DE1228246B - Verfahren zur Herstellung von Derivaten des N-Acylvinylamins - Google Patents
Verfahren zur Herstellung von Derivaten des N-AcylvinylaminsInfo
- Publication number
- DE1228246B DE1228246B DEF47408A DEF0047408A DE1228246B DE 1228246 B DE1228246 B DE 1228246B DE F47408 A DEF47408 A DE F47408A DE F0047408 A DEF0047408 A DE F0047408A DE 1228246 B DE1228246 B DE 1228246B
- Authority
- DE
- Germany
- Prior art keywords
- acyl
- carbon atoms
- torr
- linear
- branched alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000000034 method Methods 0.000 title claims description 14
- 238000002360 preparation method Methods 0.000 title claims description 4
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 claims description 35
- -1 aliphatic monocarboxylic acid Chemical class 0.000 claims description 16
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 5
- 125000002837 carbocyclic group Chemical group 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- LNETULKMXZVUST-UHFFFAOYSA-N 1-naphthoic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=CC2=C1 LNETULKMXZVUST-UHFFFAOYSA-N 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000004429 atom Chemical group 0.000 claims description 2
- 239000000047 product Substances 0.000 description 13
- 238000004458 analytical method Methods 0.000 description 8
- 239000007795 chemical reaction product Substances 0.000 description 8
- 238000003776 cleavage reaction Methods 0.000 description 7
- 238000002474 experimental method Methods 0.000 description 7
- 230000007017 scission Effects 0.000 description 7
- 239000007858 starting material Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 238000002329 infrared spectrum Methods 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 239000010453 quartz Substances 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 238000001228 spectrum Methods 0.000 description 5
- 125000001931 aliphatic group Chemical group 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 4
- WJFKNYWRSNBZNX-UHFFFAOYSA-N 10H-phenothiazine Chemical compound C1=CC=C2NC3=CC=CC=C3SC2=C1 WJFKNYWRSNBZNX-UHFFFAOYSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- PNLUGRYDUHRLOF-UHFFFAOYSA-N n-ethenyl-n-methylacetamide Chemical compound C=CN(C)C(C)=O PNLUGRYDUHRLOF-UHFFFAOYSA-N 0.000 description 3
- 229950000688 phenothiazine Drugs 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- CVSVTCORWBXHQV-UHFFFAOYSA-N creatine Chemical compound NC(=[NH2+])N(C)CC([O-])=O CVSVTCORWBXHQV-UHFFFAOYSA-N 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- RFGFCICNGCPXQJ-UHFFFAOYSA-N n-prop-1-en-2-ylacetamide Chemical group CC(=C)NC(C)=O RFGFCICNGCPXQJ-UHFFFAOYSA-N 0.000 description 2
- 238000000197 pyrolysis Methods 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 238000011144 upstream manufacturing Methods 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- HFGHRUCCKVYFKL-UHFFFAOYSA-N 4-ethoxy-2-piperazin-1-yl-7-pyridin-4-yl-5h-pyrimido[5,4-b]indole Chemical compound C1=C2NC=3C(OCC)=NC(N4CCNCC4)=NC=3C2=CC=C1C1=CC=NC=C1 HFGHRUCCKVYFKL-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- KEQFTVQCIQJIQW-UHFFFAOYSA-N N-Phenyl-2-naphthylamine Chemical compound C=1C=C2C=CC=CC2=CC=1NC1=CC=CC=C1 KEQFTVQCIQJIQW-UHFFFAOYSA-N 0.000 description 1
- 125000003047 N-acetyl group Chemical group 0.000 description 1
- DZRTZJOZKBODDI-UHFFFAOYSA-N N-but-1-enylpropanamide Chemical compound C(CC)(=O)NC=CCC DZRTZJOZKBODDI-UHFFFAOYSA-N 0.000 description 1
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- UAMZETBJZRERCQ-UHFFFAOYSA-N alpha-aminopropionitrile Chemical compound CC(N)C#N UAMZETBJZRERCQ-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000009838 combustion analysis Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- CCGKOQOJPYTBIH-UHFFFAOYSA-N ethenone Chemical compound C=C=O CCGKOQOJPYTBIH-UHFFFAOYSA-N 0.000 description 1
