DE1165338B - Insektizide Mittel - Google Patents
Insektizide MittelInfo
- Publication number
- DE1165338B DE1165338B DEU8374A DEU0008374A DE1165338B DE 1165338 B DE1165338 B DE 1165338B DE U8374 A DEU8374 A DE U8374A DE U0008374 A DEU0008374 A DE U0008374A DE 1165338 B DE1165338 B DE 1165338B
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- phenyl
- ethyl
- methylcarbamate
- dimethyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000002917 insecticide Substances 0.000 title claims description 12
- -1 2,4-dichloro-3-methyl-5-ethylphenyl-N-methylcarbamate Chemical compound 0.000 claims description 23
- 150000001875 compounds Chemical class 0.000 claims description 22
- 239000004480 active ingredient Substances 0.000 claims description 11
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 9
- FIPWRIJSWJWJAI-UHFFFAOYSA-N Butyl carbitol 6-propylpiperonyl ether Chemical compound C1=C(CCC)C(COCCOCCOCCCC)=CC2=C1OCO2 FIPWRIJSWJWJAI-UHFFFAOYSA-N 0.000 claims description 7
- 229960005235 piperonyl butoxide Drugs 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- QRTXZGIQTYDABO-UHFFFAOYSA-N carbanolate Chemical compound CNC(=O)OC1=CC(C)=C(C)C=C1Cl QRTXZGIQTYDABO-UHFFFAOYSA-N 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 3
- LNJXZKBHJZAIKQ-UHFFFAOYSA-N 1,1,1,2-tetrachloro-3-(2,3,3,3-tetrachloropropoxy)propane Chemical compound ClC(Cl)(Cl)C(Cl)COCC(Cl)C(Cl)(Cl)Cl LNJXZKBHJZAIKQ-UHFFFAOYSA-N 0.000 claims description 2
- UEKQGZQLUMSLNW-UHFFFAOYSA-N Propyl isome Chemical compound C1=C2C(C(=O)OCCC)C(C(=O)OCCC)C(C)CC2=CC2=C1OCO2 UEKQGZQLUMSLNW-UHFFFAOYSA-N 0.000 claims description 2
- WABPPBHOPMUJHV-UHFFFAOYSA-N Sesamex Chemical compound CCOCCOCCOC(C)OC1=CC=C2OCOC2=C1 WABPPBHOPMUJHV-UHFFFAOYSA-N 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 239000000284 extract Substances 0.000 claims description 2
- 239000008159 sesame oil Substances 0.000 claims description 2
- 235000011803 sesame oil Nutrition 0.000 claims description 2
- 150000003462 sulfoxides Chemical class 0.000 claims description 2
- 230000000895 acaricidal effect Effects 0.000 claims 1
- 125000003342 alkenyl group Chemical group 0.000 claims 1
- 239000000460 chlorine Substances 0.000 claims 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- 239000000203 mixture Substances 0.000 description 13
- 239000000243 solution Substances 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- 241000257159 Musca domestica Species 0.000 description 6
- 239000002609 medium Substances 0.000 description 6
- 241000196324 Embryophyta Species 0.000 description 5
- 239000000443 aerosol Substances 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 239000007921 spray Substances 0.000 description 5
- 241000239290 Araneae Species 0.000 description 4
- 241000462639 Epilachna varivestis Species 0.000 description 4
- 241000238631 Hexapoda Species 0.000 description 4
- 241001477931 Mythimna unipuncta Species 0.000 description 4
- 239000004721 Polyphenylene oxide Substances 0.000 description 4
- 125000002877 alkyl aryl group Chemical group 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 229920000570 polyether Polymers 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000004094 surface-active agent Substances 0.000 description 4
