DE1179317B - Verfahren zur Herstellung wasserloeslicher Phthalocyaninfarbstoffe - Google Patents
Verfahren zur Herstellung wasserloeslicher PhthalocyaninfarbstoffeInfo
- Publication number
- DE1179317B DE1179317B DEF30688A DEF0030688A DE1179317B DE 1179317 B DE1179317 B DE 1179317B DE F30688 A DEF30688 A DE F30688A DE F0030688 A DEF0030688 A DE F0030688A DE 1179317 B DE1179317 B DE 1179317B
- Authority
- DE
- Germany
- Prior art keywords
- parts
- weight
- water
- hydroxyethyl
- general formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 8
- 239000001007 phthalocyanine dye Substances 0.000 title claims description 5
- 238000002360 preparation method Methods 0.000 title claims description 5
- 239000000975 dye Substances 0.000 claims description 25
- 125000001997 phenyl group Chemical class [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 150000001412 amines Chemical class 0.000 claims description 6
- 230000002378 acidificating effect Effects 0.000 claims description 5
- 239000007859 condensation product Substances 0.000 claims description 4
- 150000001805 chlorine compounds Chemical class 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 229910004727 OSO3H Inorganic materials 0.000 claims description 2
- 238000004040 coloring Methods 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 230000004048 modification Effects 0.000 claims 1
- 238000012986 modification Methods 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 28
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 14
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 13
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- RBTKNAXYKSUFRK-UHFFFAOYSA-N heliogen blue Chemical compound [Cu].[N-]1C2=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=NC([N-]1)=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=N2 RBTKNAXYKSUFRK-UHFFFAOYSA-N 0.000 description 10
- 229920000742 Cotton Polymers 0.000 description 9
- 150000003457 sulfones Chemical class 0.000 description 9
- -1 sulfuric acid ester Chemical class 0.000 description 9
- 241000083869 Polyommatus dorylas Species 0.000 description 8
- YXZRCLVVNRLPTP-UHFFFAOYSA-J turquoise blue Chemical compound [Na+].[Na+].[Na+].[Na+].[Cu+2].NC1=NC(Cl)=NC(NC=2C=C(NS(=O)(=O)C3=CC=4C(=C5NC=4NC=4[N-]C(=C6C=CC(=CC6=4)S([O-])(=O)=O)NC=4NC(=C6C=C(C=CC6=4)S([O-])(=O)=O)NC=4[N-]C(=C6C=CC(=CC6=4)S([O-])(=O)=O)N5)C=C3)C(=CC=2)S([O-])(=O)=O)=N1 YXZRCLVVNRLPTP-UHFFFAOYSA-J 0.000 description 8
- 239000001103 potassium chloride Substances 0.000 description 7
- 235000011164 potassium chloride Nutrition 0.000 description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 7
- 238000004043 dyeing Methods 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 239000002253 acid Substances 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- KZTYYGOKRVBIMI-UHFFFAOYSA-N diphenyl sulfone Chemical compound C=1C=CC=CC=1S(=O)(=O)C1=CC=CC=C1 KZTYYGOKRVBIMI-UHFFFAOYSA-N 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 229920003043 Cellulose fiber Polymers 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 239000001045 blue dye Substances 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000004627 regenerated cellulose Substances 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- SZIFAVKTNFCBPC-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl SZIFAVKTNFCBPC-UHFFFAOYSA-N 0.000 description 1
- SKDHHIUENRGTHK-UHFFFAOYSA-N 4-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=C(C(Cl)=O)C=C1 SKDHHIUENRGTHK-UHFFFAOYSA-N 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- CHMBIJAOCISYEW-UHFFFAOYSA-N n-(4-aminophenyl)acetamide Chemical compound CC(=O)NC1=CC=C(N)C=C1 CHMBIJAOCISYEW-UHFFFAOYSA-N 0.000 description 1
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical class N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- BUUPQKDIAURBJP-UHFFFAOYSA-N sulfinic acid Chemical compound OS=O BUUPQKDIAURBJP-UHFFFAOYSA-N 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/44—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring
- C09B62/503—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring the reactive group being an esterified or non-esterified hydroxyalkyl sulfonyl or mercaptoalkyl sulfonyl group, a quaternised or non-quaternised aminoalkyl sulfonyl group, a heterylmercapto alkyl sulfonyl group, a vinyl sulfonyl or a substituted vinyl sulfonyl group, or a thiophene-dioxide group
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/44—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring
- C09B62/503—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring the reactive group being an esterified or non-esterified hydroxyalkyl sulfonyl or mercaptoalkyl sulfonyl group, a quaternised or non-quaternised aminoalkyl sulfonyl group, a heterylmercapto alkyl sulfonyl group, a vinyl sulfonyl or a substituted vinyl sulfonyl group, or a thiophene-dioxide group
- C09B62/517—Porphines; Azaporphines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL261956D NL261956A (enExample) | 1960-03-05 | ||
| DEF30688A DE1179317B (de) | 1960-03-05 | 1960-03-05 | Verfahren zur Herstellung wasserloeslicher Phthalocyaninfarbstoffe |
| US92172A US3268548A (en) | 1960-03-05 | 1961-02-28 | Water-soluble phthalocyanine dyestuffs |
| CH260161A CH428047A (de) | 1960-03-05 | 1961-03-03 | Verfahren zur Herstellung wasserlöslicher Phthalocyaninfarbstoffe und Verwendung derselben |
| GB8130/61A GB981191A (en) | 1960-03-05 | 1961-03-06 | Water-soluble phthalocyanine dyestuffs and process for their manufacture |
| BE600946A BE600946A (fr) | 1960-03-05 | 1961-03-06 | Nouveaux colorants de phtalocyanine solubles dans l'eau et leur préparation. |
| FR854728A FR1286992A (fr) | 1960-03-05 | 1961-03-06 | Nouveaux colorants de phtalocyanine solubles dans l'eau et leur préparation |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF30688A DE1179317B (de) | 1960-03-05 | 1960-03-05 | Verfahren zur Herstellung wasserloeslicher Phthalocyaninfarbstoffe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1179317B true DE1179317B (de) | 1964-10-08 |
Family
ID=7093868
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF30688A Pending DE1179317B (de) | 1960-03-05 | 1960-03-05 | Verfahren zur Herstellung wasserloeslicher Phthalocyaninfarbstoffe |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3268548A (enExample) |
| BE (1) | BE600946A (enExample) |
| CH (1) | CH428047A (enExample) |
| DE (1) | DE1179317B (enExample) |
| GB (1) | GB981191A (enExample) |
| NL (1) | NL261956A (enExample) |
Cited By (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1283997B (de) * | 1965-01-02 | 1968-11-28 | Hoechst Ag | Verfahren zur Herstellung wasserloeslicher Phthalocyaninfarbstoffe |
| DE2745480A1 (de) * | 1977-10-10 | 1979-04-19 | Hoechst Ag | Verfahren zur herstellung von faserreaktiven farbstoffen, deren verwendung sowie mit ihnen gefaerbtes leder und fasermaterialien |
| US4576755A (en) * | 1981-09-30 | 1986-03-18 | Hoechst Aktiengesellschaft | Water-soluble fibre-reactive phthalocyanine compounds |
| JPS61221270A (ja) * | 1985-03-21 | 1986-10-01 | ヘキスト・アクチエンゲゼルシヤフト | 水溶性モノ‐及びジスアゾ化合物、その製造法及びこれを用いて着色する方法 |
| EP0196536A1 (de) * | 1985-03-21 | 1986-10-08 | Hoechst Aktiengesellschaft | Wasserlösliche Azoverbindungen, Verfahren zu deren Herstellung und ihre Verwendung als Farbstoffe |
| EP0201868A1 (de) * | 1985-05-15 | 1986-11-20 | Hoechst Aktiengesellschaft | Wasserlösliche Disazoverbindungen, Verfahren zu deren Herstellung und ihre Verwendung als Farbstoffe |
| EP0210331A1 (de) * | 1985-05-17 | 1987-02-04 | Hoechst Aktiengesellschaft | Wasserlösliche Mono- und Disazoverbindungen, Verfahren zu deren Herstellung und ihre Verwendung als Farbstoffe |
| EP0692559A1 (de) | 1994-06-30 | 1996-01-17 | Hoechst Aktiengesellschaft | Mit polymeren Aminverbindungen modifizierte synthetische cellulosische Fasern |
| EP0783052A2 (de) | 1995-12-20 | 1997-07-09 | Hoechst Aktiengesellschaft | Flüssigformulierung von N-(2-Sulfatoethyl)piperazin-sulfat |
