DE1235766B - Geraffte und zusammengedrueckte schlauchfoermige Wursthaut aus Cellulose in Form eines Rohres - Google Patents
Geraffte und zusammengedrueckte schlauchfoermige Wursthaut aus Cellulose in Form eines RohresInfo
- Publication number
- DE1235766B DE1235766B DEU6591A DEU0006591A DE1235766B DE 1235766 B DE1235766 B DE 1235766B DE U6591 A DEU6591 A DE U6591A DE U0006591 A DEU0006591 A DE U0006591A DE 1235766 B DE1235766 B DE 1235766B
- Authority
- DE
- Germany
- Prior art keywords
- tooth
- teeth
- roller
- rollers
- hose
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 235000013580 sausages Nutrition 0.000 title claims description 41
- 229920002678 cellulose Polymers 0.000 title claims description 7
- 239000001913 cellulose Substances 0.000 title claims description 7
- 230000000694 effects Effects 0.000 claims description 9
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 5
- 238000009826 distribution Methods 0.000 claims description 3
- 238000003825 pressing Methods 0.000 claims description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims 1
- 239000000463 material Substances 0.000 description 3
- 230000006835 compression Effects 0.000 description 2
- 238000007906 compression Methods 0.000 description 2
- 238000006073 displacement reaction Methods 0.000 description 2
- 239000004627 regenerated cellulose Substances 0.000 description 2
- 230000032258 transport Effects 0.000 description 2
- 244000059549 Borneo rubber Species 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- WYTGDNHDOZPMIW-RCBQFDQVSA-N alstonine Natural products C1=CC2=C3C=CC=CC3=NC2=C2N1C[C@H]1[C@H](C)OC=C(C(=O)OC)[C@H]1C2 WYTGDNHDOZPMIW-RCBQFDQVSA-N 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 238000005429 filling process Methods 0.000 description 1
- 235000015244 frankfurter Nutrition 0.000 description 1
- 238000007373 indentation Methods 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 238000011031 large-scale manufacturing process Methods 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A22—BUTCHERING; MEAT TREATMENT; PROCESSING POULTRY OR FISH
- A22C—PROCESSING MEAT, POULTRY, OR FISH
- A22C13/00—Sausage casings
- A22C13/0013—Chemical composition of synthetic sausage casings
-
- A—HUMAN NECESSITIES
- A22—BUTCHERING; MEAT TREATMENT; PROCESSING POULTRY OR FISH
- A22C—PROCESSING MEAT, POULTRY, OR FISH
- A22C13/00—Sausage casings
- A22C13/02—Shirring of sausage casings
-
- A—HUMAN NECESSITIES
- A22—BUTCHERING; MEAT TREATMENT; PROCESSING POULTRY OR FISH
- A22C—PROCESSING MEAT, POULTRY, OR FISH
- A22C13/00—Sausage casings
- A22C2013/0096—Sausage casings cellulosic
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Food Science & Technology (AREA)
- Meat, Egg Or Seafood Products (AREA)
- Treatment Of Fiber Materials (AREA)
- Processing Of Meat And Fish (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US768166A US2984574A (en) | 1958-10-20 | 1958-10-20 | Shirred cellulosic sausage casing and method of manufacture |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1235766B true DE1235766B (de) | 1967-03-02 |
Family
ID=25081738
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEU6591A Pending DE1235766B (de) | 1958-10-20 | 1959-10-19 | Geraffte und zusammengedrueckte schlauchfoermige Wursthaut aus Cellulose in Form eines Rohres |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US2984574A (show.php) |