- 239000004563 wettable powder Substances 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 241000253994 Acyrthosiphon pisum Species 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 229920004890 Triton X-100 Polymers 0.000 description 3
- 239000013504 Triton X-100 Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 239000003350 kerosene Substances 0.000 description 3
- 229910052903 pyrophyllite Inorganic materials 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- UZXVGUUDTLGQQN-UHFFFAOYSA-N (2,4-dichloro-3,5-dimethylphenyl) n-methylcarbamate Chemical compound CNC(=O)OC1=CC(C)=C(Cl)C(C)=C1Cl UZXVGUUDTLGQQN-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- ILWHLGNHCPUNAG-UHFFFAOYSA-N CC(C(Cl)=C1)=CC(N(C)C(O)=O)=C1Cl Chemical compound CC(C(Cl)=C1)=CC(N(C)C(O)=O)=C1Cl ILWHLGNHCPUNAG-UHFFFAOYSA-N 0.000 description 2
- 241000256113 Culicidae Species 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- 241000257226 Muscidae Species 0.000 description 2
- 241001454295 Tetranychidae Species 0.000 description 2
- 241000607479 Yersinia pestis Species 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 description 2
- 239000000428 dust Substances 0.000 description 2
- 238000010410 dusting Methods 0.000 description 2
- 239000004495 emulsifiable concentrate Substances 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- 230000002195 synergetic effect Effects 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- VKUODZNCFGSXLO-UHFFFAOYSA-N (2,4-dichloro-3-ethyl-5-methylphenyl) N-methylcarbamate Chemical compound CNC(OC1=C(C(=C(C(=C1)C)Cl)CC)Cl)=O VKUODZNCFGSXLO-UHFFFAOYSA-N 0.000 description 1
- AZXKDALZKPSQGB-UHFFFAOYSA-N (2,4-dichloro-5-ethyl-3-methylphenyl) n-methylcarbamate Chemical compound CCC1=CC(OC(=O)NC)=C(Cl)C(C)=C1Cl AZXKDALZKPSQGB-UHFFFAOYSA-N 0.000 description 1
- LTQFKXFWWQZRLF-UHFFFAOYSA-N (2,4-dichloro-5-methylphenyl) n-methylcarbamate Chemical compound CNC(=O)OC1=CC(C)=C(Cl)C=C1Cl LTQFKXFWWQZRLF-UHFFFAOYSA-N 0.000 description 1
- KVMVGZGQFGYUTG-UHFFFAOYSA-N (2-chloro-4,5-dimethylphenyl) N-butylcarbamate Chemical compound C(CCC)NC(OC1=C(C=C(C(=C1)C)C)Cl)=O KVMVGZGQFGYUTG-UHFFFAOYSA-N 0.000 description 1
- LEXZKBXNWHMYNE-UHFFFAOYSA-N (2-chloro-4,5-dimethylphenyl) N-propylcarbamate Chemical compound C(CC)NC(OC1=C(C=C(C(=C1)C)C)Cl)=O LEXZKBXNWHMYNE-UHFFFAOYSA-N 0.000 description 1
- GHYOCDFICYLMRF-UTIIJYGPSA-N (2S,3R)-N-[(2S)-3-(cyclopenten-1-yl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]-3-hydroxy-3-(4-methoxyphenyl)-2-[[(2S)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]propanamide Chemical compound C1(=CCCC1)C[C@@H](C(=O)[C@@]1(OC1)C)NC([C@H]([C@@H](C1=CC=C(C=C1)OC)O)NC([C@H](C)NC(CN1CCOCC1)=O)=O)=O GHYOCDFICYLMRF-UTIIJYGPSA-N 0.000 description 1
- QFLWZFQWSBQYPS-AWRAUJHKSA-N (3S)-3-[[(2S)-2-[[(2S)-2-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-[1-bis(4-chlorophenoxy)phosphorylbutylamino]-4-oxobutanoic acid Chemical compound CCCC(NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12)C(C)C)P(=O)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 QFLWZFQWSBQYPS-AWRAUJHKSA-N 0.000 description 1
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241001124076 Aphididae Species 0.000 description 1