- 230000004992 fission Effects 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000002762 monocarboxylic acid derivatives Chemical class 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- AWTKJYKSTHOKIE-UHFFFAOYSA-N n-(1-cyanobutyl)formamide Chemical compound CCCC(C#N)NC=O AWTKJYKSTHOKIE-UHFFFAOYSA-N 0.000 description 1
- BTOLKYABKKUYSM-UHFFFAOYSA-N n-methyl-n-prop-1-en-2-ylacetamide Chemical compound CC(=C)N(C)C(C)=O BTOLKYABKKUYSM-UHFFFAOYSA-N 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/01—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms
- C07C255/24—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms containing cyano groups and singly-bound nitrogen atoms, not being further bound to other hetero atoms, bound to the same saturated acyclic carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F226/00—Copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by a single or double bond to nitrogen or by a heterocyclic ring containing nitrogen
- C08F226/02—Copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by a single or double bond to nitrogen or by a heterocyclic ring containing nitrogen by a single or double bond to nitrogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF47408A DE1228246B (de) | 1965-03-06 | 1965-10-13 | Verfahren zur Herstellung von Derivaten des N-Acylvinylamins |
| CH195866A CH461461A (de) | 1965-03-06 | 1966-02-11 | Verfahren zur Herstellung von Derivaten des N-Acylvinylamins |
| US527733A US3424791A (en) | 1965-03-06 | 1966-02-16 | Process for the preparation of derivatives of n-acyl vinylamine |
| GB7320/66A GB1094794A (en) | 1965-03-06 | 1966-02-18 | Preparation of derivatives of n-acyl amino alkenes |
| NL6602353A NL6602353A (https=) | 1965-03-06 | 1966-02-23 | |
| BE677368D BE677368A (https=) | 1965-03-06 | 1966-03-04 | |
| FR52390A FR1470809A (fr) | 1965-03-06 | 1966-03-07 | Procédé pour la préparation de dérivés de nu-acyl-vinylamines |
| AT208266A AT262251B (de) | 1965-03-06 | 1966-03-07 | Verfahren zur Herstellung von N-Acylvinylaminen |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF45437A DE1224304B (de) | 1965-03-06 | 1965-03-06 | Verfahren zur Herstellung eines N-Acyl-Monovinylamins |
| DEF47408A DE1228246B (de) | 1965-03-06 | 1965-10-13 | Verfahren zur Herstellung von Derivaten des N-Acylvinylamins |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1228246B true DE1228246B (de) | 1966-11-10 |
| DE1228246C2 DE1228246C2 (https=) | 1967-06-01 |
Family
ID=25976663
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF47408A Granted DE1228246B (de) | 1965-03-06 | 1965-10-13 | Verfahren zur Herstellung von Derivaten des N-Acylvinylamins |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3424791A (https=) |
| AT (1) | AT262251B (https=) |
| BE (1) | BE677368A (https=) |
| CH (1) | CH461461A (https=) |
| DE (1) | DE1228246B (https=) |
| FR (1) | FR1470809A (https=) |
| GB (1) | GB1094794A (https=) |
| NL (1) | NL6602353A (https=) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5641881A (en) * | 1994-08-19 | 1997-06-24 | Basf Aktiengesellschaft | Preparation of N-alkenylcarboxamides |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2093871A5 (https=) * | 1970-05-29 | 1972-01-28 | Agripat Sa | |
| DE3213873A1 (de) * | 1982-04-15 | 1983-10-27 | Basf Ag, 6700 Ludwigshafen | Flockungsmittel fuer schlaemme |
| US4567300A (en) * | 1984-01-14 | 1986-01-28 | Mitsubishi Chemical Industries Limited | Process for producing N-substituted formamides |
| DE3443462A1 (de) * | 1984-11-29 | 1986-05-28 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von umsetzungsprodukten des cyanwasserstoffs |
| DE3443463A1 (de) * | 1984-11-29 | 1986-05-28 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von n-vinylformamid |