| BE (1) | BE583759A (show.php) |
| CH (1) | CH362332A (show.php) |
| DE (1) | DE1235766B (show.php) |
| FR (1) | FR1243052A (show.php) |
| GB (1) | GB922908A (show.php) |
| LU (1) | LU37808A1 (show.php) |
| NL (2) | NL244482A (show.php) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1632115B1 (de) * | 1967-12-27 | 1970-02-12 | Kalle Ag | Maschine zum Raffen von künstlichen Wursthüllen |
| DE1632114B1 (de) * | 1967-12-27 | 1970-02-12 | Kalle Ag | Maschine zum Raffen von künstlichen Wursthüllen |
| DE2147498A1 (de) * | 1971-09-23 | 1973-04-05 | Kalle Ag | Verfahren und vorrichtung zum raffen von huellen |
| DK152742B (da) * | 1971-09-23 | 1988-05-09 | Hoechst Ag | Rynket emballeringshylster, isaer poelseskind samt fremgangsmmaade og apparat til fremstilling af dette. |
Families Citing this family (56)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL282315A (show.php) * | 1961-08-24 | |||
| DE1271585B (de) * | 1961-08-24 | 1968-06-27 | Kalle Ag | Vorrichtung zum Raffen von Wursthuellen |
| US3148992A (en) * | 1962-03-13 | 1964-09-15 | Union Carbide Corp | Method of packaging shirred meat casings and package |
| NL130708C (show.php) * | 1963-06-14 | |||
| US3266911A (en) * | 1963-10-07 | 1966-08-16 | Tee Pak Inc | Method of shirring synthetic tubular sausage casing |
| US3397069A (en) * | 1964-12-15 | 1968-08-13 | Union Carbide Corp | Coherent self-sustaining stick of shirred and compressed tubular sausage casing |
| DE1782331C2 (de) * | 1968-08-16 | 1974-09-19 | Union Carbide Corp., New York, N.Y. (V.St.A.) | Verfahren und Vorrichtung zur Herstellung von gerafften, schlauchfö'rmigen Nahrungsmittelhüllen |
| US3704483A (en) * | 1970-03-05 | 1972-12-05 | Union Carbide Corp | Method of making shirred tubing |
| US3865954A (en) * | 1972-04-11 | 1975-02-11 | Union Carbide Corp | Closure for shirred casing sticks |
| US3886979A (en) * | 1972-08-01 | 1975-06-03 | Union Carbide Corp | Shirred tubular food casings having a barrier coating |
| DE2309720C2 (de) * | 1973-02-27 | 1983-04-14 | Hoechst Ag, 6230 Frankfurt | Verfahren und Vorrichtung zum Raffen von Schlauchhüllen |
| US4176204A (en) * | 1974-01-25 | 1979-11-27 | Bruno Winkler | Process for shirring tubular films and product thereof |
| DE2403470C3 (de) * | 1974-01-25 | 1981-02-12 | Naturin-Werk Becker & Co, 6940 Weinheim | Vorrichtung zum Raffen von Schlauchfolien aus tierischer Hautfasermasse |
| US3892869A (en) * | 1974-03-27 | 1975-07-01 | Union Carbide Corp | End plug closures for shirred casing sticks and methods for making them |
| US4077090A (en) | 1976-05-14 | 1978-03-07 | Union Carbide Corporation | Food casing stuffing sizing control apparatus |
| US4164057A (en) * | 1976-05-14 | 1979-08-14 | Union Carbide Corporation | Food casing stuffing sizing control method |
| FI64497C (fi) * | 1976-10-16 | 1983-12-12 | Guenter Kollross | Anordning foer axiell hopstoetning av ett tunnvaeggigt slangmaterial skaerskilt en konsttarm foer korvtillverkning |
| US4133076A (en) * | 1977-06-30 | 1979-01-09 | Union Carbide Corporation | Large casings stuffing product stoppering means |
| CA1089700A (en) * | 1977-08-25 | 1980-11-18 | David W. Clark | Self-sustaining stick of shirred casing |
| US4210981A (en) * | 1978-09-29 | 1980-07-08 | Union Carbide Corporation | Ectating ring shirring method and apparatus |
