DE1234709B - Kontinuierliches Verfahren zum Bleichen saurer Sulfonierungsprodukte - Google Patents
Kontinuierliches Verfahren zum Bleichen saurer SulfonierungsprodukteInfo
- Publication number
- DE1234709B DE1234709B DEH51383A DEH0051383A DE1234709B DE 1234709 B DE1234709 B DE 1234709B DE H51383 A DEH51383 A DE H51383A DE H0051383 A DEH0051383 A DE H0051383A DE 1234709 B DE1234709 B DE 1234709B
- Authority
- DE
- Germany
- Prior art keywords
- bleaching
- product
- bleach
- stage
- weight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000004061 bleaching Methods 0.000 title claims description 38
- 230000002378 acidificating effect Effects 0.000 title claims description 10
- 238000010924 continuous production Methods 0.000 title claims description 4
- 239000000047 product Substances 0.000 claims description 43
- 239000007844 bleaching agent Substances 0.000 claims description 39
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 25
- 238000006277 sulfonation reaction Methods 0.000 claims description 21
- 239000002253 acid Substances 0.000 claims description 15
- 150000004665 fatty acids Chemical group 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 13
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 239000000243 solution Substances 0.000 claims description 12
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 11
- 239000000194 fatty acid Substances 0.000 claims description 11
- 229930195729 fatty acid Natural products 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 claims description 10
- -1 fatty acid esters Chemical class 0.000 claims description 9
- 150000007513 acids Chemical class 0.000 claims description 7
- 239000003795 chemical substances by application Substances 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- 230000003472 neutralizing effect Effects 0.000 claims description 6
- 239000002002 slurry Substances 0.000 claims description 6
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 5
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical class [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 claims description 5
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 229910052740 iodine Inorganic materials 0.000 claims description 5
- 239000011630 iodine Substances 0.000 claims description 5
- 239000007864 aqueous solution Substances 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 claims description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- 150000008064 anhydrides Chemical class 0.000 claims description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 239000011734 sodium Substances 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- 239000012043 crude product Substances 0.000 claims 2
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 claims 1
- 150000004679 hydroxides Chemical class 0.000 claims 1
- 238000002372 labelling Methods 0.000 claims 1
- SWHAQEYMVUEVNF-UHFFFAOYSA-N magnesium potassium Chemical compound [Mg].[K] SWHAQEYMVUEVNF-UHFFFAOYSA-N 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000003860 storage Methods 0.000 description 5
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000003760 tallow Substances 0.000 description 4
- 239000013543 active substance Substances 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000006386 neutralization reaction Methods 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 229910019093 NaOCl Inorganic materials 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 2
