupling components used in diazo types |
| US2423572A (en) * | 1946-05-03 | 1947-07-08 | Du Pont | Naphtholsulfonamidobenzaldehydes and acetals thereof |
| US2545057A (en) * | 1946-06-12 | 1951-03-13 | Gen Aniline & Film Corp | Diazotypes containing resorcinol sulfonic acids as coupling components |
| US2512845A (en) * | 1946-07-15 | 1950-06-27 | Ciba Ltd | Monoazo-dyestuffs |
| NL140419B (nl) * | 1947-06-06 | Western Electric Co | Werkwijze voor het bereiden van een minstens twee componenten met verschillende dampspanningen bevattende damp. | |
| US2603639A (en) * | 1948-12-03 | 1952-07-15 | Friedrichsen Wilhelm | Sulfonamido compounds |
| US2856397A (en) * | 1952-10-09 | 1958-10-14 | Basf Ag | Production of metal-containing azo dyestuffs |
| US2792383A (en) * | 1952-11-28 | 1957-05-14 | Ciba Ltd | Metalliferous monoazo-dyestuffs |
| DE1068555B (https=) * | 1957-02-04 | 1959-11-05 | ||
| DE1086124B (de) * | 1958-06-14 | 1960-07-28 | Kalle Ag | Diazotypie-Kopierschichten zur Herstellung von Zwischenoriginalen |
| NL276942A (https=) * | 1961-04-08 | 1900-01-01 | ||
| GB1052978A (https=) * | 1963-11-26 |
-
0
- GB GB1052977D patent/GB1052977A/en active Active
-
1963
- 1963-09-14 DE DEK50826A patent/DE1240738B/de active Pending
-
1964
- 1964-09-04 NL NL646410312A patent/NL139826B/xx unknown
- 1964-09-10 CH CH1182064A patent/CH438934A/de unknown
- 1964-09-11 AT AT784864A patent/AT255892B/de active
- 1964-09-11 US US395901A patent/US3406071A/en not_active Expired - Lifetime
- 1964-09-11 BE BE653020A patent/BE653020A/xx unknown
- 1964-09-11 SE SE10968/64A patent/SE305806B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BE653020A (https=) | 1965-03-11 |
| US3406071A (en) | 1968-10-15 |
| NL6410312A (https=) | 1965-03-15 |
| GB1052977A (https=) | |
| NL139826B (nl) | 1973-09-17 |
| SE305806B (https=) | 1968-11-04 |
| AT255892B (de) | 1967-07-25 |
| CH438934A (de) | 1967-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE827900C (de) | Entwickler fuer Schwarz-Weiss- und insbesondere fuer Farbenfotografie | |
| DE837958C (de) | Verfahren zur Herstellung von Azomethin-Farbstoffbildern durch farbgebende Entwicklung | |
| DE1178704B (de) | Diazotypiematerial | |
| DE1240738B (de) | Lichtempfindliche Schicht fuer die Trockenentwicklung | |
| DE1226879B (de) | Lichtempfindliches Kopiermaterial mit einseitig diazotiertem p-Phenylendiamin-Derivat als licht-empfindliche Substanz | |
| DE1148868B (de) | Photographische Materialien fuer das Silberfarbbleichverfahren | |
| DE1157483B (de) | Verfahren zur Herstellung gelber Farbbilder mit Hilfe der farbgebenden Entwicklung und lichtempfindliche Silberhalogenidemulsion hierfuer | |
| DE1137311B (de) | Farbkuppler fuer photographische Farbenbilder | |
| DE1156311B (de) | Photographische Materialien fuer das Silberfarbbleichverfahren | |
| DE1163675B (de) | Zweikomponenten-Diazotypielichtpausmaterial | |
| DE806936C (de) | Verfahren zur Herstellung von photographischen Farbbildern durch Farbentwicklung | |
| DE1226878B (de) | Lichtempfindliche Diazoschicht | |
| DE571692C (de) | Verfahren zum UEbersensibilisieren von photographischen Filmen | |
| DE872912C (de) | Verfahren zum Sensibilisieren photographischer Emulsionen | |
| DE1000392C2 (de) | Verfahren zur Herstellung von Diazoamino-Derivaten | |
| DE1544494B1 (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| DE857737C (de) | Photographische Halogensilberemulsion fuer die Farbenphotographie | |
| DE1242451B (de) | Diazotypieschicht | |
| DE1572023C3 (de) | Verfahren zur Erzeugung von Dfazotypiebildern | |
| DE1229844B (de) | Verfahren zur Herstellung von Lichtpausen | |
| AT219411B (de) | Photographisches Ein- oder Mehrschichtenmaterial | |
| DE1255486B (de) | Zweikomponenten-Diazotypiematerial | |
| DE604135C (de) | Verfahren zur Herstellung von wasserunloeslichen Azofarbstoffen | |
| DE1137626B (de) | Verfahren zur Herstellung farbiger photographischer Bilder nach dem Silberfarbbleichverfahren | |
| DE3938763C1 (https=) |