| DE3603450A1 (de) * | 1986-02-05 | 1987-08-06 | Basf Ag | Verfahren zur reinigung von n-vinylformamid |
| DE4030380A1 (de) * | 1990-09-26 | 1992-04-02 | Basf Ag | Anionisch polymerisiertes n-vinylformamid und verfahren zu seiner herstellung |
| DE102004058071A1 (de) * | 2004-12-01 | 2006-06-08 | Basf Ag | Verfahren zur Reinigung von polaren Vinylverbindungen |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1196657B (de) * | 1961-09-21 | 1965-07-15 | Hoechst Ag | Verfahren zur Herstellung von N-Vinylcarbon-saeureamiden |
-
1965
- 1965-10-13 DE DEF47408A patent/DE1228246B/de active Granted
-
1966
- 1966-02-11 CH CH195866A patent/CH461461A/de unknown
- 1966-02-16 US US527733A patent/US3424791A/en not_active Expired - Lifetime
- 1966-02-18 GB GB7320/66A patent/GB1094794A/en not_active Expired
- 1966-02-23 NL NL6602353A patent/NL6602353A/xx unknown
- 1966-03-04 BE BE677368D patent/BE677368A/xx unknown
- 1966-03-07 FR FR52390A patent/FR1470809A/fr not_active Expired
- 1966-03-07 AT AT208266A patent/AT262251B/de active
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5641881A (en) * | 1994-08-19 | 1997-06-24 | Basf Aktiengesellschaft | Preparation of N-alkenylcarboxamides |
Also Published As
| Publication number | Publication date |
|---|---|
| DE1228246C2 (https=) | 1967-06-01 |
| FR1470809A (fr) | 1967-02-24 |
| BE677368A (https=) | 1966-08-01 |
| NL6602353A (https=) | 1966-09-07 |
| GB1094794A (en) | 1967-12-13 |
| US3424791A (en) | 1969-01-28 |
| CH461461A (de) | 1968-08-31 |
| AT262251B (de) | 1968-06-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH494730A (de) | Verfahren zur Herstellung von Dibenzocyclopentenen | |
| DE1228246B (de) | Verfahren zur Herstellung von Derivaten des N-Acylvinylamins | |
| DE2047658B2 (de) | 2-Styryl- und 2-Phenyläthinylbenzylaminderivate, Verfahren zu deren Herstellung und diese enthaltende Arzneimittel | |
| DE1245967B (de) | Verfahren zur Herstellung von S.S-Diamino-o-chlor-pyrazincarbonsäurealkylestern | |
| DE1224304B (de) | Verfahren zur Herstellung eines N-Acyl-Monovinylamins | |
| DE2336403A1 (de) | Verfahren zur herstellung von isocyanaten | |
| EP0388587B1 (de) | Verfahrensverbesserung bei der technisch angewandten Knoevenagelschen Synthese | |
| DE2329545A1 (de) | Verfahren zur herstellung von 2-vinyloxazolinen | |
| EP0021039B1 (de) | Verfahren zur Herstellung von aromatischen Azomethinen | |
| DE2256167B1 (https=) | ||
| DE1643640C3 (de) | Verfahren zur Herstellung von omega-Carbamoylalkansäuren, omega-Cyanalkansäuren und Alkan-alpha, omegadicarbonlmjden | |
| CH627437A5 (de) | Verfahren zur herstellung von alpha-ketocarbonsaeureamiden. | |
| DE2201899A1 (de) | Verfahren zur Herstellung von 2,2,6-Trichlorcyclohexanon und -Masse | |
| AT229281B (de) | Verfahren zur Herstellung von Olefinen | |
| EP0394644A2 (de) | Halogenbenzolderivate | |
| AT250334B (de) | Verfahren zur Herstellung von α-Carbalkoxy-β-arylamino-acrylsäureestern | |
| DE2432630A1 (de) | Verfahren zur herstellung von cyannorbornen | |
| DE852996C (de) | Verfahren zur Herstellung von Gemischen aus Acetylisoaepfelsaeure-dinitril und ª‡-Acetoxyacrylsaeurenitril | |
| AT228196B (de) | Verfahren zur Herstellung von 3-Oxo-spiro-(cycloalkan-1',2-cumaranen) | |
| DE2947475B1 (de) | Verfahren zur Herstellung von 3-Cyanpropionsaeureamid | |
| DE1266751B (de) | Verfahren zur Herstellung von Benztraubensaeurenitril aus Hydroxyiminoaceton | |
| DE940528C (de) | Verfahren zur Herstellung von Acrylsaeureamid und ª‡-substituierten Acrylsaeureamiden | |
| EP0439816B1 (de) | Verfahren zur Gewinnung von Cyclohexen aus solches enthaltenden Gemischen mit Benzol und/oder Cyclohexan | |
| DE857362C (de) | Verfahren zur Herstellung von aliphatischen Nitrocarbonsaeuren und deren Derivaten | |
| DE1921662C3 (de) | Verfahren zur Reinigung von Malonsäuredinitril |