- 241001388466 Bruchus rufimanus Species 0.000 description 1
- MLGLKSPLIWSTED-UHFFFAOYSA-N C(C)(C)NC(OC1=C(C=C(C(=C1)C)C)Cl)=O Chemical compound C(C)(C)NC(OC1=C(C=C(C(=C1)C)C)Cl)=O MLGLKSPLIWSTED-UHFFFAOYSA-N 0.000 description 1
- CQDKSHMMVJAEMU-UHFFFAOYSA-M CCCCCCCCCC[N+]1=CC=C(C=C1)C.[Cl-] Chemical compound CCCCCCCCCC[N+]1=CC=C(C=C1)C.[Cl-] CQDKSHMMVJAEMU-UHFFFAOYSA-M 0.000 description 1
- ASPFGOJPULRUIC-UHFFFAOYSA-N CCN(C(O)=O)C(C=C(C)C(C)=C1)=C1Cl Chemical compound CCN(C(O)=O)C(C=C(C)C(C)=C1)=C1Cl ASPFGOJPULRUIC-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical compound NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 1
- 241000207199 Citrus Species 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- 241000255925 Diptera Species 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010061217 Infestation Diseases 0.000 description 1
- 240000007049 Juglans regia Species 0.000 description 1
- 235000009496 Juglans regia Nutrition 0.000 description 1
- 229920001732 Lignosulfonate Polymers 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 240000004713 Pisum sativum Species 0.000 description 1
- 235000010582 Pisum sativum Nutrition 0.000 description 1
- RVGRUAULSDPKGF-UHFFFAOYSA-N Poloxamer Chemical compound C1CO1.CC1CO1 RVGRUAULSDPKGF-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 241000916142 Tetranychus turkestani Species 0.000 description 1
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000005210 alkyl ammonium group Chemical group 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 229920005551 calcium lignosulfonate Polymers 0.000 description 1
- GTCAXTIRRLKXRU-UHFFFAOYSA-N carbamic acid methyl ester Natural products COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- 235000020971 citrus fruits Nutrition 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 229940125797 compound 12 Drugs 0.000 description 1
- 229940125810 compound 20 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-M dodecanoate Chemical compound CCCCCCCCCCCC([O-])=O POULHZVOKOAJMA-UHFFFAOYSA-M 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- JAXFJECJQZDFJS-XHEPKHHKSA-N gtpl8555 Chemical compound OC(=O)C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](B1O[C@@]2(C)[C@H]3C[C@H](C3(C)C)C[C@H]2O1)CCC1=CC=C(F)C=C1 JAXFJECJQZDFJS-XHEPKHHKSA-N 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229940070765 laurate Drugs 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000005394 methallyl group Chemical group 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 239000003595 mist Substances 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229920001993 poloxamer 188 Polymers 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 239000012747 synergistic agent Substances 0.000 description 1
- 235000020234 walnut Nutrition 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/20—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof
- C07D295/205—Radicals derived from carbonic acid
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US60769A US3131215A (en) | 1960-10-06 | 1960-10-06 | 2-halo-and 2, 4-dihalo-alkylphenyl carbamates |
| US12926261A | 1961-08-04 | 1961-08-04 | |