| EP0790348A1 (de) | 1996-02-15 | 1997-08-20 | DyStar Textilfarben GmbH & Co. Deutschland KG | Verfahren zum Auswaschen von Textildrucken auf aminierten Baumwoll-, Celluloseregenerat-und Seidenfasergeweben |
| WO1999013009A1 (en) * | 1997-09-05 | 1999-03-18 | Avecia Limited | Phthalocyanine compounds used in inks for ink jet printing |
| EP0971002A1 (de) * | 1994-02-19 | 2000-01-12 | DyStar Textilfarben GmbH & Co. Deutschland KG | Reaktivfarbstoffmischungen und deren Verwendung zum Färben und Bedrucken von hydroxy- und/oder carbonamidgruppenhaltigen Fasermaterialien |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1084362A (enExample) * | 1963-10-11 | |||
| NL130648C (enExample) * | 1964-03-26 | |||
| DE1795140C3 (de) * | 1968-08-16 | 1981-12-10 | Hoechst Ag, 6000 Frankfurt | Wasserlösliche Phthalocyaninfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken von Fasermaterialien aus nativer oder regenerierter Cellulose, Wolle, Seide, linearen Polyamiden sowei von Leder |
| US4033980A (en) * | 1968-08-16 | 1977-07-05 | Hoechst Aktiengesellschaft | Phthalocyanine dyestuffs and process for preparing them |
| US3989692A (en) * | 1972-02-23 | 1976-11-02 | Bayer Aktiengesellschaft | Reactive dyestuffs |
| DE3727909A1 (de) * | 1987-08-21 | 1989-03-02 | Hoechst Ag | Wasserloesliche phthalocyaninverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE560034A (enExample) * | ||||
| BE565997A (enExample) * | ||||
| BE563199A (enExample) * |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3046075A (en) * | 1962-07-24 | Dyeing and finishing textile materials | ||
| US2670265A (en) * | 1954-02-23 | Process | ||
| BE507417A (enExample) * | 1950-01-09 | |||
| US2935506A (en) * | 1956-09-04 | 1960-05-03 | Ici Ltd | New dyestuffs and process for dyeing therewith |
| US3062830A (en) * | 1959-11-27 | 1962-11-06 | Gen Aniline & Film Corp | Phthalocyanine dyestuffs |
-
0
- NL NL261956D patent/NL261956A/xx unknown
-
1960
- 1960-03-05 DE DEF30688A patent/DE1179317B/de active Pending
-
1961
- 1961-02-28 US US92172A patent/US3268548A/en not_active Expired - Lifetime
- 1961-03-03 CH CH260161A patent/CH428047A/de unknown
- 1961-03-06 BE BE600946A patent/BE600946A/fr unknown
- 1961-03-06 GB GB8130/61A patent/GB981191A/en not_active Expired
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE560034A (enExample) * | ||||
| BE565997A (enExample) * | ||||
| BE563199A (enExample) * |
Cited By (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1283997B (de) * | 1965-01-02 | 1968-11-28 | Hoechst Ag | Verfahren zur Herstellung wasserloeslicher Phthalocyaninfarbstoffe |
| DE2745480A1 (de) * | 1977-10-10 | 1979-04-19 | Hoechst Ag | Verfahren zur herstellung von faserreaktiven farbstoffen, deren verwendung sowie mit ihnen gefaerbtes leder und fasermaterialien |
| US4576755A (en) * | 1981-09-30 | 1986-03-18 | Hoechst Aktiengesellschaft | Water-soluble fibre-reactive phthalocyanine compounds |
| JPS61221270A (ja) * | 1985-03-21 | 1986-10-01 | ヘキスト・アクチエンゲゼルシヤフト | 水溶性モノ‐及びジスアゾ化合物、その製造法及びこれを用いて着色する方法 |
| EP0196536A1 (de) * | 1985-03-21 | 1986-10-08 | Hoechst Aktiengesellschaft | Wasserlösliche Azoverbindungen, Verfahren zu deren Herstellung und ihre Verwendung als Farbstoffe |
| EP0197366A1 (de) * | 1985-03-21 | 1986-10-15 | Hoechst Aktiengesellschaft | Wasserlösliche Mono- und Disazoverbindungen, Verfahren zu deren Herstellung und ihre Verwendung als Farbstoffe |
| US4731441A (en) * | 1985-03-21 | 1988-03-15 | Hoechst Aktiengesellschaft | Water-soluble azo compounds containing, as fiber-reactive groups, a (nitrophenylamino-phenylamino)-chloro-triazinylamino group and groups of the vinylsulfone series, suitable as dyestuffs |
| US4725674A (en) * | 1985-03-21 | 1988-02-16 | Hoechst Aktiengesellschaft | Water soluble monoazo and disazo compounds containing (diphenylamino)-amino-chlorotriazinylamino group substituted by a nitro group and a fibre-reaction group of the vinylsulfone series, suitable as dyestuffs |