- 150000003460 sulfonic acids Chemical class 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- QBWCMBCROVPCKQ-UHFFFAOYSA-N chlorous acid Chemical class OCl=O QBWCMBCROVPCKQ-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 235000019387 fatty acid methyl ester Nutrition 0.000 description 1
- 230000009969 flowable effect Effects 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- 210000000936 intestine Anatomy 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000013021 overheating Methods 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000002123 temporal effect Effects 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 230000008733 trauma Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F16—ENGINEERING ELEMENTS AND UNITS; GENERAL MEASURES FOR PRODUCING AND MAINTAINING EFFECTIVE FUNCTIONING OF MACHINES OR INSTALLATIONS; THERMAL INSULATION IN GENERAL
- F16C—SHAFTS; FLEXIBLE SHAFTS; ELEMENTS OR CRANKSHAFT MECHANISMS; ROTARY BODIES OTHER THAN GEARING ELEMENTS; BEARINGS
- F16C2300/00—Application independent of particular apparatuses
- F16C2300/10—Application independent of particular apparatuses related to size
- F16C2300/14—Large applications, e.g. bearings having an inner diameter exceeding 500 mm
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEH51383A DE1234709B (de) | 1964-01-15 | 1964-01-15 | Kontinuierliches Verfahren zum Bleichen saurer Sulfonierungsprodukte |
| NL6414745A NL6414745A (enExample) | 1964-01-15 | 1964-12-17 | |
| US424857A US3452064A (en) | 1964-01-15 | 1965-01-11 | Process for the manufacture of light colored surface-active sulfo fatty acid esters |
| BE658224D BE658224A (enExample) | 1964-01-15 | 1965-01-13 | |
| AT26465A AT257557B (de) | 1964-01-15 | 1965-01-14 | Kontinuierliches Verfahren zum Bleichen saurer Sulfonierungsprodukte |
| GB1612/65A GB1063431A (en) | 1964-01-15 | 1965-01-14 | Improvements in and relating to the bleaching of sulphonation products |
| FR1922A FR1420898A (fr) | 1964-01-15 | 1965-01-14 | Procédé de préparation d'esters de sulfo-acides gras tensio-actifs de couleur claire |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEH51383A DE1234709B (de) | 1964-01-15 | 1964-01-15 | Kontinuierliches Verfahren zum Bleichen saurer Sulfonierungsprodukte |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1234709B true DE1234709B (de) | 1967-02-23 |
Family
ID=7157677
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEH51383A Pending DE1234709B (de) | 1964-01-15 | 1964-01-15 | Kontinuierliches Verfahren zum Bleichen saurer Sulfonierungsprodukte |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3452064A (enExample) |
| AT (1) | AT257557B (enExample) |
| BE (1) | BE658224A (enExample) |
| DE (1) | DE1234709B (enExample) |
| FR (1) | FR1420898A (enExample) |
| GB (1) | GB1063431A (enExample) |
| NL (1) | NL6414745A (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0054724A1 (de) * | 1980-12-19 | 1982-06-30 | Henkel Kommanditgesellschaft auf Aktien | Verfahren zur vereinfachten Gewinnung von hellfarbigen waschaktiven alpha-Sulfofettsäureestern |
| EP0363781A1 (de) * | 1988-10-10 | 1990-04-18 | Henkel Kommanditgesellschaft auf Aktien | Verfahren zur Herstellung hellfarbiger alpha-Sulfofettsäurealkylestersalze |
| EP3409265A1 (de) | 2017-05-29 | 2018-12-05 | Basf Se | Verfahren zur herstellung von hellfarbigem disalz |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2555076C2 (de) * | 1975-12-06 | 1986-03-20 | Henkel KGaA, 4000 Düsseldorf | Kontinuierliches Verfahren zum Bleichen saurer α-Sulfofettsäureester |
| DE3319591A1 (de) * | 1983-05-30 | 1984-12-06 | Henkel KGaA, 4000 Düsseldorf | Verfahren zur gewinnung farbstabiler hellfarbiger waessriger salzpasten von waschaktiven (alpha)-sulfofettsaeureestern |