| US4834993A (en) * | 1979-07-31 | 1989-05-30 | Viskase Corporation | Method for external liquid smoke treatment of cellulosic food casings |
| US4525397A (en) * | 1979-07-31 | 1985-06-25 | Union Carbide Corporation | Liquid smoke treated cellulosic food casings |
| DE2944623C2 (de) * | 1979-11-05 | 1983-10-13 | Günter 6080 Groß-Gerau Kollross | Vorrichtung zum axialen Raffen von synthetischem Schlauchmaterial zur Weiterverarbeitung insbesondere auf Wurstfüllautomaten |
| DE3020734A1 (de) * | 1980-05-31 | 1981-12-10 | Günter 6080 Groß-Gerau Kollross | Vorrichtung zum axialen raffen von schlauchhuellen, insbesondere fuer die wurstherstellung |
| NZ200366A (en) * | 1981-05-01 | 1986-07-11 | Union Carbide Corp | Cored high density shirred food casing |
| CA1183396A (en) * | 1981-06-12 | 1985-03-05 | Arthur L. Sheridan | Tension sleeve supported casing article |
| US4409251A (en) * | 1982-03-25 | 1983-10-11 | Union Carbide Corporation | Controllably moisturized mold resistant cellulosic food casings |
| US4688298A (en) * | 1982-04-05 | 1987-08-25 | Viskase Corporation | Cored high density shirred casings |
| US4466463A (en) * | 1982-09-30 | 1984-08-21 | Union Carbide Corporation | Disk pairs inside package article for automatically and continuously making sausages with flat ends |
| US4551884A (en) * | 1982-09-30 | 1985-11-12 | Union Carbide Corporation | Method and apparatus for use in automatically and continuously making sausages with flat ends |
| US4466466A (en) * | 1982-09-30 | 1984-08-21 | Union Carbide Corporation | Overwrapped disks in a package article for automatically and continuously making sausages with flat ends |
| US4466465A (en) * | 1982-09-30 | 1984-08-21 | Union Carbide Corporation | Package article for automatically and continuously making sausages with flat ends |
| US4466464A (en) * | 1982-09-30 | 1984-08-21 | Union Carbide Corporation | Overwrapped disk pairs in a package article for automatically and continuously making sausages with flat ends |
| US4500576A (en) * | 1983-02-14 | 1985-02-19 | Union Carbide Corporation | Inhibition of discoloration on cellulose food casings |
| US4511613A (en) * | 1983-02-14 | 1985-04-16 | Union Carbide Corporation | Method for inhibiting discoloration on cellulose food casings |
| US4518619A (en) * | 1983-02-15 | 1985-05-21 | Union Carbide Corporation | Preparation of smoke treated, stuffed food casings |
| GB8408330D0 (en) * | 1984-03-30 | 1984-05-10 | Devro Ltd | Shirring tubular casing |
| EP0180666B1 (en) * | 1984-11-05 | 1989-07-26 | International Chemical Engineering AG | A tubular casing for foodstuffs |
| US4648428A (en) * | 1984-12-21 | 1987-03-10 | Teepak, Inc. | Shirred tubular material |
| NL8601320A (nl) * | 1986-05-23 | 1987-12-16 | Krehalon Bv | Werkwijze voor het geven van een vorm aan krimpbare kunstdarmen. |
| US4818551A (en) * | 1986-08-05 | 1989-04-04 | Viskase Corporation | Method of making a liquid smoke impregnated shirred casing stick |
| US5230933A (en) * | 1990-07-11 | 1993-07-27 | Viskase Corporation | Acid resistant peelable casing |
| US5173074A (en) | 1991-10-15 | 1992-12-22 | Viskase Corporation | Method and apparatus for severing shirred tubular food casing, and article |
| CA2090884C (en) | 1992-03-04 | 2001-10-16 | John Markulin | Cellulosic article containing an olefinic oxide polymer and method of manufacture |