| US374839A US3402245A (en) | 1960-10-06 | 1964-06-12 | Insecticidal 2-halo- and 2, 4-dihaloalkylphenyl carbamate compositions and method for controlling insects |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1165338B true DE1165338B (de) | 1964-03-12 |
Family
ID=27369907
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEU8374A Pending DE1165338B (de) | 1960-10-06 | 1961-10-04 | Insektizide Mittel |
| DEU8375A Pending DE1160842B (de) | 1960-10-06 | 1961-10-04 | Verfahren zur Herstellung von 2-Halogen- und 2, 4-Dihalogen-alkylphenylcarbamaten |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEU8375A Pending DE1160842B (de) | 1960-10-06 | 1961-10-04 | Verfahren zur Herstellung von 2-Halogen- und 2, 4-Dihalogen-alkylphenylcarbamaten |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3402245A (OSRAM) |
| BE (1) | BE608910A (OSRAM) |
| BR (1) | BR6133044D0 (OSRAM) |
| CH (2) | CH410901A (OSRAM) |
| DE (2) | DE1165338B (OSRAM) |
| FR (1) | FR1334947A (OSRAM) |
| GB (1) | GB934576A (OSRAM) |
| NL (1) | NL269988A (OSRAM) |
| SE (1) | SE302704B (OSRAM) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE608910A (OSRAM) * | 1960-10-06 | |||
| JPS516131B1 (OSRAM) * | 1964-12-28 | 1976-02-25 | ||
| US4303793A (en) * | 1979-03-12 | 1981-12-01 | Ppg Industries, Inc. | Aqueous carbamate dispersions |
| CN114878620B (zh) * | 2022-03-09 | 2024-10-22 | 华东师范大学 | 一种基于核磁共振的无机硫含量的检测方法 |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE961042C (de) * | 1952-01-26 | 1957-03-28 | Boehringer Sohn Ingelheim | Fungicide und acaricide Mittel |
| DE1058304B (de) * | 1953-06-09 | 1959-05-27 | Philips Nv | Insektenbekaempfungsmittel |
| US2904464A (en) * | 1958-01-20 | 1959-09-15 | Union Carbide Corp | Insecticidal compositions containing 1-naphthyl-n-methylcarbamate and piperonyl butoxide as a synergist therefor |
| US2904463A (en) * | 1958-01-20 | 1959-09-15 | Union Carbide Corp | Insecticidal compositions containing 1-naphthyl-n-methylcarbamate and sulfoxide as a synergist therefor |
| US2904465A (en) * | 1958-01-20 | 1959-09-15 | Union Carbide Corp | Insecticidal compositions containing 1-naphthyl-n-methylcarbamate and sesoxane as a synergist therefor |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE532057A (OSRAM) * | ||||
| NL85372C (nl) * | 1952-11-22 | Merck Ag E | Werkwijze ter bereiding van een bestrijdingsmiddel voor schadelijke organismen, alsmede het bestrijden van schadelijke organismen daarmee | |
| FR1081976A (fr) * | 1953-05-16 | 1954-12-24 | Rhone Poulenc Sa | Nouveaux esters carbamiques et leur utilisation dans la lutte contre les insectes |
| US2933383A (en) * | 1956-11-23 | 1960-04-19 | Union Carbide Corp | Method of combating weeds using nu-substituted carbamates of 2, 4, 5-trichloro, 6-nitro phenol |
| US3062707A (en) * | 1959-06-29 | 1962-11-06 | California Research Corp | 3-t-amyl-6-chlorophenyl n-methylcarbamate and method of inhibiting the cholinesterase function in agricultural parasites therewith |
| BE608910A (OSRAM) * | 1960-10-06 |
-
0
- BE BE608910D patent/BE608910A/xx unknown
- NL NL269988D patent/NL269988A/xx unknown
-
1961
- 1961-08-28 GB GB30946/61A patent/GB934576A/en not_active Expired
- 1961-09-05 CH CH1029661A patent/CH410901A/de unknown
- 1961-09-05 CH CH1540865A patent/CH421935A/de unknown