| DE3432324A1 (de) * | 1984-09-03 | 1986-03-13 | Henkel KGaA, 4000 Düsseldorf | Verfahren zur regelung des disalzgehalts in (alpha)-sulfofettsaeureester-tensiden |
| DE3538910A1 (de) * | 1985-11-02 | 1987-05-14 | Henkel Kgaa | Verfahren zur herstellung beweglicher pasten waschaktiver alpha-sulfofettsaeureestersalze hohen feststoffgehalts |
| US5397494A (en) * | 1990-10-30 | 1995-03-14 | The Procter & Gamble Company | Improving the color of surfactant agglomerates by admixing a solid bleaching agent |
| EP0483413B1 (en) * | 1990-10-30 | 1996-01-31 | The Procter & Gamble Company | Improving the colour of surfactant agglomerates by admixing a solid bleaching agent |
| WO1993013113A1 (de) * | 1991-12-21 | 1993-07-08 | Henkel Kommanditgesellschaft Auf Aktien | Verfahren zur bleiche oberflächenaktiver verbindungen |
| US5429773A (en) * | 1993-02-05 | 1995-07-04 | The Procter & Gamble Company | Process to improve alkyl ester sulfonate surfactant compositions |
| DE4316601A1 (de) * | 1993-05-18 | 1994-11-24 | Henkel Kgaa | Verfahren zur Herstellung hellfarbiger Alkyl- und/oder Alkenyloligoglycoside |
| US6184190B1 (en) * | 2000-06-08 | 2001-02-06 | Colgate-Palmolive Co. | Aqueous solution of an alpha sulfonate surfactant comprising 1,3-bis (hydroxymethyl)-5, 5-dimethylimidazolidine-2, 4 dione |
| CN100509769C (zh) * | 2006-04-27 | 2009-07-08 | 李宏才 | α-磺基脂肪酸酯盐制备方法 |
| CN114605293B (zh) * | 2022-03-17 | 2024-08-02 | 广州市日用化学工业研究所有限公司 | 一种脂肪酸甲酯磺酸盐的制备工艺 |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB360002A (en) * | 1930-07-21 | 1931-10-21 | Ig Farbenindustrie Ag | Improvements in the manufacture and production of wetting, washing, emulsifying and dispersing agents |
| GB745189A (en) * | 1952-10-31 | 1956-02-22 | Colgate Palmolive Co | Manufacture of sulphate and sulphonate synthetic detergents |
| US2804466A (en) * | 1954-10-14 | 1957-08-27 | Colgate Palmolive Co | Process of bleaching sulfated and sulfonated anionic synthetic detergent compositions and the resulting products |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2846457A (en) * | 1953-09-28 | 1958-08-05 | Rayette Inc | Decolorized detergents and method of manufacture |
| US3354187A (en) * | 1962-03-09 | 1967-11-21 | Henkel & Cie Gmbh | Bleaching dark-colored sulfonation products |
-
1964
- 1964-01-15 DE DEH51383A patent/DE1234709B/de active Pending
- 1964-12-17 NL NL6414745A patent/NL6414745A/xx unknown
-
1965
- 1965-01-11 US US424857A patent/US3452064A/en not_active Expired - Lifetime
- 1965-01-13 BE BE658224D patent/BE658224A/xx unknown
- 1965-01-14 AT AT26465A patent/AT257557B/de active
- 1965-01-14 FR FR1922A patent/FR1420898A/fr not_active Expired
- 1965-01-14 GB GB1612/65A patent/GB1063431A/en not_active Expired
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB360002A (en) * | 1930-07-21 | 1931-10-21 | Ig Farbenindustrie Ag | Improvements in the manufacture and production of wetting, washing, emulsifying and dispersing agents |
| GB745189A (en) * | 1952-10-31 | 1956-02-22 | Colgate Palmolive Co | Manufacture of sulphate and sulphonate synthetic detergents |
| US2804466A (en) * | 1954-10-14 | 1957-08-27 | Colgate Palmolive Co | Process of bleaching sulfated and sulfonated anionic synthetic detergent compositions and the resulting products |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0054724A1 (de) * | 1980-12-19 | 1982-06-30 | Henkel Kommanditgesellschaft auf Aktien | Verfahren zur vereinfachten Gewinnung von hellfarbigen waschaktiven alpha-Sulfofettsäureestern |