| US5979509A (en) | 1994-09-15 | 1999-11-09 | Teepak Investments, Inc. | Method and apparatus for smoothening the surface of shirred food casings |
| US5782683A (en) * | 1996-08-27 | 1998-07-21 | Alfacel S.A. | Cold temperature shirring |
| US5914141A (en) * | 1997-03-11 | 1999-06-22 | Alfacel S.A. | Easy peeling wiener casings via use of enzymes |
| DE10049178A1 (de) * | 2000-10-05 | 2002-04-11 | Guenter Kollross | Geraffte Schlauchfolie sowie Verfahren und Vorrichtung zum Raffen |
| US7001635B2 (en) * | 2002-05-06 | 2006-02-21 | Viskase Corporation | Process for improving smoky color of an encased food product |
| US20040062834A1 (en) * | 2002-09-26 | 2004-04-01 | Casematic, S.A. De C.V. | Polyamide-based sausage casing |
| US20040202762A1 (en) * | 2003-04-08 | 2004-10-14 | Ducharme Paul E | Smoked nonfibrous casing |
| US20070148294A1 (en) * | 2003-04-08 | 2007-06-28 | Ducharme Paul E Jr | Smoked nonfibrous casing |
| US7507150B2 (en) * | 2004-08-23 | 2009-03-24 | Visko Teepak Belgium Nv | Shirred casing |
| CN102948451B (zh) * | 2011-08-25 | 2014-10-22 | 梧州神冠蛋白肠衣有限公司 | 一种套缩头 |
| CN104872264B (zh) * | 2015-05-26 | 2017-04-05 | 广东德福隆生物科技有限公司 | 一种用于输送肠衣的抹油夹 |
| CN106386993B (zh) * | 2015-05-26 | 2019-01-25 | 广东德福隆生物科技有限公司 | 一种改进结构的套缩机 |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2722714A (en) * | 1954-02-12 | 1955-11-08 | Tee Pak Inc | Shirring machine |
| FR1122079A (fr) * | 1954-02-11 | 1956-08-31 | United Shoe Machinery Ab | Machine à découper, perforer ou opérations analogues |
| US2819488A (en) * | 1954-07-07 | 1958-01-14 | Union Carbide Corp | Shirring apparatus |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2001461A (en) * | 1934-06-08 | 1935-05-14 | Visking Corp | Shirred tubing and method of preparing the same |
| US2583654A (en) * | 1947-12-27 | 1952-01-29 | Transparent Package Company | Automatic shirring machine |
-
0
- NL NL114002D patent/NL114002C/xx active
- NL NL244482D patent/NL244482A/xx unknown
- LU LU37808D patent/LU37808A1/xx unknown
-
1958
- 1958-10-20 US US768166A patent/US2984574A/en not_active Expired - Lifetime
-
1959
- 1959-10-17 FR FR807803A patent/FR1243052A/fr not_active Expired
- 1959-10-19 GB GB35276/59A patent/GB922908A/en not_active Expired
- 1959-10-19 BE BE583759A patent/BE583759A/fr unknown
- 1959-10-19 CH CH362332D patent/CH362332A/fr unknown
- 1959-10-19 DE DEU6591A patent/DE1235766B/de active Pending
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1122079A (fr) * | 1954-02-11 | 1956-08-31 | United Shoe Machinery Ab | Machine à découper, perforer ou opérations analogues |
| US2722714A (en) * | 1954-02-12 | 1955-11-08 | Tee Pak Inc | Shirring machine |
| US2722715A (en) * | 1954-02-12 | 1955-11-08 | Tee Pak Inc | Shirring method |
| US2723201A (en) * | 1954-02-12 | 1955-11-08 | Tee Pak Inc | Shirred casing |
| US2819488A (en) * | 1954-07-07 | 1958-01-14 | Union Carbide Corp | Shirring apparatus |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1632115B1 (de) * | 1967-12-27 | 1970-02-12 | Kalle Ag | Maschine zum Raffen von künstlichen Wursthüllen |
| DE1632114B1 (de) * | 1967-12-27 | 1970-02-12 | Kalle Ag | Maschine zum Raffen von künstlichen Wursthüllen |
| DE2147498A1 (de) * | 1971-09-23 | 1973-04-05 | Kalle Ag | Verfahren und vorrichtung zum raffen von huellen |