| US4701523A (en) * | 1985-05-15 | 1987-10-20 | Marcos Segal | Water-soluble disazo compounds containing one or two (nitro-phenylamino)-phenylamino-chlorotriazinylamino groups, the nitro-phenylamino being additionally substituted by a fiber-reactive group of the vinylsulfone series, suitable as dyestuffs |
| EP0201868A1 (de) * | 1985-05-15 | 1986-11-20 | Hoechst Aktiengesellschaft | Wasserlösliche Disazoverbindungen, Verfahren zu deren Herstellung und ihre Verwendung als Farbstoffe |
| EP0210331A1 (de) * | 1985-05-17 | 1987-02-04 | Hoechst Aktiengesellschaft | Wasserlösliche Mono- und Disazoverbindungen, Verfahren zu deren Herstellung und ihre Verwendung als Farbstoffe |
| EP0971002A1 (de) * | 1994-02-19 | 2000-01-12 | DyStar Textilfarben GmbH & Co. Deutschland KG | Reaktivfarbstoffmischungen und deren Verwendung zum Färben und Bedrucken von hydroxy- und/oder carbonamidgruppenhaltigen Fasermaterialien |
| EP0692559A1 (de) | 1994-06-30 | 1996-01-17 | Hoechst Aktiengesellschaft | Mit polymeren Aminverbindungen modifizierte synthetische cellulosische Fasern |
| EP0783052A2 (de) | 1995-12-20 | 1997-07-09 | Hoechst Aktiengesellschaft | Flüssigformulierung von N-(2-Sulfatoethyl)piperazin-sulfat |
| EP0790348A1 (de) | 1996-02-15 | 1997-08-20 | DyStar Textilfarben GmbH & Co. Deutschland KG | Verfahren zum Auswaschen von Textildrucken auf aminierten Baumwoll-, Celluloseregenerat-und Seidenfasergeweben |
| WO1999013009A1 (en) * | 1997-09-05 | 1999-03-18 | Avecia Limited | Phthalocyanine compounds used in inks for ink jet printing |
| US6235097B1 (en) | 1997-09-05 | 2001-05-22 | Avecia Limited | Phthalocyanine compounds used in inks for ink jet printing |
Also Published As
| Publication number | Publication date |
|---|---|
| NL261956A (enExample) | |
| GB981191A (en) | 1965-01-20 |
| US3268548A (en) | 1966-08-23 |
| BE600946A (fr) | 1961-09-06 |
| CH428047A (de) | 1967-01-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1179317B (de) | Verfahren zur Herstellung wasserloeslicher Phthalocyaninfarbstoffe | |
| EP0153599B1 (de) | Triphendioxazin-vinylsulfon-Farbstoffe | |
| DE1148341B (de) | Verfahren zur Herstellung von Farbstoffen | |
| DE2353149A1 (de) | Saure disazofarbstoffe, verfahren zu ihrer herstellung und ihrer verwendung | |
| DE1289206B (de) | Verfahren zur Herstellung von wasserloeslichen Azophthalocyaninfarbstoffen | |
| DE945944C (de) | Verfahren zur Herstellung von wasserloeslichen und beizenziehenden Azophthalocyaninfarbstoffen | |
| DE1644157C3 (de) | Wasserlösliche Monoazoreaktivfarbstoffe und Verfahren zur Herstellung dieser Farbstoffe | |
| EP0279277B1 (de) | Wasserlösliche Monoazo-pyrazolon-Verbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| CH645663A5 (de) | Verfahren zur herstellung von chlorzinksalzen von thiazoliumazofarbstoffen. | |
| DE3840164A1 (de) | Reaktivfarbstoffe | |
| DE1283997B (de) | Verfahren zur Herstellung wasserloeslicher Phthalocyaninfarbstoffe | |
| DE3717667A1 (de) | Wasserloesliche naphthyl-azo-pyrazolon-verbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe | |
| EP0374661A1 (de) | Reaktivfarbstoffe | |
| DE2264698B2 (de) | Aminonaphthalinsulfonsäuren und deren Verwendung | |
| DE2337488B1 (de) | Verfahren zur Herstellung von reaktiven Xanthenfarbstoffen | |
| DE832179C (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| DE1226731B (de) | Verfahren zur Herstellung von basischen Phthalocyaninfarbstoffen | |
| DE1569686C3 (de) | Wasserunlösliche Styrylfarbstoffe | |
| AT158260B (de) | Verfahren zur Herstellung von Azofarbstoffen. | |
| DE1019025B (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE890250C (de) | Verfahren zur Herstellung von Leukoschwefelsaeureestern von Kuepenfarbstoffen | |
| AT220267B (de) | Verfahren zur Herstellung von neuen Monoazofarbstoffen | |
| DE1569698A1 (de) | Wasserunloesliche Styrylfarbstoffe und Verfahren zu deren Herstellung | |
| DE728487C (de) | Verfahren zur Herstellung von N, N-Dialkyl- oder N-Alkyl-N-aralkyldipyrazolanthronylen | |
| AT281224B (de) | Verfahren zur Herstellung von neuen Anthrachinonfabrstoffen |