| EP0363781A1 (de) * | 1988-10-10 | 1990-04-18 | Henkel Kommanditgesellschaft auf Aktien | Verfahren zur Herstellung hellfarbiger alpha-Sulfofettsäurealkylestersalze |
| WO1990003967A1 (de) * | 1988-10-10 | 1990-04-19 | Henkel Kommanditgesellschaft Auf Aktien | Verfahren zur herstellung hellfarbiger alpha-sulfofettsäurealkylestersalze |
| EP3409265A1 (de) | 2017-05-29 | 2018-12-05 | Basf Se | Verfahren zur herstellung von hellfarbigem disalz |
| WO2018219705A1 (de) | 2017-05-29 | 2018-12-06 | Basf Se | Verfahren zur herstellung von hellfarbigem disalz |
| US11389384B2 (en) | 2017-05-29 | 2022-07-19 | Basf Se | Method for producing a light-coloured disalt |
Also Published As
| Publication number | Publication date |
|---|---|
| AT257557B (de) | 1967-10-10 |
| BE658224A (enExample) | 1965-07-13 |
| US3452064A (en) | 1969-06-24 |
| GB1063431A (en) | 1967-03-30 |
| FR1420898A (fr) | 1965-12-10 |
| NL6414745A (enExample) | 1965-07-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1234709B (de) | Kontinuierliches Verfahren zum Bleichen saurer Sulfonierungsprodukte | |
| DE709276C (de) | Verfahren zur Herstellung von Reinigungs- und Waschmitteln durch Sulfonierung von fetten OElen | |
| EP0182118B1 (de) | Pumpfähige hochkonzentrierte wässrige Pasten von Alkalisalzen Alpha-sulfonierter Fettsäurealkylester und Verfahren zu ihrer Herstellung | |
| EP0129710B1 (de) | Verfahren zur Gewinnung farbstabiler hellfarbiger wässriger Salzpasten von waschaktiven alpha-Sulfofettsäureestern | |
| DE68918053T2 (de) | Verfahren zum Entfärben von Schwefelsäure aus der Säureherstellung. | |
| DE1215695B (de) | Verfahren zur Herstellung hellfarbiger Olefinsulfonierungsprodukte bzw. der entsprechenden Sulfonate | |
| DE1443995A1 (de) | Verfahren zur Herstellung hellfarbiger kapillaraktiver Ester von Sulfofettsaeuren bzw. derer Salze | |
| DE2555076C2 (de) | Kontinuierliches Verfahren zum Bleichen saurer α-Sulfofettsäureester | |
| DE2455891A1 (de) | Verfahren zur herstellung von alphasulfofettsaeureestersalzen | |
| DE2727345A1 (de) | Verfahren zur herstellung von 8-amino-1-naphthol-3,6-disulfonsaeure | |
| DE1768735C3 (de) | Verfahren zur Herstellung von Sulfonierung^- oder Sulfatisierungsprodukten | |
| DE1185178B (de) | Verfahren zur Herstellung von hellfarbigen Olefinsulfonaten | |
| CH465593A (de) | Verfahren zum Sulfatieren von Alkoholen | |
| DE1179931C2 (de) | Verfahren zur Gewinnung hellfarbiger kapillar-aktiver Sulfonsaeuren von Fettsaeureestern bzw. deren Salzen | |
| DE1248645B (de) | Verfahren zur Herstellung von sulfonierten Fettsäureestern bzw. sulfonierten Fettsäuren und gegebenenfalls deren Salzen | |
| DE1443984C3 (enExample) | ||
| DE1258864C2 (de) | Verfahren zur gewinnung hellfarbiger salze von sulfofettsaeureestern | |
| DE845341C (de) | Verfahren zur Herstellung von aetzalkaliarmen Alkalialkoholaten | |
| DE487103C (de) | Verfahren zur Gewinnung von Glykol-Glyzerin-Gemischen | |
| DE3840092A1 (de) | Konzentrierte, fliessfaehige aniontenside und verfahren zu ihrer herstellung | |
| DE1418887A1 (de) | Verfahren zur Aufarbeitung der Sulfonierungsprodukte von Fettsaeuren und deren Derivaten,insbesondere von Fettsaeureestern | |
| DE1468032A1 (de) | Verfahren zur Gewinnung hellfarbiger Gemische aus Kapillaraktivsubstanzen mit einem Gehalt an Salzen von Sulfofettsaeuren oder deren Estern | |
| DE526419C (de) | Verfahren zum Bleichen von Fettstoffen pflanzlicher oder tierischer Herkunft | |
| DE2445729A1 (de) | Verfahren zur herstellung von fettsaeuren aus metallseifen | |
| DE884040C (de) | Verfahren und Vorrichtung zur Herstellung von Chlordioxyd |