| DK152742B (da) * | 1971-09-23 | 1988-05-09 | Hoechst Ag | Rynket emballeringshylster, isaer poelseskind samt fremgangsmmaade og apparat til fremstilling af dette. |
Also Published As
| Publication number | Publication date |
|---|---|
| GB922908A (en) | 1963-04-03 |
| CH362332A (fr) | 1962-05-31 |
| US2984574A (en) | 1961-05-16 |
| BE583759A (fr) | 1960-02-15 |
| FR1243052A (fr) | 1960-10-07 |
| NL244482A (show.php) | |
| LU37808A1 (show.php) | |
| NL114002C (show.php) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1235766B (de) | Geraffte und zusammengedrueckte schlauchfoermige Wursthaut aus Cellulose in Form eines Rohres | |
| DE1632137C3 (de) | Verfahren und Vorrichtung zum Kräuseln von Wursthüllen | |
| DE2317867C2 (de) | Endverschluß einer als hohle Raupe gerafften Nahrungsmittelhülle und Vorrichtung zu seiner Herstellung | |
| DE1532028B1 (de) | Verfahren und Vorrichtung zur Herstellung von gerafften Wursthuellen | |
| EP0110341B1 (de) | Verfahren und Vorrichtung zum Öffnen, axialen Raffen und Abtrennen von dünnwandigem Schlauchhüllenmaterial und zum anschliessenden Überführen der dadurch gebildeten Raupen an eine Weiterverarbeitungsstelle | |
| DE2632853A1 (de) | Vorrichtung zum herstellen von beuteln aus einer zweilagigen bahn aus thermoplastischem material | |
| DE2939318A1 (de) | Verfahren und vorrichtung zum raffen von schlaeuchen | |
| DE3322105A1 (de) | Verfahren zum raffen von schlauchfoermigen huellen und vorrichtung fuer dieses verfahren | |
| DE2328363A1 (de) | Verfahren und werkzeug zur herstellung eines gerollten randes fuer einen behaelter sowie behaelter mit einem solchen rand | |
| DE68915360T2 (de) | Verfahren und Vorrichtung zum Abtrennen von gefalteten Nahrungsumhüllungen. | |
| DE1954103A1 (de) | Verfahren und Vorrichtung zum Raffen von endlosen stranggepressten Schlaeuchen | |
| DE2309721C2 (de) | Verfahren und Vorrichtung zum Raffen von Schlauchhüllen | |
| DE2528472A1 (de) | Vorrichtung zur herstellung von essbaren schlaeuchen | |
| DE2122391A1 (de) | Wursthüllenstöcke | |
| DE3416125A1 (de) | Geraffte schlauchraupe mit endverschluss und verfahren zu ihrer herstellung | |
| DE1943097C3 (de) | Verfahren und Vorrichtung zur Herstellung von spiralförmig gewickelten, starkwandigen Papprohrabschnitten mit polygonalem Querschnitt | |
| DE2147498C3 (de) | Verfahren und Vorrichtung zum Raffen von Hüllen | |
| DE69201014T2 (de) | Verfahren und Vorrichtung zur Herstellung von Hüllen zum Füllen mit Fleischwaren. | |
| DE3230358A1 (de) | Geraffte schlauchhuelle, rafforgan zu ihrer herstellung sowie vorrichtung mit diesem rafforgan | |
| DE1102542B (de) | Vorrichtung zur zickzackfoermigen Verformung von Papier, Pappe od. dgl. | |
| DE1432502C (de) | Vorrichtung zum Raffen von Hüllen, insbesondere Wursthullen | |
| DE1139049B (de) | Verfahren und Vorrichtung zum Raffen von Wursthuellen | |
| DE2360480A1 (de) | Einseitig verschlossener hohlstab aus geraffter schlauchhuelle mit innenliegendem, aus der schlauchhuelle selbst gebildetem verschluss sowie verfahren zur herstellung des verschlusses | |
| DE2318457C3 (de) | Hohlstab aus geraffter Hülle mit innenliegendem, aus dem Hüllmaterial selbst gebildetem Endverschluß in Gestalt eines als Rolle ausgebildeten Schlauchwickels und Verfahren zu seiner Herstellung | |
| DE2004444C3 (de) | Vorrichtung zur Herstellung von Dunnwandrohren |