- 1961-09-22 SE SE9455/61A patent/SE302704B/xx unknown
- 1961-09-29 BR BR133044/61A patent/BR6133044D0/pt unknown
- 1961-10-04 DE DEU8374A patent/DE1165338B/de active Pending
- 1961-10-04 DE DEU8375A patent/DE1160842B/de active Pending
- 1961-10-05 FR FR875162A patent/FR1334947A/fr not_active Expired
-
1964
- 1964-06-12 US US374839A patent/US3402245A/en not_active Expired - Lifetime
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE961042C (de) * | 1952-01-26 | 1957-03-28 | Boehringer Sohn Ingelheim | Fungicide und acaricide Mittel |
| DE1058304B (de) * | 1953-06-09 | 1959-05-27 | Philips Nv | Insektenbekaempfungsmittel |
| US2904464A (en) * | 1958-01-20 | 1959-09-15 | Union Carbide Corp | Insecticidal compositions containing 1-naphthyl-n-methylcarbamate and piperonyl butoxide as a synergist therefor |
| US2904463A (en) * | 1958-01-20 | 1959-09-15 | Union Carbide Corp | Insecticidal compositions containing 1-naphthyl-n-methylcarbamate and sulfoxide as a synergist therefor |
| US2904465A (en) * | 1958-01-20 | 1959-09-15 | Union Carbide Corp | Insecticidal compositions containing 1-naphthyl-n-methylcarbamate and sesoxane as a synergist therefor |
Also Published As
| Publication number | Publication date |
|---|---|
| SE302704B (OSRAM) | 1968-07-29 |
| NL269988A (OSRAM) | |
| BR6133044D0 (pt) | 1973-05-10 |
| FR1334947A (fr) | 1963-08-16 |
| DE1160842B (de) | 1964-01-09 |
| CH410901A (de) | 1966-04-15 |
| BE608910A (OSRAM) | |
| GB934576A (en) | 1963-08-21 |
| US3402245A (en) | 1968-09-17 |
| CH421935A (de) | 1966-10-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2433680C3 (de) | 23-Dihydro-2,2-diinethyI-7-benzofuranyl-methyl-carbamat-N-aminosulfenylderivate, Verfahren zu deren Herstellung und diese Verbindungen enthaltende insektizide Zubereitungen | |
| DE1695269B2 (de) | 2-Dialkylamino-4-pyrimidinylcarbamate, Verfahren zur Herstellung derselben sowie sie enthaltende Schädlingsbekämpfungsmittel | |
| EP0789999A2 (de) | Herbizide Ölsuspensionskonzentrate | |
| DE2425713C3 (de) | Insektizides Mittel auf Basis von Benzylphenolderivaten | |
| DE1217695B (de) | Insekticide Mittel mit acaricider Wirkung | |
| DE3020694A1 (de) | Molluskizide zusammensetzung | |
| DE2118317A1 (OSRAM) | ||
| DE1125226B (de) | Insektenbekaempfungsmittel | |
| DE1693192A1 (de) | Schaedlingsbekaempfungsmittel | |
| DE1443933C2 (de) | Thiocyano-phenyl-isothiocyanate und ihre Verwendung als Schädlingsbekämpfungsmittel | |
| DE4103174A1 (de) | Insektizide mittel | |
| DD215002A5 (de) | Pestizide zusammensetzung | |
| DE2745533C2 (OSRAM) | ||
| DE1181978B (de) | Mittel zur Bekaempfung von Arthropoden, Mollusken und Fischen | |
| DE2041627C3 (de) | Pestizide Mittel | |
| DE2842281A1 (de) | Insektizide zusammensetzungen | |
| DE1138277B (de) | Schaedlingsbekaempfungsmittel | |
| DE972737C (de) | Mittel zur Bekaempfung des Kartoffelkaefers | |
| DE1801279C (de) | 2 Methyl 5 sek bzw tert butyl phenyl N methylcarbamat und ihre Verwen dung als Insektizide | |
| DE3604791A1 (de) | Mikrobizides mittel | |
| AT264912B (de) | Insektizide Mischungen | |
| AT204329B (de) | Mittel zur Bekämpfung von Milben | |
| DE1049148B (de) | Nematozides Mittel | |
| DE868375C (de) | Insekticide | |
| DE1567006C3 (de) | Unkrautbekämpfungsmittel |