DE1154056B - Elastischer Huefthalter - Google Patents
Elastischer HuefthalterInfo
- Publication number
- DE1154056B DE1154056B DEB55392A DEB0055392A DE1154056B DE 1154056 B DE1154056 B DE 1154056B DE B55392 A DEB55392 A DE B55392A DE B0055392 A DEB0055392 A DE B0055392A DE 1154056 B DE1154056 B DE 1154056B
- Authority
- DE
- Germany
- Prior art keywords
- girdle
- fabric
- holder
- elastic
- pieces
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000004744 fabric Substances 0.000 claims description 22
- 210000001015 abdomen Anatomy 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- LUTSRLYCMSCGCS-BWOMAWGNSA-N [(3s,8r,9s,10r,13s)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,16-decahydrocyclopenta[a]phenanthren-3-yl] acetate Chemical compound C([C@@H]12)C[C@]3(C)C(=O)CC=C3[C@@H]1CC=C1[C@]2(C)CC[C@H](OC(=O)C)C1 LUTSRLYCMSCGCS-BWOMAWGNSA-N 0.000 description 2
- 239000003351 stiffener Substances 0.000 description 2
- 230000000295 complement effect Effects 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 239000013013 elastic material Substances 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 230000037303 wrinkles Effects 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A41—WEARING APPAREL
- A41C—CORSETS; BRASSIERES
- A41C1/00—Corsets or girdles
- A41C1/02—Elastic corsets
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Corsets Or Brassieres (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR778384A FR1216363A (fr) | 1958-11-05 | 1958-11-05 | Perfectionnements aux gaines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1154056B true DE1154056B (de) | 1963-09-12 |
Family
ID=8708004
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEB55392A Pending DE1154056B (de) | 1958-11-05 | 1959-11-04 | Elastischer Huefthalter |
Country Status (5)
| Country | Link |
|---|---|
| BE (1) | BE584101A (esLanguage) |
| CH (1) | CH361548A (esLanguage) |
| DE (1) | DE1154056B (esLanguage) |
| FR (1) | FR1216363A (esLanguage) |
| LU (1) | LU37862A1 (esLanguage) |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR557072A (fr) * | 1922-10-06 | 1923-08-02 | Perfectionnement apporté aux ceintures-corsets en tissu caoutchouté | |
| DE660053C (de) * | 1932-07-18 | 1938-05-16 | Warner Brothers Company | Korsett |
| GB500384A (en) * | 1937-10-23 | 1939-02-08 | Madeleine Hannatelle | Improvements in corsets and like garments |
| CH326933A (de) * | 1955-01-11 | 1958-01-15 | Treo Company Inc | Hüftgürtel |
-
0
- LU LU37862D patent/LU37862A1/xx unknown
-
1958
- 1958-11-05 FR FR778384A patent/FR1216363A/fr not_active Expired
-
1959
- 1959-10-28 BE BE584101A patent/BE584101A/fr unknown
- 1959-10-28 CH CH361548D patent/CH361548A/fr unknown
- 1959-11-04 DE DEB55392A patent/DE1154056B/de active Pending
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR557072A (fr) * | 1922-10-06 | 1923-08-02 | Perfectionnement apporté aux ceintures-corsets en tissu caoutchouté | |
| DE660053C (de) * | 1932-07-18 | 1938-05-16 | Warner Brothers Company | Korsett |
| GB500384A (en) * | 1937-10-23 | 1939-02-08 | Madeleine Hannatelle | Improvements in corsets and like garments |
| CH326933A (de) * | 1955-01-11 | 1958-01-15 | Treo Company Inc | Hüftgürtel |
Also Published As
| Publication number | Publication date |
|---|---|
| BE584101A (fr) | 1960-02-15 |
| CH361548A (fr) | 1962-04-30 |
| FR1216363A (fr) | 1960-04-25 |
| LU37862A1 (esLanguage) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH386619A (de) | Stützvorrichtung für den menschlichen Körper | |
| DE2400031A1 (de) | Buestenhalter | |
| DE846682C (de) | Korsett oder korsettaehnliches Kleidungsstueck | |
| DE916883C (de) | Korselett | |
| DE1154056B (de) | Elastischer Huefthalter | |
| DE1410762C3 (de) | Hüftgürtel | |
| DE955761C (de) | Hose mit Guertel | |
| DE1829703U (de) | Buestenhalter. | |
| DE660053C (de) | Korsett | |
| DE726254C (de) | Hueftguertel | |
| AT90125B (de) | Umstandsgürtel. | |
| DE1138003B (de) | Elastischer Hueftformer | |
| DE587033C (de) | Korsett | |
| DE469050C (de) | Band, insbesondere Hueftband, zum Halten von Kleidungsstuecken | |
| DE2853226A1 (de) | Vorrichtung zur elastischen befestigung eines schutzbelages auf einer matratze | |
| AT122200B (de) | Unterkleid. | |
| DE882082C (de) | Leibbinde | |
| AT261137B (de) | Tuchbelag, insbesondere Leintuch | |
| DE1098884B (de) | Verfahren zur Herstellung von Plisseeroecken | |
| DE243327C (esLanguage) | ||
| DE941723C (de) | Elastischer Hueftguertel | |
| DE1142807B (de) | Korsett | |
| DE1929896C3 (de) | Hüftgürtel | |
| DE540824C (de) | Verfahren zur Herstellung eines nicht elastischen Gewebes | |
| AT109487B (de) | Elastischer Kleiderbesatz. |